A triangular prism has a height of 5.9 meters and volume 86.376 cubic meters. What is the area of the base of the prism?

Answers

Answer 1

Answer: 14.64m^2

Step-by-step explanation:

Base area = volume/height

Substitute:

86.376/5.9 = 14.64cm^2

Hope that helps!


Related Questions

why is the null hypothesis always a statement of equality

Answers

The null hypothesis is formulated as a statement of equality to represent the assumption of no effect, no difference, or no relationship between variables in hypothesis testing.

The null hypothesis is typically formulated as a statement of equality because it represents the assumption or claim of no effect, no difference, or no relationship between variables in the context of statistical hypothesis testing.

When conducting hypothesis tests, we start with the assumption that there is no significant difference or relationship between variables, and any observed differences or relationships are merely due to random chance or sampling variability. The null hypothesis serves as a benchmark or reference point against which we compare the observed data.

Formulating the null hypothesis as a statement of equality allows for a clear and specific claim to be tested statistically. It sets the baseline or default position that is assumed to be true unless there is sufficient evidence to reject it in favor of an alternative hypothesis.

For example, in a study comparing the mean scores of two groups, the null hypothesis might state that the population means are equal (μ1 = μ2). This implies that any observed difference in sample means is due to chance, rather than a true difference in the population means.

By specifying the null hypothesis as a statement of equality, statistical tests provide a framework to assess the likelihood of observing the obtained data under the assumption of no effect or no difference, allowing us to make inference and draw conclusions about the population parameters based on the evidence from the sample.

To know more about null hypothesis, refer here:

https://brainly.com/question/29892401

#SPJ4

A Simple Maximization Problem

Consider the following linear programming problem
a. List all the extreme points of the feasible region. b. Find the optimal solution and the objective function value.
c. List the values of all the slack variables.
a. (0,0),(5,0),(3.75,3.75),(3.5,4.5),(0,8); b. x=3.5,y=4.5,OFV=59.5;c.s1=0,s2=2,s3=0
a. (0,0),(5,0),(3.5,4.5),(0,8); b. x=3.5,y=4.5,OFV=59.5;c.s1=0,s2=2,s3=0.
a. (0,0),(5,0),(3.75,3.75),(6,4),(0,8); b. x=6,y=4,OFV=76;c1.s1=5,s2=0,s3=2.
a. (0,0),(5,0),(8,0),(3.5,4.5),(0,8); b. x=8,y=0,OFV=64;c.s1=45,s2=20,s3=0.
a. (0,0),(5,0),(3.75,3.75),(4,6),(0,8); b. x=4,y=6, OFV =74;c1.s1=0,s2=0, s3=2.
a. (0,0),(5,0),(8,0),(3.5,4.5),(0,8),(0,10); b. x=0,y=10,OFV=70;c.s1=25,s2=0,s3=2
a. (0,0),(3,0),(3.75,3.75),(3,5),(0,4); b. x=3,y=5, OFV =59;c1.s1=5,s2=0,s3=0
a. (0,0),(5,0),(3.75, 3.75),(3.5),(0,8); b. x=3, y=5, OFV=59; c1.s1=5, s2=0, s3=0

Answers

a. (0,0), (5,0), (3.75, 3.75), (3.5,4.5), (0,8);

b. x = 3.5, y = 4.5, OFV = 59.5;

c. s1 = 0, s2 = 2, s3 = 0.

a. The extreme points of the feasible region are the vertices of the polygon formed by the intersection of the constraint lines. In this case, the extreme points are (0,0), (5,0), (3.75, 3.75), (3.5,4.5), and (0,8).

b. To find the optimal solution and the objective function value, we evaluate the objective function at each extreme point and choose the point that maximizes the objective function. In this case, the point (3.5, 4.5) maximizes the objective function with a value of 59.5. Therefore, the optimal solution is x = 3.5 and y = 4.5, and the objective function value is 59.5.

c. The slack variables represent the surplus or slack in each constraint. We calculate the slack variables by subtracting the actual value of the left-hand side of each constraint from the right-hand side. In this case, the values of the slack variables are s1 = 0 (indicating no slack in the first constraint), s2 = 2 (indicating a surplus of 2 in the second constraint), and s3 = 0 (indicating no slack in the third constraint).

