15. Solve the following equation (1 point)
3 + 6z = 13 + 6z
Oza-
6
=
Oz=22
O infinitely many solutions
Ono solution

Answers

Answer 1

Answer:

Step-by-step explanation:

There are no solutions to this equation

3 + 6z = 13 + 6z              Subtract 6z from both sides

  - 6z =       - 6z

3 = 13

There is no way on this planet using this numbering system that you can get 3 = to 13


Related Questions

y = -x + 2 on a graph

Answers

2 is your y and you go down and one to the right for -x think of it as -1/1

Pls tell me where to put what in the picture below

Pls tell me where to put what in the picture below

Answers

Answer:

M is the gradient of the line and b is the y-intercept or where the line cuts the y-axis and the x is zero at the point

Step-by-step explanation:

3. Quilt square are cut on the diagnal to form triangular quilt pieces. The hypotenuse of the resulting triangles is 34 inches long. What is the side length of each piece

Answers

The side length of each piece of quilt is approximately 24.06 inches.

In the given scenario, quilt square is cut on the diagonal to form triangular quilt pieces. The hypotenuse of the resulting triangles is 34 inches long. We have to determine the side length of each piece.

In a right triangle, according to the Pythagorean theorem, the sum of the squares of the legs is equal to the square of the hypotenuse.

So, we can use the Pythagorean theorem to find the length of the sides of the triangular quilt pieces.

The theorem states that a² + b² = c². In this case, c = 34 inches.

Let's assume that each quilt square has sides of length x inches.

When the square is cut diagonally, it is divided into two triangles with legs of length x inches.

According to the Pythagorean theorem, the length of the hypotenuse (34 inches) of each triangle is given by:

x² + x² = 34²2x² = 1156x² = 578x = √578 ≈ 24.06 inches

Learn more about triangles at;

https://brainly.com/question/15296033

#SPJ11

Write Y=3x^2+6x+7 in vertex form

Answers

Answer: \(3(x+1)^{2} +4\\\)

 

Step-by-step explanation:

\(3x^{2} +6x+7\\\)                     leave space to complete the square

\(3x^{2} +6x\\\)          + 7            factor out a 3 from the first part

\(3(x^{2} +2x\)       ) + 7            complete the square by dividing middle number by 2 and squaring

           \(\frac{2}{2} ^{2}\) = 1                    1 is your completion of square

\(3(x^{2} +2x+1)+7-3\\\)      you need to balance the+1 but the 3 in front means you actually added 3 so you need to balance by subtracting3

\(3(x+1)^{2} +4\\\)                    factor gives you this simplified form which is vertex form

What is the solution to this equation x-16=9

Answers

Answer:

\(x=25\)

Step-by-step explanation:

\(x-16=9\\x=9+16\\x=25\)

Hope it helps

If the significance level of a hypothesis test is 10%, for which of the following p-values would you reject the null hypothesis? Select all that apply.
0.08
0.89
0.05
0.11

Answers

You would reject the null hypothesis for a p-value of 0.08 and 0.05. So, the correct answer for rejection is a) and c).

A significance level of 10% means that the probability of rejecting the null hypothesis when it is actually true is 10%. This probability is also known as the Type I error rate.

If the p-value is less than or equal to the significance level, then we reject the null hypothesis. In this case, the significance level is 10%, so we would reject the null hypothesis for p-values less than or equal to 0.1.

Therefore, we would reject the null hypothesis for the p-value of 0.08 and 0.05, as they are less than or equal to the significance level of 10%. However, we would not reject the null hypothesis for the p-value of 0.89 and 0.11, as they are greater than the significance level.

So, the option a) and c) are rejected.

To know more about null hypothesis:

https://brainly.com/question/28920252

#SPJ4

Simplify the expression using order of operations (pedmas)

3³+6(2+½)​

Answers

Answer:

42

Step-by-step explanation:

The order of PEMDAS is attached,

3³ + 6(2+½)​

3³ + 6(\(\frac{3}{2}\))​

27 + 6(\(\frac{3}{2}\))​

27 + 6(\(\frac{3}{2}\))​

27 + 15

42

Have a nice day!

