A gas has a volume a 3L at 200kPa. What will it's new volume be if the pressure is changed at 500Kpa

Answers

Answer 1

Answer:

300/

Explanation:

jdjdjdhddhehhrjejejehe


Related Questions

What happens to the amount of solution when we add food colour to it?

Answers

Answer:

We need more? What else is in the question? This is unanswerable.

Explanation:

HELP NEEDED!!!!
The volume of a gas is 760 ml. The temperature changes from 20 oC to 40 oC. What will be the new volume?
A. 1520 ml
B. 1220 ml
C. 812 ml
D. 612 ml

Answers

The answer for this question is A. 1520ml... by using Charles law.. l hope it helped?? :)

household items that are substance or mixture

Answers

Oil and water.

Lemon juice and tea.

Honey and tea.

Milk and chocolate.

Coffee and cream.

Cream and sugar.

Flour and butter.

Cereal and milk.

Answer:

oil ,water lemon juice and tea coffee an cream honey and tea milk and chocolate these are mixtures

I need help on these chemistry problems

I need help on these chemistry problems

Answers

Answer:

15. 2.5 M

16. 2.5 moles

17. 0.128 M

18. 56 g

Explanation:

15. Determination of the molarity of NaOH.

Mole of NaOH = 2.5 moles

Volume = 1 L

Molarity =?

Molarity = mole /Volume

Molarity of NaOH = 2.5 / 1

Molarity of NaOH = 2.5 M

16. Determination of the number of mole of solute.

Volume = 1 L

Molarity = 2.5 M

Mole of HCl =?

Molarity = mole /Volume

2.5 = mole of HCl /1

Mole of HCl = 2.5 moles.

17. Determination of the molarity of Na₂S

We'll begin by calculating the number of mole in 20 g of Na₂S. This can be obtained as follow:

Mass of Na₂S = 20 g

Molar mass of Na₂S = (23×2) + 32

= 46 + 32

= 78 g/mol

Mole of Na₂S =?

Molar = mass / molar mass

Mole of Na₂S = 20 / 78

Mole of Na₂S = 0.256 mole

Finally, we shall determine the molarity of Na₂S. This can be obtained as follow:

Mole of Na₂S = 0.256 mole

Volume = 2 L

Molarity of Na₂S =?

Molarity = mole /Volume

Molarity of Na₂S = 0.256 / 2

Molarity of Na₂S = 0.128 M

18. Determination of the mass of solute.

We'll begin by calculating the number of mole solute (CH₄) in the solution. This can be obtained as follow:

Volume = 1 L

Molarity of CH₄ = 3.5 M

Mole of CH₄ =?

Molarity = mole / Volume

3.5 = mole of CH₄ / 1

Mole of CH₄ = 3.5 moles

Finally, we shall determine the mass of the solute (CH₄). This can be obtained as follow:

Mole of CH₄ = 3.5 moles

Molar mass of CH₄ = 12 + (4×1)

= 12 + 4

= 16 g/mol

Mass of CH₄ =?

Mole = mass /Molar mass

3.5 = Mass of CH₄ / 16

Cross multiply

Mass of CH₄ = 3.5 × 16

Mass of CH₄ = 56 g

Calculate the volume of 0.1M ammonia which could be obtained by heating 2.7g of ammonium chloride with excess sodiumhydroxide and absorbing all the ammonia evolved.​

Answers

The volume of 0.1 M ammonia obtained from the reaction is 0.504 L.

To solve this problem

The balanced chemical equation for the reaction between ammonium chloride and sodium hydroxide is:

NH4Cl + NaOH → NaCl + H2O + NH3

From the equation, we can see that 1 mole of ammonium chloride produces 1 mole of ammonia.

First, we need to calculate the number of moles of ammonium chloride present in 2.7 g of NH4Cl:

Molar mass of NH4Cl = 14.01 + 1.01 x 4 + 35.45 = 53.49 g/mol

Number of moles of NH4Cl = mass / molar mass = 2.7 g / 53.49 g/mol = 0.0504 mol

Since the reaction goes to completion and we have an excess of sodium hydroxide, all of the ammonia produced will be absorbed by the 0.1 M solution of the absorber.

