anova with replication is also known as? repeated measures between-group design mixed design one-way anova

Answers

Answer 1

this is "Repeated measures ANOVA, which is a statistical test used to analyze data from experiments in which the same participants are measured multiple times under different conditions.

What is a repeated measures ANOVA ?

A repeated measures ANOVA is a statistical test used to analyze data from experiments in which the same participants are measured multiple times under different conditions. This design is sometimes referred to as a "within-subjects design" because each participant is measured within the same group.

Here are the steps for conducting a repeated measures ANOVA:

State the null and alternative hypotheses.Check the assumptions of the test, which include normality, sphericity, and homogeneity of variance.Calculate the within-subjects sum of squares (SSW), the between-subjects sum of squares (SSB), and the total sum of squares (SST).Calculate the degrees of freedom (df) for each of these sums of squares.Calculate the mean square (MS) for each source of variance by dividing the sum of squares by the degrees of freedom.Calculate the F ratio by dividing the between-subjects MS by the within-subjects MS.Determine the critical value for the F ratio using a table or software.Compare the calculated F ratio to the critical value. If the calculated F ratio is greater than the critical value, reject the null hypothesis and conclude that there is a significant effect of the independent variable on the dependent variable.If the null hypothesis is rejected, follow up with post hoc tests to determine which conditions differ significantly from each other.

Learn more about  ANOVA

brainly.com/question/24157862

#SPJ11


Related Questions

A random sample of size 64 is taken from a normal population with u = 51.4 and o=6.8. a). What is the probability that the mean of the sample will fall between 50.5 and 52.3?
b). What is the probability that the sample standard deviation will exceed 10?

Answers

a) The probability that the mean of the sample will fall between 50.5 and 52.3 is approximately 0.8623.

b) The probability that the sample standard deviation will exceed 10 is approximately 0.0244.

a) To find the probability that the mean of the sample falls between 50.5 and 52.3, we need to calculate the z-scores for these values and then use the z-table or a statistical calculator.

The formula to calculate the z-score is:

z = (x - μ) / (σ / √n)

Where:

x = the sample mean (in this case, the mean is between 50.5 and 52.3)

μ = the population mean (given as 51.4)

σ = the population standard deviation (given as 6.8)

n = the sample size (given as 64)

For 50.5:

z_1 = (50.5 - 51.4) / (6.8 / √64) = -0.15

For 52.3:

z_2 = (52.3 - 51.4) / (6.8 / √64) = 0.6625

Next, we use the z-table or a statistical calculator to find the probability associated with these z-scores. The probability of the mean falling between 50.5 and 52.3 is the difference between the cumulative probabilities at z_2 and z_1.

P(50.5 < x < 52.3) = P(z_1 < z < z_2)

Looking up the z-scores in the z-table or using a statistical calculator, we find that the probability associated with z_1 is approximately 0.4364 and the probability associated with z_2 is approximately 0.9454.

Therefore, the probability that the mean of the sample falls between 50.5 and 52.3 is approximately:

P(50.5 < x < 52.3) = 0.9454 - 0.4364 ≈ 0.8623

b) To find the probability that the sample standard deviation exceeds 10, we need to use the chi-square distribution.

The formula to calculate the chi-square statistic for sample standard deviation is:

χ² = (n - 1) * s² / σ²

Where:

n = sample size (given as 64)

s = sample standard deviation (in this case, we are interested in values exceeding 10)

σ = population standard deviation (given as 6.8)

To find the probability, we calculate the chi-square value and then use the chi-square distribution table or a statistical calculator.

χ² = (64 - 1) * 10² / 6.8² ≈ 121.5294

Using the chi-square distribution table or a statistical calculator, we find that the probability of the chi-square value exceeding 121.5294 is approximately 0.0244.

Therefore, the probability that the sample standard deviation exceeds 10 is approximately 0.0244.

For more questions like Probability click the link below:

https://brainly.com/question/30034780

#SPJ11

what is the equation of a line that passes through 4,3 and 2,3

Answers

4x3 and 2x3
That’s the answer
You times then if a comma there

please any one knows the answer I only have 2 minutes left
What five-letter word becomes shorter when you add two letters to it? ​

Answers

Answer:

short .

short becomes shorter when you add er .

