The concentration in mmol/L of the chemist's mercury(I) chloride solution. is 2.03 × 10^-8 M
We are given;
Number of moles of mercury (i) chloride as 0.000406 μmol
Volume is 200 mL
We are required to calculate the concentration of the solution.
We need to know that;
Concentration is also known as molarity is given by;
Molarity = Number of moles ÷ Volume
Number of moles = 4.06 × 10^-10 Moles
Volume = 0.02 L
Therefore;
Concentration = 4.06 × 10^-10 Moles ÷ 0.02L
= 2.03 × 10^-8 M
Thus, the molarity of the solution is 2.03× 10^-8 M.
To learn more about molarity visit:https://brainly.com/question/8732513
#SPJ9
Which of the following molecules would contain a polar covalent bond? A molecule containing two atoms
Answer:
of different elements with different electronegativities
Explanation:
A molecule containing two atoms "of different elements with different electronegativities"
A polar covalent bond exists when two different atoms (non-metals) with different electronegativities are able to share their electrons in a covalent bond.
Some examples of polar covalent bonds are seen in:
1. Ammonia(NH3): The polar covalent bonds exists between the nitrogen and hydrogen atoms.
2. Water(H2O): The polar covalent bond exists between hydrogen and oxygen. The oxygen molecule has a net negative charge while the hydrogen atoms have a net positive charge.
can you make energy with ionized particles? yes or no and how
Starting with 0.3500 mol CO(g) and 0.05500 mol COCl2(g) in a 3.050 L flask at 668 K, how many moles of CI2(g) will be present at equilibrium?
CO(g) + Cl2(g)》COCl2(g)
Kc= 1.2 x 10^3 at 668 K
At equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.
1: Write the balanced chemical equation:
\(C_O\)(g) + \(Cl_2\)(g) ⟶ \(C_OCl_2\)(g)
2: Set up an ICE table to track the changes in moles of the substances involved in the reaction.
Initial:
\(C_O\)(g) = 0.3500 mol
\(Cl_2\)(g) = 0.05500 mol
\(C_OCl_2\)(g) = 0 mol
Change:
\(C_O\)(g) = -x
\(Cl_2\)(g) = -x
\(C_OCl_2\)(g) = +x
Equilibrium:
\(C_O\)(g) = 0.3500 - x mol
\(Cl_2\)(g) = 0.05500 - x mol
\(C_OCl_2\)(g) = x mol
3: Write the expression for the equilibrium constant (Kc) using the concentrations of the species involved:
Kc = [\(C_OCl_2\)(g)] / [\(C_O\)(g)] * [\(Cl_2\)(g)]
4: Substitute the given equilibrium constant (Kc) value into the expression:
1.2 x \(10^3\) = x / (0.3500 - x) * (0.05500 - x)
5: Solve the equation for x. Rearrange the equation to obtain a quadratic equation:
1.2 x \(10^3\) * (0.3500 - x) * (0.05500 - x) = x
6: Simplify and solve the quadratic equation. This can be done by multiplying out the terms, rearranging the equation to standard quadratic form, and then using the quadratic formula.
7: After solving the quadratic equation, you will find two possible values for x. However, since the number of moles cannot be negative, we discard the negative solution.
8: The positive value of x represents the number of moles of \(Cl_2\)(g) at equilibrium. Substitute the value of x into the expression for \(Cl_2\)(g):
\(Cl_2\)(g) = 0.05500 - x
9: Calculate the value of \(Cl_2\)(g) at equilibrium:
\(Cl_2\)(g) = 0.05500 - x
\(Cl_2\)(g) = 0.05500 - (positive value of x)
10: Calculate the final value of \(Cl_2\) (g) at equilibrium to get the answer.
Therefore, at equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.
For more such questions on equilibrium, click on:
https://brainly.com/question/517289
#SPJ8
If 75 g. of Potassium Chloride (ionic compound) is dissolved in 250 grams of
water, what will be the freezing point of the solution? Kf = 1.86
Answer:
\(T_{f,sol}=-15.0\°C\)
Explanation:
Hello there!