The concentration of the ammonia solution can be calculated as follows:

0.1 M = moles of NH3 / volume of NH3 solution (in liters)

moles of NH3 = 0.0504 mol (from above)

Volume of NH3 solution = moles of NH3 / 0.1 M = 0.0504 mol / 0.1 M = 0.504 L

Therefore, the volume of 0.1 M ammonia obtained from the reaction is 0.504 L.

Learn more about mole here : brainly.com/question/15356425

#SPJ1

Determine the volume of oxygen gas produced by decomposition of 3.05g KCIO3.
KCIO3(s) -> KCl(s) + O2

Answers

The volume of oxygen gas produced by the decomposition of 3.05 g KCIO₃ according to the given equation is 1.68 liters

How do i determine the volume of oxygen gas produced?

Let us begin by obtaining the mole of 3.05 g of KClO₃. Details below:

Mass of KClO₃ = 3.05 g Molar mass of KClO₃ = 122.5 g/mol Mole of KClO₃ =?

Mole = mass / molar mass

Mole of KClO₃ = 3.05 / 122.5

Mole of KClO₃ = 0.025 mole

Next, we shall determine the mole of of oxygen gas, O₂ produced from the reaction. Details below:

KClO₃ -> 2KCl + 3O₂

From the balanced equation above,

1 mole of KClO₃ reacted to produced 3 moles of O₂

Therefore,

0.025 mole of KClO₃ will react to produce = 0.025 × 3 = 0.075 mole of O₂

Finally, we shall obtain the volume of oxygen gas, O₂ produced. This is shown below

At STP,

1 mole of O₂ = 22.4 Liters

Therefore,

0.075 moles of O₂ = 0.075 × 22.4

0.075 moles of O₂ = 1.68 liters

Thus, the volume of oxygen gas, O₂ produced is 1.68 liters

Learn more about volume:

https://brainly.com/question/225322

#SPJ1


A known reaction has Change in U= 38 kJ/mol. The reaction is done at constant pressure and you measure the amount
of work done to be w=+2 kJ/mol. What is q in kJ/mol?

Answers

q = 36kJ/ mol amount of heat is produced according to 1st law of Thermodynamics

What is 1st law of Thermodynamics ?

The first law of thermodynamics states that energy is neither created nor destroyed, only its form can be changed. In any system, energy transfer involves exceeding control limits by mass, external work, or heat transfer beyond limits. These cause changes in the stored energy within the control volume.

The first law of thermodynamics states that heat is a form of energy and therefore thermodynamic processes obey the law of conservation of energy. This means that it cannot generate or destroy thermal energy.

ΔU = q + w

38kJ/ mol = q + 2kJ/mol = 36kJ/mol

q = 36kJ/ mol amount of heat is produced according to 1st law of Thermodynamics

To know about  1st law of Thermodynamics from the link

https://brainly.com/question/26035962

#SPJ13

ASAP PLEASE!!!B. Complete the drawing for the sample reaction below to show the law of conservation of
mass, when XY is produced.
+
->

ASAP PLEASE!!!B. Complete the drawing for the sample reaction below to show the law of conservation ofmass,

Answers

The complete reaction, according to the law of conservation of mass is:

XX + YY → 2XY

The Law of Conservation is a fundamental principle in chemistry and physics. It states that in a closed system, mass cannot be created or destroyed during a chemical reaction or a physical change. The total mass of the substances involved before the reaction or change must equal the total mass of the substances after the reaction or change.

This principle is based on the understanding that atoms are not created or destroyed, but they can combine or separate to form different substances.

Learn more about the law of mass conservation, here:

https://brainly.com/question/28711001

#SPJ1

What is a photon?
what is a photon?
-a wavelength of energy having amplitude and frequency
-a mixture of different elements in a metal
-a packet of light energy emitted from a light source
-a magnet used to deflect electrons away from traveling in a straight path

Answers

The photon is a type of elementary particle. It is the quantum of the electromagnetic field including electromagnetic radiation such as light and radio waves, and the force carrier for the electromagnetic force. Photons are massless,[a] so they always move at the speed of light in vacuum so the answer is A a photon is a wave length

Please help me! I don't understand this at all. All the info is in the picture. Thank you so much!!!