     I hope this is what you are looking for, but if not - comment! I will edit and update my answer accordingly.

- Heather

Simplify the expression using order of operations (pedmas)3+6(2+)

William is thinking of 2 numbers. The larger number is four less than two times the smaller
number. The sum of the numbers is 104. What are William's numbers? Please write your
answer in a sentence.

Answers

Answer:

The numbers are 36 and 68.

Step-by-step explanation:

Let the smaller number be x.

"The larger number is four less than two times the smaller

number."

The larger number is

2x - 4

The sum of the numbers is x + 2x - 4, or 3x - 4.

"The sum of the numbers is 104."

3x - 4 = 104

3x = 108

x = 36

The smaller number is 36.

The larger number is 2x - 4, or

2x - 4 = 2(36) - 4 = 72 - 4 = 68

The larger number is 68.

Answer: The numbers are 36 and 68.

If in a population the rate of mutation that converts the A allele to the a allele is 10^-6 and the current frequency of the A allele is 0.75 and the a allele is 0.25, then the frequency of the A and a alleles in the next generation will be
Multiple Choice
O A: 0.74 a: 0.26
O A: 0.75000075 a: 0.24999925
O A: 0.75 a: 0.25
O A: 0.74999925 a: 0.25000075

Answers

The frequency of A allele after a single generation of mutation can be found as follows: Frequency of A allele after a single generationp(A) = p(A) x (1 - m) + q(a) x m

where,
m = mutation rate = 10^-6p(A) = frequency of A allele in initial generation = 0.75q(a) = frequency of a allele in initial generation = 0.25Thus,p(A) = 0.75 x (1 - 10^-6) + 0.25 x 10^-6 = 0.74999925

And the frequency of a allele will beq(a) = 1 - p(A) = 1 - 0.74999925 = 0.25000075

Therefore, the frequency of the A and a alleles in the next generation will beA: 0.74999925 and a: 0.25000075.

This is option D.

To know more about generation Visit:

https://brainly.com/question/12841996

#SPJ11

help for a cookie!!!!!

help for a cookie!!!!!

Answers

Answer:

-3 is your answer i am very sure

Step-by-step explanation:

Find the eigenvalues and eigenvectors of A geometrically over the real numbers R. (If an eigenvalue does not exist, enter DNE. If an eigenvector does not exist, enter DNE in any single blank.) A = 1 0 (reflection in the line y x) 0 1 = -1 has eigenspace span (smaller A-value) = 1 has eigenspace span (largerA-value)

Answers

The matrix A represents the linear transformation that reflects points across the line y=x in the Cartesian plane.

To find the eigenvalues of A, we solve the characteristic equation:

det(A - λI) = 0

where I is the identity matrix and λ is an eigenvalue of A.

A - λI =

[1-λ 0]

[0 1-λ]

det(A - λI) = (1-λ)(1-λ) - 0*0 = (1-λ)^2

Setting this expression equal to zero and solving for λ, we find:

(1-λ)^2 = 0

1-λ = 0

λ = 1

So the only eigenvalue of A is 1.

To find the eigenvectors corresponding to λ=1, we solve the system of equations:

(A - λI)v = 0

where v is an eigenvector of A.

For λ=1, we have:

(A - I)v =

[0 0]

[0 0]

which implies that any non-zero vector in the plane (i.e., any non-zero vector in R^2) is an eigenvector of A corresponding to the eigenvalue 1.

Therefore, the eigenspace corresponding to the eigenvalue 1 is all of R^2, and any non-zero vector in R^2 can be taken as an eigenvector.

In summary, the eigenvalue of A is 1, and the eigenspace corresponding to this eigenvalue is all of R^2. Any non-zero vector in R^2 can be taken as an eigenvector.

