Answer:
Cu3 (PO4)2
3×64 + 2×(31+ 4×16)
192 + 2×(31+64)
192 + 2×(95)
192+190
=382g
How much mass of sodium chloride ( ) should be dissolved in water to make 1.5 L of 0.75 M aqueous solution? The molar mass of is 58.5 g.
Answer:
Mass = 65.8 g
Explanation:
Given data:
Mass of sodium chloride = ?
Volume of solution = 1.5 L
Molarity of solution = 0.75 M
Solution:
Number of moles of sodium chloride:
Molarity = number of moles / volume in L
By putting values,
0.75 M = number of moles = 1.5 L
Number of moles = 0.75 M × 1.5 L
Number of moles = 1.125 mol
Mass of sodium chloride:
Mass = number of moles × molar mass
Mass = 1.125 mol × 58.5 g/mol
Mass = 65.8 g
the aka of a weak monoprotic acid is 1.31×10−5.1.31×10−5. what is the ph of a 0.0812 m0.0812 m solution of this acid?
The pH of a 0.0812 M solution of a weak monoprotic acid with an acid dissociation constant (Ka) of 1.31×10⁻⁵ is be calculated as 3.69
Step 1: Write the equation for the dissociation of the weak acid in water. HA(aq) + H₂O(l) ⇌H₃O⁺(aq) + A⁻(aq)
Step 2: Write the expression for the acid dissociation constant (Ka) for the weak acid. Ka = [H₃O⁺][A⁻] / [HA]
Step 3: Substitute the known values into the expression for Ka and solve for [H3O+].Ka = [H₃O⁺][A-] / [HA]1.31 × 10⁻⁵ = [H₃O⁺]2 / 0.0812[H₃O⁺] = 2.04 × 10⁻⁴ M
Step 4: Calculate the pH of the solution using the following equation: pH = -log[H₃O⁺]pH = -log(2.04 × 10⁻⁴)pH = 3.69
Therefore, the pH of a 0.0812 M solution of this weak monoprotic acid is 3.69.
To know more about pH, refer
https://brainly.com/question/12609985
#SPJ11
I NEED HELP PLS PLS PLS
1/10
Mixtures in which one ingredient dissolves in
another to form an uniform systerp are known
as suspensions.
Truth or false?
Answer:
True.
Explanation:
Suspensions are formed when a mixture is not fully dissolved in another mixture, and happens when solid particles can be seen floating on the surface of the mixture of the mixtures.
1) How many Faradays are needed to produce
(a) 2.70g of Al
(b) 6.0g of Mg
(c) 10g of H₂
(d) 71g of Cl
2) How many moles of electrons are required to produce by electrolysis:
(a) 27g of Al
(b) 8g of O₂
The amount of Faradays and moles of electrons are required to produce by electrolysis are calculated thus.
How to find Faradays and electrons?(a) The molar mass of Al is 26.98 g/mol, which means that one mole of Al will require 3 moles of electrons to be produced. To find out the number of Faradays needed to produce 2.70 g of Al, calculate the number of moles of Al:
moles of Al = mass of Al / molar mass of Al
moles of Al = 2.70 g / 26.98 g/mol
moles of Al = 0.100 mol
Faraday's law of electrolysis to calculate the number of Faradays needed:
Faradays = moles of substance / n
n = number of electrons per mole of substance
n for Al is 3, so:
Faradays = 0.100 mol / 3
Faradays = 0.0333 F
Therefore, 0.0333 Faradays are needed to produce 2.70 g of Al.
(b) The molar mass of Mg is 24.31 g/mol, which means that one mole of Mg will require 2 moles of electrons to be produced. To find out the number of Faradays needed to produce 6.0 g of Mg, calculate the number of moles of Mg:
moles of Mg = mass of Mg / molar mass of Mg
moles of Mg = 6.0 g / 24.31 g/mol
moles of Mg = 0.247 mol
Use Faraday's law of electrolysis to calculate the number of Faradays needed:
Faradays = moles of substance / n
n = number of electrons per mole of substance
n for Mg is 2, so:
Faradays = 0.247 mol / 2
Faradays = 0.1235 F
Therefore, 0.1235 Faradays are needed to produce 6.0 g of Mg.
