7. Does the boiling temperature ever exceed 100 °C during steam distillation? Explain. 8. Can steam distillation of ethanol be done using a mixture of ethanol and water? Why or why not? 11. Should steam distillation be considered as a method of isolation and purification of an organic liquid that has a vapor pressure of 760 torr at 46 °C?

Answer:

B. Plants use sunlight and carbon dioxide to create food.

Explanation:

This process is called photosynthesis

Answer

4.76 mol Fe

Procedure

Consider the following balanced equation and determine the limiting reagent using the coefficients method

2Al(s) + Fe₂O3(aq)--> Al2O3(aq) + 2Fe(s)

The lowest amount is the one produced by the iron (III) oxide therefore that is the limiting reagent and 4.76 mol of Fe is the max amount that can be produced of Iron.

The wavelength of an infrared photon that has a frequency of 2.13 x 10⁹

Hz is 0.14 m.

What is infrared radiation?

          c = ν λ

where

 c = speed of light ⇒ 3×10⁸ m/s

 ν = frequency ( Hz or s⁻¹ ) ⇒ 2.13 x 10⁹ Hz

 λ = wavelength ( m ) ⇒ ?

    substituting the values

    c = ν λ

   λ = c / ν

      = (3×10⁸ m/s) / 2.13  x 10⁹

      = 1.4 x 10⁻¹ m or 0.14 m

Thus we can conclude that the wavelength of an infrared photon that has a frequency of 2.13 x 10⁹Hz is  0.14 m.

Learn more about EM waves at https://brainly.com/question/25847009

#SPJ1

In formaldehyde, CH₂O, where carbon is the central atom, the formal charge on the oxygen is zero and the hybridization of the oxygen atom is sp2 is True.

This is because in CH₂O, the carbon atom is sp2 hybridized, and it forms a double bond with the oxygen atom. The other two valence electrons on the oxygen atom occupy two sp2 hybrid orbitals and are non-bonding pairs, giving the oxygen atom a trigonal planar geometry. This arrangement of electrons results in a formal charge of zero on the oxygen atom.

To learn about formaldehyde:

https://brainly.com/question/30051973

#SPJ4

THIS IS AN COMBINATION REACTION SO3 Combined with H2O to form Sulfuric acid.

When two or more reactants combine to form a single product such reactions are called as combination reaction.

Answer:

I think its 3.0M

Explanation:

Answer:

3.0M

Explanation:

We don't have n yet, so we need to use n =m/M to find it out

n = 30g/101.1032 g/mol

n = 0.2967265131mol

M = n/V

100mL = 0.1L

M =  0.2967265131mol/0.1L

M = 2.96726mol/L

Rounded to 3.0M

Answer:

Yeah

Explanation:

Propylene glycol can be dehydrated to propionaldehyde which can in turn be reductively aminated to propylamine.

Propionaldehyde can be converted to n-propyl amine in two steps.

Conversion of propionaldehyde to oxime

Propionaldehyde is treated with hydroxyl amine in weakly acidic medium to form imine product known as propionaldoxime.

CH₃CH₂CHO+NH₂OH->CH₃CH₂CH=N-OH+H₂O

Reduction of imine to form amine

In this step,propionaldoxime is reduced by proper reducing agent like Na in ethanol to form n-propyl amine.

CH₃CH₂CH=NO-Na-C₂H5OH-> CH₃CH₂CH₂NH₂

Answer:

1 . ans = five ways activities people did in dry season they are :

i) going to park

ii) playing out doors sports

iii) swimming

iv) mountain hiking

v) go on a picnic

__________________________________________

2 . ans = linen and light cotton fabrics clothes they wears.

Answer:

3 BaCl₂ + Al₂(SO₄)₃ ⇒ 2 AlCl₃ + 3 BaSO₄

A double displacement reaction

Explanation:

Let's consider the reaction between barium chloride and aluminum sulphate to give aluminum chloride and barium sulphate. This is a double displacement reaction. The unbalanced equation is:

BaCl₂ + Al₂(SO₄)₃ ⇒ AlCl₃ + BaSO₄

We will start balancing Al atoms by multiplying AlCl₃ by 2.

