After the HCl and NaOH react, Fernando measures the
mass again. Using the mass before the reaction in the
diagram, what is the mass after the reaction?
Remember, It is in a closed system.
A. 5.00 grams
OB. 10.00 grams
O C. 15.00 grams
OD. 20.00 grams

Answers

Answer 1

Answer:c

Explanation:

Answer 2

As the combined mass of the HCl and NaOH is 15 grams before the reaction. Therefore the mass after the reaction will be 15 grams according to the law of conservation of mass. Therefore, option (C) is correct.

What is law of conservation of matter?

Matter can be transformed form via physical changes and chemical changes from one form to another form, during any of these changes, the total mass is conserved. The same quantity of matter exists before and after the chemical or physical as none of the matter is created or destroyed.

The balanced equation between the reaction of HCl and NaOH:

\(HCl +NaOH \longrightarrow H_2O +NaCl\)

According to the law of conservation of mass, the mass of HCl and NaOH will be equal to the mass of the products water and NaCl.

As mentioned in the question the combined mass of HCl and NaOH measured before the reaction is 15 grams. Therefore, the mass of the products in the closed container will be equal to 15 grams as well.

Learn more about law conservation of matter, here:

brainly.com/question/23910777

#SPJ5

Your question was incomplete,  most probably the complete question was,

Fernando places 15 ml of HCl and 50 ml of NaOH in 100 ml of a beaker. He places them on a scale together and measures the combined mass of 15 grams.

After the HCl and NaOH react, Fernando measures the mass again. Using the mass before the reaction, what is the mass after the reaction? Remember, It is in a closed system.

A. 5.00 grams

B. 10.00 grams

C. 15.00 grams

D. 20.00 grams


Related Questions


The element Carbon
has an atomic number
of 6 and an atomic
mass of 12. What are
the number of
subatomic particles
found inside the
nucleus?

Answers

Answer:

An atomic mass of 12 means carbon, and its atomic number is 6.

Explanation:

Which of the following statements does not describe the structure of an atom? (3 points) a Inside the nucleus of an atom are protons and neutrons. b Protons are positively charged sub-atomic particles. c Electrons are negatively charged sub-atomic particles. d Most of the mass of an atom comes from the electron cloud.

Answers

Answer:

D.

Explanation:

The electron cloud has negligible mass. Most mass come from the nucleus.

The lattice energy for MX is -475 kJ/mol and it's heat of hydration is -395 kJ/mol. What is the heat solution for MX

The lattice energy for MX is -475 kJ/mol and it's heat of hydration is -395 kJ/mol. What is the heat

Answers

The quantity of energy released or absorbed when a material is dissolved in a solvent is known as the heat of solution, also known as enthalpy of solution.

In this instance, the lattice energy and the heat of hydration are subtracted from one another to get the heat of solution for MX. MX's heat of hydration is -395 kJ/mol, and its lattice energy is -475 kJ/mol. As a result, MX's heat of solution is -80 kJ/mol. An essential thermodynamic characteristic that may be used to estimate a substance's solubility in a solvent is the heat of solution.

When the solute particles are distributed in the solvent, energy is either released or absorbed. The temperature of the MX solution in this instance is only soluble in water.

Learn more about  heat of hydration at:

https://brainly.com/question/21235543

#SPJ1

The normal boiling point of ethanol is 78.4 oC. Its enthalpy of vaporization is 38.6 kJ/mol. Estimate the vapor pressure of ethanol at 26.3 oC.

Answers

Answer: The vapor pressure of ethanol at \(26.3^{o}C\) is 238.3 torr.

Explanation:

Given: \(\Delta H_{vap}\) = 38.6 kJ/mol

\(T_{1} = 26.3^{o}C = (26.3 + 273) K = 299.3 K\)

\(T_{2} = 78.4^{o}C = (78.4 + 273) K = 351.4 K\)

Formula used to calculate the vapor pressure of ethanol is as follows.

\(ln\frac{P_{2}}{P_{1}} = \frac{\Delta H_{vap}}{R} [\frac{1}{T_{1}} - \frac{1}{T_{2}}]\\\)

Substitute the values into above formula as follows.

