Answer:
The molar mass of the unknown gas is 128g/mol
Explanation:
The rate of effusion of 2 different gases follows the equation:
Rate gas A / Rate gas B = √MM gas B / √MM gas A
Where rate is the speed of effusion of each gas and MM the molar mass of each gas
If gas A is oxygen and gas B the unknown:
Rate gas A / Rate gas B = 2 = √MM gas B / √32g/mol
11.134 = √MM gas B
128g/mol = MM gas B
The molar mass of the unknown gas is 128g/mol
How many grams of F are in 185g CaF2
There are 90.0 g of F are present in 185 g of CaF₂. In chemistry, a mole, usually spelled mol, is a common scientific measurement unit for significant amounts of extremely small objects like atoms, molecules, or other predetermined particles.
According to question, mass of CaF₂ = 185 g
It is required to calculate the moles of CaF₂
Moles of CaF₂ = 185 g / 78.074 g.mol-1
= 2.369 mole of CaF₂
Now find the moles of F from the moles of CaF₂
1 mole of CaF₂ = 2 moles of F
2.369 mole of CaF₂ = ?
= 4.74 moles of F
Now change the mole to gram of F
Mass of F = 4.74 moles of F × 18.998 g/mol
= 90.03 g of F
Thus, 90.0 g of F are in 185 g of CaF₂.
Learn more about mole, here:
https://brainly.com/question/30892840
#SPJ1
Use the word bank below to answer the questions that follow:
chemical
mixture
heat capacity
homogeneous viscosity sublimation
physical property compound chemical formula
substance density
mass
temperature
pressure
heterogeneous
The ratio of the mass of a substance to its volume is called
Answer:
The ratio of the mass of a substance to its volume is called...density.
a metal worker used a cutting torch that operated by reacting acetylene gas with oxygen gas, as shown in the unbalanced equation below. balance the following equation for the reaction of acetylene and oxygen, using the smallest whole-number coefficients. (the values are 1,2,3,4,5)
The balanced equation for the reaction of acetylene (C₂H₂) and oxygen (O₂) is; 2 C₂H₂(g) + 5 O₂(g) → 4 CO₂(g) + 2 H₂O(g) + heat
The coefficients in the balanced equation represent the stoichiometric ratio of the reactants and products in the chemical reaction. In this case, 2 molecules of acetylene (C₂H₂) react with 5 molecules of oxygen (O₂) to produce 4 molecules of carbon dioxide (CO₂) and 2 molecules of water (H₂O), along with the release of heat.
The balanced equation shows that the number of atoms of each element is the same on both the sides of the equation, in accordance with the law of conservation of mass.
To know more about acetylene here
https://brainly.com/question/20529866
#SPJ1
Please help, its due today! I'll also make you brainiest (put them in an order that's simple, look at the picture and you'll see what I mean) Thank you and God bless! <33
On beaches there are often areas of grassy dunes where people are prohibited from walking. How do these protected areas preserve ecosystem services? Use the graphic organizer to categorize the following as either examples of land reclamation of protecting biodiversity.
Answer:
Preventing erosion – Land Reclamation
Protecting nesting areas – Protecting Biodiversity
Preventing littering – Land Reclamation
Preventing habitat disruption – Protecting Biodiversity
Protecting native species – Protecting Biodiversity
Preventing contamination of soil – Land Reclamation
Explanation:
I really hope I'm right! I tried my hardest, please give me brainliest :)
have a good day!
Briefly explain the features of computer?
Some of the essential features of computers:
1. Processing Power
2. Storage Capacity
3. Memory
4. Input and Output
5. Connectivity
6. Software
7. Multitasking
8. Scalability
9. Reliability and Durability
10. User Interface
Computers are complex machines that have become an integral part of our daily lives. They possess several key features that enable them to perform a wide range of tasks efficiently. Here are some of the essential features of computers:
1. Processing Power: Computers are capable of executing complex calculations and tasks at incredible speed. They contain powerful processors that can perform billions of operations per second, enabling them to handle various applications and processes.