In this case, for these problem about the colligative property of freezing point depression, it is possible set up the following equation:
\(T_{f,sol}-T_{f,water}=-i*m*Kf\)
Whereas the van't Hoff's factor, i, is 2 since KCl is ionized in two ions (K+ and Cl-); and the molality (m) of the solution is computed by:
\(m=\frac{75g*\frac{1mol}{74.55g} }{250g*\frac{1kg}{1000g} } \\\\m=4.02mol/kg\)
Thus, since the freezing point of water (ice) is 0°C, we obtain the following freezing point of the solution by plugging in:
\(T_{f,sol}=-(2)(4.02mol/kg)(1.86\°C/mol*kg)\\\\T_{f,sol}=-15.0\°C\)
Best regards!
Sodium reacts with water according to the equation shown below. If 4.6g of sodium is used, what mass of hydrogen gas will be produced? You may need some of the data in the table.
0.4g of Hydrogen will be produced when 4.6g of Sodium is used to provide Sodium Hydroxide.
The balanced equation for the formation of Sodium Hydroxide is given below:
2Na + 2H₂O ------> 2NaOH + H₂
It is shown that 2 moles of Na produce 2moles of Hydrogen. We know that the atomic mass of Sodium is 23g/mol. Then the number of moles present in 4.6g of Sodium would be,
Moles of Sodium = 4.6/23
Moles of Sodium = 0.2mol
Therefore,4.6g of Sodium has 0.2mol. Therefore, then 0.2 mol of sodium reacts to give out 0.2 mol of Hydrogen gas
The mass of hydrogen gas could be computed by the product of the mass of hydrogen gas and moles of hydrogen which is given by,
Mass of 2 atoms of hydrogen = 2x1x0.2
Mass of 2 atoms of hydrogen= 0.4g
Therefore, for every 0.2mol of Sodium, 0.1 mol of Hydrogen is produced which is equal to 0.4g of Hydrogen.
To know more about stoichiometry, click below:
https://brainly.com/question/16060223
#SPJ1
A 25.00 gram sample of an unknown metal initially at 99.0 degrees Celsius is added to 50.00 grams of water initially at 14.33 degrees Celsius. The final temperature of the system is 20.15 degrees Celsius. Calculate the specific heat of the metal. (The specific heat of water is 4.184 J/g*C). Record your answer in scientific notation using three significant figures.
The specific heat of the metal can be calculated using calorimetric equation. The specific heat of the metal here is 0.61 J/g °C.
What is specific heat capacity?The specific heat capacity of substance is the heat energy required to raise its temperature by one degree Celsius per one gram of the substance.
The calorimetric equation connecting the heat energy q, mass m, specific heat c and temperature difference ΔT is:
q = m c ΔT
Here, the heat released from the metal is equal to the heat absorbed by water.
Therefore,
q metal = q water. Let c be the specific heat of the metal.
25 g × ( 99 - 20.15°C) ×c = 50 g × ( 20.15°C- 14.33) × 4.18 J/g °C
= 1217.5 J
Then c = 1217.5 J/25 g × ( 99 - 20.15°C) = 0.61 J/g °C.
Therefore, the specific heat of the metal is 0.61 J/g °C.
Find more on calorimetry:
https://brainly.com/question/3609481
#SPJ1
An aqueous solution of 4mol/L nitric acid is electrolysed in an electrolytic cell using graphite electrodes, write the chemical symbol for all the ions in the electrolytic cell?
The main ions present in the electrolytic cell during the electrolysis of 4 mol/L nitric acid are H+, NO3-, OH-, and NO2. Additionally, water (H2O) is also present as the solvent.
Hydrogen ion (H+): When nitric acid dissolves in water, it ionizes to release hydrogen ions, which are positively charged. The chemical symbol for the hydrogen ion is H+.
Nitrate ion (NO3-): Nitric acid also dissociates to form nitrate ions. These ions have a negative charge, and their chemical symbol is NO3-.
Hydroxide ion (OH-): Water molecules can undergo self-ionization, producing hydroxide ions and hydrogen ions. In the presence of water, nitric acid can also lead to the formation of hydroxide ions, OH-.