Therefore, the correct option is:

a. (0,0), (5,0), (3.75, 3.75), (3.5,4.5), (0,8);

b. x = 3.5, y = 4.5, OFV = 59.5;

c. s1 = 0, s2 = 2, s3 = 0.

Learn more about polygon from

https://brainly.com/question/26583264

#SPJ11

Select the correct answer.
What are the possible values of x in 6x2 + 432 = 0?

Select the correct answer.What are the possible values of x in 6x2 + 432 = 0?

Answers

Answer:

D.

Step-by-step explanation:

Select the correct answer.What are the possible values of x in 6x2 + 432 = 0?

the car is 470 cm long.the school bus is 310 cm longer than the car.the school bus is 590 cm longer than the motorbike. how much cm is the motorbike?

Answers

Answer:

  190 cm

Step-by-step explanation:

If m represents the length of the motorbike, then we have ...

  car + (added length1 of bus) = motorbike + (added length2 of bus)

  470 cm + 310 cm = m + 590 cm

  m = (470 +310 -590) cm = 190 cm

The motorbike is 190 cm long.



is this table a function?

is this table a function?

Answers

Answer: No, it is not a function

We have x = 81 repeat itself. Any time x repeats, it means we don't have a function.

Put another way, the input x = 81 leads to more than one y output. A function is only possible if any given input leads to exactly one output. The input must be in the domain.

No
You can’t have two different numbers on the same x point. 81 is not able to be a negative 9 and a positive in the same graph

is 15 square rooted rational​

Answers

Answer: The square root of 15 is a rational number

explanation: if 15 is a perfect square. ... Since 15 is not a perfect square, it is an irrational number. This means that the answer to the square root of 15 will have an infinite number of decimals. The decimals will not terminate and you cannot make it into an exact fraction.

One side of a square is 3x + 2. Which expression represents the perimeter?
_____________________________

(A) 2(3x+2)

(B) (3x+2)²

(C) 4(3x+2)

Answers

Answer:

C.  4(3x+2)

Step-by-step explanation:

Each side of a square is equal to each other, so the perimeter would be 4*(3x+2).

4(x-5)<16

helppp i’m really bad at math

Answers

Answer:

x < 9

Step-by-step explanation:

Distribute 4

4x -20 < 16

add 20 to both sides

4x<36

divide by 4

x<9

Bella is watching a baseball game. So far, 4 out of 22 batters have gotten a hit. What is the experimental probability that the next batter will get a hit?

Answers

The required experimental probability that the next batter will get a hit is 2/11.

What is Probability?

A number that indicates how likely an event is to occur is called its probability. It is communicated as a number in the reach from 0 and 1, or, utilizing rate documentation, in the reach from 0% to 100 percent. The higher the probability, the more likely the event is to occur.

According to question:

The experimental probability of an event happening is defined as the number of times the event occurs divided by the total number of trials or events.

In this case, we are given that 4 out of 22 batters have gotten a hit so far. Therefore, the experimental probability that the next batter will get a hit is:

P(hit) = Number of hits / Total number of batters

P(hit) = 4/22

Simplifying:

P(hit) = 2/11

Therefore, the experimental probability that the next batter will get a hit is 2/11.

To know more about Probability visit:

brainly.com/question/15124899

#SPJ1

according to a survey, the average american person watches tv for 3 hours per week. to test if the amount of tv in new york city is less than the national average, a researcher decides to do a hypothesis test, at a 1% significance level. she surveys 19 new yorkers randomly and asks them about their amount of tv each week, on average. from the data, the sample mean time is 2.5 hours per week, and the sample standard deviation (s) is 0.9 hours. h0: μ≥3; ha: μ<3. α

Answers

The researcher wants to test if the average amount of TV watched in New York City is less than the national average of 3 hours per week. To do this, they will conduct a hypothesis test at a 1% significance level. Null Hypothesis (H0) .


Alternative Hypothesis (Ha): The alternative hypothesis states that the average amount of TV watched in New York City is less than the national average of 3 hours per week. In symbols, Ha: μ < 3. Significance Level (α): The significance level, denoted by α, determines the threshold for rejecting the null hypothesis. In this case, the researcher has chosen a 1% significance level, which means they are willing to accept a 1% chance of making a Type I error (rejecting the null hypothesis when it is true). Sample Data: The researcher surveys 19 New Yorkers randomly and asks them about their average amount of TV watched per week. From the data, the sample mean time is found to be 2.5 hours per week, and the sample standard deviation (s) is 0.9 hours.