2. Storage Capacity: Computers have the ability to store and retrieve vast amounts of data. They come equipped with different types of storage devices such as hard drives, solid-state drives (SSDs), and cloud storage, providing ample space for storing files, programs, and operating systems.
3. Memory: Computers have two primary types of memory: RAM (Random Access Memory) and ROM (Read-Only Memory). RAM provides temporary storage for data and instructions that the computer is actively using, while ROM contains firmware and permanent instructions that are essential for booting up the computer.
4. Input and Output: Computers allow users to interact with them through various input and output devices. Input devices include keyboards, mice, touchscreens, and microphones, while output devices include monitors, printers, speakers, and headphones. These devices enable users to input commands and receive feedback from the computer.
5. Connectivity: Computers can connect to networks and other devices, enabling communication and data transfer. They have built-in network adapters and support for various connectivity options such as Ethernet, Wi-Fi, Bluetooth, and USB, allowing users to access the internet, share files, and connect to peripherals.
6. Software: Computers run on software, including operating systems, applications, and utilities. The software provides the instructions and programs that allow users to perform tasks, manipulate data, and manage hardware resources.
7. Multitasking: Computers are designed to handle multiple tasks simultaneously. They can execute multiple programs concurrently, switch between tasks rapidly, and allocate system resources efficiently, providing users with the ability to multitask and enhance productivity.
8. Scalability: Computers offer scalability, allowing users to upgrade hardware components and expand storage capacity as needed. This feature ensures that computers can adapt to evolving technological demands and accommodate future growth.
9. Reliability and Durability: Computers are designed to be reliable and durable. They undergo rigorous testing and are built with high-quality components to ensure stable performance and withstand daily use.
10. User Interface: Computers provide graphical user interfaces (GUIs) that enable users to interact with the system easily. GUIs utilize visual elements such as icons, windows, and menus, making it intuitive for users to navigate and access various functions.
These features collectively make computers versatile, powerful, and indispensable tools in our modern world, enabling us to accomplish a wide range of tasks efficiently and effectively.
for more questions on storage
https://brainly.com/question/26972068
#SPJ8
why does a balanced chemical equation support the law of conservation of mass
Answer:
A matter can not be created or destroyed in chemical reactions. In every chemical reactions, the same mass of matter must end up in the product as started in the reactants
Which one of the following can be classified as a weak electrolyte?
HBr
CaF2
OBr2
HF
F2
F2 can be classified as a weak electrolyte.
An electrolyte is a medium containing ions that conducts electricity through the movement of those ions but does not conduct electrons. Most soluble salts, acids, and bases dissolved in a polar solvent, such as water, fall into this category.
A strong electrolyte is a solution/solute that ionizes or dissociates completely or almost completely in solution. In the solution, these ions are excellent conductors of electric current. Originally, a "strong electrolyte" was defined as a chemical that conducts electricity well in aqueous solution. Hydrogen chloride is an example of a strong electrolyte. A weak electrolyte is one that does not completely dissolve in water.
To learn more about electrolytes, here
https://brainly.com/question/28699046
#SPJ1
A chemical reaction between X and Y forms C according to the reaction below. The data for three trials to measure the
rate of this reaction are also given.
Trial
1
2
3
[X] (M)
0.01
0.01
0.02
X+Y→C
[Y] (M)
0.015
0.030
0.015
What is the rate law for this reaction?
OR=KX²M
OR=KX³M²
OR=KXM²
OR=KX²M²
Initial Rate (M/s)
7.83x10-5
BIBE
3.13x 104
1.57x10
Explanation: The rate law for a chemical reaction is an equation that relates the rate of the reaction to the concentrations of the reactants. To determine the rate law for a reaction, experiments are typically conducted with different initial concentrations of the reactants and the initial rate of the reaction is measured.
From the data provided, it appears that the reaction is of the form X + Y → C. And the concentration of X and Y are varied in three trials and the corresponding Initial rate is measured.