(c) The molar mass of H₂ is 2.02 g/mol, which means that one mole of H₂ will require 2 moles of electrons to be produced. To find out the number of Faradays needed to produce 10 g of H₂, calculate the number of moles of H₂:
moles of H₂ = mass of H₂ / molar mass of H₂
moles of H₂ = 10 g / 2.02 g/mol
moles of H₂ = 4.95 mol
Now use Faraday's law of electrolysis to calculate the number of Faradays needed:
Faradays = moles of substance / n
n = number of electrons per mole of substance
n for H₂ is 2, so:
Faradays = 4.95 mol / 2
Faradays = 2.475 F
Therefore, 2.475 Faradays are needed to produce 10 g of H₂.
(d) The molar mass of Cl₂ is 70.91 g/mol, which means that one mole of Cl₂ will require 2 moles of electrons to be produced. To find out the number of Faradays needed to produce 71 g of Cl₂, calculate the number of moles of Cl₂:
moles of Cl₂ = mass of Cl₂ / molar mass of Cl₂
moles of Cl₂ = 71 g / 70.91 g/mol
2 (a) To produce 27g of Al by electrolysis, calculate the number of moles of Al and then use the equation:
1 mole of Al + 3 moles of e⁻ → 1 mole of Al³⁺
Molar mass of Al = 27 g/mol
Number of moles of Al = 27 g / 27 g/mol = 1 mole
Therefore, 3 moles of electrons are required to produce 1 mole of Al.
To produce 27g of Al:
3 moles of e⁻ / 1 mole of Al × 1 mole of Al = 3 moles of e⁻
So, 3 moles of electrons are required to produce 27g of Al by electrolysis.
(b) To produce 8g of O₂ by electrolysis, calculate the number of moles of O₂ and then use the equation:
2 moles of H₂O + electricity → 2 moles of H₂ + 1 mole of O₂
Molar mass of O₂ = 32 g/mol
Number of moles of O₂ = 8 g / 32 g/mol = 0.25 mole
Therefore, 0.5 moles of electrons are required to produce 0.25 mole of O₂.
To produce 0.25 mole of O₂:
0.5 moles of e⁻ / 1 mole of O₂ × 0.25 mole of O₂ = 0.125 moles of e⁻
So, 0.125 moles of electrons are required to produce 8g of O₂ by electrolysis.
Find out more on Faradays here: https://brainly.com/question/1640558
#SPJ1
Energy stored in bonds of molecules is called:
a. chemical
b. nuclear
c. light
d. none of these
Answer:
a. chemical
Explanation:
Chemical energy is energy stored in the bonds of atoms and molecules.
Part B: Short Answer - Answer the following questions
6. Why are the elements so important?
7. The transition metal Cobalt has an atomic number of 27 and an atomic mass of approximately 59
AMU. How many neutrons does it have? Show all your calculations for full marks.
I
28
tv
I need help fast 50 points
Answer:
7. 32neutrons
Explanation:
mass number is equal to number of protons plus the number of neutrons
the atomic number is also known as the number of protons
therefore 59-27=32
A sugar solution has a concentration of 4grams/litre what volume of the solution is in a beaker if the total amount of sugar in the beaker is 2grams
The volume of the sugar solution in the beaker is 0.5 liters.
The question at hand involves finding the volume of a sugar solution that has a concentration of 4 grams per liter when the total amount of sugar in the beaker is 2 grams.
Here is the solution:Let V be the volume of the sugar solution in the beaker. The concentration of sugar is 4 grams/liter. Thus, the total amount of sugar in V liters of the sugar solution is 4V grams of sugar. The problem states that the total amount of sugar in the beaker is 2 grams.
Therefore:4V = 2V = 2/4 = 0.5 liters. Therefore, the volume of the sugar solution in the beaker is 0.5 liters.
:The volume of the sugar solution in the beaker is 0.5 liters.
To know more about sugar solution visit:
brainly.com/question/2632762
#SPJ11
Can someone help its confusing
Answer:
It's a metaphor. It's comparing Jordan and their emotions to a tornado
If a 3.1g ring is heated using 42 J, its temperature rises 17.9°C. Calculate the
specific heat capacity of the ring.
Answer:
0.756 J/g°C
Explanation:
The specific heat capacity of any material is defined as the quantity of heat (J) absorbed per unit of mass (kg) with an increase in temperature is 1 °C.
Specific heat capacity is defined as:
\(S = \frac{Q}{m*deltaT}\)
given, Q = 42J, m(mass) = 3.1g and ΔT = 17.9 °C
\(S = \frac{42.0}{3.1*17.9}\)
S = 0.756 J/g°C
Balance the following:
Reactants Products
B2+ _W2->BW3
Answer: B2 + 3W2 ---> 2BW3
Explanation:
You have 2 B on the right and 1 B on the left to balance out B, you need to add 2 wich gives you 6 W on the left and 2 W on the right. To baance W on both sides you add a 3 to the W on the right which gives you 6 W on both sides.