Step-by-step explanation:

Answer:

shorter

Step-by-step explanation:

short

shorter

Letters x, y, and z are angle measures. Which equations would guarantee that lines p and q are parallel? Check all that apply. x = z x + y = 180° x + z = 180° x = y z = 180°

Answers

The equations that would guarantee that lines p and q are parallel are;

x = z

x + y = 180°

The image showing the lines p and q as well as the angles x, y and z can be found in the link at the end of this answer.

From the image given;

We see that a transverse line cuts across the two parallel lines p and q. Thus;

We can see that x and z are corresponding angles and as such, we can say that; x = z.

Secondly, we can see that y and z are supplementary angles because they form a straight line and sum of angles that form a straight is 180°.

Thus; y + z = 180°

Since x = z, then by substitution property of equality, we can say that;

x + y = 180°

Read more at; https://brainly.com/question/13128119

Answer:

Step-by-step explanation:

A and B

five numbers have a mean of 3. four of the numbers are 7,5,2,-4. what is the 5th number?​

Answers

Answer:   The fifth number is 5

Step-by-step explanation:

(a) Write an expression for a Riemann sum of a function f on an interval [a, b]. Explain the meaning of the notation that you use.
(b) If f(x)⩾ 0, what is the geometric interpretation of a Riemann sum? Illustrate with a diagram.
(c) If f(x) takes on both positive and negative values, what is the geometric interpretation of a Riemann sum? Illustrate with a diagram.

Answers

(a) The expression for a Riemann sum of a function f on an interval [a, b] is Δx = (b-a)/n

(b) If f(x)⩾ 0, then the geometric interpretation of a Riemann sum is infinity

(c) If f(x) takes on both positive and negative values, then the geometric interpretation of a Riemann sum is infinity

Riemann sums are an important tool in calculus for approximating the area under a curve. They are used to estimate the value of a definite integral, which represents the area bounded by the curve and the x-axis on a given interval. In this explanation, we will discuss the expression for a Riemann sum, its notation, and its geometric interpretation.

(a) Expression for a Riemann sum:

A Riemann sum is an approximation of the area under a curve using rectangles. We divide the interval [a, b] into n subintervals, each of length Δx=(b−a)/n. The notation used to represent this is:

Δx = (b-a)/n

(b) Geometric interpretation of a Riemann sum when f(x)⩾ 0:

If f(x) is always non-negative, the Riemann sum represents an approximation of the area between the curve and the x-axis on the interval [a, b].

Each rectangle has a positive area, which contributes to the overall area under the curve. The sum of the areas of the rectangles approaches the true area under the curve as the number of subintervals n approaches infinity.

(c) Geometric interpretation of a Riemann sum when f(x) takes on both positive and negative values:

When f(x) takes on both positive and negative values, the Riemann sum represents the net area between the curve and the x-axis on the interval [a, b].

Each rectangle may have a positive or negative area, depending on the sign of f(xi).

The positive areas represent regions where the curve is above the x-axis, and the negative areas represent regions where the curve is below the x-axis.

In conclusion, Riemann sums are used to approximate the area under a curve on an interval [a, b]. The expression for a Riemann sum involves dividing the interval into n subintervals and approximating the area under the curve using rectangles.

To know more about Riemann sum here.

https://brainly.com/question/30241844

#SPJ4

what is the median of 6 5 9 9 6 7 and 6

Answers

Answer:

6

Explanation:

To know the median, we first need to organize the data from least to greatest, so:

5 6 6 6 7 9 9

Then, the median will be the value that is in the middle, so:

5 6 6 6 7 9 9

Therefore, the median is 6 because there are 3 values to the left of 6 and 3 values to the right of 6.