For more questions like eigenvalues visit the link below:

https://brainly.com/question/15586347

#SPJ11

help help plssssssssss

help help plssssssssss

Answers

Answer:

nice laptop

Step-by-step explanation:

Scientists believe that some mass extinction events are possibly caused by asteroids, volcanic activity, or climate change. How many mass extinctions have occurred on Earth in the last 4. 6 billion years? 0 1 5 10.

Answers

Currently, the Earth is facing a sixth mass extinction event, which is primarily caused by human activity, including habitat destruction, overhunting, and climate change.

The Earth has undergone several mass extinction events over the last 4.6 billion years. The precise number of mass extinctions is still under discussion, and estimates vary.

There have been five major mass extinction events in the last 4.6 billion years of Earth's history. The first mass extinction event occurred during the Ordovician period (443 million years ago), and the most recent occurred at the end of the Cretaceous period (66 million years ago).

It is believed that these mass extinction events were caused by natural phenomena such as volcanic eruptions, asteroid impacts, and climate change, as well as human activities like deforestation and pollution.The most well-known mass extinction event was the one that wiped out the dinosaurs at the end of the Cretaceous period.

However, mass extinction events are not just ancient history.

Currently, the Earth is facing a sixth mass extinction event, which is primarily caused by human activity, including habitat destruction, overhunting, and climate change.

To know more about Ordovician period visit:

brainly.com/question/3584035

#SPJ11

In a sale, the price of a book is reduced by 25%.
The price of the book in the sale is £12
Work out the original price of the book

Answers

Question: In a sale, the price of a book is reduced by 25%. The price of the book in the sale is £12. Work out the original price of the book

Answer: £16

Step-by-step explanation:

To determine the original price of the book, we can use the fact that the sale price is 75% (100% - 25%) of the original price. Let's denote the original price as x.

75% of x = £12

To solve for x, we can set up the equation:

0.75x = £12

To isolate x, we divide both sides of the equation by 0.75:

x = £12 / 0.75

x = £16

Therefore, the original price of the book was £16.

Shelby made equal deposits at the beginning of every 3 months into an RRSP. At the end of 9 years, the fund had an accumulated value of $55,000. If the RRSP was earning 3.50\% compounded monthly, what was the size of the quarterly deposits? Round to the nearest cent

Answers

The size of the quarterly deposits in Shelby's RRSP account was approximately $147.40.

Let's denote the size of the quarterly deposits as \(D\). The total number of deposits made over 9 years is \(9 \times 4 = 36\) since there are 4 quarters in a year. The interest rate per period is \(r = \frac{3.50}{100 \times 12} = 0.0029167\) (3.50% annual rate compounded monthly).

Using the formula for the future value of an ordinary annuity, we can calculate the accumulated value of the RRSP fund:

\[55,000 = D \times \left(\frac{{(1 + r)^{36} - 1}}{r}\right)\]

Simplifying the equation and solving for \(D\), we find:

\[D = \frac{55,000 \times r}{(1 + r)^{36} - 1}\]

Substituting the values into the formula, we get:

\[D = \frac{55,000 \times 0.0029167}{(1 + 0.0029167)^{36} - 1} \approx 147.40\]

Therefore, the size of the quarterly deposits, rounded to the nearest cent, is approximately $147.40.

To learn more about  interest Click Here: brainly.com/question/30393144

#SPJ11

how many dekameters is 4500 centimeters

Answers

Answer:

4.5

Step-by-step explanation:

one decameter is equal to 1000 centimeters 4500/100= 4.5



Nicole and Kiri are evaluating the conditional If 15 is a prime number, then 20 is divisible by 4. Both think that the conditional is true, but their reasoning differs. Is either of them correct? Explain.

Answers

Neither of Nicole and Kiri are correct that evaluating the conditional If 15 is a prime number, then 20 is divisible by 4.

Nicole reasoning is incorrect because despite the fact that 20 is divisible by 4, it does not mean the conditional is true. The conditional states that “15 is a prime number”- this is incorrect. Because this is incorrect the validity of the conclusion does not justify the validity of the hypothesis. Kiri’s reasoning is inaccurate despite the fact that his explanation of the hypothesis is correct, the hypothesis has no direct implication on the conclusion.