Which statement describes the difference between metallic bonds and Van der Waals forces? O
A. Metallic bonds hold nonpolar molecules together, while Van der Waals forces hold positive ions and freely moving valence electrons together. O
B. Metallic bonds cause an attraction between partially positive and partially negative atoms, while Van der Waals forces hold nonpolar molecules together
C. Metallic bonds hold metal atoms and freely moving valence electrons together, while Van der Waals forces hold nonpolar molecules together
OD. Metallic bonds hold metal atoms and freely moving valence electrons together while Van der Waals forces hold atoms together when they share valence electrons.
Answer: C
Explanation: Just took the test on a.p.e.x.
Answer:
O C. Metallic bonds hold metal atoms and freely moving valence electrons together, while Van der Waals forces hold nonpolar molecules together.
Explanation:
Guys help me pls
Which of type of elements are mainly gases at room temperature, dull and
brittle with low melting points?
draw the structures of the precursors to hexan-3-ol given the reagents below.
In order to draw the structures of the precursors to hexan-3-ol, we need to know the reagents involved in the reaction. Without this information, we cannot accurately draw the structures. However, we can provide a brief explanation of the process involved in the formation of hexan-3-ol.
Hexan-3-ol is an alcohol with the molecular formula C6H14O. It can be synthesized from various precursors, such as alkenes or aldehydes, through a process called hydroboration-oxidation. This reaction involves the addition of borane (BH3) to the double bond of the precursor, followed by oxidation with hydrogen peroxide (H2O2) and sodium hydroxide (NaOH).
The structures of the precursors will depend on the specific reagents used in the reaction.
To synthesize hexan-3-ol, we can start with two precursors: a 5-carbon alkyl halide, such as 1-bromopentane, and a 1-carbon nucleophile, such as sodium cyanide (NaCN). The structures of these precursors are as follows:
1-bromopentane: CH3-CH2-CH2-CH2-CH2-Br
Sodium cyanide: Na+ [C≡N]-
These precursors can react through a nucleophilic substitution (SN2) mechanism. The cyanide ion acts as the nucleophile, attacking the carbon bonded to the bromine atom in 1-bromopentane, displacing the bromide ion. This results in the formation of pentanenitrile (CH3-CH2-CH2-CH2-CH2-C≡N).
Next, the pentanenitrile can be reduced to hexan-3-ol using a reducing agent such as LiAlH4 (lithium aluminum hydride) or a catalytic hydrogenation process. The structure of hexan-3-ol is: CH3-CH2-CH2-CH(OH)-CH2-CH3.
To know more about precursors visit:
https://brainly.com/question/7783428
#SPJ11
00000044m
300000km/s
Both in scientific notation
Answer:
4.4 × 10^-7
3 × 10^5
Explanation:
scmack me wit dat brainliest
The procedure for making zeolite is carried out in an acidic medium. T/F
The given statement "The procedure for making zeolite is carried out in an acidic medium" is true because the process of making zeolite involves the use of an acid treatment step to remove the template molecule and promote the crystallization of the zeolite structure.
The procedure for making zeolite involves using a precursor material, such as alumina, silica, or a mixture of both, and treating it with an alkaline solution in the presence of an organic template molecule. The resulting mixture is then heated and treated in an acidic medium to form the zeolite structure.
The acidic medium is necessary to remove the organic template molecule and to promote the crystallization of the zeolite structure. This process is known as "dealumination" and involves the removal of aluminum atoms from the zeolite framework, creating a more porous structure that is better suited for certain industrial applications, such as catalysis.
To know more about the Zeolite, here
https://brainly.com/question/28588461
#SPJ4
one calorie (cal) is the amount of heat needed to (fill in the blank) the temperature of one gram of water one degree celsius.
Answer:
Raise
Explanation:
One calorie (cal) is the amount of heat needed to raise the temperature of one gram of water one degree Celsius.
this is actually science but anyways my teacher didn't explain much can someone help?
How do I solve the liters and grams in the mole calculations
describe Transpiration
Answer:
is the process of water movement through a plant and its evaporation from aerial parts, such as leaves stems and flowers.
Answer:
well in easy terms... its just like the loss of water from the leaves or other parts of a plant due to evaporation
Explanation:
Water is necessary for plants but only a small amount of water taken up by the roots is used for growth and metabolism.