To conduct the hypothesis test, the researcher can use the t-test since the population standard deviation is unknown. The researcher can then compare the calculated t-value with the critical t-value at the given significance level and degrees of freedom (n-1). If the calculated t-value falls in the rejection region, the null hypothesis is rejected in favor of the alternative hypothesis. In this case, the researcher would calculate the t-value using the sample mean (2.5 hours), the population mean (3 hours), the sample standard deviation (0.9 hours), and the sample size (19). Remember, hypothesis tests help researchers make conclusions about populations based on sample data. The chosen significance level determines the risk of making a Type I error.

To know more about average amount visit :

https://brainly.com/question/12763762

#SPJ11

The scatter plot below shows nine points from a data set. 12.0 10.8 9.6 8.4 7.2 6.0 4.8 3.6 2.4 1.2 ● 0 1 2 3 4 5 6 7 8 9 10
A 4,4,5,5,6,6
b 4,10,4,11,4,12
C8,9,8,10,8,11
D10,10,10,11,10,12​

Answers

Answer:

Therefore, based on the given scatter plot, the set of numbers that matches the points is C. 8,9,8,10,8,11.

Step-by-step explanation:

The scatter plot shown represents a set of nine points on a coordinate plane. Each point consists of an x-coordinate and a y-coordinate. To determine which set of numbers corresponds to the scatter plot, we need to analyze the pattern in the given points.

Looking at the scatter plot, we observe that the x-coordinates range from 0 to 10 with an increment of 1, while the y-coordinates seem to vary.

Now let's examine the given answer choices:

A. .4,4,5,5,6,6

B. .4,10,4,11,4,12

C. 8,9,8,10,8,11

D. 10,10,10,11,10,12

Set C (8,9,8,10,8,11) among these answer choices matches the pattern observed in the scatter plot. The x-coordinates in the scatter plot range from 0 to 10, and the y-coordinates correspond to the numbers provided in set C.

Therefore, based on the given scatter plot, the set of numbers that matches the points is C.

For more questions on this topic refer to this link:
https://brainly.com/question/6592115
#SPJ8

3x+6 and 2x+14 find value of x

Answers

Answer:

Step-by-step explanation:

3x+2x is 5x

6+14 is 20

5x+20  

if you are looking for this answer

x=4

divide 5 by 5x and 20 by 5

At a town fair, for one of the game booths contestants pick a single card from a standard deck, and payouts are based on the cards chosen. Find the probability of your card, there are no replacements a 2 or an ace

Answers

Answer:

0.1538

Explanation:

An standard deck has 52 cards. From the 52 cards there are four 2 and four aces. So there are 8 cards that are a 2 or an ace. Then, the probability will be equal to:

P = 8/52 = 0.1538

So, the answer is 0.1538

Simon has
160 meters of fencing to build a rectangular garden.
The garden's area (in square meters) as a function of the garden's width
x (in meters) is modeled by y=-x(x-80) what is the maximum area possible

Answers

The maximum area possible is 1600 square meters.

To find the maximum area possible, we need to find the vertex of the parabola represented by the function:

y=-x(x-80)


To find the x-coordinate of the vertex.

we use the formula:

x=-b/2a

where,

a = coefficient of the x-squared term (-1 in this case)  

b = coefficient of the x term (-80 in this case).

x=-b/2a= -(-80)/(2*(-1)) = 40

So the width of the garden that will result in the maximum area is 40 meters.

To find the maximum area, we substitute x=40 into the function:

y=-x(x-80):

y=-(40)(40-80)=-(40)(-40)=1600

Therefore, the maximum area possible is 1600 square meters.

know more about parabola here:

https://brainly.com/question/29211188

#SPJ11

Topic 16-1 number 13.Draw and label parallel lines XY and RS.Then draw and label TS so it is perpendicular to both XY and RS.Draw point Z on TS.
Envision Math 4th grade

Answers

Parallel lines are lines which are equidistant to each other long every point on both lines.

What is a perpendicular line?

A line is said to be perpendicular if it crosses another line at exactly 90°. Hence, as depicted in the image attached, TZ is perpendicular to RS.

It is important to note that perpendicular lines always bisect one another and that the slopes of lines that are perpendicular are negative of each other and reciprocals.