In the first trial, [X] = 0.01 M and [Y] = 0.015 M, and the initial rate of the reaction is 7.83x10-5 M/s.
In the second trial, [X] = 0.01 M and [Y] = 0.03 M, and the initial rate of the reaction is 3.13x104 M/s.
In the third trial, [X] = 0.02 M and [Y] = 0.015 M, and the initial rate of the reaction is 1.57x10 M/s.
Given the data, the rate law for this reaction is OR = KX²M. This is because when the concentration of X is doubled, the rate of the reaction is quadrupled, which is consistent with a rate law of the form OR = k[X]^2.
Calculate average:
So it shows me how but I don’t understand what they mean
1. Add the value from each trials
2. Divide by the number of trials
Answer:
Row 2 = 4.07
Row 3 = 6.03
Explanation:
The prompt gives you the correct equation for calculating the average. For this question, it may make more sense to write the equation as follows:
Average Time = (Time Trial 1 + Time Trial 2 + Time Trial 3) / # of Trials
So, for a distance of 20 cm, the average time is...
Average Time = (4.11 + 4.03 + 4.06) / 3
= 12.2 / 3
= 4.07 s
For a distance of 30 cm, the average time is...
Average Time = (6.07 + 5.99 + 6.03) / 3
= 18.09 / 3
= 6.03 s
Help me please answer this with solution....A piece of granite weighing 250g is heated in a boiling water to 100°C. When a granite is place in a calorimeter containing 400g water, the temperature of the water increases from 20°C to 28.5°C. What is the specific heat of the granite, assuming all the heat is transferred to the water?
The specific heat capacity of the granite is 0.796 J/gºC
We'll begin by calculating the heat absorbed by the water. This can be obtained as follow:
Mass of water (M) = 400 g
Initial temperature of water (T₁) = 20 °C
Final temperature (T₂) = 28.5 °C
Change in temperature (ΔT) = T₂ – T₁ = 28.5 – 20 = 8.5 °C
Specific heat capacity of water (C) = 4.184 J/gºC
Heat absorbed (Q) =?Q = MCΔT
Q = 400 × 4.184 × 8.5
Q = 14225.6 JThus, the heat absorbed by the water is 14225.6 J
Finally, we shall determine the specific heat capacity of the graniteHeat absorbed = Heat released
Heat absorbed = 14225.6 J
Heat released = –14225.6 JMass of granite (M) = 250 g
Initial temperature of granite (T₁) = 100 °C
Final temperature (T₂) = 28.5 °C
Change in temperature (ΔT) = T₂ – T₁ = 28.5 – 100 = –71.5 °C
Specific heat capacity of granite (C) =?Q = MCΔT
–14225.6 = 250 × C × –71.5
–14225.6 = –17875 × C
Divide both side by –17875
C = –14225.6 / –17875
C = 0.796 J/gºCTherefore, the specific heat capacity of the granite is 0.796 J/gºC
Learn more: https://brainly.com/question/21218237
Convert
31.82 grams of ca(oh)2 to moles
3.2 moles of K2SO3 to grams
7.25x10^23 formula units of hcl to moles
46.6L of Cl2 gas to moles at STP
Answer:
0.43 moles Ca(OH)₂506.4 grams K₂SO₃1.20 moles HCl2.080 moles Cl₂Explanation:
-We convert Ca(OH)₂ grams to moles using its molar mass:
31.82 g ÷ 74.093 g/mol = 0.43 mol-We convert K₂SO₃ moles to grams using its molar mass:
3.2 mol * 158.26 g/mol = 506.4 g-One formula unit of HCl is HCl. We convert molecules to moles using Avogadro's number:
7.25x10²³ molecules ÷ 6.023x10²³mol/molecules = 1.20 mol-At STP, one mol of any gas occupies 22.4 L:
46.6 L * 1 mol / 22.4 L = 2.080 molIf you have 23.8g of CaCl2, how many formula units is it
Answer:
1.3×10²³ formula unit
Explanation:
Given data:
Mass of CaCl₂ = 23.8 g
Number of formula unit = ?