Which statement describes what happens in a chemical reaction?
Answer: pic
Explanation:
plz
Answer:
4. matter is neither created nor destroyed
Explanation:
The Law of Conservation of Mass dates from Antoine Lavoisier's 1789 discovery that mass is neither created nor destroyed in chemical reactions. In other words, the mass of any one element at the beginning of a reaction will equal the mass of that element at the end of the reaction.
1. Hydrogen gas can be produced through the following reaction. Mg(s) + 2HCl(aq) Ã MgCl2(aq) + H2(g) c. How many grams of HCl are consumed by the reaction of 2.50 moles of magnesium? 182g HCl d. What is the mass in grams of H2 gas when 4.0 moles of Hcl is added to the reaction
The equation for the reaction is \(Mg(s) + 2HCl(aq)AMgCl2(aq) + H_2(g).\)
What is reaction?Reaction is the response of a system to an external stimulus. It is an action or a process that occurs as a result of an event or situation. Reactions are a way of adapting to the environment and can be physical, chemical, or biological. Physical reactions involve changes in the environment, such as an increase in temperature or pressure.
When 2.50 moles of magnesium reacts, the amount of HCl consumed is 2.50 moles (1 mole of Mg for every 2 moles of HCl). Since 1 mole of HCl has a mass of 36.5 g, the mass of HCl consumed by the reaction of 2.50 moles of magnesium is 2.50 x 36.5 = 91.25 g.
When 4.0 moles of HCl is added to the reaction, the mass of H₂ gas produced is 4.0 x 2 = 8 moles of H₂ gas.
Since 1 mole of H₂ gas has a mass of 2.02 g, the mass of H₂ gas produced when 4.0 moles of HCl is added to the reaction is
8 x 2.02
= 16.16 g.
To learn more about reaction
https://brainly.com/question/25769000
#SPJ4
Which set of elements has similar binding properties?
A: Cl ,Br and F
B:K, Ca, and Sc
C:Kr, Cl, and O
D:Be, C, and O
Answer:
B. K,Ca, and Sc
Explanation:
PLZ mark me as a BRAINLIEST
what is the land part of the earth called?
Answer:
Lithosphere - Earth
The lithosphere contains all of the cold, hard solid land of the planet's crust (surface), the semi-solid land underneath the crust, and the liquid land near the center of the planet.
Explanation:
Calculate the mass, in g, of 49.5ml of silver. take the density of silver to be 10.49 kg/l. omit the units when entering your solution (i.e., input a numerical solution).
The mass of 49.5 mL of silver can be calculated using the given density of silver as 10.49 kg/L.
To convert the volume from mL to L, we divide by 1000:
Volume of silver = 49.5 mL / 1000 = 0.0495 L
Next, we can use the density formula: density = mass / volume, to calculate the mass of silver:
mass = density * volume = 10.49 kg/L * 0.0495 L = 0.519855 kg
Since the question asks for the mass in grams, we can convert the mass from kilograms to grams by multiplying by 1000:
mass = 0.519855 kg * 1000 = 519.855 g
Therefore, the mass of 49.5 mL of silver is approximately 519.855 grams.
Learn more about density of silver from the given link: https://brainly.com/question/29896926
#SPJ11
xam
What do we
call the type of
reflection in
the upper
image?
A. Diffuse reflection
B. Rough reflection
C. Specular reflection
D. Obtuse reflection
Answer:
Specular reflection is correct answer by my views
hope it helps you
20 POINTS!!
__________ aid the immune system in mounting attacks against cancer cells by targeting antigens only found on the surface of cancer cells.
A. Monoclonal antibodies
B. Interferons
C. CRISPR
D. Vaccines
E. Interleukins
Answer:
B. Interferon
Explanation:
interferon targets any lingering melanoma cells and prevents them from spreading and growing.
Cu2(s)+O2(g)=Cu2O(g)+SO2(g)
please help urgent will give brainiest
Answer:
2 Cu2S + 3 O2 = 2 Cu2O + 2 SO2
Explanation:
2 Cu2S + 3 O2 = 2 Cu2O + 2 SO2
which substance is a Brønsted-Lowry conjugate acid? HClO4(aq)+H2O(l)→H3O+(aq)+ ClO4-(aq)
Answer:
Explanation:
(a) C5H5N(aq)+H2O(l)⇌C5H5NH+(aq)+OH−(aq)
(free question so use your creativity!!)
Physical science is the ____________ class in the world!
Answer:
Best
Explanation:
physical, best, greatest.