Please help me! I don't understand this at all. All the info is in the picture. Thank you so much!!!

Answers

Answer:

H₂S + Cl₂ —> S + 2HCl

Explanation:

? + Cl₂ —> S + 2HCl

To balance the equation above, we must recognise what atoms are present in the products.

The products contains S, H and Cl.

Thus, S, H and Cl must also be present in the reactants.

Considering the equation given above, we can see clearly that H and S is missing in the reactants.

H and S together as a compound is expressed as H₂S.

Now, we shall input H₂S into the equation to obtain the complete equation. This is illustrated below:

? + Cl₂ —> S + 2HCl

H₂S + Cl₂ —> S + 2HCl

Next, we shall verify to see if the equation is balanced.

There are 2 atoms of H on both sides of the equation.

There are 2 atoms of Cl on both sides of the equation.

1 atom of S exist on both sides of the equation.

Thus, the equation is balanced.

Explain why mass can’t be used as properly to identify sample of matter

Answers

Mass cannot be used as a property to identidy a sample of matter because it is an extensive property which depends on the amount of matter in a sample, not the tupe of matter it is.

How many moles of aluminum ions al3+ are present in 0.42 mol of al2so43

Answers

There are 0.84 moles of aluminum ions (Al3+) present in 0.42 mol of Al2(SO4)3.

To determine the number of moles of aluminum ions (Al3+) present in 0.42 mol of Al2(SO4)3, we need to consider the stoichiometry of the compound.

The formula of aluminum sulfate (Al2(SO4)3) indicates that for every 1 mole of the compound, there are 2 moles of aluminum ions (Al3+). This means that the mole ratio of Al3+ to Al2(SO4)3 is 2:1.

Given that we have 0.42 mol of Al2(SO4)3, we can calculate the moles of Al3+ as follows:

Moles of Al3+ = 0.42 mol Al2(SO4)3 x (2 mol Al3+ / 1 mol Al2(SO4)3)

Moles of Al3+ = 0.42 mol Al2(SO4)3 x 2

Moles of Al3+ = 0.84 mol Al3+

Therefore, there are 0.84 moles of aluminum ions (Al3+) present in 0.42 mol of Al2(SO4)3.

It's important to note that the stoichiometry of the compound determines the mole ratio between the different species involved in the chemical formula. In this case, the 2:1 ratio of Al3+ to Al2(SO4)3 allows us to determine the number of moles of Al3+ based on the given amount of Al2(SO4)3.

For more such question on aluminum visit:

https://brainly.com/question/30451292

#SPJ8

A gas has a volume of 50.0 mL at a temperature of 10.0 K and a pressure of 760. kPa. What will be the new volume when the temperature is changed to 20.0 K and the pressure is changed to 380. kPa?

Answers

When the temperature changes to 20.0 K and the pressure changes to 380 kPa, the new volume will be approximately 0.2 L (200.0 mL).

To solve this problem using the gas laws, we need to use the Ideal Gas Law. This law states that the product of the pressure and the volume of a gas is proportional to the absolute temperature.

The equation of the Ideal Gas Law is the following:

\(\boxed{\large\displaystyle\text{$\begin{gathered}\sf \bf{\dfrac{P_1V_1}{T_1}=\frac{P_2V_2}{T_2} } \end{gathered}$} }\)

Where:

P₁ = initial pressure = 760 kPaV₁ = initial volume = 50.0 mL = 0.050 LT₁ = initial temperature = 10.0 KP₂ = Final pressure = 380 kPaT₂ = final temperature = 20.0 KV₂ = Final volume = ?

