write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
There are three sets of sketches below, showing the same pure molecular compound (hydrogen chloride, molecular formula HCl) at three different temperatures. The sketches are drawn as if a sample of hydrogen chloride were under a microscope so powerful that individual atoms could be seen. Only one sketch in each set is correct. Use the slider to choose the correct sketch in each set. You may need the following information: melting point of HCl: -114.8 °C boiling point of HCl: -85.1 °C C A DODODODO 5 3. C -124. "C -105. C ? X
As per the temperature, the molecules of a substance act differently. The melting point is -114.2 °C and The boiling point of hydrogen chloride (HCl) is -85.05 °C. The correct sketch in each set is as follows:
Thus, if the temperature is kept above -85.05 °C, the molecules will be placed widely apart and will be in the gaseous state, revealing their properties.
If the temperature is between -114.2 °C and -85.05 °C, the molecules will be organized in layers capable of slipping over one another since they will be in a liquid state.
At last, the molecules will be arranged in an orderly manner because they will be in a solid state if the temperature is below -114.2 °C.
To learn more about hydrogen chloride,
brainly.com/question/17429912
#SPJ4
What part of the rocket reaches space?
Answer:
cryogenic upper stage or the very top of the r0cket
A sample of marble has a volume of 8cm and density of 2.75g/cm. What is mass?
Answer:
22.0 g
Explanation:
To find the mass, multiply the volume by the density.
8 cm³ × 2.75 g/cm³ = 22.0 g
The marble is 22.0 g.
25.0 mL of nitrous acid (HNO2) is titrated with a 1.235 M solution of KOH. The equivalence point (stoichiometric point) is observed after 9.26 mL of base is added. What is the original concentration of the acid
Answer:
0.456 M
Explanation:
Step 1: Write the balanced neutralization equation
HNO₂ + KOH ⇒ KNO₂ + H₂O
Step 2: Calculate the reacting moles of KOH
9.26 mL of 1.235 M KOH react.
0.00926 L × 1.235 mol/L = 0.0114 mol
Step 3: Calculate the reacting moles of HNO₂
The molar ratio of HNO₂ to KOH is 1:1. The reacting moles of HNO₂ are 1/1 × 0.0114 mol = 0.0114 mol.
Step 4: Calculate the initial concentration of HNO₂
0.0114 moles of HNO₂ are in 25.0 mL of solution.
[HNO₂] = 0.0114 mol / 0.0250 L = 0.456 M
an unknown substance was found to have the percent composition of 36.90% nitrogen and 63.10% oxygen. how much nitrogen and oxygen would be in 100.0 g of the unknown substance
The empirical formula is KCO2
Explanation:
As with all these problems, we assume a
100
⋅
g
mass of unknown compound, and then we work out the molar quantity:
Moles of potassium
=
47.0
⋅
g
39.10
⋅
g
⋅
m
o
l
−
1
=
1.20
⋅
m
o
l
Moles of carbon
=
14.5
⋅
g
12.011
⋅
g
⋅
m
o
l
−
1
=
1.21
⋅
m
o
l
Moles of oxygen
=
38.5
⋅
g
16.0
⋅
g
⋅
m
o
l
−
1
=
2.41
⋅
m
o
l
We divide thru by the smallest molar quantity to give the empirical formula:
K
C
O
2
.
Now the molecular formula is always a whole number of the empirical formula:
i.e.
molecular formula
=
n
×
empirical formula
And thus with the molecular mass, we can solve for
n
.
166.2
⋅
g
⋅
m
o
l
−
1
=
n
×
(
39.1
+
12.011
+
2
×
16.00
)
⋅
g
⋅
m
o
l
−
1
166.2
⋅
g
⋅
m
o
l
−
1
=
n
×
(
83.1
)
⋅
g
⋅
m
o
l
−
1
Clearly,
n
=
2
, and the
molecular formula
=
K
2
C
2
O
4
The compound is LIKELY the potassium salt of oxalic acid,
K
+
−
O
(
O
=
)
C
−
C
(
=
O
)
O
−
K
+
, i.e.
potassium oxalate.