Solution:
Number of moles = mass/molar mass
Number of moles = 23.8 g/110.98 g/mol
Number of moles = 0.21 mol
1 mole of any substance contain 6.022×10²³ formula unit
0.21 mol × 6.022×10²³ formula unit / 1mol
1.3×10²³ formula unit
in the ideal gas law which variable represents the gas constant?
a: T
b: R
c: n
d: V
e: P
Explanation:
It is represented using the ideal gas equation , or PV = nRT, where P is the pressure in atmospheres, V is the volume in liters, n represents the quantity of particles in the container, T represents the temperature in Kelvin, and R is the ideal gas constant equal to 0.0821 liters atmospheres per moles Kelvin.
What material do we get from trees that is burned as a fuel and releases carbon dioxide.
Burning biomass results in the production of nitrogen oxides, carbon monoxide, and carbon dioxide, as well as other pollutants and particulates.
Wood is the substance that is most frequently taken from trees and used as fuel. Burning wood produces carbon dioxide as a byproduct. One of the earliest techniques for producing energy is the consumption of wood, which has been used as a wellspring of intensity and light for a long time.
Wood sends carbon dioxide into the climate alongside energy. Considering that carbon dioxide is an ozone-depleting substance that traps heat in the air, it is an essential driver of environmental change when the wood is scorched.
Trees likewise produce extra side effects including debris, smoke, and water fume.
Learn more about fuel:
https://brainly.com/question/14845889
#SPJ4
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Syrup used for hummingbird feeders is commonly 25% sucrose (C12H22O11) by mass. if you wish to make 1.0 kg of this soltion, what calculate the quantitity of sucrose and the quantitiy of water that you should use.
Calculate the molality (m) of the 25% sucrose solution in the question above,
The density 25% a sucrose solution at room temperature is 1.10 g/mL. calculate the molarity (M) of the 25% sucrose solutino.
Answer:
m
Explanation:
Calculate the atomic mass of element "X", if it has 2 naturally occurring isotopes with the following masses and natural abundances: X-45 44. 8776 amu 32. 88% X-47 46. 9443 amu 67. 12%
46.2648
Explanation:Atomic mass describes the number of protons and neutrons in an atom.
Percent Abundance
Percent abundance is the percentage of atoms within a sample that have a specific mass number. The reason that different atoms within a sample would have different mass numbers is that they are different isotopes. For example, if the isotope Cl-35 has a percent abundance of 75%, then 75% of all Chlorine atoms within a sample will have a mass number of 35. Percent abundance refers to the likelihood of an isotope occurring in a natural sample. Percent abundance does not take into account artificial samples of elements.
Finding Atomic Mass
The atomic mass of an element is found through the mass of isotopes and their percent abundances. The formula for atomic mass is:
m₁*p₁ + m₂*p₂In this formula, the m is the mass of the isotope and p is the percent abundance. The percent abundance should be expressed as a decimal for all calculations. Now, plug in the values and solve.
(44.8776 * 0.3288) + (46.9443 * 0.6712)Rounded to 4 decimal places, this equals 46.2648. This means that the atomic mass of element "X" is 46.2648 amu.
Define heating effect?
Explanation:
when the current passes through a conductor the electrons have to face the resistance of the conductor which results in the loss of energy and this loss of energy gets converted into heat energy and it is called heating effect.good night.hope it will help uh.
What is the freezing point (in degrees Celcius) of 4.14 kg of water if it contains 235.1 g of butanol, C 4 H 9 O H
Answer:
Explanation:
Molal freezing point depression constant of butanol Kf = 8.37⁰C /m
ΔTf = Kf x m , m is no of moles of solute per kg of solvent .
mol weight of butanol = 70 g
235.1 g of butanol = 235.1 / 70 = 3.3585 moles
3.3585 moles of butanol dissolved in 4.14 kg of water .