We clear for V₂:

\(\boxed{\large\displaystyle\text{$\begin{gathered}\sf \bf{V_2=\frac{P_1V_1T_2}{P_2T_1 } } \end{gathered}$} }\)

Where:

P₁ = initial pressure V₁ = initial volumeT₁ = initial temperatureP₂ = Final pressureT₂ = final temperatureV₂ = Final volume

Substituting the known values:

\(\boxed{\large\displaystyle\text{$\begin{gathered}\sf \bf{V_2=\frac{760\not{kPa}\times0.050 \ L\times20.0\not{k} }{ 380\not{kPa}\times10.0\not{k} } } \end{gathered}$} }\)

\(\boxed{\large\displaystyle\text{$\begin{gathered}\sf \bf{V_2=\frac{760 \ L}{3800 } } \end{gathered}$} }\)

\(\boxed{\boxed{\large\displaystyle\text{$\begin{gathered}\sf \bf{V_2\approx0.2 \ Liters} \end{gathered}$} }}\)

When the temperature changes to 20.0 K and the pressure changes to 380 kPa, the new volume will be approximately 0.2 L (200.0 mL).

Enter your answer in the provided box.

Calculate the volume of air in liters that you might inhale (and exhale) in 8.00 hours. Assume that each breath has a volume of 0.305 liters, and that you are breathing 13 times a minute.

__L

Answers

The volume of air you might inhale (and exhale) in 8.00 hours is approximately 1903.2 liters.

To calculate the volume of air you might inhale (and exhale) in 8.00 hours, we need to determine the total number of breaths you take in that time and then multiply it by the volume of each breath.

First, let's calculate the number of breaths in 8.00 hours:

Number of breaths per minute = 13

Number of breaths per hour = 13 breaths/minute * 60 minutes/hour = 780 breaths/hour

Number of breaths in 8.00 hours = 780 breaths/hour * 8.00 hours = 6240 breaths

Now, let's calculate the volume of air in liters:

Volume of each breath = 0.305 liters

Volume of air inhaled and exhaled in 8.00 hours = Volume of each breath * Number of breaths in 8.00 hours

Volume of air inhaled and exhaled in 8.00 hours = 0.305 liters/breath * 6240 breaths = 1903.2 liters

for more such questions on volume

https://brainly.com/question/28853889

#SPJ8

What does this image represent?
a) alcohol group
b) carbonyl group
c) ether group
d) hydroxyl group

What does this image represent? a) alcohol groupb) carbonyl groupc) ether groupd) hydroxyl group

Answers

Explanation:

It represent Alcohol group (—OH)

reaction 1: reaction 2: reaction 3: the chemical equations and equilibrium expressions for two reactions at the same temperature are given above. based on the information, which of the following expressions can be used to calculate the value of for reaction 3 at the same temperature? (a) (b) (c) (d)

Answers

The expression for K3 = 1K1×1K2 when the chemical equations and equilibrium expressions for two reactions at the same temperature are given.

A rate law illustrates how a chemical reaction's rate is influenced by the reactant's concentration. For a reaction like aA -> A, the rate law frequently takes the form rate = k[A]n, where k is the proportionality constant known as the rate constant and n is the order of the reaction.

Given the reactions as:

CO(g)+3H2(g)⇄CH4(g)+H2O(g)

the rate law for the above equation is (K1) = [CH4][H2O]/[CO][H2]^3

Then [H2]^3 = [CH4][H2O]/K1[CO]

CO2(g)+H2(g)⇄CO(g)+H2O(g)

the rate law for the above equation is (K2) = [CO][H2O]/[CO2][H2]

[CO2] = [CO][H2O]/K2[H2]

CH4(g)+2H2O(g)⇄CO2(g)+4H2(g)

Similarly the rate law for the above equation is (K3) = [CO2][H2]^4/[CH4][H2O]^2

Then K3 = [CO][H2][CH4][H2O][H2O]/K2[H2]K1[CO]

Then K3 = 1K1×1K2

To learn more about equilibrium click here https://brainly.com/question/29359391

#SPJ4

complete question: Reaction 1:CO(g)+3H2(g)⇄CH4(g)+H2O(g),  K1=[CH4][H2O][CO][H2]3 . Reaction 2:CO2(g)+H2(g)⇄CO(g)+H2O(g), K2=[CO][H2O][CO2][H2]. Reaction 3:CH4(g)+2H2O(g)⇄CO2(g)+4H2(g)then K3=?

