helppppif fd = 20 units and de = 52 units, what is the value of b? round the solution to the nearest hundredth.

Answers

Answer 1

Answer: The value of b is 22.62

Step-by-step explanation: 20 is the opposite of b, 52 is the hypotenuse. Because we're given the opposite and hypotenuse, we have to use sine. So....

sin b=20/52

sin b = 0.38461538461

then using inverse of sine, the equation would be sin^-1(0.38461538461)

by putting that into the calculator you get 22.61986495 (aka 22.62)

Answer 2

Based on the triangle inequality theorem, if fd = 20 units and de = 52 units, the value of b is approximately 71 units.

To find the value of b, we can use the triangle inequality theorem. According to this theorem, the sum of the lengths of any two sides of a triangle must be greater than the length of the remaining side.

In this case, we have fd = 20 units and de = 52 units. Let's assume that b is the length of the remaining side.

Using the triangle inequality theorem, we can write the following inequality:

fd + de > b

Substituting the given values, we get:

20 + 52 > b

72 > b

Therefore, the value of b must be less than 72 units.

To round the solution to the nearest hundredth, we can round down to the nearest whole number, which is 71.

So, the value of b is approximately 71 units.

In conclusion, based on the triangle inequality theorem, if fd = 20 units and de = 52 units, the value of b is approximately 71 units.

Learn more about triangle inequality theorem from the given link:

https://brainly.com/question/30956177

#SPJ11


Related Questions

(a) The top of a hill rises 436 feet above Checkpoint 4.
What is the altitude of the top of the hill?

Answers

Answer:

no

Step-by-step explanation: obious ok

g one of these 500 accidents was chosen at random. what is the probability that the accident involved someone 45 or older given that the accident involved a driver with bac over 0.08?

Answers

0.3654 is the probability that the accident involved someone 45 or older given that the accident involved a driver with BAC over 0.08.

What is probability?

A probability is a number that expresses the possibility or likelihood that a specific event will take place. In addition to being represented as percentages ranging from 0% to 100%, probabilities can also be expressed as proportions between 0 and 1.

The probability is a measure of how likely an event is to occur. It gauges the event's degree of certainty. P(E) = Number of Favorable Outcomes/Number of All Outcomes is the formula for probability.

Given that,

one of these 500 accidents was chosen at random.

the accident involved someone 45 or older

Thus, P ( 45 and over | driver with BAC over 0.08) = P (A | B)

P (A | B) = P (A∩B) / P(B)

or, P (A | B) = P ( 45 and over ∩ driver with BAC over 0.08) / P (driver with BAC over 0.08)

or, P (A | B) = 38 / 104

or, P (A | B) =  0.3654

To know more about probability refer to:

https://brainly.com/question/13604758

#SPJ4

The complete question is as follows:

g one of these 500 accidents was chosen at random. what is the probability that the accident involved

the allowable is one metric used to determine what conversion rate you need to break even. True or False

Answers

The allowable is a term used in advertising and marketing to refer to the maximum cost per acquisition (CPA) that a business can afford to pay. So, the given statement is False.

"The allowable" is a term used in advertising and marketing to refer to the maximum cost per acquisition (CPA) that a business can afford to pay to acquire a customer while still remaining profitable. It is not directly related to the conversion rate needed to break even.

To determine the conversion rate needed to break even, you would need to consider the cost of acquiring a customer, the profit margin on the product or service being sold, and the total revenue generated by each customer. This calculation can help determine the minimum conversion rate needed to achieve profitability.

Know more about allowable here:

https://brainly.com/question/29646168

#SPJ11

Is smart do this solve
Good luck~
Pls don't spam...​

Is smart do this solveGood luck~Pls don't spam...

Answers

Step-by-step explanation:

Assume 80° should be 180° to have same pattern.