Answer linkExplanation:
As with all these problems, we assume a
100
⋅
g
mass of unknown compound, and then we work out the molar quantity:
Moles of potassium
=
47.0
⋅
g
39.10
⋅
g
⋅
m
o
l
−
1
=
1.20
⋅
m
o
l
Moles of carbon
=
14.5
⋅
g
12.011
⋅
g
⋅
m
o
l
−
1
=
1.21
⋅
m
o
l
Moles of oxygen
=
38.5
⋅
g
16.0
⋅
g
⋅
m
o
l
−
1
=
2.41
⋅
m
o
l
We divide thru by the smallest molar quantity to give the empirical formula:
K
C
O
2
.
Now the molecular formula is always a whole number of the empirical formula:
i.e.
molecular formula
=
n
×
empirical formula
And thus with the molecular mass, we can solve for
n
.
166.2
⋅
g
⋅
m
o
l
−
1
=
n
×
(
39.1
+
12.011
+
2
×
16.00
)
⋅
g
⋅
m
o
l
−
1
166.2
⋅
g
⋅
m
o
l
−
1
=
n
×
(
83.1
)
⋅
g
⋅
m
o
l
−
1
Clearly,
n
=
2
, and the
molecular formula
=
K
2
C
2
O
4
The compound is LIKELY the potassium salt of oxalic acid,
K
+
−
O
(
O
=
)
C
−
C
(
=
O
)
O
−
K
+
, i.e.
potassium oxalate.
What is the oxidation state of Br?
O A. -7
O B. +1
O c. +7
O D. -1
Compare the ionization energies of each pair of atoms. Enter the symbol for the atom with the larger ionization energy.
(If both atoms would be expected to have the same ionization energy, enter the word same.)
Pairs Symbol of atom with the larger ionization energy
Cl and I
Na and K
F and Br
Answer: 1. I
2. Na
3. F
Explanation:
Ionization energy is the energy required to remove the most loosely bound electron from an isolated gaseous atom.
In a group, the ionization energy decreases as we move down a group as the size increases. The electrons get added to the next shell. Thus the valence electron moves far from the nucleus and thus less energy is required to remove the valence electron.
1. Cl and I: Cl will have larger ionization energy as I lies lower in the group.
2. Na and K : Na will have larger ionization energy as K lies lower in the group
3. F and Br : F will have larger ionization energy as Br lies lower in the group.
Which of the following leads to a higher rate of effusion?
Answers:
1. Reduced temperature
2. Lower molar mass
3. Slower particle movement
4. Cooler gas sample
Answer:
Lower molar mass :)
Explanation:
Answer:
2. Lower Molar Mass
Explanation:
effusion can increase with either temperature increase, faster moving particles, or when the gas has lower molar mass. the only answer option that fits the description is answer option 2. Lower molar mass
Make an argument about the following claim: Exothermic reactions only release thermal energy
Exothermic reactions only release thermal energy, raising the temperature of the immediate environment. The environment is cooled through an endothermic process that absorbs heat.
What is an exothermic reaction ?An exothermic process is one in which energy is given off as heat or light. In contrast to an endothermic process, which draws energy from its surroundings, an exothermic reaction transfers energy into the environment.
The most exothermic reaction is the burning of methane because it generates a significant quantity of heat.
Thus, Exothermic reactions only release thermal energy.
To learn more about an exothermic reaction, follow the link;
https://brainly.com/question/10373907
#SPJ9
Which neutral atom is isoelectronic with Cl-??
And we can see that the potassium ion, K+, has the same electronic configuration as the chloride ion, Cl-, and the same electronic configuration as an atom of argon, Ar. Therefore, Ar, Cl-, and K+ are said to be isoelectronic species.
238/93Np → 0/-1e + ?
Answer:
looking for some pts
Explanation:
no problem
moles of each product that would form as a result of the decomposition of aspirin
The decomposition of aspirin (acetylsalicylic acid,\(C_{9} H_{8} O_{4}\)) can occur through the hydrolysis reaction, resulting in the formation of acetic acid (\(CH_{3} COOH\)) and salicylic acid (\(C_{7} H_{6}O_{3}\)).
The decomposition of aspirin (acetylsalicylic acid, \(C_{9} H_{8} O_{4}\)) can occur through the hydrolysis reaction, resulting in the formation of acetic acid (\(CH_{3} COOH\)) and salicylic acid (\(C_{7} H_{6}O_{3}\)). To determine the moles of each product formed, we need to consider the balanced chemical equation for the reaction:
\(C_{9} H_{8} O_{4} = > C_{7} H_{6}O_{3} +CH_{3} COOH\)
From the equation, we can see that for every 1 mole of aspirin, 1 mole of salicylic acid and 1 mole of acetic acid are produced.