The chemical equations and equilibrium expressions for two reactions at the same temperature are given above. Based on the information, which of the following expressions can be used to calculate the value of K3 for reaction 3 at the same temperature?

How much water has to be evaporated from 250 mL of 1 M Ca(OH)2 to make it 3 M?

Answers

Approximately 166.67 mL of water needs to be evaporated from 250 mL of 1 M Ca(OH)2 to make it 3 M.

To find the amount of water that needs to be evaporated

The relationship between the initial and final concentrations and volumes must be taken into account.

Given: Initial concentration \((C^1) = 1 M Initial volume (V^1) = 250 mL\)

\((C^2) = 3 M final concentration\)

We can use the equation:

\(C^1 * V^1 = C^2 * V^2\)

Where:

\(V^2\)is the final volume of the solution

Rearranging the equation to solve for V2:

\(V^2 = (C^1 * V^1) / C^2\)

Substituting the given values:

\(V^2 = (1 M * 250 mL) / 3 M\)

\(V^2 = 250 mL / 3\)

\(V^2\) ≈ \(83.33 mL\)

To find the amount of water that needs to be evaporated, we subtract the final volume from the initial volume:

Amount of water to be evaporated = \(V^1 - V^2\)

Amount of water to be evaporated = 250 mL - 83.33 mL

Amount of water to be evaporated ≈ 166.67 mL

Therefore, approximately 166.67 mL of water needs to be evaporated from 250 mL of 1 M Ca(OH)2 to make it 3 M.

Learn more about Initial concentration here: brainly.com/question/30720317

#SPJ1

Tiana is a chemist who is making a
chemical to add to swimming pools in order
to make the water safer. She mixed two solid
substances together in a sealed container.
The diagram above shows the repeating
groups of atoms that make up the two
starting substances.
After mixing, Tiana found two liquid
substances in the sealed container.
(Nothing had escaped.) Which of the
diagrams to the left shows the repeating
groups of atoms that make up the ending
substances?

Tiana is a chemist who is making achemical to add to swimming pools in orderto make the water safer.

Answers

Answer:  A

Explanation:

A small amount of chemical splashes in Frank’s eye. What should Frank do immediately?

Answers

Answer:

A small amount of chemical splashes in Frank's eye. What should happen next? Frank should go to the eyewash station while his lab partner tells the teacher what happened.

Explanation:

Brainlist

Identify the common indicators that a chemical reaction has occurred.

a. A color change
b. A phase change
c. Precipitate being formed
d. A solid being dissolved
e. A change in temperature
f. Bubbles being produced

Answers

Answer:

a. A color change

c. Precipitate being formed

e. A change in temperature

f. Bubbles being produced

Explanation:

Two types of changes occur namely: physical changes and chemical changes. A physical change does not affect the chemical composition of the substance involved. Physical changes include change of state etc.

However, on the other hand, a chemical change alters the chemical composition of the substances involved, hence, leading to the formation of new product(s). It is also called a chemical reaction. Since a new product is formed from the alteration of the chemical nature of the reacting substances, the following changes or indicators will be present or evident in a chemical reaction:

- color change of substance

- Precipitate being formed i.e. solid deposit

- A change in temperature

- Bubbles being produced (evolution of gas)

You are presented with a white solid and told that, because of careless labeling, it is not clear whether the substance is mercury(I) nitrate, calcium carbonate, or aluminum nitrate. When you transfer the solid to a beaker and add water, the solid dissolves to give a clear solution. Next, a Na2SO4(aq) solution is added and a white precipitate forms.

Required:
a. What is the identity of the unknown white solid?
b. How many grams of CH3OH must be added to water to prepare 150 mL of a solution that is 2.5 M CH3OH?

Answers

Answer:

aluminum nitrate

Explanation:

We already know that calcium carbonate is insoluble in water hence it will not even dissolve in the water.

Mercury(I) nitrate is soluble in water, when sodium sulfate (Na2SO4) is added to mercury(I) nitrate (Hg2(NO3)2), a pale yellow precipitate is formed.