1. Which of the following is INCORRECT:
Independent random samples arise when ...
a. one random sample is split into groups differing by an observed feature
b. the individuals in a sample are randomly assigned to experimental groups
c. data is recorded repeatedly on a random sample of individuals
d. random samples are selected separately
2. The margin of error of a confidence interval about the difference between the means of two populations is equal to
a. half the width of the confidence interval
b. twice the width of the confidence interval
c. the width of the confidence interval
d. 1.5 times the width of the confidence interval

Answers

1. Independent random samples arise when one random sample is split into groups differing by an observed feature is incorrect.

2. The margin of error of a confidence interval about the difference between the means of two populations is equal to half the width of the confidence interval.

1. Independent random samples arise when individuals in a sample are randomly assigned to experimental groups, data is recorded repeatedly on a random sample of individuals, or random samples are selected separately. The statement that one random sample is split into groups differing by an observed feature does not accurately describe independent random samples.

2. The margin of error in a confidence interval represents the range of values within which the true population parameter is likely to fall. It is calculated by taking half of the width of the confidence interval. Therefore, the correct answer is that the margin of error is equal to half the width of the confidence interval.

In summary, the incorrect statement is that independent random samples arise when one random sample is split into groups differing by an observed feature. The margin of error of a confidence interval about the difference between the means of two populations is equal to half the width of the confidence interval.

To know more about random samples, click here: brainly.com/question/29357010

#SPJ11

if the population distribution is extremely skewed, the sampling distribution for the sample mean will be skewed when the sample size is small (less than 30). T/F

Answers

The given statement is false, if the sample size is large enough, the skewness of the population distribution does not affect the shape of the sampling distribution for the sample mean.

When the population distribution is extremely skewed, the sampling distribution for the sample mean will be skewed when the sample size is small (less than 30). Skewness refers to the degree of asymmetry in a probability distribution. In a skewed distribution, the tail of the distribution extends either to the right or to the left, and the mean, median, and mode of the distribution are not equal.

In a small sample, the distribution of the sample mean tends to follow the shape of the population distribution, meaning that it will also be skewed if the population distribution is extremely skewed. This is because when the sample size is small, the sample mean is highly influenced by extreme values or outliers in the population, which can distort the shape of the sampling distribution.

However, as the sample size increases, the sampling distribution of the sample mean becomes more symmetric and approaches a normal distribution, regardless of the shape of the population distribution. This is known as the central limit theorem, which states that the distribution of the sample mean approaches a normal distribution as the sample size increases.

Therefore, if the sample size is large enough, the skewness of the population distribution does not affect the shape of the sampling distribution for the sample mean.

To learn more about sample size here:

brainly.com/question/30100088#

#SPJ11

So I'm just making sure...
Complementary angles add up to 90°
Supplementary angles add up to 180°
I've seen many different answers so I am just double checking. Thanks.​

Answers

Answer:

This is correct.

Step-by-step explanation:

Answer:

Yes...You are right... hope it helps

the air force receives 40 percent of its parachutes from company c1 and the rest from company c2. the probability that a parachute will fail to open is .0025 or .002, depending on whether it is from company c1 or c2, respectively. if a randomly chosen parachute fails to open, what is the probability that it is from company c1?

Answers

If a randomly chosen parachute fails to open, then the probability that it is from company c1 is 45.5%.

In the given question, the air force receives 40 percent of its parachutes from company c1 and the rest from company c2.

The probability that a parachute will fail to open is 0.0025 or 0.002, depending on whether it is from company c1 or c2, respectively.

If a randomly chosen parachute fails to open, then we have to find the probability that it is from company c1.

The parachute receive from P(c1) = 40% = 0.40

The parachute receive from P(c2) = 60% = 0.60

The probability of fail to open from company P(F/c1) = 0.0025

The probability of fail to open from company P(F/c2) = 0.002

The probability of random chosen parachute fails to open that it is from company c1 is

P(c1/F) = P(c1∩F)/P(F)

P(c1/F) = P(F/c1)P(c1)/P(F/c1)P(c1)+P(F/c2)P(c2)

P(c1/F) = 0.0025*0.40/0.0025*0.40+0.002*0.60

P(c1/F) = 0.001/0.001+0.0012

P(c1/F) = 0.001/0.0022

P(c1/F) = 0.455

P(c1/F) = 45.5%

To learn more about probability link is here

brainly.com/question/11034287

#SPJ4

if a consumer researcher compares the mean price of 25 items purchased at one store to the mean price for the same 25 items purchased at a second store, how many degrees of freedom are there?