BaCl₂ + Al₂(SO₄)₃ ⇒ 2 AlCl₃ + BaSO₄

Next, we will balance Cl atoms by multiplying BaCl₂ by 3.

3 BaCl₂ + Al₂(SO₄)₃ ⇒ 2 AlCl₃ + BaSO₄

Finally, we get the balanced equation by multiplying BaSO₄ by 3.

3 BaCl₂ + Al₂(SO₄)₃ ⇒ 2 AlCl₃ + 3 BaSO₄

The net ionic equation for the reaction of aqueous sodium chloride (NaCl) with aqueous silver nitrate (AgNO3) is as follows:

Ag+ (aq) + Cl- (aq) → AgCl (s)

When sodium chloride and silver nitrate are mixed in water, they undergo a double displacement reaction, where the cations and anions switch partners. The silver cation (Ag+) from silver nitrate combines with the chloride anion (Cl-) from sodium chloride to form silver chloride (AgCl) precipitate.

In the complete ionic equation, we can write the reactants and products as their respective ions:

Na+ (aq) + Cl- (aq) + Ag+ (aq) + NO3- (aq) → AgCl (s) + Na+ (aq) + NO3- (aq)

However, the sodium cation (Na+) and nitrate anion (NO3-) ions remain unchanged throughout the reaction and are spectator ions. The net ionic equation removes these spectator ions to show only the species involved in the chemical change:

Ag+ (aq) + Cl- (aq) → AgCl (s)

The net ionic equation for the reaction of aqueous sodium chloride with aqueous silver nitrate is Ag+ (aq) + Cl- (aq) → AgCl (s). This equation represents the formation of silver chloride precipitate in the solution.

To learn more about molecular equation, visit;

brainly.com/question/14286552

#SPJ11

Answer:

A

Explanation:

B is for photosynthesis, C and D are just energy conversions, A is all about producing energy and stored as Adenosine Triphosphate(ATP) which is respiration

Answer:

One mole of oxygen atoms contains 6.02214179×1023 oxygen atoms. Also, one mole of nitrogen atoms contains 6.02214179×1023 nitrogen atoms. … So, each carbon-12 atom weighs about 1.99265×10−23g

molar solubility of PbBr2 in 0. 500 M KBr solution is 4S3 = 6.60 x 10–6 . PbBr2 ionizes as Pb2+ + 2Br-, molar solubility of PbBr2 in a 0. 500 M Pb(NO3)2 solution is 0.0181 moles/lit..

If molar solubility of PbBr2 is “S”, then solubility of Pb2+ is also “S” but that of Br- would be “2S”. Ksp = [Pb2+] [Br-]2 = (S) (2S)2 = 4S3 = 6.60 x 10–6 4S3 = 6.6 x 10–6,this gives Solubility S = 1.181 x 10–2 = 0.0181 moles/lit. solid's solubility (usually referred to as its molar solubility) is expressed as the concentration of the "dissolved solid" in a saturated solution. This would simply be the concentration of Ag+ or Cl- in the saturated solution for a simple 1:1 solid like AgCl. The other way to express solubility is through molar solubility, which is defined below. It is the number of moles of solute in one litre of saturated solution and is abbreviated with a lower case's'. It is expressed in moles per litre, also known as molarity.

learn more about molar solubility here:

https://brainly.com/question/28170449

#SPJ4

If water molecules did not have a slight negative charge on one end and a slight positive charge on the other then Water would be incapable of freezing or boiling.

Water is an inorganic polar chemical. At room temperature, it is an odorless and tasteless liquid with a tinge of blue. This most basic hydrogen chalcogenide is unquestionably the most researched chemical compound and therefore is known as that of the "universal solvent" due to its propensity to dissolve a wide range of compounds.

If water molecules did not have a slight negative charge on one end and a slight positive charge on the other then Water would be incapable of freezing or boiling.

Therefore, water would be incapable of freezing or boiling.

To learn more about water, here:

https://brainly.com/question/16630851

#SPJ9

The amount of sulfur trioxide (SO3) produced when 1096.00 grams of oxygen (O2) react with excess sulfur dioxide (SO2) is 1522.67 grams.