Therefore, the moles of salicylic acid and acetic acid formed will be equal to the number of moles of aspirin that decomposes. If we know the amount of aspirin in moles, we can directly calculate the moles of each product based on stoichiometry.
For more question on aspirin
https://brainly.com/question/25794846
#SPJ8
HELP FAST 75 PTS Calculate the amount of heat needed to melt 35.0 g of ice at 0 ºC. must show work
Answer:
It takes 12,000 Joules of energy to melt 35 grams of ice at 0 °C
Explanation:
Good Luck!
Calculate the frequency of the =4
line in the Lyman series of hydrogen.
The frequency of the =4 line in the Lyman series of hydrogen is 3.09 x 10¹⁵ Hz.
What is the frequency of the n = 4 line in the Lyman series of hydrogen?The energy levels in the Lyman series of hydrogen are given by the formula:
E = -13.6/n²where
E is the energy of the level and n is an integer representing the level number.
The transition from level n to level 1 produces a photon with a frequency given by:
\(v = (E_n - E_1)/h\)
where
v is the frequency of the photon,h is Planck's constant, and \(E_n\) and \(E_1\) are the energies of levels n and 1, respectively.For the n = 4 line in the Lyman series, the initial level is n = 4 and the final level is n = 1.
The energy of the initial level is:
\(E_4\) = -13.6/4²
\(E_4\) = -0.85 eV
The energy of the final level is:
\(E_1\)= -13.6/1²
\(E_1\) = -13.6 eV
The energy difference between the levels is:
\(E_4 - E_1\) = -0.85 - (-13.6)
\(E_4 - E_1\) = 12.75 eV
Converting to joules:
v = (12.75 x 1.6 x 10⁻¹⁹ J)/6.626 x 10⁻³⁴ J s
v = 3.09 x 10¹⁵ Hz
Learn more about the Lyman series at: https://brainly.com/question/30218733
#SPJ1
PROJECT: HYDROELECTRIC POWER
Assignment Directions:
Compose an essay on hydroelectric power of at least 400 words.
Assignment Guidelines:
In your report, be sure to address:
How a hydroelectric power plant works, including why dams are built as parts of large hydropower plants;
The environmental and economic benefits of hydroelectricity, giving examples from the case studies; and
The environmental and cultural disadvantages of hydropower, giving examples from the case studies.
Hydroelectric Power: Harnessing Nature’s Energy
Let's imagine a huge wall blocking a river. On one side, the water level is high, and on the other, it's low. Now imagine that this wall has a mechanism to let the water flow from the high side to the low side, and in the process, it produces electricity. This is, in simple terms, how a hydroelectric power plant works!
Hydroelectric power plants work by using water to turn turbines that generate electricity. They are often built with dams, which are like giant walls across rivers. The dams are essential because they raise the water level on one side, creating a reservoir or a lake. This reservoir stores a huge amount of potential energy. When the water is released, it flows down through turbines, and this energy is converted into mechanical energy. The turbines are connected to generators, which turn the mechanical energy into electricity.
Now, let's talk about some of the environmental and economic benefits of hydroelectricity. It's like hitting two birds with one stone! Firstly, hydroelectric power doesn’t produce greenhouse gases or pollutants during operation, which means it’s much cleaner for our air compared to coal or gas power plants. For example, the Itaipu Dam in Brazil and Paraguay is a great case study. It generates so much electricity from hydro power that it reduces CO2 emissions equivalent to what 21.6 million cars would produce in a year!
Another economic benefit is that the electricity produced is usually cheaper in the long run. Hydroelectric plants have high upfront costs but can operate for a very long time. The Hoover Dam in the USA, built in the 1930s, still generates electricity at low cost, providing power to millions of homes.
However, there is no such thing as a free lunch. There are also environmental and cultural disadvantages to hydroelectric power. When a dam is built, the area behind it gets flooded. This means that plants, animals, and even people's homes can be submerged. For instance, the Three Gorges Dam in China displaced over 1.2 million people and flooded archaeological sites. Additionally, dams can impact fish populations. In the United States, salmon populations in the Pacific Northwest have decreased partly because dams block their migration routes.
Dams also affect the natural flow of rivers, which can have far-reaching consequences for ecosystems. The Aswan Dam in Egypt, for example, has reduced the fertility of the Nile Delta because the nutrients that used to flow down the river and enrich the soil are now trapped behind the dam.