Aluminum nitrate is soluble in water and reacts with Na2SO4(aq) solution according to the reaction, 2Al(NO3)3(aq)+3Na2SO4(aq) ---> Al2(SO4)3(s)+6NaNO3(aq). The precipitate, Al2(SO4)3(s) is a white crystalline hygroscopic solid.

Which energy source produces less negative
environmental impacts

A)Renewable Energy Sources
B)Fossil Fuels

Help

Answers

Answer:

A)Renewable Energy Sources

Explanation:

explain order of reaction and use the data below and the rate equation to show how it is calculated.



Using the data above determine
(a) order with respect to (A)
(b) order with respect to (B)
(c) rate equation
(d) overall order

explain order of reaction and use the data below and the rate equation to show how it is calculated.Using

Answers

The rate equation is Rate = k[A]²[B]³, and the reaction has an overall order of 5.

If the rate equation is correct, what is the reaction's order?

A rate law illustrates how a chemical reaction's rate is influenced by the reactant's concentration. The rate law typically has the formula rate = k[A]n for reactions like aA products, where k is the proportionality constant also known as the rate constant. and The reaction's sequence in relation to A is indicated by n.

Rate = k[A]x[B]y

Rate = k[A]²[B]³

Overall order = 2 + 3 = 5

Therefore, the overall order of the reaction is 5, and the rate equation is Rate = k[A]²[B]³.

To know more about reaction visit:-

https://brainly.com/question/28984750

#SPJ1

homogenous and heterogenous catalyst1- state the definition of each one. 2- describe in detail the mechanism of each one. 3- give example of 2 industrial uses per catalyst type with balanced equations for the reactions each catalyzes and the catalyst name.

Answers

1) Homogeneous catalysts are those that occupy the same phase as the reaction mixture (generally liquid or gas), while heterogeneous catalysts occupy a different phase. Normally, heterogeneous catalysts are solid compounds that are added to liquid or gas reaction mixtures.

While isobaric heat can be measured by using the coffee cup calorimeter, what kind of device would be needed to measure the reaction heat under isochoric condition? Please search literature to answer the question.

To measure the reaction heat more accurately at isobaric condition, what modification(s) would you suggest making on the coffee cup calorimeter? Please justify the suggested change(s).

Answers

To measure reaction heat under isochoric conditions, a bomb calorimeter is needed.

This device is designed to maintain a constant volume (isochoric) during the reaction, allowing for accurate measurement of reaction heat. To improve the accuracy of the coffee cup calorimeter for measuring reaction heat under isobaric conditions, a modification that could be made is to use a stirring device to ensure uniform mixing of the reactants and to minimize heat loss to the surroundings.

Additionally, a lid with a small hole could be placed over the top of the calorimeter to prevent heat loss while still allowing for pressure equalization. These modifications would help to minimize errors in heat measurement and improve the accuracy of the results obtained.

To know more about the Calorimeter, here

https://brainly.com/question/24150308

#SPJ1

A chemist dissolves 14.0 g of calcium hydroxide in one beaker of water, and 17.0 g of iron(III) chloride
in a second beaker of water. Everything dissolves.
When the two solutions are poured together, solid iron(III) hydroxide precipitates.
1. Write a balanced molecular equation.
2. Determine the identity of the limiting reactant.
3. Predict the mass of iron(III) hydroxide product.

Answers

Answer:

See detailed explanation.

Explanation:

Hello there!

In this case, for the given scenario, we will proceed as follows:

1. Here, we infer that the products are iron (III) hydroxide (precipitate) and calcium chloride:

\(3Ca(OH)_2+2FeCl_3\rightarrow 3CaCl_2+2Fe(OH)_3\)

2. In this step we firstly calculate the moles of both reactants, by using their molar masses 74.093 and 162.2 g/mol respectively:

\(14.0gCa(OH)_2*\frac{1molCa(OH)_2}{74.093gCa(OH)_2}=0.189molCa(OH)_2 \\\\17.0gFeCl_3*\frac{1molFeCl_3}{162.2gFeCl_3}=0.105molFeCl_3\)

Now, we calculate the moles of calcium hydroxide consumed by 0.105 moles of iron (III) chloride by using the 3:2 mole ratio between them:

\(0.105molFeCl_3*\frac{3molCa(OH)_2}{2molFeCl_3} =0.157molCa(OH)_2\)

Thus, we infer that calcium hydroxide is in excess as 0.189 moles are available for it but just 0.157 moles react and therefore, iron (III) chloride is the limiting reactant.