Hence, their belief that the conditional is true are both wrong. A conditional is only true if the premise for that conditional is first true in itself and also directly affects the conclusion.

To learn more about conditional statements. Click,  https://brainly.com/question/10714086

#SPJ4

1) Determine a. b if || a |= 6,|| b ||= 4 and the angle between the vectors 0 = π/3 ?
A) 24
B)-12
C) 12
D) None of the above

Answers

The dot product of vectors a and b  || a |= 6,|| b ||= 4 and the angle between the vectors θ = π/3 is (c) 12.

The dot product of two vectors, we can use the formula:

a · b = ||a|| ||b|| cos(theta)

where ||a|| and ||b|| represent the magnitudes of vectors a and b, respectively, and theta is the angle between the vectors.

In this case, we are given that ||a|| = 6, ||b|| = 4, and the angle between the vectors is theta = π/3.

Substituting these values into the formula, we have:

a · b = 6 × 4 × cos(π/3)

To evaluate cos(π/3), we can use the fact that it is equal to 1/2. So we have:

a · b = 6 × 4 × 1/2

= 12

Therefore, the dot product of vectors a and b is 12.

To know more about dot product click here :

https://brainly.com/question/14455586

#SPJ4

A number is called flippy if its digits alternate between two distinct digits. For example, 2020 and 37373 are flippy, but 3883 and 123123 are not. How many five-digit flippy numbers are divisible by 15?
A 3
B 4
C 5
D 6
E 8

Answers

Answer: B: 4

Step-by-step explanation:

A number is divisible by 15 if the number ends on a 0 or a 5, and the sum of its digits is divisible by 3.

We want to find a 5 digit flippy number, this can be: modeled with:

N = ababa

Where a and b are single digit numbers.

If we impose that N must end with a zero, then we will have:

N  = 0b0b0 = b0b0

This is a 4-digit number, so we can discard all the options that end with a zero.

Then the only option that we have are the numbers like:

B = 5b5b5

This number will be only divisible by 15 if:

5 + b + 5 + b + 5 = K is divisible by 3.

Then let's try find the possible values of b.

K = 3*5 + 2*b

K has two terms, the left term is already divisible by 3, then K will be divisible by 3 only if the other term is also divisible by 3.

Then we want 2*b to be divisible by 3.

And 2 is a prime number, then b must be divisible by 3, and we know that b is a number between {0,1 , 2, 3, 4, 5, 6, 7, 8 ,9}

The options are:

2*0 = 0 is divisible by 3.

2*3  = 6 is divisible by 3.

2*6 = 12 is divisible by 3

2*9 = 12 is divisible by 3.

Then we have four values of b such that:

N = 5b5b5 is divisible by 15.

Then the correct option is: B: 4

What is the value of b2 4ac for the following equation x2 5x 4 0 16 25 9 next question?

Answers

The value of b² - 4ac for the equation x² + 5x + 4 = 0 is 9.

What is the discriminant of a polynomial?

The discriminant of a polynomial is a function of its coefficients and is represented by the capital ‘D’ or Delta symbol (Δ). It shows the nature of the roots of any quadratic equations where a, b, and c are real numbers.

It is represented as ‘D’

D = b² - 4ac

Where,

a is the coefficient of x²

b is the coefficient of x

c is a constant term

x² + 5x + 4 = 0

We have given:

x² + 5x + 4 = 0

Comparing the equation with the standard form.

a = 1, b = 5 and c = 4

Substituting it in the formula

D = 5² - 4 × 1 + 4

By further calculation

D = 25 - 16

D = 9,

The quadratic roots are real and distinct

Therefore, the value of b² - 4ac is 9.

Hence, The value of b² - 4ac for the equation x² + 5x + 4 = 0 is 9.