In conclusion, hydroelectric power is an incredible way to generate clean energy, but it's important to weigh these benefits against the environmental and cultural costs. Finding ways to mitigate the negative impacts or looking at alternative renewable energy sources can help us move towards a more sustainable future.
*Keep in mind, you should paraphrase this or use it as your frame of reference, otherwise it would be plain plagiarism.*
The power of water has been harnessed by humans for centuries to generate electricity, and hydroelectric power is a renewable and sustainable energy source that has been used for many years. In this essay, we will explore the inner workings of hydroelectric power plants, the advantages and disadvantages of this energy source, and the potential it holds for a sustainable energy future. Hydroelectric power plants use the force of falling water to turn turbines, generating electricity through a process that is clean and efficient. Dams are built as part of large hydropower plants to control the flow of water and store it for later use. When the water is released from the dam, it flows through a penstock and turns the turbine, which generates electricity. Moreover, hydropower plants can be easily adjusted to meet peak demand for electricity, making them a valuable source of reliable and flexible energy.
One of the main advantages of hydroelectricity is its sustainability. Water is a renewable resource that is constantly replenished by the water cycle, making hydropower an almost infinite source of energy. Additionally, hydropower plants can provide a range of ecosystem services, such as flood control, irrigation, and recreation. For example, the Itapúa Dam on the Paraná River in Brazil provides water for irrigation, supports local fishing industries, and generates electricity for millions of homes. Nevertheless, there are also environmental and cultural drawbacks to hydropower. Large dams can cause significant harm to river ecosystems, altering the natural flow of water and affecting the habitats of fish and other aquatic species. Moreover, the construction of dams can displace local communities and destroy cultural heritage sites. For example, the construction of the Three Gorges Dam in China has caused the displacement of over one million people and has destroyed numerous cultural heritage sites.
Despite these challenges, the potential of hydroelectric power for a sustainable energy future cannot be ignored. As we move towards a world that is less reliant on fossil fuels, hydropower can play a critical role in providing clean, renewable, and reliable energy. Furthermore, new technologies are being developed to reduce the environmental impact of hydropower, such as fish ladders and other measures to support fish migration. Furthermore, hydroelectric power is a powerful and sustainable source of energy that harnesses the power of falling water to generate electricity. Although there are challenges associated with hydropower, such as the environmental and cultural impacts of large dams, the benefits of this energy source are significant. As we continue to seek sustainable solutions to our energy needs, hydroelectric power will undoubtedly play a critical role in meeting our energy demands while also protecting the environment and supporting economic growth.
Thank you, I genuinely hope this helps.
Electromagnetic waves can carry more data at higher frequencies. Why would a scientist opt to transmit data at a lower frequency instead?
What are the limitations of sending information using electromagnetic waves?
Answer:
this is the reason why scientists opt to transmit data at lower frequency instead of electromagnetic even it can carry more data at a higher frequencies is because using higher frequencies of electromagnetic spectrum travel shorter distances but have higher data carrying capacity.So this physical characteristic of electromagnetic waves limits the range and availability of frequencies for sending information.
Explanation:
Communication refers to the process of conducting and obtaining information in the form of signals. The electromagnetic waves are used by the high technology communications systems, and there are different kinds of electromagnetic waves, which are utilized like microwaves, infrared, radio waves, and others.
However, there are some of the limitations with the applications of electromagnetic waves:
1. Due to a confined number of broadcast frequencies, the application of transmitters must be restricted in a certain manner or they will lead to interference.
2. The physical features like buildings and mountains can interfere or prevent certain transmissions.
3. In the air, the signals can be misleaded due to atmospheric conditions and the signals from the space are at certain occasions get distorted by solar activity.
Kindly help me with the number 2 answer
The number of moles of nitrogen, N in 65 moles of Pb(NO₃)₄ is 260 moles
How do I determine the number of mole of N?We'll begin by obtaining the number of mole of N in one mole of Pb(NO₃)₄. Details below:
From the formula of Pb(NO₃)₄, we can see that there are 4 moles of N in 1 mole of Pb(NO₃)₄
With the above information, we can determine the number of mole of N in 65 moles of Pb(NO₃)₄. This is illustrated below:
1 mole of Pb(NO₃)₄ contains 4 moles of N
Therefore,
65 mole of Pb(NO₃)₄ will contain = (65 moles × 4 moles) / 1 mole = 260 moles of N
Thus, we can conclude from the above calculation that the number of mole of N is 260 moles
Learn more about mole:
https://brainly.com/question/13314627
#SPJ1
Magnesium parts are typically attached using
Magnesium parts are typically attached using mechanical fasteners.