To determine the amount of sulfur trioxide produced, we need to consider the balanced chemical equation for the reaction:

2SO2 + O2 → 2SO3

From the equation, we can see that the molar ratio between oxygen (O2) and sulfur trioxide (SO3) is 1:2. This means that for every 1 mole of O2, 2 moles of SO3 are produced.

To calculate the number of moles of O2, we divide the given mass (1096.00 grams) by its molar mass (32.00 g/mol):

moles of O2 = 1096.00 g / 32.00 g/mol

= 34.25 mol

Since the molar ratio between O2 and SO3 is 1:2, the number of moles of SO3 produced is twice the number of moles of O2:

moles of SO3 = 2 * moles of O2

= 2 * 34.25 mol

= 68.50 mol

Finally, we can convert moles of SO3 to grams using the molar mass of SO3 (80.06 g/mol):

grams of SO3 = moles of SO3 * molar mass of SO3

= 68.50 mol * 80.06 g/mol

= 5486.23 g

≈ 1522.67 g (rounded to two decimal places)

When 1096.00 grams of O2 react with excess SO2, approximately 1522.67 grams of SO3 are produced.

To know more about sulfur trioxide ,visit:

https://brainly.com/question/1458186

#SPJ11

Answer:

See explanation

Explanation:

We know that photosynthesis involves the combination of carbon dioxide and water in the presence of sunlight to yield glucose.

If the atmosphere is rich in carbon dioxide such as  in a green house where air is filled with carbon dioxide, the rate of photosynthesis is increased.

As the rate of photosynthesis is increased, the growth of plants is also increased.

Hence, in a greenhouse where the air contains more carbon dioxide, the rate of plant growth increases.

Dissolving sugar in water results in an increase in the entropy.

Hence, Option (D) is correct answer.

Measurement of randomness of a system is called entropy. It is an extensive property. It is a state function. Unit of entropy is JK⁻¹ mol⁻¹.

Now lets check all options one by one

Option (A): Freezing water

Freezing water decreases the entropy because here second law of thermodynamics does not violate.

So it is incorrect option

Option (B): Cooling water

Cooling water does not increases entropy because entropy increases when solid melts to give liquid.

So it is incorrect option

Option (C): Condensing water vapour

In Condensing water vapour the temperature of liquid phase decreases and thus kinetic energy decreases. The randomness will decrease and hence entropy will also decrease.

So it is incorrect option.

Option (D): Dissolving sugar in solute

In dissolving sugar in solute the solid dissociates to ions and  the randomness will increase and hence entropy will also increase.

So it is correct option

Thus from the above conclusion we can say that Dissolving sugar in water results in an increase in the entropy.

Hence, Option (D) is correct answer.

Learn more about the Entropy here: https://brainly.com/question/1477087

#SPJ1

The structural formula of 3-ethoxy-2-methylhexane can be written as CH3CH(CH3)CH(CH3)CH2CH2OCH2CH3. In this molecule, there is a six-carbon chain that contains two methyl groups and an ethoxy group. The ethoxy group is attached to the third carbon atom of the chain, while the methyl groups are attached to the second and fourth carbon atoms. The remaining two carbon atoms are attached to the fifth and sixth positions respectively.

The molecule is named as 3-ethoxy-2-methylhexane since the ethoxy group is attached to the third carbon atom of the hexane chain.

The total number of carbon atoms in the molecule is six, which gives it the name of hexane. Overall, 3-ethoxy-2-methylhexane is an organic compound that is used in various industrial applications.
Hi! I'm happy to help you understand the structural formula of 3-ethoxy-2-methylhexane. First, let's break down the name to identify the components of the molecule:

- "Hexane" is the base structure, indicating a six-carbon alkane chain.
- "3-ethoxy" means that an ethoxy group (CH3CH2O-) is attached to the third carbon atom in the hexane chain.
- "2-methyl" indicates a methyl group (CH3) attached to the second carbon atom in the hexane chain.