Learn more about parallel lines at:
https://brainly.com/question/7098341
#SPJ1

The sides of a right triangle are 6, 8, and 10.
Find the altitude drawn to the hypotenuse.
(A) 2.4
(B) 4.8
(C) 3.4
(D) 3.5
(E) 4.2

Answers

The answer is 4.8
First find area by taking base 8 = and height = 6 which is equal to 24
Then find area by taking base = 10 and height = altitude, place it equal to 24 by transposing value of altitude will come equal to 4.8

7/18 divided by 5/6. For a practice buddy

Answers

Answer:

0.46666666666

Step-by-step explanation:

i tried

Can anyone help me with my homework

Can anyone help me with my homework

Answers

Step-by-step explanation:

for the table on the left (Q5)

y(-1) = -5

y(1) = -1

y(3) = 3

for the table on the left (Q7)

y(0) = 5

y(1) = 2

y(2) = -1

y(3) = -4

Write 2/8 in simplified form

Answers

Answer:

1/4

Step-by-step explanation:

because you basically divided by two on

Answer:

1/4 is the answer mark me brainliest

pls answer asap! NO WRONG ANSWERS PLS

pls answer asap! NO WRONG ANSWERS PLS
pls answer asap! NO WRONG ANSWERS PLS

Answers

Answer:

y int (0, -45) x int (-10, 0)

Answer:

Step-by-step explanation:

When x = 0, y = -45, so the vertical intercept is (0, -45).

When y = 0, x = -10, so the horizontal intercept is (-10, 0).

David makes 17 dollars in an hour and works 25 hours a week.linda makes 25 dollars a hour abd works 7 hours each week. How much do they both make together

Answers

Step-by-step explanation:

David makes 17(25)

and

Linda maked 25(7)

so it would make the equation 17(25)+25(7)

425+175 together they would be making

600 dollars a week

-(3-10y) simplify expression pls

Answers

Answer:

-3+10y

Step-by-step explanation:

Distribute the Negative.

Answer:

-3 + 10y

Step-by-step explanation:

Apply the distributive property. Think of the negative outside the parentheses as -1. Multiply each term inside the parentheses by -1. What that does is change each sign inside the parentheses.

-(3 - 10y) = -1 * (3 - 10y) = -1 * 3 - 1 * (-10y) = -3 + 10y

simple random sampling uses a sample of size from a population of size to obtain data that can be used to make inferences about the characteristics of a population. suppose that, from a population of bank accounts, we want to take a random sample of six accounts in order to learn about the population. how many different random samples of six accounts are possible?

Answers

Number of different random samples of six accounts that can be taken from the population is (N × (N-1) × (N-2) × (N-3) × (N-4) × (N-5)) / 720

The number of different random samples of six accounts that can be taken from a population of size N

N choose k = N! / (k!(N-k)!)

where N is the population size, k is the sample size

we have N bank accounts and want to take a sample of size k = 6.

the number of different random samples of six accounts that can be taken from the population

= N! / (k!(N-k)!)

= N! / (6!(N-6)!)

= (N × (N-1) × (N-2) × (N-3) × (N-4) × (N-5)) / 720

Therefore, the number of random samples is (N × (N-1) × (N-2) × (N-3) × (N-4) × (N-5)) / 720

Learn more about random sample here

brainly.com/question/29852583

#SPJ4

Suppose you draw one card, put it back (and re-shuffle), and then draw another. What is the probability that the cards are of different suits

Answers

The probability that the two cards drawn are of different suits is approximately 0.3744 or 37.44%.

The probability that the first card drawn is of a particular suit (say hearts) is 13/52, because there are 13 hearts in the deck. The probability that the second card drawn is of a different suit (say diamonds) is 39/52, because there are 13 cards in each of the three remaining suits.

So, the probability that the first card is a heart and the second card is a diamond is (13/52) × (39/52) = 507/2704.

Similarly, the probability that the first card is a diamond and the second card is a heart is also (13/52) × (39/52) = 507/2704.

The probability that the two cards are of different suits is the sum of these two probabilities:

(507/2704) + (507/2704) = 1014/2704 ≈ 0.3744

for such more question on probability

https://brainly.com/question/13604758

#SPJ11

Question

Assuming you are drawing from a standard deck of 52 cards with 13 cards in each of the 4 suits (hearts, diamonds, clubs, and spades), the probability that the two cards drawn are of different suits can be calculated as follows:

The table shows a function. Is the function linear or nonlinear?​

The table shows a function. Is the function linear or nonlinear?