Nitrogen dioxide (NO2): During the electrolysis process, some nitrate ions may be oxidized at the anode to form nitrogen dioxide gas. The chemical symbol for nitrogen dioxide is NO2.
Water (H2O): Water itself is present in the electrolytic cell. It serves as the solvent and also participates in ionization reactions.
For more such questions on ions visit;
https://brainly.com/question/1310794
#SPJ8
What is deltaG for a reaction where
DeltaG = 3.2 kJ/mol and Q = 3.3 at
295 K? (R = 8.314 J/mol K)
The free energy is 6.128 kJ/mol
What is free energy?Free energy, also known as Gibbs free energy, is a thermodynamic quantity used to describe the energy available to do work in a system
The concept of free energy is important in many areas of chemistry, including chemical thermodynamics, biochemistry, and materials science. It is used to understand and predict the behavior of chemical reactions, phase transitions, and other thermodynamic processes.
ΔG = ΔG° + RTlnQ
ΔG = 3.2 * 10^3 + (8.314 * 295 * ln(3.3)
= 3.2 * 10^3 + 2.928 * 10^3
= 6.128 * 10^3 J/mol
or 6.128 kJ/mol
Learn more about free energy:https://brainly.com/question/15319033
#SPJ1
what are thetypes of luminous flame
Types of luminous flames:
1. Yellow Luminous Flame
2. Smoky Luminous Flame
3. Orange Luminous Flame
4. Blue Luminous Flame
Luminous flames are characterized by their visible glow, which is caused by the incomplete combustion of fuel. The presence of soot particles in the flame causes the emission of light. There are different types of luminous flames, which can be classified based on their fuel composition and burning conditions. Here are some common types of luminous flames:
1. Yellow Luminous Flame: This is the most common type of luminous flame, often seen in open fires, candles, and gas stoves. It appears yellow due to the presence of soot particles in the flame. Yellow flames indicate incomplete combustion of hydrocarbon fuels, such as methane, propane, or natural gas. The high carbon content in these fuels leads to the formation of soot, which emits visible light.
2. Smoky Luminous Flame: This type of flame is characterized by a significant amount of black smoke and soot production. It is commonly observed in poorly adjusted or malfunctioning burners or engines. The excessive presence of unburned fuel in the flame results in incomplete combustion and the emission of dark smoke particles.
3. Orange Luminous Flame: An orange flame indicates a higher combustion temperature compared to a yellow flame. It is often seen in more efficient burners or when burning fuels with a higher carbon content, such as oil or diesel. The higher temperature helps in burning more of the carbon particles, reducing the amount of soot and making the flame appear less yellow.
4. Blue Luminous Flame: A blue flame is typically associated with complete combustion. It indicates efficient burning of fuel, resulting in minimal soot formation. Blue flames are commonly observed in gas burners or Bunsen burners. The blue color is a result of the combustion of gases, such as methane, in the presence of sufficient oxygen.
It's important to note that the luminosity of a flame can vary depending on factors such as fuel-air mixture, combustion temperature, and the presence of impurities. Achieving complete combustion and minimizing the production of soot is desirable for efficient and cleaner burning processes.
for more questions on luminous
https://brainly.com/question/27163038
#SPJ8
If you can answer both please do if not help with the top one please!
We are required to calculate the percentage yield of sodium carbonate.
We are given this reaction:
\(2NaHCO_3\text{ }\rightarrow Na_2CO_3+H_2O+CO_2\)Given: mass of NaHCO3 = 1.357 g and molar mass =84.01g/mol
mass of Na2CO3 = 0.768g and molar mass = 105.99 g/mol
%Yield = (actual yield/theoretical yield) x 100
We do know the actual yield, which is 0.768 g, but we do not know the theoretical yield.
number of moles of NaHCO3 = 1.357 g/84.01 g/mol
=0.01615 mol
Take the number of moles and multiply by molar ratio and multiply by molar mass of Na2CO3 to the theoretical mass of Na2CO3.
mass of Na2CO3 = 0.01615 mol x (1/2) x 105.99 g/mol
= 0.856 g
%Yield = (0.768/0.856) x 100
%Yield = 89.7%
.