\(ln\frac{P_{2}}{P_{1}} = \frac{\Delta H_{vap}}{R} [\frac{1}{T_{1}} - \frac{1}{T_{2}}]\\ \\ln \frac{760 torr}{P_{1}} = \frac{38600 J}{8.314 J/mol K}[\frac{1}{299.3} - \frac{1}{351.4}]\\\frac{760}{P_{1}} = 3.18\\P_{1} = 238.3 torr\)

Thus, we can conclude that the vapor pressure of ethanol at \(26.3^{o}C\) is 238.3 torr.

If the following elements were to form an ionic compound, which noble-gas configuration would they most likely attain?

a. Li
b. Na
c. Br
d. Sr

Answers

Li would attain the noble-gas configuration of helium (1s²), Na would attain the noble-gas configuration of neon (2s²2p⁶), Br would attain the noble-gas configuration of krypton (3s²3p⁶3d¹⁰4s²4p⁶) and Sr would attain the noble-gas configuration of krypton (4s²3d¹⁰4p⁶).

When atoms of certain elements react to form an ionic compound, they tend to lose or gain electrons in order to achieve a stable electronic configuration similar to that of a noble gas.

The noble gases have completely filled outermost electron shells and are thus chemically inert. Therefore, in order to achieve a similar electronic configuration, atoms of other elements tend to gain or lose electrons to either achieve a completely filled outer shell or an empty outer shell.

a. Lithium (Li) has one valence electron and is likely to lose it to attain the stable electron configuration of helium (He).

b. Sodium (Na) has one valence electron and is likely to lose it to attain the stable electron configuration of neon (Ne).

c. Bromine (Br) has seven valence electrons and is likely to gain one electron to attain the stable electron configuration of krypton (Kr).

d. Strontium (Sr) has two valence electrons and is likely to lose them to attain the stable electron configuration of krypton (Kr).

To know more about noble-gas configuration refer to-

https://brainly.com/question/7036466

#SPJ11

One of the most important reactions in the process of extracting the element chromium from chromite is the reaction of chromite with coke.

2C + FeCr2O4 --> FeCr2 + CO2

What mole ratio would you use if you were determining how much C you would need for a complete reaction if you knew how much FeCr2O4 you had available?

Answers

The mole ratio you would use to determine how much C you would need for a complete reaction knowing the amount of FeCr₂O₄ available is 2 moles C : 1 mole of FeCr₂O₄.

One of the most important reactions in the process of extracting the element chromium from chromite is the reaction of chromite with coke. To determine how much C you would need for a complete reaction if you knew how much FeCr₂O₄ you had available, the mole ratio you would use is as follows.

2C + FeCr₂O₄ → FeCr₂ + 2CO₂

Now, look at the balanced equation.

2 moles of C reacts with one mole of FeCr₂O₄ to produce one mole of FeCr₂ and 2 moles of CO₂

i.e 2 moles C : 1 mole of FeCr₂O₄

This is the mole ratio you would use to determine how much C you would need for a complete reaction if you knew how much FeCr₂O₄ you had available.

Learn more about mole ratio here: https://brainly.com/question/30632038

#SPJ11

Question 7
Review
The solubility of KCl(s) in water depends on the
a
pressure on the solution
b.
rate of stirring
size of the KCl sample
d
temperature of the water
Submit Answer
Hide Toolbar

Answers

D =temperature of the water

You forgot to dry the bread knife when you washed it and reddish brown spots appeared on it. is it chemistry or physical change?

Answers

Answer:

Chemical because water + metal = rust.

Explanation:

A new substance was formed.

What important ingredients do you need to create a fertilized egg

Answers

Answer:

In the 1970s, Epel and other researchers showed that calcium is the essential factor that sparks development in eggs. As calcium levels rise, metabolic changes occur that cause the egg to divide and form into an embryo.

Explanation:

the h-n-h bond angles between the nitrogen and the hydrogens in ammonia (nh3) are larger than the h-o-h bond angle in water because the three n to h bonds need more room to spread out as opposed to just the two o to h bonds. the h-n-h bond angles between the nitrogen and the hydrogens in ammonia (nh3) are larger than the h-o-h bond angle in water because the three n to h bonds need more room to spread out as opposed to just the two o to h bonds. true false need more information

Answers

False. The H-N-H bond angles in ammonia (NH₃) are actually smaller than the H-O-H bond angles in water.

In ammonia, the H-N-H bond angle is approximately 107.5°, while the H-O-H bond angle in water is approximately 104.5°. This difference is mainly due to the presence of two lone pairs of electrons on the oxygen atom in water, which repel the O-H bonds, leading to a smaller bond angle compared to ammonia, which has only one lone pair of electrons on the nitrogen atom.