Answers

Answer:

nonlinear

Step-by-step explanation:

Hey There!

A linear function would have a straight line when graphed meaning that it would have a constant slope

This is a nonlinear function because y is not moving at a constant rate with x

16-8=8

8-2=6

It went down 8 then it went down 6

therefore it is a nonlinear function

Important Please Help!!!!

Important Please Help!!!!

Answers

Answer:

C.

Step-by-step explanation:

The statement is flipped, and saying different sayings.

Answer:

If n + 4 is odd,  then n is odd.

Step-by-step explanation:

Contrapositive statements negate the original statement and interchanges(flips) it.

So the negated statement would be ' If n is odd, then n + 4 is  odd'.

Then we interchange that statement so  ' If n is odd, then n + 4 is odd' becomes, ' if n + 4 is odd,  then n is odd.'

Can you please help me with this question?

Eliza made a scale drawing of her parents’ convenience store. The scale she used was 1 mm: 6 m. The convenience store’s freezer section is 24 meters in real life. How long is the freezer section in the drawing? (be sure to label your answer)

Answers

Answer:

To find out the length of the freezer section in the drawing, we need to use the scale factor of the drawing, which is 1 mm: 6 m.

First, we can set up a proportion to relate the real length of the freezer section to its length in the drawing:

1 mm / 6 m = x mm / 24 m

Here, x represents the length of the freezer section in the drawing that we're trying to find.

To solve for x, we can cross-multiply and simplify:

6 m * x mm = 1 mm * 24 m

x = (1 mm * 24 m) / 6 m

x = 4 mm

Therefore, the length of the freezer section in the drawing is 4 mm.

Suppose a triangle has two sides of length 3 and 4 and that the angle
between these two sides is 60°. What is the length of the third side of the
triangle?
A. 5
B. 113
C. 413
D. 3
SUBMIT

Answers

The answer to this question is 413

Help! Will give the brainiest to the right answer!
Algebra!

Help! Will give the brainiest to the right answer!Algebra!

Answers

Step-by-step explanation:

f(g(-2))

= f[(-2)² + 2]

= f(6)

= -0.5(6)² + 5(6)

= 12.

Select the correct answer.
Simplify the following expression.



A.

B.

C.

D.

I attached the screenshot.

Select the correct answer.Simplify the following expression.A. B. C. D. I attached the screenshot.

Answers

Answer:

B. \( 11^2 \)

Step-by-step explanation:

\( \frac{ {11}^{6} }{ {11}^{4} } = {11}^{6 - 4} = {11}^{2} \\ \)

The simplified form of the given expression is \(\frac{11^{6} }{11^4}\) will be \(11^2\).

What are exponents?

The exponents of a number are defined as the representation of a number that shows how many times a number is multiplied by itself.

The given expression is

\(\frac{11^{6} }{11^4}\)

Therefore, the exponent will subtract,

= \(11 ^{6-4}\)

= \(11^2\)

Thus, the simplified form will be \(11^2\).

Learn more about exponent ;