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
During laparoscopic surgery, CO2 gas is used to expand the abdomen to help create a larger
working space. If the CO2 injected into the abdomen produces a pressure of 20.0 mmHg
and a volume of 4.00 L at 32.0C, how many grams of CO2 were used?
Answer:
The answer to your question is V2 = 4.97 l
Explanation:
Data
Volume 1 = V1 = 4.40 L Volume 2 =
Temperature 1 = T1 = 19°C Temperature 2 = T2 = 37°C
Pressure 1 = P1 = 783 mmHg Pressure 2 = 735 mmHg
Process
1.- Convert temperature to °K
T1 = 19 + 273 = 292°K
T2 = 37 + 273 = 310°K
2.- Use the combined gas law to solve this problem
P1V1/T1 = P2V2/T2
-Solve for V2
V2 = P1V1T2 / T1P2
-Substitution
V2 = (783 x 4.40 x 310) / (292 x 735)
-Simplification
V2 = 1068012 / 214620
-Result
V2 = 4.97 l
Calculate the mass of lead (III) iodide, Pb13, that can be produced by the reaction of 135 g of lead, Pb,
and 338 g of iodine.
1. What is the limiting reactant?
2. How much product is formed?
Answer:
\(m_{PbI_3}=383.05gPbI_3\)
Explanation:
Hello!
In this case, since the reaction between lead and iodine is:
\(2Pb+3I_2\rightarrow 2PbI_3\)
We can see there is 2:2 and 3:2 mole ratio between each reactant and the product; in such a way, for the limiting reactant we must compute the moles of lead (III) iodide yielded by each reactant first:
\(n_{PbI_3}^{by\ Pb}=135gPb*\frac{1molPb}{207.2gPb}*\frac{2molPbI_3}{2molPb} =0.652molPbI_3\\\\n_{PbI_3}^{by\ I_2}=338gI_2*\frac{1molI_2}{253.81gI_2}*\frac{2molPbI_3}{3molI_2} =0.888molPbI_3\)
Thus, the limiting reactant is lead because it yields the fewest moles of product. Next, we compute the mass of lead (III) iodide by multiplying the produced 0.652 moles by its molar mass:
\(m_{PbI_3}=0.652molPbI_3*\frac{587.91gPbI_3}{1molPbI_3} \\\\m_{PbI_3}=383.05gPbI_3\)
Best regards!
A 120 mL solution of sea water had 2.7x1022 sodium ions. What is the concentration of sodium in mol/L?
To calculate the concentration of sodium ions in sea water in units of mol/L, we need to use Avogadro's number to convert the number of ions to moles, and then divide by the volume of the solution in liters.
Avogadro's number is the number of atoms or molecules in one mole of a substance, and it is approximately 6.022 x 10²³.
First, we need to calculate the number of moles of sodium ions in the solution:
Number of moles of Na+ = (2.7 x 10²²) / (6.022 x 10²³) = 0.0448 mol
Next, we need to calculate the concentration of sodium ions in the solution:
Concentration of Na+ = (0.0448 mol) / (0.120 L) = 0.373 mol/L
Therefore, the concentration of sodium ions in sea water is approximately 0.373 mol/L.
To know more about Avogadro's number, visit:
https://brainly.com/question/11907018
#SPJ1
Write the chemical formula for this molecule
The chemical formula for the molecule you provided is C2H5Cl.
In the molecule, the central atom is carbon (C), which is bonded to two hydrogen atoms (H) and one chlorine atom (Cl). The carbon atom forms single bonds with each of the hydrogen and chlorine atoms, resulting in a linear structure.
To write the chemical formula, we start by indicating the number of atoms of each element present in the molecule. In this case, there are two carbon atoms (C2), five hydrogen atoms (H5), and one chlorine atom (Cl1).
Next, we write the symbols for the elements in the order of their appearance. The formula is typically written with the carbon atom first, followed by hydrogen, and then any other elements in alphabetical order. Therefore, the chemical formula for the molecule is C2H5Cl.