To learn more about the discriminant of a polynomial visit,

https://brainly.com/question/272234

#SPJ4


14. A baby weighed 7 lb 3 oz at birth. Four months later, the baby
weighed 13 lb 5 oz. Find the percent of increase in the baby's
weight. Round to the nearest tenth

Answers

Answer:

I'm an island boii ️️

please help and please explain ill mark brainless, thank you:)​

please help and please explain ill mark brainless, thank you:)

Answers

Answer:

Its A...

Step-by-step explanation:

11/25 = 11 ÷ 25

11 ÷ 25 = 0.44

A: 0.44

It’s your first option......which is 0.44

plzz answer this question i will mark brainliest

plzz answer this question i will mark brainliest

Answers

Answer:

Step-by-step explanation:

line 1.

y=3

line 2.

x=-1.2

line 3.

x=3

line 4.

y=-2.6

length=3-(-1.2)=3+1.2=4.2

width=3-(-3)=3+3=6

area=4.2×6=25.2

Helppp!!!! please!!!

Helppp!!!! please!!!

Answers

Answer:

B. 24700

Step-by-step explanation:

Answer:

b. 24700 cm³

Step-by-step explanation:

\(\frac{lwh}{3} \\\\65*30*38/3 = 24700 cm^3\)

Hope this helps! :)

You are filling a 56 gallon aquarium with water at a rate of 1 3/4 gallons per minute. You start filling the aquarium at 10:50am. At what time is the aquarium filled?

Answers

To find the time when the aquarium is filled, we can use the following formula:

time = volume / rate

where volume is the total volume of water to be filled (56 gallons), and rate is the rate at which the water is being filled (1 3/4 gallons per minute).

Substituting the given values into the formula, we get:

time = 56 / 1 3/4

time = 42 1/4 minutes

Therefore, the aquarium will be filled at 42 1/4 minutes past 10:50am

Learn more about volumes visit : brainly.com/question/1972490

#SPJ11

In supply (and demand) problems, yy is the number of items the supplier will produce (or the public will buy) if the price of the item is xx.
For a particular product, the supply equation is
y=5x+390y=5x+390
and the demand equation is
y=−2x+579y=-2x+579
What is the intersection point of these two lines?
Enter answer as an ordered pair (don't forget the parentheses).
What is the selling price when supply and demand are in equilibrium?
price = $/item
What is the amount of items in the market when supply and demand are in equilibrium?
number of items =

Answers

In supply and demand problems, "y" represents the quantity of items produced or bought, while "x" represents the price per item. Understanding the relationship between price and quantity is crucial in analyzing market dynamics, determining equilibrium, and making production and pricing decisions.

In supply and demand analysis, "x" represents the price per item, and "y" represents the corresponding quantity of items supplied or demanded at that price. The relationship between price and quantity is fundamental in understanding market behavior. As prices change, suppliers and consumers adjust their actions accordingly.

For suppliers, as the price of an item increases, they are more likely to produce more to capitalize on higher profits. This positive relationship between price and quantity supplied is often depicted by an upward-sloping supply curve. On the other hand, consumers tend to demand less as prices rise, resulting in a negative relationship between price and quantity demanded, represented by a downward-sloping demand curve.

Analyzing the interplay between supply and demand allows economists to determine the equilibrium price and quantity, where supply and demand are balanced. This equilibrium point is critical for understanding market stability and efficient allocation of resources. It guides businesses in determining the appropriate production levels and pricing strategies to maximize their competitiveness and profitability.

In summary, "x" represents the price per item, and "y" represents the quantity of items supplied or demanded in supply and demand problems. Analyzing the relationship between price and quantity is essential in understanding market dynamics, making informed decisions, and achieving market equilibrium.

To know more supply and demand about refer here:

https://brainly.com/question/32830463

#SPJ11

Which enequality represents B? Thanks ! (Question 5)

Which enequality represents B? Thanks ! (Question 5)

Answers

The inequality to represent the given scenario is b≥ \(22\frac{2}{3}\). Therefore, option A is the correct answer.