What are mechanical fasteners?A tool used to mechanically attach (or fasten) two or more things together is known as a mechanical fastener. Although there are many distinct kinds of mechanical fasteners, they can generally be split into two groups: permanent and non-permanent fastening.
There are many different kinds of mechanical fasteners, such as screws, nails, nuts, bolts, washers, anchors, and rivets.
Since World War II, magnesium sheet has been utilized in the transportation sector as a structural material.
For the purpose of attaching magnesium components to various metal substrates, upset protrusion joining was created. Cast and wrought alloys are the two primary divisions of magnesium alloys. Cast alloys made of magnesium are the most common use. Many industries use parts and components made of magnesium and magnesium alloys.
Read more on magnesium here:https://brainly.com/question/25860912
#SPJ1
how does ease of ion pair formation depend on concentration.
The air pressure inside a balloon is 0.78 atm. What is this
pressure in mmHg?
mmHg
Your answer should be rounded to 2 significant figures. Do not include units in
Answer:
The pressure in mmHg is 59.
Explanation:
Given data:
Pressure of air inside balloon = 0.78 atm
Pressure in mmHg = ?
Solution:
mmHg:
mmHg is referred as manometric unit of pressure. It is define as the pressure exerted by mercury column at height of one millimeter.
Symbol:
"mmHg"
Atmosphere (atm)
atm is unit of pressure. It is used as a standard unit. It is equal to the 101325 Pa.
1 atm = 760 mmHg
Inorder to convert the atm into mmHg we will multiply the given atm value with 760.
0.78 atm × 760 mmHg / 1 atm = 592.8 mmHg
59 mmHg or 59
The previous part could be done without using the decay equation, because the ratio of original 14C14C to present 14C14C was an integer power of 1/2. Most problems are not so simple. To solve more general carbon-dating problems, you must first find the value of the decay constant for 14C14C, so that you can easily use the decay equation. Using the given half-life, 5730 yearsyears, find the value of the decay constant for 14C14C. Express your answer in inverse years to three significant figures. View Available Hint(s)
Answer: The decay constant for C14 is \(0.000121years^{-1}\)
Explanation:
Expression for rate law for first order kinetics is given by:
\(t=\frac{2.303}{k}\log\frac{a}{a-x}\)
where,
k = rate constant
t = age of sample
a = let initial amount of the reactant
a - x = amount left after decay process
for completion of half life:
Half life is the amount of time taken by a radioactive material to decay to half of its original value.
\(t_{\frac{1}{2}}=\frac{0.693}{k}\)
\(k=\frac{0.693}{5730years}=0.000121years^{-1}\)
The decay constant for C14 is \(0.000121years^{-1}\)
which is an example of a colloid? a mixture that settles out, a mixture that scatters light, a mixture that is separated by filtration, or a salt and water mixture?
These substances have dispersed particles that are large enough to scatter light, making the beam visible. Therefore, out of the options provided, a mixture that scatters light is an example of a colloid. Option B)
A colloid is a type of mixture in which particles are dispersed throughout a medium, creating a homogeneous appearance. Unlike solutions, where the particles are completely dissolved, and suspensions, where the particles settle out, colloids have particles that are larger than those in solutions but smaller than those in suspensions. One characteristic of colloids is that they can scatter light due to the size of the particles. This scattering of light is known as the Tyndall effect. Examples of colloids include milk, fog, and aerosol sprays. These substances have dispersed particles that are large enough to scatter light, making the beam visible. Therefore, out of the options provided, a mixture that scatters light is an example of a colloid. Therefore option B) is correct
For more question on mixture
https://brainly.com/question/24647756
#SPJ8
Note Complete Question
which is an example of a colloid?
a mixture that settles out,
b mixture that scatters light,
c mixture that is separated by filtration,
d salt and water mixture?
Write the solubility product expressions for the following compounds.
(a) Ag2CO3
(b) Hg2Cl2
(a) The solubility product expression for Ag2CO3 is:
Ksp = [Ag+]^2[CO3^2-]
(b) The solubility product expression for Hg2Cl2 is:
Ksp = [Hg2^2+][Cl^-]^2
Pretty easy question if you know science. 20 Points
A piece of nickel at 25 °C is dropped into a glass of water at 25 °C. Which statement is correct?