Answers

In this case, the consumer researcher has two samples of 25 items each, so the total number of observations is 50. Therefore, the degrees of freedom for this comparison would be 49 (50-1).

The formula for degrees of freedom is df = n-1,

where n represents the number of observations in a sample.

In this case, the consumer researcher has two samples of 25 items each, so the total number of observations is 50. Therefore, the degrees of freedom for this comparison would be 49 (50-1).

If a consumer researcher compares the mean price of 25 items purchased at one store to the mean price for the same 25 items purchased at a second store, the degrees of freedom are 49.

The formula for degrees of freedom is df = n-1,

where n represents the number of observations in a sample.

In this case, the consumer researcher has two samples of 25 items each, so the total number of observations is 50.

Therefore, the degrees of freedom for this comparison would be 49 (50-1).

In general, degrees of freedom are important because they help to determine the variability and precision of statistical estimates.

When the degrees of freedom are high, the estimates tend to be more precise and reliable because there is more data available to support them.

Conversely, when the degrees of freedom are low, the estimates tend to be more uncertain and prone to error because there is less data available to support them.

For similar question on samples.

https://brainly.com/question/25142707

#SPJ11

HELP PLEASEEEEEE!!!!!!!

HELP PLEASEEEEEE!!!!!!!

Answers

Answer:

Step-by-step explanation:

It is a straight path that goes on without end in two directions. What is it?
A. line
B. plane
C.ray
D. triangle

Answers

The correct answer is A. line. A line is a straight path that extends infinitely in both directions. It has no endpoints and continues indefinitely.

A line is a basic geometric object that is defined by two points or can be represented by a single equation. It is characterized by its straightness and infinite length, extending in both directions without any boundaries or endpoints. A line can be represented by a straight line segment with two distinct points or by an equation such as y = mx + b in a coordinate system.

On the other hand, a plane refers to a two-dimensional flat surface that extends infinitely in all directions. It is not a straight path but rather a flat, continuous surface. A ray, is a part of a line that has one endpoint and extends infinitely in one direction. It is not a straight path that continues indefinitely in both directions like a line.

A triangle is a closed geometric shape with three sides and three angles. It is not a straight path but rather a closed figure formed by connecting three non-collinear points.Therefore ,the correct answer is A.

learn more about straight line :

https://brainly.com/question/31693341

#SPJ4

True or false?? The triangles shown below must be congruent ?

True or false?? The triangles shown below must be congruent ?

Answers

Answer:

True

Step-by-step explanation:

Because the angles are the same and one of the legs are the same, it is concluded that they are congruent.

Answer:

the statement is true )

Step-by-step explanation:

rule of  ASA ( angle side angle)

EMERGENCY! Please give me the correct answer!​

EMERGENCY! Please give me the correct answer!

Answers

Answer:

1/49 is the answer

Step-by-step explanation:

Can any one Simplify (3^1/3)^4

Answers

Answer:

\(1\)

Step-by-step explanation:

1. \((3^{1} / 3)^{4}\)

2. \(3^{1} = 3\)

3. \(3 / 3 = 1\)

4. \(1^{4} = 1\)

30 points + marked as brain thing

30 points + marked as brain thing

Answers

The answer of the given question based on the Compound interest the answer is option a) Rounding to 2 decimal places gives D ≈ 824.50, so the closest option provided is a) 825. Therefore, the number that goes in box D is approximately 824.50, rounded to 2 decimal places.

What is Principal?

In compound interest, term "principal" refers to the initial amount of money that is invested or borrowed. The principal is  starting point for calculating interest that will be earned or paid over time.

When you invest money at compound interest rate, interest earned is added to  principal amount, and  resulting sum becomes new principal for next interest calculation.