The nitrogen atom possesses a partial charge that is opposite to that of each hydrogen atom, which is partially positive.

The electrons inside ammonia molecules are distributed with uneven charges. The nitrogen atom has a partial negative charge because it is more electronegative than the hydrogen atom and draws electrons to it. In addition to having a partial positive charge, hydrogen is less electronegative than nitrogen. As a result, the nitrogen atom has a partial negative charge, whereas the hydrogen atom has a partly positive charge.

Learn more about ammonia here

https://brainly.com/question/30602612

#SPJ11

The complete question is

Find the statement True or false: The H-N-H bond angles between the nitrogen and the hydrogens in ammonia (NH₃) are larger than the H-O-H bond angle in water because the three N to H bonds need more room to spread out as opposed to just the two o to H bonds.

A scientist placed a sample of lithium into a container of water. The scientist observed the lithium floating and making a buzzing sound as gas bubbles were forming around it. Smoke and steam were released as well. Which conclusion is BEST supported by this observation?

A.
Water was vaporized.

B.
Dissolved gases were released.

C.
A chemical change took place.

D.
The lithium was dissolved by the water.

Answers

Answer:

Explanation:Again, this is an example of a physical change. Figure 3.6. 1: Ice melting is a physical change. When liquid water (H2O) freezes into a solid state (ice), it appears changed; however, this change is only physical, as the composition of the constituent molecules is the same: 11.19% hydrogen and 88.81% oxygen by mass.03-Sept-2019

trace the path of information through your body from a stimulus to a reaction

Answers

Here's a general overview of how information travels through your body from a stimulus to a reaction:

1. Stimulus: A stimulus is any physical or chemical change in the environment that activates a sensory receptor in your body. Examples of stimuli include light, sound, touch, taste, and smell.

2. Sensory receptors: Sensory receptors are specialized cells that detect stimuli and convert them into electrical signals that can be transmitted to the nervous system. Each type of sensory receptor is specialized to respond to a specific type of stimulus.

3. Sensory neurons: Sensory neurons are nerve cells that transmit electrical signals from sensory receptors to the spinal cord or brain. The sensory neurons are part of the peripheral nervous system.

4. Spinal cord or brain: Depending on the type of stimulus and where it occurs in the body, the electrical signals from sensory neurons may travel directly to the spinal cord or to the brain. The spinal cord is the main pathway for signals that don't require conscious awareness, such as reflexes, while the brain processes signals that require conscious perception.

5. Processing: Once the electrical signals reach the spinal cord or brain, they are processed by a network of neurons that interprets the information and generates a response. This processing may involve multiple regions of the brain, depending on the complexity of the stimulus and the required response.

6. Motor neurons: Motor neurons are nerve cells that transmit electrical signals from the brain or spinal cord to muscles or glands. Motor neurons are part of the peripheral nervous system.

7. Response: The electrical signals from motor neurons cause muscles to contract or glands to secrete hormones or other substances, producing a physical response to the stimulus. This response may be immediate, as in the case of a reflex, or it may be delayed, as in the case of a conscious decision to move or speak.

Overall, the path of information from a stimulus to a reaction involves a complex interplay between sensory receptors, sensory neurons, the spinal cord and brain, motor neurons, and muscles or glands. Each step in this process is critical to the overall response to the stimulus, and any disruptions or damage to these systems can result in a range of sensory and motor deficits.

Here are the energy levels in a fantasy hypothetical hydrogen-like atom. (You cannot use the Rydberg constant, 2.18 x 10-18 J, for this problem, therefore). What is the frequency of a photon that is absorbed when an electron goes from level 2 to level 4? Energyn = 4 -2.10 x 10-19 Jn = 3 -3.20 x 10-19 Jn = 2 - 5.20 x 10-19 Jn = 1 - 9.80 x 10-19 J

Answers

Answer:

4.7 x 10^14 Hz

Explanation:

From Bohr's theory, the energy absorbed or emitted (ΔE) by an atom transiting from one energy level to another is given as;

ΔE = E4 - E2

Where;

E4 = energy corresponding to the energy level n=4

E2 = energy corresponding to the level n= 2

ΔE = (-2.10 x 10-19) - ( - 5.20 x 10-19)

ΔE =3.1 x 10-19

But

ΔE = hf

h = Plank's constant

f= frequency of photon absorbed

f = ΔE/h = 3.1 x 10-19/6.6 x 10-34

f = 4.7 x 10^14 Hz

When NaCl (table salt) dissolves in water, the change is endothermic. Yet, when added to water, it
dissolves without added energy (spontaneously) over a wide range of temperatures. How can this
be?