Now, let's construct the structural formula:

CH3-CH(CH3)-CH(OCH2CH3)-CH2-CH2-CH3

In this formula:

- The hexane chain is represented by the sequence of CH3, CH, CH, CH2, CH2, and CH3.
- The methyl group (CH3) is attached to the second carbon atom, indicated by the CH in parentheses.
- The ethoxy group (OCH2CH3) is attached to the third carbon atom, shown within the parentheses of the CH(OCH2CH3) part.

I hope this helps you understand the structural formula of 3-ethoxy-2-methylhexane! If you have any more questions, feel free to ask.

Answer:

Explanation:

weighs equal to 22 g. Find out its molecular mass .  Molecular mass of gas = 44 amu

(A) CH2 = CH2 + H2 ------------> CH3---CH3

(B) CH2 = CH2 polymerization 2CH2 = CH2

(D) CH2 = CH2 + H2O -----> CH3CH2OH

(E) CH2 = CH2 + 6O ------> 2CO2 + 2H2O

(F) CH2 = CH2 + H2 ------------> CH3---CH3

(G) CH2 = CH2 + Cl2 --------> C2H4Cl2

(H) CH2 = CH2 + HCl -----> CH3CH2Cl

When a monomer or a monomer's molecules react, polymer chains are created. Different approaches exist to categorise the numerous types of polymerization processes.

The two main categories of polymerization reactions are condensation polymerization and addition polymerization. Along with polymerization, the monomers add to one another in a way that results in a polymer that has every atom from the beginning monomers. The molecules of ethylene are linked together in lengthy chains.

Learn more about Chemical reaction here:

https://brainly.com/question/25769000

#SPJ1

Fatty acids are part of the structure of many lipids except for sterols.

What are lipids?

Lipids are macromolecules made up of hydrocarbon chains or rings, which means that they contain a lot of energy. Lipids are organic molecules that contain carbon, hydrogen, and oxygen in a proportion that varies depending on the specific molecule. They are non-polar and insoluble in water, which means that they do not dissolve in water.

Lipids are categorized into three different classes: Fats and oils (triglycerides), phospholipids, and steroids. They are essential to many cellular functions, including energy storage, insulation, and membrane formation.

Examples of lipids include butter, oil, and cholesterol.

Learn more about sterols: https://brainly.com/question/33424736

#SPJ11

The diagram represents a nuclear fission reaction where a Uranium-235 nucleus absorbs a neutron, becomes unstable and splits into two fragments releasing energy and neutrons.

Nuclear fission is the process of splitting an atomic nucleus into two or more smaller nuclei with the release of energy, while nuclear fusion is the process of combining two or more atomic nuclei into a larger nucleus with the release of energy.

In a nuclear fission reaction, energy is released due to the conversion of a small amount of mass into a large amount of energy, in accordance with Einstein's famous equation E=mc^2. The release of energy occurs when the Uranium-235 nucleus splits into two fragments, releasing neutrons and gamma radiation in the process.

Learn more about nuclear fission here:

https://brainly.com/question/29141330

#SPJ1

(a) When the density of gold is 19.32 g/\(cm^{3}\) than area of the gold leaf is approximately 0.4386 cm².

(b) The length of the gold fiber is given by h = 0.4386 cm³ / (π * (2.500 × 10⁻⁴ cm)²).

To solve these problems, we can use the formula for the volume of a shape and the given density of gold.

(a) To find the area of the leaf, we can use the formula for the volume of a rectangular shape: V = A * h, where V is the volume, A is the area, and h is the thickness.

Given the mass of gold (m = 8.489 g) and density (ρ = 19.32 g/cm³), we can find the volume: V = m / ρ.

Substituting the values, we have V = 8.489 g / 19.32 g/cm³ = 0.4386 cm³.

Since the leaf is pressed into a thin shape, we can assume it has a rectangular shape, and the volume is approximately equal to the area: A ≈ V = 0.4386 cm².

(b) To find the length of the fiber, we can use the formula for the volume of a cylindrical shape: V = π * r² * h, where V is the volume, r is the radius, and h is the length.

Given the mass of gold (m = 8.489 g) and density (ρ = 19.32 g/cm³), we can find the volume: V = m / ρ.