https://brainly.com/question/5497425

Other Questions
when a typical restriction enzyme cuts a dna molecule, the cuts are staggered so that the dna fragments have single-stranded ends. this is important in recombinant dna work because . Which one of the following compounds is a non-electrolyte when dissolved in water?Cu(NO3)2CaCl2HClNaCH3CO2CCl4 why is it more common to report the standard deviation for grouped data rather than variance for grouped data? Determine the length of side QR in the following triangle After leaving on my headlights all night, my automotive battery from problem 1 is drained of all its energy. I plan to recharge the battery by connecting it to a battery charger powered by the 120 VAC power outlet in my garage. The battery charger is essentially a 120 VAC to 12 VDC power supply. The charger is 90% efficient at converting AC power into DC power. In other words, 90% of the 120 VAC power that goes into the charger shows up as 12 VDC power. The other 10% of the power that comes in is converted to heat within the charger. If I want to warm my garage, this heat is useful, otherwise it is considered a waste product. Batteries are not 100% efficient. In other words, not all of the energy you put into them during charging can be extracted during discharging. This is because the battery generates heat, and also undergoes some chemical reactions that consume energy. Assume to fully charge the battery of problem 1 you will need the charger to put in 120% of the energy that was extracted during discharging (actual lead acid batteries are probably less efficient than this). Assuming you pay the average rate for residential electrical power in the USA (you will need to look this up, or if you wish, you can use the rate that showed up on the last utility bill you paid). Required:How much will it cost to recharge your battery? Which of the following will most likely increase the demand for a particular good?a. a decrease in incomeb. a decrease in the number of consumers purchasing substitute productsc. a fall in the price of substitute goodsd. an increase in time required to purchase complimentary goodse. a decrease in the price of complementary goods Please explain on how to solve for the second answer. choose an adjective to describe della and jim (use text evidence)-the gift of the magi by o. henryOne dollar and eightyseven cents. That was all. Three times Della counted it. And the next day would be Christmas. There was clearly nothing to do but flop down on the shabby little couch and howl. So Della did it. While the mistress of the home is gradually subsiding from sobs to sniffles, take a look at the home. A furnished flat at $8 per week. There was a card bearing the name Mr. James Dillingham Young.Della finished her cry and attended to her cheeks with the powder rag. Tomorrow would be Christmas Day, and she had only $1.87 to buy a present for Jim. Her Jim. Many a happy hour she had spent planning for something fine and rare for him. Now, there were two possessions of the James Dillingham Youngs in which they both took a mighty pride. One was Jims gold watch that had been his fathers and his grandfathers. The other was Dellas hair. So now Dellas beautiful hair fell about her rippling and shining like a cascade of brown waters. It reached below her knee and made itself almost a garment for her. then she put it back up .On went her old brown jacket; on went her old brown hat. With a whirl of skirts she fluttered out the door and down the stairs to the street. Where she stopped the sign read: Mne. Sofronie. Hair Goods of All Kinds. One flight up Della ran.Madame, Will you buy my hair? asked Della. She took off her hat and down rippled the brown cascade.Let me see, said Madame, lifting the mass with a practised hand. Hmm. Twenty dollars.Della took the money quick. Oh, and the next two hours tripped by on rosy wings. She was ransacking the stores for Jims present.She found it at last. It was a platinum fob chain simple and chaste in design. As soon as she saw it she knew that it must be Jims. It was like him. Quietness and value the description applied to both.After that, when he came home he was shocked at her hair being gone so she was saying things like "im still myself with my hair arent i?" but the reason why he was shook was because he bought her a clip for her hair that she had always wanted....the end What's the verb in we should order a pizza The narrators reaction to his prison and torture the is like the strict parent part of our personality, often judging what the is doing. the tries to balance or mediate the dynamic between id and superego. group of answer choices When goods are to be picked up by a non-merchant at the place of sale of a merchant, risk of loss passes:1)when the goods reach the buyer's destination.2)when the seller tenders the goods.3)when the goods are delivered to a common carrier.4)when the buyer takes physical possession of the goods.In a shipment contract, risk of loss passes from seller to buyer when:1)the seller tenders the goods.2)the goods are delivered to the destination.3)the goods are delivered to the carrier.4)the buyer takes physical possession of the goods. #3: consider the following strand of template DNA: 3' ATGCCAA 5' In which direction will DNA polymerase move when replicating this segment?a. left to right b. right to left. c. both directions#4: Again considering the DNA segment in question 3, the complementary segment of DNA that is synthesized by DNA polymerase will be:a. 5' ATGCCAA 3'b. 3' ATGCCAA 5'c. 5' TACGGTT 3'd. 3' TACGGTT 5' Why are elements on the periodic table not arranged by mass? (1 point)O This would not allow all of the elements with similar properties to be lined up with each otheroAtoms with similar masses are so different from each other that this would lead to a random arrangement ofatoms.O Atoms are so small that it would make little sense to talk about their massSimilar elements have such different masses that this would lead to a completely random arrangement ofelements Can someone please help me with this Ill give brainliest _____ is designed to prevent closure of the vessel during and after angioplasty. What primarily drives the formation of citrate from oxaloacetate and acetyl-coa?. maggie had $24 to spend on seven pencils. after buying them, she had $10. how much did each pencil cost? Find the difference between -14w - 3 and 5w. -19w + 3 -9w - 3 -19w - 3 -22w (pls help) A piece of board is 2/3 m long is being cut into smaller pieces that are each 3/10 m long. Which expression could be one of the steps in determining how many of those pieces can be made