ΔTf = 8.37 x 3.3585 / 4.14
= 6.79⁰C
Depression in freezing point = 6.79
freezing point of solution = - 6.79⁰C .
what is Keq for the reaction N2+3H2 = 2NH3 if the equilibrium concentrations are NH3 = 3 M, N2 = 1 M, H2 = 2 M
The ammonia formation has been 1.125 mol/L.
Keq is defined as the ratio of the mathematical product of the equilibrium concentrations of the species on the right that is multiplied by the concentrations of the chemical products divided by the mathematical product of the equilibrium concentrations of the species on the left.
This is the reaction that makes ammonia from hydrogen and nitrogen. Only one product is produced in this reaction. This reaction is therefore known as a binding reaction. A small Keq Keq < 1 implies a large concentration of reactants at equilibrium. In this case, the reaction drives the formation of reactants. If Keq ≈ 1 it means that there is a significant amount of reactants and products in equilibrium.
Learn more about The equilibrium concentrations here:-https://brainly.com/question/13414142
#SPJ1
Keq is equal to the number 4.5
⚠️Which type of energy warms earths surface⚠️ ASAP needed 10points
Solar energy is the type of energy that warms earth surface. Details about solar energy can be found below.
What is solar energy?Solar energy is the energy in the form of electromagnetic radiation emitted from the Sun.
Solar energy is especially that part of electromagnetic energy that is converted into usable thermal or electrical energy by man.
This energy from the sun warms the Earth surface and provides the heat needed for various activities.
Learn more about solar energy at: https://brainly.com/question/9704099
#SPJ1
PLZ HELP
A lake has a surface area of 15.0 square miles and an average depth of 51.0 feet.
What is its volume in liters?
Explanation:
calcium carbonate reacts with dilute hydrochloric acid according to the equation:
CaCO3 + 2HCl = CaCl2 + H2O + CO2
the rate of reaction decreases with time because the
Concentration of the reactants decreases over time as they are used up in the reaction. This means that there are fewer collisions between the reactant particles per unit time, leading to a decrease in the rate of reaction. Additionally, as the reaction progresses, the concentration of the product molecules increases, leading to an increase in the likelihood of the reverse reaction (i.e., CaCl2 + H2O + CO2 → CaCO3 + 2HCl) occurring. This also contributes to a decrease in the rate of the forward reaction over time.
Giant planet atmospheres have layers of clouds and aerosols (tiny liquid droplets) made from different chemicals because:
A) convection does not occur on giant planets.
B) the Coriolis effect affects each chemical compound differently.
C) different chemicals condense at different temperatures.
D) the winds are in the outermost layer.
Matter are anything that is made up of atoms. The quantity of matter can be observed only on the basis of mass and volume calculation. Thus option C is correct option.
What is matter?Matter is a substance that has some mass and can occupy some volume. The matter is mainly used in science. Matter can be solid, liquid or gas.
Matter is anything that is made up of atoms. Anything around us that can be physically seen and touched are matter. Ice, water and water vapors are example of matter.
Giant planet atmospheres have layers of clouds and aerosols (tiny liquid droplets) made from different chemicals because different chemicals condense at different temperatures.
Therefore, option C is correct option.
To learn more about matter, here:
https://brainly.com/question/4562319
#SPJ1
NaNO2 is it acidic, basic or neutral
Answer:
An aqueous solution of NaNO2 is obtained from the solution containing the salt of a strong base and weak acid. The pH of this solution will be greater than 7. Hence, NaNO2 the solution will be basic or alkaline. Therefore, an aqueous solution of NaNO2 will be basic.
When \(\rm NaNO_2\) is dissolved in water, it becomes slightly basic. However, the degree of basicity is rather low when compared to strong bases such as alkali metal hydroxides.