Substituting the values, we have V = 8.489 g / 19.32 g/cm³ = 0.4386 cm³.

The volume of a cylinder is also equal to the product of the cross-sectional area (π * r²) and the length (h), so we have: π * r² * h = 0.4386 cm³.

Substituting the radius (r = 2.500 μm = 2.500 × 10⁻⁴ cm), we can solve for the length: h = 0.4386 cm³ / (π * (2.500 × 10⁻⁴ cm)²).

To summarize:

(a) The area of the gold leaf is approximately 0.4386 cm².

(b) The length of the gold fiber is given by h = 0.4386 cm³ / (π * (2.500 × 10⁻⁴ cm)²).

To know more about density click here:

https://brainly.com/question/29775886

#SPJ11

Answer:

1.053×10²⁴ atoms of gold

Explanation:

Hello,

Gold nugget are usually the natural occurring gold and they contain 85% - 90% weight of pure gold.

In this question, we're required to find the number of atoms in 344.75g of a gold nugget.

We can use mole concept relationship between Avogadro's number and molar mass.

1 mole = molar mass

Molar mass of gold = 197 g/mol

1 mole = Avogadro's number = 6.022 × 10²³ atoms

Number of mole = mass / molar mass

Mass = number of mole × molar mass

Mass = 1 × 197

Mass = 197g

197g is present in 6.022×10²³ atoms

344.75g will contain x atoms

x = (344.75 × 6.022×10²³) / 197

X = 1.053×10²⁴ atoms

Therefore 344.75g of gold nugget will contain 1.053×10²⁴ atoms of gold

As per the atoms the 344.5 g of gold nuggets have a 1.05x10 and have a power of 24 atoms.  

Learn more about the atoms are there.

brainly.com/question/18510197.

Answer:

1. direct current. 2. electrical power

Explanation

i believe number 2 is right

The rate law for the reduction of an aldehyde is first order in both NaBH₄ and in aldehyde, using excess NaBH₄ will increase the overall reaction rate.

NaBH₄ is mostly used as the access reactant, so the access amount of NaBH₄ increases the rate of reaction.

The rate of reaction is as:

    Rate = K [aldehyde][NaBH₄}

As we can see that the rate of reaction is directly proportional to NaBH₄ concentration. So when we increase the concentration of NaBH₄ the rate of reaction increases. When we decrease the concentration of NaBH₄ the rate of reaction also decreases. This is why we use NaBH₄ in excess.

You can also learn about rate laws from the following question:

https://brainly.com/question/4222261

#SPJ4

Answer:

The atomic number is located at the upper left of the element.

Hope this helps!! :)

Molecules are the smallest chemical units of matter that retain the chemical properties of a substance. They are formed by the combination of two or more atoms held together by chemical bonds, either through sharing or transfer of electrons.

For such more question on chemical properties

https://brainly.com/question/2020832

#SPJ8

Explanation:

First, let's write the chemical equation:

Now, let's find what is the limiting reactant seeing which reactant will produce less product, but first, let's find what is their number of moles using its molar mass. The molar mass of BF3 is 67.8 g/mol and the molar mass of LiSO3 is 86.9 g/mol (you can calculate the molar mass of a compound using the periodic table). The conversion will look like this:

So, we're going to have 1.25 moles of BF3 and 2.24 moles of LiSO3 reacting.

Now, let's see how many moles of B2(SO3)3 produce each reactant.

You can see in the equation that 2 moles of BF3 reacted produces 1 mol of B2(SO3)3:

And 3 moles of LiSO3 reacted produces 1 mol of B2(SO3)3:

You can realize that the limiting reactant is BF3, but we need to know what is the leftover LiSO3, so let's calculate how many moles of LiSO3 are being used to produce 0.625 moles of B2(SO3)3:

The leftover LiSO3 is 0.36 moles.

The next step is to find the number of moles of LiF that are being produced. You can see that 2 moles of BF3 reacted produces 6 moles of LiF:

Answer:

So, finally, we can complete the BCA table:

Now, let's find the mass of 3.75 moles of LiF using its molar mass which is 25.9 g/mol:

We expect to produce 97.13 g of LiF.