What are inequalities?

Inequalities are the mathematical expressions in which both sides are not equal. In inequality, unlike in equations, we compare two values. The equal sign in between is replaced by less than (or less than or equal to), greater than (or greater than or equal to), or not equal to sign.

Given that, at Dublin International Airport if your luggage weighs more than  \(22\frac{2}{3}\) kilograms, you will be charged an additional baggage fee for the overweight luggage.

So, the inequality is b≥ \(22\frac{2}{3}\)

Therefore, option A is the correct answer.

To learn more about the inequalities visit:

https://brainly.com/question/20383699.

#SPJ1

2.) Let's consider a Stackelberg version of monopolistic competition. Suppose market demand is given by P = 30 – Q and there are ""n"" firms in the market with the first firm denoted as the leader

Answers

The specific numerical solution will depend on the number of firms in the market and their behavior.

In a Stackelberg version of monopolistic competition, there is a leader firm that sets its output first, and all the other firms in the market act as followers and choose their outputs simultaneously.

Suppose there are "n" firms in the market, with the first firm denoted as the leader. Let's assume that each firm has a constant marginal cost of $10 per unit. Then, the leader firm's profit-maximizing output level can be found by solving the following problem:

max (30-Q1-Q2-...-Qn)Q1 - 10Q1

subject to Q1 >= 0

where Q1 is the output level of the leader firm, and Q2, Q3, ..., Qn are the output levels of the follower firms.

Taking the first-order condition by differentiating with respect to Q1 and setting it equal to zero, we get:

d/dQ1 [(30-Q1-Q2-...-Qn)Q1 - 10Q1] = 0

Simplifying this expression, we get:

30 - Q1 - Q2 - ... - Qn - 2Q1 = 0

Solving for Q1, we get:

Q1 = (30 - Q2 - ... - Qn)/3

This equation gives us the leader firm's profit-maximizing output level as a function of the follower firms' output levels.

Now, let's consider the follower firms' profit-maximizing output levels. Since each follower firm is a price-taker, its profit-maximizing output level can be found by equating marginal cost to market price, which is equal to the market demand curve divided by the total quantity produced by all firms in the market. Therefore, the profit-maximizing output level of the jth follower firm can be expressed as:

Qj* = (1/n) * (30 - Q1 - Q2 - ... - Qj-1 - Qj+1 - ... - Qn - 10)

where Qj* is the follower firm's profit-maximizing output level, and j = 2, 3, ..., n.

Using these expressions for the leader and follower firms' profit-maximizing output levels, we can solve for the equilibrium outputs and profits in the Stackelberg version of monopolistic competition. However, the specific numerical solution will depend on the number of firms in the market and their behavior.

To learn more about market visit:

https://brainly.com/question/13414268

#SPJ11

Triangle ABC is similar to triangle DBE. Select the responses that make the statements true. Large triangle A B C with side length 7. 5. Smaller triangle D B C inside A B C, which shares vertex B. Side B E has length 5 and base D E has length 13

Answers

The correct responses are: "Triangle DBC is similar to triangle ABC" and "The length of side DE is 13."

Since triangle ABC is similar to triangle DBE, we know that the corresponding angles are congruent and the corresponding sides are proportional.

From the given information, we know that side BC of triangle ABC corresponds to side BE of triangle DBE, since they share vertex B. Therefore, we can use the proportion:

BC / BE = AC / DE

Substituting the given values, we have:

BC / 5 = 7.5 / 13

Solving for BC, we get:

BC = (5 x 7.5) / 13 = 2.88 (rounded to two decimal places)

Therefore, the length of side BC is 2.88.

Now we can check which of the given statements are true:

"The length of side AB is 3.75." We do not have enough information to determine the length of side AB, so this statement cannot be determined to be true or false based on the given information.

"Triangle DBC is similar to triangle ABC." This statement is true, since they share angle B and the sides BC and BE are proportional.