Use reduction formulas and solve:

\(\dfrac{sin(180+A)+2cos(180+A)cos(A-180)}{2cos^2(360+A)-cos(-A)} =\)\(\dfrac{-sin(A)+2(-cos(A))(-cos(A))}{2cos^2(A)-cos(A)} =\)\(\dfrac{2cos^2(A)-sin(A)}{2cos^2(A)-cos(A)}\)

As given, it simplifies to the above fraction.

If the sin was cos then the final result would be 1 as both numerator and denominator would be equal.

richu and Deepu two students of a Vidyalaya contribute to charity the contribution of richu is 3/5 of the contribution of Deepu write a linear equation according to the above statement and draw the graph​

Answers

Answer : y = 3/5x

Explanation:

richu and Deepu two students of a Vidyalaya contribute to charity the contribution of richu is 3/5 of

Find the value of a² - 6 if
a = 5

Answers

Answer:

19

Step-by-step explanation:

a²-6

where, a=5

(5)²-6

25-6

19

Answer:

\(\huge\boxed{\sf 19}\)

Step-by-step explanation:

Given expression:

a² - 6

Put a = 5

= (5)² - 6

= 25 - 6

= 19

\(\rule[225]{225}{2}\)

What is the domain? I need help on this problem

What is the domain? I need help on this problem

Answers

The domain of the function \(f(x) = \sqrt{\frac{1}{3}x + 2\) is (d) x  ≥ -6

How to determine the domain of the function

From the question, we have the following parameters that can be used in our computation:

\(f(x) = \sqrt{\frac{1}{3}x + 2\)

Set the radicand greater than or equal to 0

So, we have

1/3x + 2 ≥ 0

Next, we have

1/3x  ≥ -2

So, we have

x  ≥ -6

Hence, the domain of the function is (d) x  ≥ -6

Read more about domain at

https://brainly.com/question/31900115

#SPJ1

how many sides does a polygon have if the sum of the interior angles is 3960

Answers

A polygon with a sum of interior angles of 3960 has 22 sides.

The sum of the interior angles of a polygon can be calculated using the formula:

(n-2) * 180

where n is the number of sides of the polygon. This formula is derived from the fact that the total degree measure of a polygon is equal to the sum of the degree measures of its interior angles. In a polygon with n sides, there are n angles, each measuring 180 degrees. So the total degree measure of a polygon with n sides is n * 180.

Now, if we subtract the degree measures of two angles, we are left with the sum of the degree measures of the remaining n-2 angles. This is why the formula for the sum of the interior angles of a polygon is given as (n-2) * 180.

To find the number of sides of a polygon given its sum of interior angles, we can rearrange the formula as follows:

n = (Sum of interior angles / 180) + 2

So, if the sum of the interior angles is given as 3960, we can plug that into the formula:

n = (3960 / 180) + 2

n = 22

Therefore, a polygon with a sum of interior angles of 3960 has 22 sides.

To learn more about polygon please click on below link.

https://brainly.com/question/18487663

#SPJ4

How many sides does a polygon have if the sum of the interior angles is 3960?

what is the answer for this one 4x + 16 = ?

Answers

Answer:

4(x+4)

Step-by-step explanation:

Factor 4x+16

4x+16

=4(x+4)

Answer : x = 2


Explanation: 4x + 16 = 24
4x + 16-16 = 24 -16
4x=8
4x/4=8/4
x=2

Spin a spinner numbered 1-8 and you land on 8 twice in a row what is the probability?

Answers

The probability that you land on 8 twice is 1/64

What is probability?

The area of mathematics known as probability deals with numerical representations of the likelihood that an event will occur or that a statement is true. An event's probability is a number between 0 and 1, where, roughly speaking, 0 denotes the event's impossibility and 1 denotes certainty.

We spin a spinner numbered 1-8 twice

The total sample space can be given by considering all the possible values

Hence the total number of spins are 8*8= 64 spins

The possibility that getting 8 twice is only once possible. As it will be only one pair in all the possible values.