3. Here, we use the moles of iron (III) chloride we've just computed, the 2:2 mole ratio with iron (III) hydroxide and its molar mass (106.867 g/mol) as shown below:

\(0.105molFeCl_3*\frac{2molFe(OH)_3}{2molFeCl_3} *\frac{106.867gFe(OH)_3}{1molFe(OH)_3} \\\\=11.2gFe(OH)_3\)

Regards!

which of the following best represents how a single gene can encode more than one type of protein? choose 1 answer: choose 1 answer:

Answers

Splicing represents how a single gene can encode more than one type of protein.

What is Splicing?

Splicing is the process of removing introns from a gene and joining the exons together. This process is necessary for the production of a functional protein. In eukaryotic organisms, genes are composed of both exons (the coding regions) and introns (non-coding regions). During splicing, the introns are removed and the exons are connected. The resulting mRNA molecule is then ready for translation into a functional protein. Splicing can be either intron-mediated or trans-splicing, depending on the type of organism and the type of gene. Intron-mediated splicing occurs in eukaryotes, while trans-splicing occurs in prokaryotes.

It is a post-transcriptional modification that allows a single gene to code for multiple proteins. In eukaryotes, gene splicing occurs prior to mRNA translation by the differential inclusion or exclusion of pre-mRNA regions. Splicing of genes is a significant source of protein diversity.

Therefore, Splicing is the correct answer.

To learn more Splicing from the link

https://brainly.com/question/13328501

#SPJ4

A single gene can encode more than one type of protein through several different mechanisms, including:

How a single gene can encode more than one type of protein? Alternative splicing: This is a process in which different parts of the RNA transcribed from a gene are selectively included or excluded, resulting in the production of multiple different protein isoforms from the same gene.Post-transcriptional modifications: These are changes that occur to the RNA after it has been transcribed from the gene. For example, RNA can be edited, which can change the sequence of the encoded protein.Translation initiation: Different proteins can be produced from the same gene by starting translation at different locations.Ribosomal frame shifting: This occurs when the ribosome "slips" during translation, resulting in a different reading frame and the production of a different protein.Proteolytic cleavage: Proteins can be produced by cleaving a precursor protein into multiple functional proteins.In summary, a single gene can encode multiple proteins through alternative splicing, post-transcriptional modifications, translation initiation, ribosomal frame shifting, and proteolytic cleavage.

To learn more about single gene refer:

brainly.com/question/288619

#SPJ4

Jared is using a 100 ft rope to set up a kite-shaped area for food vendors. He has started roping off the area as shown below, and has one more stake to place. How can Jared use all of the rope to complete the kite shape?
Explain.
30 ft

Jared is using a 100 ft rope to set up a kite-shaped area for food vendors. He has started roping off

Answers

Jared can use the entire 100 ft rope to complete the kite shape by placing the remaining stake at the center

To use the entire 100 ft rope to complete the , Jared can follow these steps:

1)Place the first stake at the center of the intended kite shape.

2)Measure a distance of 30 ft from the center stake in one direction and place a second stake at that point.

3)Measure a distance of 30 ft from the center stake in the opposite direction and place a third stake at that point.

4)Measure a distance of 20 ft from the center stake in the remaining two directions perpendicular to the first measurements, and place the fourth and fifth stakes at those points.

Finally, connect the stakes with the rope to form the complete kite shape.

The kite shape has two pairs of equal-length adjacent sides. In this case, the sides measured at 30 ft create one pair, while the sides measured at 20 ft create the other pair. This configuration allows Jared to use all of the 100 ft rope.

To visualize the shape:

The center stake acts as the point where the two pairs of adjacent sides meet.

The first pair of adjacent sides measures 30 ft each, extending in opposite directions from the center stake.

The second pair of adjacent sides measures 20 ft each, perpendicular to the first pair and also extending in opposite directions from the center stake.