Answers

Hello there, mate!  

This happens because of the fact that endothermic reactions result as a positive ΔH. Then, when the NA-Ci chemical is added to the water, the water's thickness and entropy increases, which causes ∨-salt ions to start forming in the water (ω).

"Which of the following reagents would oxidize Zn to Zn2+, but not Sn to Sn2+?Br2Br-Ca^2+Co^2+CaCo"

Answers

The only reagent that could potentially oxidize Zn to Zn²⁺ without oxidizing Sn to Sn²⁺ is Br₂ (bromine).

To determine which reagent would oxidize Zn to Zn²⁺ but not Sn to Sn²⁺, we need to compare the reduction potentials (E°) of the elements involved. The reagent with a higher reduction potential will have a greater tendency to accept electrons and oxidize the other element.

The reduction potential for Zn²⁺/Zn (Zn²⁺ + 2e⁻ ⇌ Zn) is approximately -0.76 V, while the reduction potential for Sn²⁺/Sn (Sn²⁺ + 2e⁻ ⇌ Sn) is approximately -0.14 V. Since the reduction potential for Zn²⁺/Zn is lower than that of Sn²⁺/Sn, Zn is less easily oxidized compared to Sn.

Now, let's examine the given reagents:

Br₂: Bromine (Br₂) has a higher reduction potential than Zn²⁺/Zn. It could potentially oxidize Zn to Zn²⁺. However, it can also oxidize Sn to Sn²⁺ because its reduction potential is higher than both Zn²⁺/Zn and Sn²⁺/Sn.

Br-: Bromide ion (Br-) has a lower reduction potential than both Zn²⁺/Zn and Sn²⁺/Sn. It would not oxidize either Zn or Sn.

Ca²⁺+: Calcium ion (Ca²⁺) has a lower reduction potential than both Zn²⁺/Zn and Sn2+/Sn. It would not oxidize either Zn or Sn.

Co²⁺: Cobalt(II) ion (Co²⁺) has a lower reduction potential than both Zn²⁺/Zn and Sn²⁺/Sn. It would not oxidize either Zn or Sn.

CaCo: This combination does not represent a known reagent or species and cannot be evaluated in terms of its oxidation potential.

Based on the given options, the only reagent that could potentially oxidize Zn to Zn²⁺ without oxidizing Sn to Sn²⁺ is Br₂ (bromine). However, it's important to note that in practical scenarios, multiple factors can influence redox reactions, so careful experimental considerations may be required to determine the actual outcome.

To know more about reduction potential, refer to the link below:

https://brainly.com/question/31362624#

#SPJ11

can someone help me please

can someone help me please

Answers

Answer:

From left box to right box: Footwall, fault plane, hanging wall

Explanation:

A foot wall is the one holding us the hanging wall so the highest piece. Think of rock climbing. You put your feet on the wall or rocks to push yourself up. The foot wall is the rocks for the hanging wall.

The hanging wall is the part that's "hanging" from the other wall. So the lowest one. Think of it as the part that's hanging.

A fault plane is where the place where the fault happens which would be where there is the difference in elevations originate from. Think of it like the crack in the middle.

Don't be afraid to reach out if you need further help, I hope this helps!

Which statement describes an electrolyte?

Answers

When an electrolyte dissolves in water, the resulting solution conducts an electric current.

How many carbon atoms are there in .500 mol of CO2?

Answers

Answer: There are \(3.011 \times 10^{23}\) atoms present in 0.500 mol of \(CO_{2}\).

Explanation:

According to the mole concept, there are \(6.022 \times 10^{23}\) atoms present in 1 mole of a substance.

In a molecule of \(CO_{2}\) there is only one carbon atom present. Therefore, number of carbon atoms present in 0.500 mol of \(CO_{2}\) are as follows.

\(1 \times 0.500 \times 6.022 \times 10^{23}\\= 3.011 \times 10^{23}\)

Thus, we can conclude that there are \(3.011 \times 10^{23}\) atoms present in 0.500 mol of \(CO_{2}\).

In the formation of SO2 and SO3 the ratio of the weight of oxygen which combines with 10kg of sulphur is ?