The subscripts in the formula indicate the number of atoms of each element in the molecule. In this case, there are two carbon atoms, five hydrogen atoms, and one chlorine atom.
It's important to note that the formula represents the simplest ratio of atoms in the molecule. It does not provide information about the spatial arrangement or bonding pattern of the atoms. Additional structural information, such as the arrangement of atoms in space, would require a more detailed representation, such as a Lewis structure or a three-dimensional model.
for more questions on chemical formula
https://brainly.com/question/21393201
#SPJ8
Sexual reproduction occurs when two specialized sex cells also known as _____________, fuse together.
Answer:
Explanation:
During sexual reproduction the two gametes join together in a fusion process known as fertilization, to create a zygote, which is the precursor to an embryo offspring, taking half of its DNA from each of its parents. In humans, a zygote contains 46 chromosomes: 23 from its mother and 23 from its father
if the electron configuration of a diatomic molecule has 6 electrons in bonding orbitals and 2 electrons in antibonding orbitals, then the overall bond order is g
If the electron configuration of a diatomic molecule has 6 electrons in bonding orbitals and 2 electrons in antibonding orbitals, then the overall bond order is 2.
We know that bond order is = \(\frac{no of electron in bonding- antibonding}{2}\)
so here no of electron on bonding is 6 and in antibonding orbital it is 2 so B.O.= 2
What is bond order?
The number of electron pairs that form bonds between two atoms is known as bond order. A single bond, a double bond, a triple bond, a quadruple bond, and so on have a bond order of one in a covalent bond between two atoms.
The number of electrons in the bonding molecular orbital (Nb) and the number of electrons in the antibonding molecular orbitals are what is known as the bond order (Na). Bond order is also known as the number of covalent bonds in a molecule, i.e., Bond order = (Nb-Na)/2.
Read more about bond order:
https://brainly.com/question/1686358
#SPJ4
Define exothermic and endothermic. What are the mathematical signs of the internal energy and enthalpy when a process is exothermic?
Exothermic refers to chemical interactions that aerobic respiration. Combustion reactions release higher energy. Endothermic refers to atoms and molecules that either use or absorb reactive power.
What is an exothermic explanation?A chemical process known as an endothermic releases energy as heat or light. It is an endothermic reaction's opposite. Chemical equation expressed as reactants + products + energy. An reaction mechanism is one in which electricity is given off as light or warmth.
Exothermic example: What is it?A response is deemed to be exothermic if it produces heat while also undergoing a net decrease in basic enthalpy change. Samples include those type of combustion, iron rust, including water froze. Exothermic processes are those that discharge heat and energy into the surroundings.
To know more about exothermic visit:
https://brainly.com/question/13243759
#SPJ1
What is an indicator?
Hope it helps you!!
those questions in pictures
For this section:
The acids that would be completely dissociated when dissolved in water are A, (H O)₂SO and B, (H O)IO₃.(i) pH of 7(ii) pH of 4.763I₂ + 2PBr₃ → 6IBr + P₂4LiH + GaCl₃ → 4LiCl + GaH₃NH₃ + BCl₃ → NH₃BCl₃How to determine pH and products?(d) To determine which acid would be completely dissociated when dissolved in water, consider the strength of the acid and its ability to ionize completely. Strong acids are those that ionize completely in water, while weak acids only partially dissociate.
Among the given options:
(H O)₂SO is sulfuric acid (H₂SO₄), which is a strong acid and completely dissociates in water.
(H O)IO₃ is iodic acid (HIO₃), which is also a strong acid and completely dissociates in water.
(H O)₂SO₂ is not a known acid and cannot be evaluated for dissociation.
HCO₂H is formic acid (HCOOH), which is a weak acid and only partially dissociates in water.
Therefore, the acids that would be completely dissociated when dissolved in water are (H O)₂SO and (H O)IO₃.
(e) To estimate the pH of the given solutions formed by titration, compare the moles of the acid and base used in the reaction.
(i) For the titration of 25.0 mL of 0.10 M aqueous NaOH with 25.0 mL of 0.10 M aqueous HCl, the reaction between a strong acid (HCl) and a strong base (NaOH) forms a neutral salt (NaCl) and water. The resulting solution would have a pH of 7, indicating neutrality.