Hence, The total probability is 1/64

To learn more about the probability please refer the following link

https://brainly.com/question/24756209

#SPJ4

there are four multiple-choice questions on an exam, each with three possible answers. (a) determine the number of possible answer sequences for the four questions. (b) if you do not know the answers and are guessing, what is the probability of getting all four answers correct? (round your answer to five decimal places.) (c) if you do not know the answers and are guessing, what is the probability that you will answer at least one question out of four correctly? (round your answer to five decimal places.)

Answers

(a) There are 81 possible answer sequences for the four questions.

(b) The probability of getting all four answers correct when guessing is approximately 0.01235 when rounded to five decimal places.

(c) The probability of answering at least one question correctly when guessing is approximately 0.51775 when rounded to five decimal places.

(a) Since there are three possible answers for each of the four questions, there are a total of 3^4 = 81 possible answer sequences for the four questions.

(b) If you are guessing on each question, the probability of getting one question correct is 1/3. Since there are four questions, the probability of getting all four correct is (1/3)^4 = 1/81, which is approximately 0.01235 when rounded to five decimal places.

(c) The probability of not getting any question correct is (2/3)^4, since there are two incorrect answers for each question and we are guessing on all four questions. Therefore, the probability of getting at least one question correct is 1 - (2/3)^4, which is approximately 0.51775 when rounded to five decimal places.

Learn more about probability here

brainly.com/question/11234923

#SPJ4


Which of the following is a rational number?
Ο Α) π
B) 1.425
Oc) 50
OD) -4

Answers

B) 50 is rational number
OC:50 is the correct answer
Rational numbers are numbers that aren’t already expressed as a quotient or fraction.

Warfarin is a drug used as an anticoagulant. After administration of the drug is stopped, the quantity remaining in a patient's body decreases at a rate proportional to the quantity remaining. Suppose hat the half-life of warfarin in the body is 37 hours. Sketch the quantity, Q, of warfarin in a patient's body as a function of the time, t (in hours), since stopping administration of the drug. Mark 37 hours on your graph.

Answers

The graph showing the 37 hours on the graph is attached accordingly.

What is the explanation for this?

The objective   of the given information is to describe the decay or elimination of warfarin,an anticoagulant drug, from the body.

Understanding that the quantity of warfarin decreases at a rate proportional to the quantity remaining helps in determining the drug's concentration over time and estimating how long it takes for the drug to be eliminated or reach a certain level in the body.

Learn more about graphs:
https://brainly.com/question/19040584
#SPJ1

Warfarin is a drug used as an anticoagulant. After administration of the drug is stopped, the quantity

Unit 2 logic and proof homework 3 conditional statements

Answers

By engaging in these exercises, students can develop a deeper understanding of conditional statements and logical reasoning, which are essential skills for further studies in mathematics and logic.

In Unit 2 of a logic and proof course, homework 3 focuses on conditional statements.

Conditional statements are fundamental concepts in logic and mathematics, representing logical implications between two statements.

They are typically expressed in "if-then" format, where the "if" part is the hypothesis and the "then" part is the conclusion.

The homework may involve tasks such as:

Identifying conditional statements: Students are given a set of statements and asked to identify which ones are conditional statements.

They need to recognize the "if-then" structure and correctly identify the hypothesis and conclusion.

Analyzing the truth value of conditional statements:

Students may be given conditional statements and asked to determine whether they are true or false.

They need to evaluate the hypothesis and conclusion to determine if the implication holds in each case.

Writing converse, inverse, and contrapositive statements:

Students may be required to manipulate given conditional statements to form their converse, inverse, and contrapositive statements.

This involves switching the positions of the hypothesis and conclusion or negating both parts.

Applying the laws of logic:

Students may need to apply logical laws, such as the Law of Detachment or the Law of Modus Tollens, to deduce conclusions based on conditional statements.

Constructing counterexamples:

Students may be asked to provide counterexamples to disprove statements that are falsely claimed to be universally true based on a given conditional statement.