By following this arrangement, Jared will use the entire length of the 100 ft rope to create the kite shape for the food vendors.

Know more about  length    here:

https://brainly.com/question/28211283

#SPJ8


I need help putting these in order . Someone Please help me .

I need help putting these in order . Someone Please help me .

Answers

By lowering temperature from liquid to solid, atoms lose some of their energy, when atoms slow down, they move close together and make the matter denser.

suppose you are asked to find the area of a rectangle that is 2.1- cmcm wide by 5.6- cmcm long. your calculator answer would be 11.76 cm2cm2 . now suppose you are asked to enter the answer to two significant figures. (note that if you do not round your answer to two significant figures, your answer will fall outside of the grading tolerance and be graded as incorrect.) enter your answer to two significant figures and include the appropriate units. activate to select the appropriates template from the following choices. operate up and down arrow for selection and press enter to choose the input value typeactivate to select the appropriates symbol from the following choices. operate up and down arrow for selection and press enter to choose the input value type nothingnothing

Answers

11.76 cm² to two significant figures will give the area of the rectangle as 11.8 cm².

How to reduce numbers to two significant figures?

To reduce a number to two significant figures, you need to perform the following steps:

Determine the first significant figure by finding the first non-zero digit from the left.Count the total number of digits after the first significant figure.If there are more than two digits after the first significant figure, round the number to the second significant figure.If there are less than two digits after the first significant figure, leave the number as is.

To reduce 11.76 to two significant figures, you need to determine the first two non-zero digits and the location of the decimal point. The first two non-zero digits are 11, and the decimal point is between the 1 and the 7. Therefore, the reduced number is 11.8 (since the rounding rule is to round up if the third digit is 5 or greater). So, 11.76 reduced to two significant figures is 11.8 cm².

Learn more on significant figures here: https://brainly.com/question/24491627

#SPJ1

Other Questions
what is the rule that states that the number of transistors per microchip doubles every two years? Which of these are true of political action committees (pacs) but not of interest groups? choose two answers The infrared spectrum of the starting material (2-methylcyclohexanone) will have a peak present at ____________, which will be absent in the product (2-methylcyclohexanol). find the value of M in the following equation 7=m*12 50 points. Describe this imagedescribe this image to the best of your ability in a couple of sentences summarizing the following; how does it make you feel? what does the image contain? what is happening in the image?full answers only! incorrect answers will lead to you being flagged! PLSSSS HELPPPPPPPP ME THIS IS SO HARD PLSSS In the united states, when do individuals experience their highest positive affect? What is a key difference in how young adults and older adults experience the meaning of death as loss? pls mar ^ry me if u like commander eerwin Please help me with the circled questions 0: experiment 2: at what temperature did the nh4cl begin to crystallize from the solution of 5.0 g nh4cl in 10 ml h2o? select the closest answer.30.8 oc68.8 oc26.0 oc46.7 oc if the dimention of a right rectangular prism are 7cm,9cm and 3cm then find the total surface area,its volume and the length of it diagonals during the late seventeenth and the eighteenth centuries, approximately 90 percent of southern black women . group of answer choices a. worked in the fields. b. lived in small towns and cities. c. had a reasonable expectation of gaining their freedom. d. worked as domestic servants. -9x-9+5^3x4^4 I need step by step pleas 2. If someone had the list of traits you provided in question 1, do you think he or she would be able to nd you in a group of 1000 people? Why or why not? If not, what other information encoded in your genes might distinguish you from the others in the group? What are other traits that are encoded for by DNA? a(n) _______________ is a single device that serves several functions, such as printing, scanning, faxing, and copying. Marques is a high school basketball player. In a particular game, he made some three point shots and some free throws (worth one point each). Marques made a total of 8 shots altogether and scored a total of 12 points. Determine the number of three point shots Marques made and the number of free throws he made. African rhythms, Ragtime & Bluesmixed to form the new AmericanMusic tradition of Jazz.A.TrueB. False Why did bud not buddy wake up immediately think about his mother? The point at which two or more lineages diverge from their common ancestor is called?