(ii) For the titration of 25.0 mL of 0.10 M aqueous NaOH with 25.0 mL of 0.10 M aqueous acetic acid, consider the ionization of acetic acid and the formation of its conjugate base. The pKa of acetic acid is given as 4.76.
Since the volumes and concentrations of the acid and base are equal, we have a 1:1 mole ratio between them. This means that half of the acetic acid will be neutralized, and the remaining half will be in the form of the conjugate base (acetate ion, CH₃COO-). The resulting solution will be a buffer solution with a pH close to the pKa of acetic acid, which is 4.76.
(f) To predict the products formed from mixing the given reagents, we need to consider the reactions and the possible chemical reactions that occur.
(i) 3I₂ + PBr₃: This reaction involves the combination of iodine (I₂) with phosphorus tribromide (PBr₃). The balanced equation is:
3I₂ + 2PBr₃ → 6IBr + P₂
(ii) 4LiH + GaCl₃: This reaction involves the combination of lithium hydride (LiH) with gallium trichloride (GaCl₃). The balanced equation is:
4LiH + GaCl₃ → 4LiCl + GaH₃
(iii) NH₃ + BCl₃: This reaction involves the combination of ammonia (NH₃) with boron trichloride (BCl₃). The balanced equation is:
NH₃ + BCl₃ → NH₃BCl₃
Find out more on pH here: https://brainly.com/question/26424076
#SPJ1
A solution has a [H3O+] of 1 × 10−5 M. What is the [OH−] of the solution?
A) 9 M
B) 14 M
C) 1 x 10^{-9}
D) 1 x 10^{-14}
1.How is sunlight different from light produced by a light blub or by a fluorescent light blub?
2.What are some examples of light sources that you have seen where the light emitted was a color other than white?
3.What are some examples you have seen where white light was split into different colors?
Answer:
lemme slurp them juices out of that p*ssy. You must taste sweet.
Explanation:
A physical change is chemically the same after the experiment.
True
False
Answer: True
Explanation:
4. What is the main hydrocarbon component of natural gas? A. ethane
B. ethene C. methane
7.The fact that alpha particles cannot travel very far trough body tissues is the main reason that radioactive tracers use to detect diseases in internal organs emit beta particles or gamma rays.
A. true B. false
8.A wax is an ester of a long-chain fatty acid and a long-chain alcohol. A. true
B. false
Answer:
Q.4) C. Methane
Q.7) A. False
Q.8) A. True
Magnesium hydroxide reacts with chlorine to form magnesium chloride,
magnesium chlorate and water. How many grams of magnesium hydroxide is
needed to yield 8.00 moles of magnesium chlorate?
77.8 g Mg(OH)2
9178.1 g Mg(OH)2
2799.6 g Mg(OH)2
.823 g Mg(OH)2
How many grams of sodium sulfato pro
The grams of magnesium hydroxide needed to yield 8.00 moles of magnesium chlorate is approximately 466.64 g. None of the options provided match the calculated value of 466.64 g.
To determine the grams of magnesium hydroxide (Mg(OH)2) needed to yield 8.00 moles of magnesium chlorate (Mg(ClO3)2), we need to consider the balanced chemical equation for the reaction between magnesium hydroxide and chlorine.
The balanced equation is as follows:
2 Mg(OH)2 + 6 Cl2 → 2 Mg(ClO3)2 + 2 H2O
From the balanced equation, we can see that 2 moles of Mg(OH)2 react with 6 moles of Cl2 to produce 2 moles of Mg(ClO3)2.
Therefore, the stoichiometric ratio is 2 moles of Mg(OH)2 : 2 moles of Mg(ClO3)2.
To calculate the grams of Mg(OH)2 needed, we can use the stoichiometric ratio and the given moles of Mg(ClO3)2.
Given:
Moles of Mg(ClO3)2 = 8.00 moles
Using the stoichiometric ratio, we have:
8.00 moles Mg(ClO3)2 × (2 moles Mg(OH)2 / 2 moles Mg(ClO3)2) = 8.00 moles Mg(OH)2
To convert moles to grams, we need to multiply by the molar mass of Mg(OH)2.