They also help students develop critical thinking and problem-solving abilities, as they have to analyze and manipulate logical structures.

For similar questions on conditional

https://brainly.com/question/27839142

#SPJ8

use green's theorem to find the counterclockwise circulation and outward flux for the field f=(7x−4y)i (9y−4x)j and curve c: the square bounded by x=0, x=4, y=0, y=4.

Answers

The counterclockwise circulation around c is 12 and the outward flux through c is zero.

Green's theorem is a useful tool for calculating the circulation and flux of a vector field around a closed curve in two-dimensional space.

In this case,

we have a field f=(7x−4y)i+(9y−4x)j and

a square curve c bounded by x=0, x=4, y=0, y=4.

To find the counterclockwise circulation, we can use the line integral of f along c, which is equal to the double integral of the curl of f over the region enclosed by c.

The curl of f is given by (0,0,3), so the line integral evaluates to 12.

To find the outward flux, we can use the double integral of the divergence of f over the same region, which is equal to zero since the divergence of f is also zero.

To learn more about : circulation

https://brainly.com/question/30619471

#SPJ11

What are the next 3 numbers in the Geometric sequence 9, 3, 1, 1/3?

Answers

Answer:

The common ratio of this sequence is 1/3, so to find the next three terms we can continue multiplying by 1/3:

1/3 * 1/3 = 1/9

1/9 * 1/3 = 1/27

1/27 * 1/3 = 1/81

Therefore, the next three terms in the sequence are 1/9, 1/27, and 1/81.

1/9, 1/27, and 1/81 are the next 3 numbers in the Geometric sequence 9, 3, 1, 1/3

The given geometric sequence is 9, 3, 1, 1/3.

To find the common ratio, we divide any term by the previous term. Let's use the second and first terms:

3 ÷ 9 = 1/3

The common ratio is 1/3.

To find the next three terms, we can continue multiplying each term by the common ratio.

1/3 * (1/3) = 1/9

(1/3) * (1/9) = 1/27

(1/9) * (1/27) = 1/81

Therefore, the next three terms in the geometric sequence are 1/9, 1/27, and 1/81.

Learn more about geometric sequence here:

https://brainly.com/question/13008517

#SPJ6

If p and q are remainders when the polynomials

If p and q are remainders when the polynomials

Answers

Answer:

Step-by-step explanation:

Which number is closest to √18

Answers

Answer:

4.2 or 4

Step-by-step explanation:

√18 = 4.24264068712

or 4.2

or 4

The first term of a sequence is 13. The term-to-term rule is 'take away 5'. Work out the 4th term

Answers

Answer:

The answer is -2, give me brainliest answer

Step by step solution:

1. 13-5=8

2. 8-5=3

3. 3-5= -2

Answer:

-2

Step-by-step explanation:

13

13 - 5 = 8

8 - 5 = 3

3 - 5 = -2

A-123
B-57
C-90
D-33

A-123B-57C-90D-33

Answers

Answer:

D

Step-by-step explanation:

Plz help
⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀⠀

Plz help

Answers

Answer:

C.

Step-by-step explanation:

Lateral Area formula: ph (perimeter x height)

Answer:

C.

Step-by-step explanation:

8.49 a normal population with unknown variance has a mean of 20. is one likely to obtain a random sample of size 9 from this population with a mean of 24 and a standard deviation of 4.1? if not, what conclusion would you draw?

Answers

The conclusion that can be drawn from the population is that it's an unusual event.

What will they conclusion be?

From the information, the normal population with unknown variance has a mean of 20. is one likely to obtain a random sample of size 9 from this population with a mean of 24 and a standard deviation of 4.1.

The test statistic will be:

t = (Population mean - Sample mean) / Deviation / ✓number

t = (24 - 20) / 4.1 / ✓9.

t = 2.93

Degree of freedom = n - 1

= 9 - 1

= 8

The p value is 0.0095 from a distribution table.