Answers

Explanation:

So,0.3125 * 10 ^3 moles of Sulphur combines with 0.3125 * 10^3 moles of Oxygen to from SO2. Therfore mass ratio of SO2 : SO3 = 10 : 15 = 2:3.

The harvesting of peat as an energy source is dangerous for the workers, why?
A)
workers have to work in cold wet conditions
B)
venomous animals live in the bogs where peat is harvested
harvesting peat does not expose workers to any serious danger
D)
serious infections caused by bioaerosols; airborne particles containing
fungi, viruses, and bacteria

Answers

B venomous animals live in the bigs where peat is harvested

if the same amount of heat is added to 50.0 g samples of each of the metals, which are all at the same temperature, which metal will reach the highest temperature?

Answers

The metal which will reach the highest temperature is the metal with the lowest specific heat capacity.

What is the amount of heat added to each metal?

The amount of heat Q = mcΔT where

m = mass of metalc = specific heat capacity of mateal and ΔT = temperature change

Temperature change of the metal

Making ΔT subject of the formula, we have

ΔT = Q/mc

Given that Q and m are the same for each metal,

ΔT ∝ 1/c

We see that the temperature change is inversely proportional to the specific heat capacity.

Since the metals are at the same temperature, the metal which will reach the highest temperature is the metal with the lowest specific heat capacity.

So, the metal which will reach the highest temperature is the metal with the lowest specific heat capacity.

Learn more about temperature here:

https://brainly.com/question/16559442

#SPJ12

in which situations is there a point to the left of the particles where an electron will be in equilibrium? (select all that apply.)

Answers

The situations is there a point to the left of the particles where an electron will be in equilibrium are when the net force is zero, an electron will be in equilibrium.

The net force is calculated using the force components acting on the electron, which is the sum of all the forces. The sum of the forces is zero when the electron is in equilibrium, and there is no acceleration. The point at which the forces acting on an electron are in equilibrium is a point to the left of the particles.When the electron is static, it will be in equilibrium.

An electron in static equilibrium is stationary, and its acceleration is zero, as it does not move. When the net force acting on the electron is zero, the electron will be in static equilibrium. This results in a point to the left of the particles where the electron is in equilibrium.

Learn more about equilibrium at:

https://brainly.com/question/28514442

#SPJ11

What did you know for sure after one Test? Two tests? Three tests?

Answers

Answer:

I knew that I learned something and passed that test. And that is all I want to do.

Explanation:

Answer:

vaiana and I have been working with our team since we been through

The theoretical yield and the percent yield are calculated shown below. Did you perform the calculations correctly?

The theoretical yield and the percent yield are calculated shown below. Did you perform the calculations

Answers

Answer:

\(56 \times { \frac{01514344}{?} }^{2} 5566648443hffii51 \\ \div 232333\)

Answer:

write a letter to the presiding member of your district assessment telling him or her about two of the achievement of your community over the last five years and the plans for the future

What mass of magnesium will react with an excess of hydrochloric acid to produce 500 mL of H2 (g) at STP?

What mass of magnesium will react with an excess of hydrochloric acid to produce 500 mL of H2 (g) at

Answers

0.00486 g of magnesium will react with an excess of hydrochloric acid to produce 500 mL of H2 (g) at STP.

What is ideal gas law?

The ideal gas is the virtual gas that chemists and students dream of because it would be much simpler if there weren't some kind of intermolecular force that would complicate the simple law of the ideal gas. An ideal gas is essentially a point cloud moving with constant random linear motion. Its behavior is described by the assumptions described in the kinetic molecular theory of gases. This ideal gas definition contrasts with the non-ideal gas definition. This is because this equation describes how gases actually behave.

The ideal gas law states that the product of pressure and volume in a gram molecule of an ideal gas is equal to the product of the gas's absolute temperature and the universal gas constant.

PV = nRT

Where, n = number of moles.

P = Pressure (1 atm)

T = Temperature (273 K)

V = Volume (0.5 L)

R = Ideal gas constant (8.314J/K⋅mol)

Now, substitute the values:

1 × 0.5 = n × 8.314 × 273

n = 0.00022 moles

Mg + 2HCl → MgCl₂ + H₂

The mole ratio of Mg and H₂ is 1:1 for the given reaction

Hence the number of moles for Mg will be same as H₂, which is 0.00022 moles.