Based on the information provided in the image, we can calculate the value in box D by multiplying the values in boxes B and C and then dividing by 100:

D = (B × C) ÷ 100

D = (850 × 97) ÷ 100

D = 824.5

Rounding to 2 decimal places gives D ≈ 824.50, so the closest option provided is a) 825. Therefore, the number that goes in box D is approximately 824.50, rounded to 2 decimal places.

To know more about Amount visit:

https://brainly.com/question/30935846

#SPJ1

Total equity after adding the simple interest in the amount will be $825.

What is simple interest?

Simple interest is a type of interest that is calculated only on the principal amount of a loan or investment, without taking into account any interest that may have accumulated in previous periods.

In simple interest, the amount of interest earned or owed is calculated as a percentage of the principal amount, multiplied by the time period for which the interest is being calculated.

simple interest is found using

I = P * r * t

Where I is the amount of interest earned or owed, P is the principal amount, r is the annual interest rate as a decimal, and t is the              time period in years.

Now,

Assuming that the return rate of 10% is a simple annual interest rate, the total equity after one year can be calculated using the formula for simple interest:

Total equity = Principal + Interest

where the interest is calculated as:

Interest = Principal x Rate x Time

In this case, the principal is $750, the rate is 10%, and the time is one year.

Then,

Interest = $750 x 0.10 x 1 = $75

Therefore, the total equity after one year would be:

Total equity = $750 + $75 = $825

To know more about simple interest visit the link

brainly.com/question/25845758

#SPJ1

I need to write this quotient in Scientific Notation
(7.488 × 10^8)÷(3.12×10^2)

Answers

13.3 is the answer for it

Please Help!! I will give brainliest

The question is attached below

Please Help!! I will give brainliestThe question is attached below

Answers

Answer:

Step-by-step explanation:

P(x) = \(\frac{2}{3x-1}\)

Q(x) = \(\frac{6}{-3x+2}\)

P(x) × Q(x) = \(\frac{2}{3x-1}\times \frac{6}{-3x+2}\)

                 = \(\frac{2\times 6}{(3x-1)(-3x+2)}\)

                 = \(\frac{12}{(3x-1)(-3x+2)}\)

P(x) ÷ Q(x) = \(\frac{2}{(3x-1)}\) ÷ \(\frac{6}{(-3x+2)}\)

                 = \(\frac{2}{(3x-1)}\times \frac{(-3x+2)}{6}\)

                 = \(\frac{(-3x+2)}{3(3x-1)}\)

Fill in the Blank: a. The entire collection of objects being studied is called the ________________. b. A small subset from the set of all 2013 minivans is called a ________________. c. Consider the amount of sugar in breakfast cereals. This characteristic of breakfast cereal (objects) is called a ________________.

Answers

a. The entire collection of objects being studied is called the population.

b. A small subset from the set of all 2013 minivans is called a sample.

c. Consider the amount of sugar in breakfast cereals. This characteristic of breakfast cereal (objects) is called a variable.

a. Population: The population refers to the entire group or collection of objects, individuals, or units that are of interest in a study. It represents the complete set of items from which a sample is drawn. For example, if you are conducting a study on the heights of all adults in a particular country, the population would consist of every adult in that country.

b. Sample: A sample is a smaller subset or representative portion of the population. It is selected from the larger population with the intention of making inferences or generalizations about the population. Sampling is often done when studying an entire population is not feasible or practical. In the context of the example given, a sample of 2013 minivans could be randomly selected from the entire set of minivans produced in 2013.

c. Variable: A variable is a characteristic or attribute that can vary or take different values within a population or sample. In the given example of breakfast cereals, the amount of sugar is a variable. Variables can be quantitative, such as numerical measurements like weight or height, or qualitative, such as categories or labels like color or brand. In statistical analysis, variables are used to describe and analyze data, and they can be classified as independent variables (predictors) or dependent variables (outcomes).

To learn more about variable

https://brainly.com/question/28248724

#SPJ11

chelsea wants to cover a rectangular prism-shaped box with paper. which is closest to the minimum amount of paper chelsea needs?

Answers

Chelsea needs at least 190 cm² of paper to cover the box.

To find the minimum amount of paper Chelsea needs to cover the rectangular prism-shaped box, we need to calculate the surface area of the box.

Surface Area = 2(lw + lh + wh)

Where,

L is length, W is width, aH nd f f is height.

So, to find the minimum amount of paper Chelsea needs, we need to know the box's surface area of the box. Once we have the dimensions, we can plug them into the formula and calculate the surface area.

For example, if the box has dimensions of length of 10 cm, width 5 cm, and height 30 cm, the surface area would be:

Surface Area = 2(50 + 30 + 15)

Surface Area = 2(95)

Surface Area = 190 cm²

Therefore, Chelsea needs at least 190 cm² of paper to cover the box.

To learn more about rectangular prism-shaped boxes  visit:

https://brainly.com/question/12468835

#SPJ4

Find the domain of the logarithmic function. (Enter your answer using interval notation.) f(x) = -log3(x + 3) Find the x-intercept. (x, y) = Find the vertical asymptote. x =

Answers

To find the domain of the logarithmic function f(x) = -log3(x + 3), we first need to identify the values of x for which the function is defined. Logarithmic functions are defined only for positive arguments, meaning that we need x + 3 > 0.

Step 1: Solve the inequality x + 3 > 0.
x > -3

The domain of the function is all x values greater than -3. In interval notation, this is written as (-3, ∞).

Now, let's find the x-intercept of the function, which is the point where the function crosses the x-axis (y = 0). To do this, we need to solve the equation f(x) = 0 for x.

Step 2: Set f(x) = 0 and solve for x.
0 = -log3(x + 3)
-log3(x + 3) = 0

Step 3: Solve for the logarithmic equation.
log3(x + 3) = 1

Step 4: Rewrite the logarithmic equation in exponential form.
3^1 = x + 3
3 = x + 3

Step 5: Solve for x.
x = 3 - 3
x = 0

The x-intercept is (0, 0).

Lastly, let's find the vertical asymptote of the function. This is the line that the function approaches but never actually reaches. For logarithmic functions, the vertical asymptote is located at the point where the argument of the log is zero.

Step 6: Set x + 3 = 0 and solve for x.
x = -3

The vertical asymptote is x = -3.

To summarize:
- Domain: (-3, ∞)
- X-intercept: (0, 0)
- Vertical asymptote: x = -3

To learn more about ''domain of the logarithmic function'' visit : https://brainly.com/question/16444481

#SPJ11

2b + 8 - 5b + 3 = -13 + 8b -5

Answers

b = 29/11 = around 2.6
I think this is the correct answer and the that the other guy gave you is wrong
2b + 8 - 5b + 3 = -13 + 8b -5

Plz help brainiest to the correct answer!

Plz help brainiest to the correct answer!
Plz help brainiest to the correct answer!

Answers

Here’s the answer to your questions.
Plz help brainiest to the correct answer!

#1

Current temperature=0°C

Temperature before 1 hour

\(\\ \sf{:}\dashrightarrow 0+3°C=3°C\)

#2

Temperature before 3h

\(\\ \sf{:}\dashrightarrow 0+3(3)=0+9=9°C\)

#3

Temperature before 4.5h

\(\\ \sf{:}\dashrightarrow 0+4.5(3)=13.5°C\)

The new runway your client is pouring on the east side of the estate is to the ranch house is 3.75 miles long, and covers a total of 5.6 acres, which means the runway is feet wide.

Answers

The width of the runway is approximately 28.3 feet. The length of the runway in feet is Length = 3.75 miles * 5,280 feet/mile

The new runway being constructed on the east side of the estate, which extends to the ranch house, is 3.75 miles long and covers a total area of 5.6 acres. To determine the width of the runway in feet, we can use the following information:

1 acre = 43,560 square feet

First, let's convert the length of the runway from miles to feet:

1 mile = 5,280 feet

Therefore, the length of the runway in feet is:

Length = 3.75 miles * 5,280 feet/mile

Next, let's calculate the width of the runway using the area and length:

Area = Length * Width

Since we are given the area in acres, we need to convert it to square feet:

Area = 5.6 acres * 43,560 square feet/acre

Now, we can solve for the width:

Width = Area / Length

Substituting the values we have:

Width = (5.6 acres * 43,560 square feet/acre) / (3.75 miles * 5,280 feet/mile)

Simplifying the expression:

Width = (5.6 * 43,560) / (3.75 * 5,280) feet

Calculating the value:

Width ≈ 560,784 / 19,800 feet

Width ≈ 28.3 feet

Therefore, the width of the runway is approximately **28.3 feet**.

Learn more about width here

https://brainly.com/question/28107004

#SPJ11

Hometown Gym charges a $200 membership fee and $45 per month. Local Gym charges a $50 membership fee and $55 per month. Write an equation to represent the situation. *

Answers

Answer:

=> membership fee = $50

=> monthly fee = $55

=> First month = 105$

=> 50 + 55(x)

=> 50 + 55 (15)

=> 50 + 825

=> 875

Workout gym

=> membership fee = $200

=> monthly fee = $45

=> First month = 245$

=> 200 + 45(x)

=> 200 + 45(15)

=> 200 + 675

=> 875

Step-by-step explanation:


Determine whether each sequence is arithmetic, geometric, or neither. Then find the tenth term. 1/4, 1,4,16,. . . .

Answers

The sequence  1/4, 1, 4, 16,  . . . . is a geometric sequence and its 10th term is 65,536

To determine whether the sequence is an arithmetic or geometric one, we need to check the relation between two consecutive terms.

If it is an arithmetic sequence, then:

 a(n) = a(n-1) + d

where d is the common difference.

If it is a geometric sequence, then:

 a(n) = a(n-1) . r

where r is the common ratio.

The given sequence is:

   1/4, 1, 4, 16,  . . . .

In this sequence:

a(1) = 1/4

a(2) = 1

a(3) = 4

a(4) = 16

Notice that

a(2) : a(1) = 1 : 1/4 = 4

a(3) : a(2) = 4 : 1 = 4

and so on

Since the ratio of consecutive terms are constant, then the given sequence is a geometric sequence. Furthermore, its ratio, r = 4.

To find the 10th term, use the formula:

a(n) = a(1) . rⁿ⁻¹

Substitute n = 10, r = 4, and a(1) = 1/4

a(10) = 1/4 . 4⁹

a(10) = 4⁸  = 65,536

Learn more about sequence here:

https://brainly.com/question/27360759

#SPJ4

Hello everyone ! I need helps from you ! So , in class we do a control and I get 16 / 20. So I wants a pencentage ! Thanks vers much.

Answers

Hey there, 16/20 would be 80%. It is a quite simple fraction that one could use calculator for.

However I hope I was to any help :)

what is 5 feet 9 inches in centimeters?

Answers

Answer:

it is 175.2

Step-by-step explanation:

We know that 5 ft and 9 inches are equivalent to 175.26 cm using conversion factors.

What are conversion factors?

The units of a measured quantity can be changed without changing the value by using a conversion factor, which is a formula that illustrates the relationship between the units.

A conversion ratio (or unit factor) always equals one if the numerator and denominator are the same value expressed in different units (1).

One unit of measurement can be converted into another using conversion factors.

The conversion procedure includes changing the company's accounting system from a single-entry to a double-entry one.

We know that:
5 feet = 152.4 cm

9 inches = 22.86 cm

Then,

5 ft and 9 inches = 175.26 cm

Therefore, we know that 5 ft and 9 inches are equivalent to 175.26 cm using conversion factors.