"Angle C in triangle ABC is congruent to angle D in triangle DBE." This statement cannot be determined to be true or false based on the given information, since we do not know which angle in triangle DBE corresponds to angle C in triangle ABC.

"The length of side AC is 4.29." This statement cannot be determined to be true or false based on the given information, since we only have information about side BC and side BE. We do not have enough information to determine the length of side AC.

"The length of side DE is 7.8." This statement is false, since the length of side DE is given as 13, not 7.8.

To learn more about Triangle here:

https://brainly.com/question/14926756

#SPJ4

Triangle ABC is similar to triangle DBE. Select the responses that make the statements true. Large triangle

I WILL GIVE BRAINLIEST
HELP

HELP

HELP

Given ƒ(x) = 2/3x - 1, complete Parts A and B.



Part A: Using the table provided, create five points to demonstrate that for the function, ƒ(x) = 2/3x - 1, there is exactly one output value for each corresponding input value. In your final answer, include all calculations and the completed table.



Part B: On a separate sheet of paper, use the points created in Part A to graph the function, ƒ(x) = 2/3x - 1. Label the values on the x- and y-axes, and all points on the graph.

Answers

Answer:

If you place a number in for x and solve this will help you to find y.

Step-by-step explanation: For example x=0 then we would do 2/3(0) -1= 0-1= y. Then you can go form there to find one of the y;'s then be able to do the other 4. :)

Step-by-step explanation:

Other Questions
The credit purchase of a new oven for $6,500 was posted to Kitchen Equipment as a $6,500 debit and to Accounts Payable as a $6,500 debit. What effect would this error have on the trial balance The heat of vaporization of water is 40.66 kJ/mol. How much heat is absorbed when 2.23 g of water boils at atmospheric pressure? HELPP PLEASEE I NEED HELP A conference will take place in a large hotel meeting room. The organizers of the conference have created a drawing for how to arrange the room. The scale indicates that 1/2 inch on the drawing corresponds to 12 feet in the actual room. In the scale drawing, the length of the room is 3 1/3 inches. What is the actual length of the room? IUPAC NAME FOR:CH2(OH)-CH2-CH(C2H5)-OH How would the moon appear to people on earth on this dayIt would be half darkIt would be. Quarter darkIt would be complete light It would be completely dark 1. Differentiate between speed and velocity. what is the noun in this sentence the last question was answered by simone can some one draw me please in any kind of style. chemically, what is the difference between a natural molecules extracted from a living source and a synthetic molecules developed in a laboratory? Which expert creates the most dangerous mood Which is NOT true of "Black Square" by Kasimir Malevich? A. It was created in the middle of the first World War B. It's a revolutionary symbol C. It is the first time someone made a painting that wasn't of something D. It marked the end of representation painting forever the nurse is teaching a client about medications for seizures. which items should be included in this teaching? 2/9 divided by 4????? If the average levels of 45 brain natriuretic peptide bloodtests is 175 pg/ml and their variance is 144 pg/ml, what is thecoefficient of variation of the brain natriuretic peptides in thisstudy pop What is likely to happen in the long term if the earth continues to absorb more energy than it emits? a. the earth will discontinue recycling energy. b. organisms will begin to compensate for the change by incorporating more energy. c. the overall temperature of the earth will increase. d. the nutrient cycles will happen more frequently. suppose aggregate consumer spending equals $5,000 when aggregate disposable income is zero. furthermore, suppose that when disposable income increases from $300 to $400, consumer spending increases by $70, and that this relationship between a change in disposable income and its effect on consumer spending is predictable and constant. if aggregate disposable income equals $2,000, then which is the value of aggregate consumer spending? What is the process of thinking, planning, and acting that can reduce your risk when behind the wheel? Group of answer choices The Assassination of Archduke Francis Ferdinand (-Explain who, when, where, why, and Austria-Hungarys Reaction acres if land if they improved the land and maintained residencyThe Homestead Act of 1862 granted settlersforyears.A 100... 10B. 80...10C. 160...5D. 160...10I need an answer ASAP!!!!