The molar mass of Mg(OH)2 = (24.31 g/mol) + (2 * 16.00 g/mol) = 58.33 g/mol
Grams of Mg(OH)2 = 8.00 moles Mg(OH)2 × 58.33 g/mol = 466.64 g
Therefore, the grams of magnesium hydroxide needed to yield 8.00 moles of magnesium chlorate is approximately 466.64 g.
For more such questions on magnesium chlorate
https://brainly.com/question/12358640
#SPJ11
Please help i have an exam tomorow!!
1. Oxygen is a reactant needed for all _________ reactions.
2. The products of the complete combustion reaction of a hydrocarbon (compound containing carbon and hydrogen) are ______ and _____ .
3. ______ combustion takes place if the quantity of oxygen is sufficient.
4. Incomplete combustion takes place if the quantity of oxygen is _______.
5. Combustion is a ______ change.
6. In a combustion reaction, oxygen is the oxidizer and the substance
which burns is the ______.
7. The lower the kindling temeperature, the _____ is the combustion.
8. If a substance burns at room temperature in the absence of a flame the
combustion is said to be _____.
9. combustion reactions are accompanied by _____ and _____ effect.
10. combustion reactions dont take place at the same _______.
2,6,8, and 10 are the ones i need the most help with
1. Oxygen is a reactant needed for all combustion reactions.
2. The products of the complete combustion reaction of a hydrocarbon (compound containing carbon and hydrogen) are carbon dioxide and water.
3. Complete combustion takes place if the quantity of oxygen is sufficient.
4. Incomplete combustion takes place if the quantity of oxygen is insufficient.
5. Combustion is a exothermic change.
6. In a combustion reaction, oxygen is the oxidizer and the substance which burns is the fuel.
7. The lower the kindling temperature, the easier is the combustion.
8. If a substance burns at room temperature in the absence of a flame the combustion is said to be spontaneous.
9. Combustion reactions are accompanied by heat and light effect.
10. Combustion reactions don't take place at the same rate.
1)Oxygen is a reactant needed for all combustion reactions. Combustion reactions are chemical reactions that involve the rapid combination of a fuel (usually a hydrocarbon) with oxygen gas. Oxygen acts as the oxidizing agent, providing the necessary component for the reaction to occur. Without oxygen, combustion cannot take place.
2)The products of the complete combustion reaction of a hydrocarbon are carbon dioxide and water. In the presence of sufficient oxygen, hydrocarbons undergo complete combustion, resulting in the production of carbon dioxide (\(CO_2\)) and water (\(H_2O\)). This reaction releases a significant amount of energy in the form of heat and light.
3)Complete combustion takes place if the quantity of oxygen is sufficient. Complete combustion occurs when there is an adequate supply of oxygen available for the reaction. In this case, the fuel (hydrocarbon) reacts completely with oxygen, resulting in the formation of carbon dioxide and water as the only products
4)Incomplete combustion takes place if the quantity of oxygen is limited. In situations where there is insufficient oxygen available, incomplete combustion occurs. This leads to the formation of products such as carbon monoxide (CO) and carbon (soot) in addition to carbon dioxide and water. Incomplete combustion is less efficient and can release harmful pollutants into the environment.
5)Combustion is a chemical change. Combustion is classified as a chemical change because it involves the breaking and forming of chemical bonds between atoms and molecules. The reactants (fuel and oxygen) undergo a chemical reaction to produce new substances (products) with different properties, such as carbon dioxide and water. Heat and light are also typically released during combustion.
6)In a combustion reaction, oxygen is the oxidizer, and the substance that burns is the fuel or combustible material. Oxygen acts as the oxidizing agent, meaning it accepts electrons from the fuel, leading to the oxidation (burning) of the fuel. The fuel provides the carbon and hydrogen atoms that combine with oxygen to form carbon dioxide and water.
7)The lower the kindling temperature, the easier the combustion. The kindling temperature is the minimum temperature at which a substance can ignite and sustain combustion. If the kindling temperature is lower, it means that less heat is required to initiate the combustion process. Substances with lower kindling temperatures are more prone to catching fire and sustaining combustion.
8)If a substance burns at room temperature in the absence of a flame, the combustion is said to be spontaneous. Spontaneous combustion refers to the ignition and burning of a substance without the need for an external ignition source, such as a flame. It occurs when certain materials, under specific conditions, undergo self-heating and eventually reach their ignition temperature, leading to combustion.
9)Combustion reactions are accompanied by heat and light effects. Combustion reactions are highly exothermic, meaning they release a significant amount of heat energy. This energy is released in the form of heat and light, resulting in flames or glowing embers during combustion.
10)Combustion reactions don't take place at the same rate for all substances. The rate of combustion can vary depending on factors such as the nature of the fuel, the availability of oxygen, temperature, and pressure. Different substances have different combustion rates due to variations in their chemical properties and reactivity.
Know more about carbon dioxide here:
https://brainly.com/question/30355437
#SPJ8
CH4+3CI2 ---> CHCI3+3HCI
How many grams of HCI are produced when 325 grams of CHCI3 are produced??
SHOW ALL WORK INCLUDING UNITS
When 325 grams of CHCl3 is produced, approximately 297.54 grams of HCl are also produced.
To determine the amount of HCl produced when 325 grams of CHCl3 (chloroform) is produced, we need to use the balanced chemical equation for the reaction:
CH4 + 3Cl2 -> CHCl3 + 3HCl
From the balanced equation, we can see that the stoichiometric ratio between CHCl3 and HCl is 1:3. This means that for every 1 mole of CHCl3, 3 moles of HCl are produced.
To calculate the number of moles of CHCl3, we need to divide the given mass (325 grams) by its molar mass:
Molar mass of CHCl3 = 12.01 g/mol (C) + 1.01 g/mol (H) + 3 x 35.45 g/mol (Cl) = 119.38 g/mol
Moles of CHCl3 = 325 g / 119.38 g/mol = 2.72 mol
Since the stoichiometric ratio between CHCl3 and HCl is 1:3, the number of moles of HCl produced is three times that of CHCl3:
Moles of HCl = 2.72 mol x 3 = 8.16 mol
To calculate the mass of HCl, we multiply the number of moles by its molar mass:
Molar mass of HCl = 1.01 g/mol (H) + 35.45 g/mol (Cl) = 36.46 g/mol
Mass of HCl = 8.16 mol x 36.46 g/mol = 297.54 g
For more such question on HCl. visit :
https://brainly.com/question/28179864
#SPJ8
Given the following unbalanced equation:
____Mg + ____O2→ ____ MgO
If you have 8.01 moles of Mg, how many moles of MgO can you make?
8.01 mol MgO
General Formulas and Concepts:Math
Pre-Algebra
Order of Operations: BPEMDAS
Brackets Parenthesis Exponents Multiplication Division Addition Subtraction Left to RightChemistry
Atomic Structure
MolesCompoundsStoichiometry
Using Dimensional AnalysisAnalyzing Reactions RxNExplanation:Step 1: Define
[RxN - Unbalanced] Mg + O₂ → MgO
[RxN - Balanced] 2Mg + O₂ → 2MgO
[Given] 8.01 moles Mg
[Solve] moles MgO
Step 2: Identify Conversions
[RxN] 2 mol Mg → 2 mol MgO
Step 3: Stoich
[DA] Set up: \(\displaystyle 8.01 \ mol \ Mg(\frac{2 \ mol \ MgO}{2 \ mol \ Mg})\)[DA] Multiply/Divide [Cancel out units]: \(\displaystyle 8.01 \ mol \ MgO\)Find the discriminant and the number of real roots for this equation.
x2 + 2x+8 = 0
Answer:
Option 'D' is correct.
Step-by-step explanation:
Since we have given that
We will first find the "Discrimination":
Since discriminant is less than 0 i.e. D<0.
So, there will no real roots.
Hence, D = -28 and there is no real roots.
Therefore, Option 'D' is correct.
Explanation:
helpp plz I’ll mark brainiest
choose all statements that describe acids