For the mass of Mg:

m = n × Mm

Where, m = mass

n = number of moles (0.00022 moles)

Mm = molar mass (24.3 g/moles)

m = 0.00486 g

To know more about ideal gas law, visit:

https://brainly.com/question/13821925

#SPJ1

Study the chemical reaction below and answer the questions that follow: 8Al + 3Fe₃O₄ → 4Al₂O₃ + 9Fe How many moles of iron would be produced if 4.0 moles of aluminum reacts with an excess of Fe₃O₄?

A. 4.0 moles
B. 4.5 moles
C. 8.0 moles
D. 9.0 moles

Answers

Answer: the answewr is A. hope this helps!

Explanation:

nswer
Draw and name the following compound
CH3CHCHCH(CH3)CH(CH3)CH2CH2CH3
CECEC-

Answers

CH3CH CH3 ch2ch2ch3 stand for Five carbon atoms make up the longest carbon chain. A methyl group can be found at carbon-3 as well. Thus, 3-methylpentane is its IUPAC designation.

What is CH3CH CH3 CH2CH2CH3's IUPAC name?Butene is the IUPAC designation for CH3CH2CH = CH2.Position isomers CH3CH=CHCH3 and CH3CH2CH=CH3 exist because they share the identical chemical formula (C4H9) and differ only in the location of unsaturation.With 10 sigma and 3 pi bonds, CH2 = CH - C - CH3 is a compound. One sigma bond and one pi bond together form a double bond. One sigma and two pi bonds make up a triple bond.The alkene CH3=CH2=CH3 is known as 2-pentene. The first carbon atom of the double bond is given the lower number at the end of the chain, which is numbered from there.

To Learn more About 3-methylpentane, Refer:

https://brainly.com/question/24163873

#SPJ9

nswerDraw and name the following compoundCH3CHCHCH(CH3)CH(CH3)CH2CH2CH3CECEC-

Consider the following reaction at K.
Which of the following statements are correct?

Consider the following reaction at K.Which of the following statements are correct?

Answers

The described process is the six-electron reduction of Cr3+ ions to solid chromium (Cr) and solid selenium (Se). We can determine the accuracy of the following claims using the information provided:

G > 0: Under normal circumstances, the reaction is not spontaneous because it entails reducing Cr3+ ions to Cr, which requires energy input. G is hence positive.

S > 0: Without extra system knowledge, it is challenging to discern the sign of S. The total change in entropy (S) may, however, be little or even negative because the reaction results in the production of two solid products from two watery reactants.

Since G is positive, the reaction is reactant-favored and not product-favored. The claim that "The reaction is reactant-favored" is thus true.

Since the reaction involves the transfer of six electrons from Cr3+ to Se, the statement "n = 6 mol electrons" is accurate.

G > 0: Since the reaction is not spontaneous under normal circumstances, G is higher than zero.

The appropriate answers are thus:

The reaction is reactant-favored.

n = 6 mol electrons.

Learn more about reaction   at:

https://brainly.com/question/28984750

#SPJ1

calculate the ph for each of the cases in the titration of 50.0 ml of 0.190 m hclo(aq) with 0.190 m koh(aq)

Answers

The ph for each of the cases in the titration of 50.0 ml of 0.190 m hclo(aq) with 0.190 m koh(aq) is 10.1878.

Case 1  when 0.0 mL of KOH is added Ph is 4.0596

Case 2  when 25.0 mL of KOH is added Ph is 7.398

Case 3  when 35.0 mL of KOH is added Ph is 7.766

Case 4  when 50.0 mL of KOH is added Ph is 10.1878

Case 5  when 60.0 mL of KOH is added Ph is 12.2374

Calculation :

1) .when 0.0 mL of KOH is added

HClO dissociates as:

HClO          ----->     H+   +  ClO-

0.19                 0         0

0.19-x               x         x

Ka = [H+][ClO-]/[HClO]

Ka = x*x/(c-x)

Assuming x can be ignored as compared to c

So, above expression becomes

Ka = x*x/(c)

so, x = sqrt (Ka*c)

x = sqrt ((4*10^-8)*0.19) = 8.718*10^-5

since c is much greater than x, our assumption is correct

so, x = 8.718*10^-5 M

use

pH = -log [H+]

= -log (8.718*10^-5)

= 4.0596

2)when 25.0 mL of KOH is added

Given:

M(HClO) = 0.19 M

V(HClO) = 50 mL

M(KOH) = 0.19 M

V(KOH) = 25 mL

mol(HClO) = M(HClO) * V(HClO)

mol(HClO) = 0.19 M * 50 mL = 9.5 mmol

mol(KOH) = M(KOH) * V(KOH)

mol(KOH) = 0.19 M * 25 mL = 4.75 mmol

We have:

mol(HClO) = 9.5 mmol

mol(KOH) = 4.75 mmol

4.75 mmol of both will react

excess HClO remaining = 4.75 mmol

Volume of Solution = 50 + 25 = 75 mL

[HClO] = 4.75 mmol/75 mL = 0.0633M

[ClO-] = 4.75/75 = 0.0633M

They form acidic buffer

acid is HClO

conjugate base is ClO-

Ka = 4*10^-8

pKa = - log (Ka)

= - log(4*10^-8)

= 7.398

use:

pH = pKa + log {[conjugate base]/[acid]}

= 7.398+ log {6.333*10^-2/6.333*10^-2}

= 7.398

3)when 35.0 mL of KOH is added

Given:

M(HClO) = 0.19 M

V(HClO) = 50 mL

M(KOH) = 0.19 M

V(KOH) = 35 mL

mol(HClO) = M(HClO) * V(HClO)

mol(HClO) = 0.19 M * 50 mL = 9.5 mmol

mol(KOH) = M(KOH) * V(KOH)

mol(KOH) = 0.19 M * 35 mL = 6.65 mmol

We have:

mol(HClO) = 9.5 mmol

mol(KOH) = 6.65 mmol

6.65 mmol of both will react

excess HClO remaining = 2.85 mmol

Volume of Solution = 50 + 35 = 85 mL

[HClO] = 2.85 mmol/85 mL = 0.0335M

[ClO-] = 6.65/85 = 0.0782M

They form acidic buffer

acid is HClO

conjugate base is ClO-

a = 4*10^-8

pKa = - log (Ka)

= - log(4*10^-8)= 7.398

use:

pH = pKa + log {[conjugate base]/[acid]}

= 7.398+ log {7.824*10^-2/3.353*10^-2}

= 7.766

4)when 50.0 mL of KOH is added

Given:

M(HClO) = 0.19 M

V(HClO) = 50 mL

M(KOH) = 0.19 M

V(KOH) = 50 mL

mol(HClO) = M(HClO) * V(HClO)

mol(HClO) = 0.19 M * 50 mL = 9.5 mmol

mol(KOH) = M(KOH) * V(KOH)

mol(KOH) = 0.19 M * 50 mL = 9.5 mmol

We have:

mol(HClO) = 9.5 mmol

mol(KOH) = 9.5 mmol

9.5 mmol  of both will react to form ClO- and H2O

ClO- here is strong base

ClO- formed = 9.5 mmol

Volume of Solution = 50 + 50 = 100 mL

Kb of ClO- = Kw/Ka =  1*10^-14/4*10^-8 = 2.5*10^-7

concentration ofClO-,c = 9.5 mmol/100 mL = 0.095M

ClO- dissociates as

ClO-        + H2O   ----->     HClO  +   OH-

0.095                        0         0

0.095-x                      x         x

Kb = [HClO][OH-]/[ClO-]

Kb = x*x/(c-x)

Assuming x can be ignored as compared to c

So, above expression becomes

Kb = x*x/(c)

so, x = sqrt (Kb*c)

x = sqrt ((2.5*10^-7)*9.5*10^-2) = 1.541*10^-4

since c is much greater than x, our assumption is correct

so, x = 1.541*10^-4 M

[OH-] = x = 1.541*10^-4 M

use:

pOH = -log [OH-]

= -log (1.541*10^-4)

= 3.8122

use:

PH = 14 - pOH

= 14 - 3.8122

= 10.1878

5)when 60.0 mL of KOH is added

Given:

M(HClO) = 0.19 M

V(HClO) = 50 mL

M(KOH) = 0.19 M

V(KOH) = 60 mL

mol(HClO) = M(HClO) * V(HClO)

mol(HClO) = 0.19 M * 50 mL = 9.5 mmol

mol(KOH) = M(KOH) * V(KOH)

mol(KOH) = 0.19 M * 60 mL = 11.4 mmol

We have:

mol(HClO) = 9.5 mmol

mol(KOH) = 11.4 mmol

9.5 mmol of both will react

excess KOH remaining = 1.9 mmol

Volume of Solution = 50 + 60 = 110 mL

[OH-] = 1.9 mmol/110 mL = 0.0173 M

use:

pOH = -log [OH-]

= -log (1.727*10^-2)

= 1.7626

use:

PH = 14 - pOH

= 14 - 1.7626

= 12.2374

Learn more about titration here : https://brainly.com/question/186765

#SPJ4

does a pi bond have two pairs of electrons true or false

Answers

False

Explanation:

A pi bond is formed by the overlap of two p orbitals that contain one electron each. Therefore, a pi bond consists of a single shared pair of electrons.