Since the p value is less, it's an unusual event.

Learn more about sample on:

brainly.com/question/24466382

#SPJ1

A sample of gold has a mass of 579 g. The volume of the sample is 30 cm3. What is the density of the gold sample?

Answers

The density of the gold sample is 19.3g/cm³

Let the mass of the gold sample be represented by m

m = 579 g

Let the volume of the gold sample be represented by V

V = 30 cm³

Let the density of the gold sample be represented by ρ

The formula for the density is:

\(Density = \frac{Mass}{Volume}\)

\(\rho = \frac{m}{V} \\\rho = \frac{579}{30} \\\rho = 19.3 g/cm^3\)

The density of the gold sample is 19.3g/cm³

Learn more here: https://brainly.com/question/17780219

what perfect of 50 is 10​

Answers

Answer:

20%

Step-by-step explanation:

1,000 ÷ 50 = 20 so the answer is 20% and hope it helps!

Answer:20%  i dont know if you have to show work but yeah                                                                                                                              

sam purchased 5 raffle tickets a total of 120 raffle tickets were sold what is the probability that one of sams tickets will be the winner

sam purchased 5 raffle tickets a total of 120 raffle tickets were sold what is the probability that one

Answers

Answer:

1/24

Step-by-step explanation:

5/120 which simplifies to:  1/24

pls help if you can asap!!!!

pls help if you can asap!!!!

Answers

Answer: A

Step-by-step explanation: I would say A because the angle is greater than 90 degrees

Answer:

We have supplementary angles.

76 + 3x + 2 = 180

3x + 78 = 180

3x = 102

x = 34

If Cos A = 9/41 and tan B = 28/45 angle A and B are in quadrant I find the value of Tan(A+B)

Answers

Answer: i just need points
Explanation: i need points so 3/4572

Divide 54kg in the ratio 1:5

Answers

Answer:

54 can be divided into 45 and 9

Step-by-step explanation:

add 1+5=6

therefore 1/6*54=9

5/6*54=45

A newspaper reporter wrote an article about a recent football game 8749 people attended the game but the reporter rounded the number to the nearest hundred in the article which number the reporter use?

Answers

Answer:

your answer would be .

Step-by-step explanation:

8750







Three dice are thrown simultaneously, the probability that sum being 3 is * (2 Points) \( 3 / 215 \) \( -12^{2} \)

Answers

The probability of getting 3 is P(A) = 1/216. The probability that sum being 3 is 1 / 216.

When three dice are thrown simultaneously, the probability that the sum is 3 is 1/216. A dice can show a minimum of one and a maximum of six dots, for a total of six sides, giving it a total of 6 * 6 * 6 = 216 possible outcomes.

:When three dice are thrown simultaneously, the probability that the sum is 3 is 1/216. The probability can be calculated as follows:

Let A be the event that the sum is 3. The number of ways to get 3 is 1, i.e., (1, 1, 1). The total number of possible outcomes is 6³,

since each die can have 6 possible outcomes.

Therefore, the probability of getting 3 is P(A) = 1/216.

In conclusion, the probability that sum being 3 is 1 / 216.

To know more about probability visit:

brainly.com/question/31828911

#SPJ11

Other Questions
The following sort method correctly sorts the integers in elements into ascending order.Line 1: public static void sort(int[] elements)Line 2: {Line 3: for (int j = 1; j < elements.length; j++)Line 4: {Line 5: int temp = elements[j];Line 6: int possibleIndex = j;Line 7: while (possibleIndex > 0 && temp < elements[possibleIndex - 1])Line 8: {Line 9: elements[possibleIndex] = elements[possibleIndex - 1];Line 10: possibleIndex--;Line 11: }Line 12: elements[possibleIndex] = temp;Line 13: }Line 14: }Consider the following three proposed changes to the code:Change 1Replace line 3 with:Line 3: for (int j = elements.length - 2; j >= 0; j--)Change 2Replace line 7 with:Line 7: while (possibleIndex > 0 && temp > elements[possibleIndex - 1])Change 3Replace line 7 with:Line 7: while (possibleIndex < elements.length - 1 && temp < elements[possibleIndex + 1])and replace lines 9-10 with:Line 9: elements[possibleIndex] = elements[possibleIndex + 1];Line 10: possibleIndex++;Suppose that you wish to change the code so that it correctly sorts the integers in elements into descending order rather than ascending order. Which of the following best describes which combinations of the proposed changes would achieve this goal?A) Enacting any of the three changes individuallyB) Enacting changes 1 and 2 together, or enacting change 3 by itselfC) Enacting changes 1 and 3 together, or enacting change 2 by itselfD) ONLY enacting changes 1 and 2 togetherE) ONLY enacting change 2 by itself Explain the effects of the slave trade in the Americas. Please Please Please and this question?Why has China s path to development been so complex? Answer this ques 300 words. Provide main points to answer. 8th-grade science 50 points What is the most important factor in determining whether a population will grow, shrink, or stay the same size? I am writing an essay for this and I need a starting point. I'm a little stumped on how to start and what to write so help would be VERY much appreciated. Sara has a home-based business and needs to produce professional looking documents. She's willing to pay more money for a high-quality, fast printer that produces sharp text and doesn't use too much ink. Which printer should she choose? Select your answer, then click Done. {X(t), t >0} is a pure birth process with X(0) = 0. Its birth rates lk are such that Ak = max(4-k, 0), k= 0, 1, 2, .... Let Wk = min{t: X(t) = k} be the waiting times. Find the variance of W1 + W2+W3. Solve the system of equations by graphing.9x2 48y2 = 96x2 + y2 = 169answer options (5, 12) (14, 6) (6, 14) (12, 5) Three widely used methods of allocating the cost of equipment over its useful life are Multiple-ChoiceA FIFO, UFO, and weighted average B. Straight line units-ot-production, and declining-balance C None of these are correct D Depreciation, location, amortration, and depletion The unit of account function of money refers to the Question 11 options: fact that money and income are the same thing. common denominator of measurement provided by money. characteristic that all money is intrinsically valuable. all of the above What problems could arise if some countries continue to usefossil fuels and others do not? Annual sales for a company are $125,000 and are increasing at a rate of 8% per year. What will this company's annual sales after 5 years In the lab, Amy has two solutions that contain alcohol and is mixing them with each other. She uses 3 times as much Solution A as Solution B. Solution A is 17% alcohol and Solution B is 14% alcohol. How many milliliters of Solution B does she use, if the resulting mixture has 520 milliliters of pure alcohol? Andres Michael bought a new boat. He took out a loan for $24,420 at 3.5% interest for 2 years. He made a $4,330 partial payment at 2 months and another partial payment of $2,600 at 6 months. How much is due at maturity? After his Political Science class, Andre only remembered the parts of his professor's lecture that he agreed with. This is an example of selective Since energy cannot be created, which arrow represents the energy that will be converted to chemical energy the chameleon can later use in seventh grade, petra was taught how to study and take notes, but she has never used those skills because she earned good grades without them. however, after failing her first two ap psychology exams, she begins to use these techniques for the first time and continues to use them after she is rewarded with higher grades. this is an example of Choose the right order of complexity (increasing order) of ai based on functionality. a. reactive machines b. self-awareness c. limited memory machines d. theory of mind Solve the equation. (Enter your answers as a comma-separated list. Use n as an arbitrary integer. Enter your response in radians.) tan2(x) + tan(x) 20 = 0 Which risk assessment category designates a space where procedures create the most danger to a patient? suppose that two people standing 2 miles apart both see the burst from a fireworks display. after a period of time, the first person standing at point a hears the burst. one second later, the second person standing at point b hears the burst. if the person at point b is due west of the person at point a and if the display is known to occur due north of the person at point a , where did the fireworks display occur?