Heat will flow from the nickel to the water in the glass.
Heat will flow from the water in the glass to the nickel.
There will be no transfer of heat from the nickel to the water in the glass.
The final temperature of water and nickel will be 0 °C.
Answer:
C.
Explanation:
because the heat From the nickel and the heat from the water are the same.
As a piece of nickel at 25 °C is dropped into a glass of water at 25 °C, there will be no transfer of heat from the nickel to the water in the glass.
To answer the question, we need to know what heat transfer is.
What is heat transfer?This is the flow of heat energy from one body to another over a temperature gradient.
Heat transfer between Nickel at 25 °C and water at 25 °C.
Since a piece of nickel at 25 °C is dropped into a glass of water at 25 °C, there is no temperature gradient, since, both bodies are at the same temperature. Thus, no heat is transferred from the nickel to the water.
So, as a piece of nickel at 25 °C is dropped into a glass of water at 25 °C, there will be no transfer of heat from the nickel to the water in the glass.
Learn more about heat transfer here:
https://brainly.com/question/20493362
A substance that consists of two are more substances that are physically combined
Answer:
mixture
Explanation:
a mixture is a physical combination of two or more substances where there is no chemical reaction
Select the correct structure that
corresponds to the name.
1,1,1-trifluoroethane
The correct chemical structure that corresponds to 1,1,1-trifluoroethane is (a).
What is 1,1,1-trifluoroethane?
A chemical structure is a spatial arrangement of atoms in a molecule. It determines the molecular geometry and when necessary the electronic chemistry as well .1,1,1-Trifluoroethane or simply known as trifluoroethane is Hydrofluorocarbon (HFC) compound that is colourless and highly inflammable gas with ether like odour. One method of preparation of 1,1,1-Trifluoroethane is by fluorination of 1-chloro-1,1-difluoroethane in the presence of hydrofluoric acid. The chemical formula for 1,1,1-Trifluoroethane is \(C__{2} } H_{3} F_{3}\). The high stability of it's chemical structure because of being heavier than air makes it a greenhouse gas with high infrared absorbent power. It can be used as a propellant or refrigerant and in cleaning of electrical equipments.
Learn more about 1,1,1-trifluoroethane here:
https://brainly.com/question/1390779
#SPJ1
how many moles of h2 can be made from the complete reaction of 3.5 moles of al?
Given: 2Al+6HCL 2Alcl3+3h2
Answer:
From the given equation, we can see that for every 2 moles of Al, we get 3 moles of H2
So, we can say the the number of moles of H2 is 3/2 times the number of moles of Al
We are given the number of moles of Al and we have to find the number of moles of H2
We have deduced the relationship:
Moles of Al * 3 / 2 = Moles of H2
Replacing the variables with given values
3.5 * 3 / 2 = Moles of H2
Moles of H2 = 5.25 moles
Jade wants to measure the thickness of a copper wire. She wound the copper wire 30 times around a pencil and used a ruler to measure the length of the wound wire as shown in the figure.
Section of ruler is shown next to a pencil with a wire wound around it. The markings on the ruler are from zero to two centimeters. There are two small markings, one is between zero and one and the other is between one and two. The length of the entire wound wire starts at zero and goes to the small marking which is exactly between one and two.
Which of these is the most accurate thickness of the copper wire? (1 point)
0.001 cm
0.005 cm
0.01 cm
0.05 cm
Answer: 0.05
Explanation:Divide the length (1.5 cm) by the number of turns (30)
The direct proportion rule allows you to find that the correct answer for the result of the thickness of the copper wire is:
0.05 cm
Copper is a strong material with which the cross section is constant, therefore the copper wire has a constant thickness, which is why when making a full turn it advances the same amount
When Jade wound thirty times (n = 30) it has the same diameter each time, therefore with a direct rule of proportions we can find the thickness of the wire.
If in 30 laps we have 1.5 cm, in one lap we have?
\(x= 1 turn ( \frac{1.5 cm}{30 turn} )\)
x = 0.05 cm
In conclusion using a direct rule of proportions we can that the correct answer for the result of the thickness of the copper wire is:
0.05 cm
Learn more here: brainly.com/question/23530320
what is the answer to this question