A double bond, which includes one sigma bond and one pi bond, would have two shared pairs of electrons.

https://brainly.com/question/14482473#

#SPJ11

Other Questions
What is the equation of the line that passes through the point (-6,-4) and has a slope of 1/3 If you have loaned capital to a firm, then you could be. reaction a starts with a 4 carbon chain where carbon 2 has a hydroxy substituent, and carbon 3 has two methyl substituents. this reacts with h b r in heat to generate the product. 8-5 skills practice using the distributive property page 33 Javier bought a painting for $150$150dollar sign, 150. Each year, the painting's value increases by a factor of 1.151.151, point, 15.Which expression gives the painting's value after 777 years?Choose 1 answer:Choose 1 answer:(Choice A) (1501.15)7(1501.15) 7 left parenthesis, 150, dot, 1, point, 15, right parenthesis, start superscript, 7, end superscriptA(1501.15)7(1501.15) 7 left parenthesis, 150, dot, 1, point, 15, right parenthesis, start superscript, 7, end superscript(Choice B) 1501.1571501.15 7 150, dot, 1, point, 15, start superscript, 7, end superscriptB1501.1571501.15 7 150, dot, 1, point, 15, start superscript, 7, end superscript(Choice C) (150+1.15)7(150+1.15)7left parenthesis, 150, plus, 1, point, 15, right parenthesis, dot, 7C(150+1.15)7(150+1.15)7left parenthesis, 150, plus, 1, point, 15, right parenthesis, dot, 7(Choice D) 150+1.157150+1.157150, plus, 1, point, 15, dot, 7D150+1.157150+1.157 which of the following is not a habit of mind of a good scientist?a. skepticismb. creativityc. intellectual predictability d. openness to new ideas Please help Worth 20 points Show the work Identify the right of employees that is covered under the Taft-Hartley Act.A) the right to nominate candidates for union officeB) the right to participate in union meetings and secret-ballot electionsC) the right to choose whether they join a union or other groupD) the right to examine unions' financial recordsE) the right to physically block nonstriking employees from entering the workplace What evidence supports the inference that internet fads usually last a sort time? n addition to sit-ins, other forms of direct action: a.encountered very little resistance by local white authorities. b.included "wade-ins," where black activists attempted to integrate southern beaches. c.attracted national attention, especially the 1961 "freedom rides," where integrated groups rode interstate buses into the deep south and were violently attacked along the way. d.were limited to marches and demonstrations. e.b and c How is a theory different from a law?A. Theories are factual statements, while laws can be used to make predictions.B. Theories cannot be modified over time, while laws can be modified over time.C. Theories are factual statements, while laws are modified over time.D. Theories can be modified over time, while laws cannot be modified over time. Can anyone help me on this please Find the area of the parallelogram with verticesP(2, 1, 1), Q(4, 4, 4), R(6, 8, 12), and S(4, 5, 9). Consider an annuity that pays GHS 1000 annually for 6 years at a rate of 8% yearly. Compute the present value of the annuity if payments are done at the beginning of the year, and end of the year.Which one is more attractive? Motive your answer assume a 15 cm diameter wafer has a cost of 12, contains 84 dies, and has 0.020 defects/cm2. assume a 20 cm diameter wafer has a cost of 15, contains 100 dies, and has 0.031 defects/cm2. find the yield for both wafers. Find the zeros of the quadratic function What were dr. martin luther king jr. methods of protesting unjust laws and practices? check any of the boxes that apply. a. marches boycotts b. hunger strikes c. public speechesd. civil disobedience e. violent demonstrations Open with Angles p and q are complementary, p is four times the size of q. What is the size of q ? Ben wants to buy 2 blue sweaters for $116 each and 3 brown sweaters for $42 each.How much will Ben spend on the five sweaters?Ben will spend $ on the five sweaters. The train travels 580 miles in 4 hours. The train travels at a constant rate. At this rate, how many hours will it take the train to travel 725 miles? It takes the train type your answer... hours to travel 725 miles.