Know more about conversion factors here:

brainly.com/question/97386

#SPJ4

Other Questions
consider the following table of long-run total costs for three different firms:quantity1234567firm a$60$70$80 $90 $100 $110 $120firm b 11 24 39 56 75 96 119firm c 21 34 49 66 85 106 129does each of these firms experience economies of scale or diseconomies of scale? if you were working for a pharmaceutical company trying to develop anticancer drugs, what biological process would be the best target to investigate? if you were working for a pharmaceutical company trying to develop anticancer drugs, what biological process would be the best target to investigate? cellular respiration glycolysis meiosis mitosis "In at least 150 words, analyze the narrators of The Circuit and The Passing. How do they compare to one another?"Sorry for the little information thats the whole question, if sombody can please answer I need it as soon as possible :) 4. when uv light of wavelength 255 nm falls on a metal surface, the maximum kinetic energy of emitted electrons is 1.40 ev. what is the work function of the metal? 2x2y= 10 Standard to Slope Intercept Form Knowing indicators of an unstable person can allow you to identify a potential insider threat before an incident. (antiterrorism scenario training, page 4) FILL THE BLANK. the part of an automobile that has been most closely regulated in an effort to make the air cleaner is the _____________________. How does competition impact cost and demand? PLEASE HELP!! I NEED TO SUBMIT THIS IN 20 MINUTES How many per tickets are in one mole? What are two concrete ways to analyze art?color and balancecontrast and valueprinciples and elements Draw a box plot for the following data. {27, 14, 12, 17, 26, 27, 27, 12, 24, 14, 15, 19, 23, 26, 15} he picture below depicts the haymarket riot in may 1886. based on the picture, which sentence best describes the viewpoint of the artist? responses the protestors were prepared to use violence. the protestors were prepared to use violence. the police were largely responsible for the violence. the police were largely responsible for the violence. the lives of women and children were endangered. the lives of women and children were endangered. the protestors' demands were largely justified. What is the probability of drawing four queens from a standard deck of cards, given that the first card drawn was a queen? Assume that the cards are not replaced.3/208254/521/208253/52 Which technology is shown in the photograph?A. Negative controlsB. Biostimulation reactionC. Gel electrophoresisD. Polymerase chain reaction A candle is 30 in. long. After burning for 12 min, the candle is 25 in long if it continues to burn at the same rate, how long will it take for the whole candle to burn? Can someone pls help me I will mark you as brain June19/Q8-V225.0 cm of 0.100 mol/dm aqueous sodium hydroxide is neutralised by 24.6 cm of dilutesulfuric acid.What is the concentration of the dilute sulfuric acid?A 0.0508 mol/dmB 0.0984 mol/dmC 0.102 mol/dmD 0.203 mol/dm Directions: Read the sentence and determine the meaning of the word using clues or your prior knowledge. Then explain what clues in the sentence helped you determine the word meaning.1. Confiscate: Joannes mother came up to the school to get the cell phone the teacher had confiscated.Definition: What clues in the sentence lead you to your definition?2. Obedient: Unlike her older brother Jerome, who stayed out all hours of the night, Kate obediently followed the curfew her parents set.Definition: What clues in the sentence lead you to your definition?3. Consume: John was so hungry that he consumed the cranberry muffin and went back for a donut.Definition: What clues in the sentence lead you to your definition?4. Coax: After the bird escaped, Chris tried to coax it back into the cage with treats.Definition: What clues in the sentence lead you to your definition?5. Peculiar: Since it was a school day, Denise thought it was peculiar that she saw no children on the street during her drive to work.Definition: What clues in the sentence lead you to your definition?6. Outcast: If a wolf refuses to help its pack hunt, it becomes an outcast and must go on alone.Definition: What clues in the sentence lead you to your definition?7. Discard: Dad had no need for the broken air conditioner, so he discarded it on the corner by the trash.Definition: What clues in the sentence lead you to your definition?8. Content: While others eat eggs, pancakes, and bacon for breakfast, Mike was content with a piece of toast and a glass of orange juice.Definition: What clues in the sentence lead you to your definition?9. Fortunate: Because he had such good friends and family, Malcolm considered himself fortunate.Definition: What clues in the sentence lead you to your definition?10. Observe: The teacher stopped the students after she observed them wrestling.Definition: What clues in the sentence lead you to your definition? a certain store is selling packages of 10 pencils and 4 pens. the manager wants to make a larger package in the same ratio. if the large package has 10 pens, how many pencils are in the large package?