The salt sodium nitrite (\(\rm NaNO_2\)) is made up of the sodium cation (\(\rm Na^+\)) and the nitrite anion (\(\rm NO_2^-\)). A compound's acidity or basicity is determined by its behaviour in water and the presence of any acidic or basic characteristics. In the instance of NaNO2, hydrolysis occurs when it is dissolved in water. \(\rm NO_2^- + H_2O \rightarrow HNO_2 + OH^-\)
The nitrite ion has a basic nature since it can take a proton. As a result, when dissolved in water, \(\rm NaNO_2\) is slightly basic. However, the degree of basicity is rather low when compared to strong bases such as alkali metal hydroxides.
To know more about basic solution, here:
https://brainly.com/question/3449428
#SPJ6
Identify What part of
Thomson's model are
represented by the
"chocolate chips” in the
ball of cookie dough?
The part of Thomson's model are represented by the "chocolate chips” are the electrons.
Thomson's model
Thomson's model was the first atomic model to address the electricity of the atom and its divisibility.
In this model, Thomson made an analogy to a cookie dough with chocolate chips, indicating that the atom would be a large positive mass with small negative particles (electrons).
So, the "chocolate chips" in the ball of cookie dough are electrons.
Learn more about Thomson's model in: brainly.com/question/12869665
Jill likes to watch her dad cook. First, he puts liquid raw eggs in a hot pan, and the eggs get stiff. Then, he adds solid cheese to the pan and the cheese gets gooey.
The changes in the eggs and cheese illustrate that
A.
different substances can have different densities.
B.
different substances can have different volumes.
C.
different substances can react differently to heat.
D.
different substances can react differently to light.
Answer: c
Explanation:
different substances can react differently to heat.
Answer: c
Explanation:
different substances can react differently to heat.
The irreversible isomerization A
B was carried out in a batch reactor and the following concentration time data were obtained:
Time vs Concentration data in a Batch reactor
t 0 3 5 8 10 12 15 7.5
mol/h 4 2.89 2.25 1.45 1.0 0.65 0.25 0.07
Determine the reaction order,
, and the specific reaction a rate constant, k, using any method of your choice.
The reaction order and specific reaction rate constant can be determined by performing the kinetics experiment on irreversible polymerization A. Kinetic experiments can be used to investigate the rate and mechanism of chemical reactions. Chemical kinetics is the study of chemical reactions' speed and pathway.
The term "kinetics" refers to the study of reaction rates, which are determined by measuring the concentration of reactants and products as a function of time.Kinetics experiments can be used to determine the reaction rate and order of reaction. A chemical reaction's rate is defined as the change in the concentration of a reactant or product per unit time. The order of a reaction refers to the number of molecules that must react to produce a product. The order of reaction can be determined by measuring the initial rate of the reaction as a function of concentration.Methods for determining the reaction rate order include the initial rate method, the half-life method, and the integrated rate method. The initial rate method determines the reaction order by measuring the initial rate of the reaction at different reactant concentrations. The half-life method determines the reaction order by measuring the time it takes for the reactant concentration to decrease by half.The integrated rate method determines the reaction order by measuring the concentration of the reactant or product at different times.The specific rate constant can be determined by using the Arrhenius equation, which relates the rate constant to the activation energy, temperature, and frequency factor. The frequency factor can be determined by measuring the rate constant at different temperatures.For such more question on polymerization
https://brainly.com/question/1602388
#SPJ8
Which statement best demonstrates how data from a global positioning system (GPS) can be used to lessen the effects of a
wildfire? (1 point)
GPS data can be used by people to quickly evacuate an area because of a wildfire
GPS data can be used by scientists to predict weather patterns that can lead to a wildfire
GPS data can be used by firefighters to identify the boundaries of a wildfire
GPS data can be used by first responders to calculate the safest route to a wildfire
Answer: here is your answer
Explanation: You are visiting your Grandmother and notice that she is eating a balanced diet, taking vitamins, getting the proper amount of sleep and is not overweight. Despite her healthy lifestyle, she appears run down and tired. You realize that it's due to her lack of physical activity. Write a convincing letter to your grandma explaining the benefits of participating in regular physical activity.
What is the balance for Fe + O2 → Fe304
Answer:
3Fe + 2O2 → Fe3O4
Explanation: