Classify each of the following as an element, a compound,or a mixture, copper,water, nitrogen,and sulfur

Answers

Answer 1

Answer: copper, nitrogen,and sulfur : element

water : compound

Explanation:

Element is a pure substance which is composed of atoms of similar elements.It can not be decomposed into simpler constituents using chemical reactions. Example: Sulphur (S), copper (Cu), Nitrogen (N).

Compound is a pure substance which is made from atoms of different elements combined together in a fixed ratio by mass.It can be decomposed into simpler constituents using chemical reactions. Example: water \((H_2O)\)


Related Questions

The molarity (m) of a solution refers to

Answers

The molarity(m) of a solution means number of moles of solute by volume of solution in litres.

Molarity is the molar concentration of a solution measured in moles of solute per liter of solution. Solution molarity is the number of moles of solute dissolved in 1 liter of solution. To calculate the molarity of a solution, divide the moles of solute by the volume of the solution, expressed in liters.

Molarity is the amount of a substance in a given volume of solution. Molarity is defined as the number of moles of solute per liter of solution. Molarity is also called the molarity of a solution. Divide the moles of solute by the total volume of the solution in liters. The ratio of the volume occupied by a substance to the amount of substance, usually given at a specific temperature and pressure.

Learn more about Molarity here:-https://brainly.com/question/26873446

#SPJ1

5.86 ■ Liquid oxygen for use as a rocket fuel can be produced by cooling dry air to −183°C, where the O2 condenses. How many liters of dry air at 25°C and 750 torr would need to be processed to produce 150 L of liquid O2 at −183°C? (The mole fraction of oxygen in dry air is 0.21, and the density of liquid oxygen is 1.14 g/mL.)

Answers

Approximately 631.5 liters of dry air at 25°C and 750 torr would need to be processed to produce 150 liters of liquid \(O_2\) -183°C.

To solve this problem, we need to consider the ideal gas law and the molar volume of gases.

First, we can calculate the number of moles of oxygen in 150 L of liquid \(O_2\) at -183°C. To do this, we divide the mass of liquid oxygen by its molar mass:

Mass of liquid oxygen = volume of liquid oxygen * density of liquid oxygen = 150 L * 1.14 g/mL = 171 g

Molar mass of oxygen (O2) = 32 g/mol

Number of moles of oxygen = mass of oxygen / molar mass of oxygen = 171 g / 32 g/mol ≈ 5.34 mol

Since the mole fraction of oxygen in dry air is given as 0.21, we can calculate the total moles of dry air needed to produce 5.34 mol of oxygen:

Moles of dry air = moles of oxygen / mole fraction of oxygen = 5.34 mol / 0.21 ≈ 25.43 mol

Now, we can use the ideal gas law to calculate the volume of dry air at 25°C and 750 torr (convert to atm) that corresponds to 25.43 mol:

PV = nRT

P = 750 torr * (1 atm / 760 torr) ≈ 0.987 atm

V = volume of dry air (unknown)

n = 25.43 mol

R = 0.0821 L·atm/(mol·K)

T = 25°C + 273.15 = 298.15 K

Solving for V:

V = nRT / P = (25.43 mol)(0.0821 L·atm/(mol·K))(298.15 K) / 0.987 atm ≈ 631.5 L

For more such questions on dry air visit:

https://brainly.com/question/14247097

#SPJ8

write a balanced chemical equation for the decomposition of asprin

Answers

The balanced chemical equation for the decomposition of aspirin (acetylsalicylic acid) is:

\(2C_{9}H_{8}O_{4} (aspirin) → 2C_{7}H_{6}O_{3} (salicylic acid) + 2CO_{2} (Carbon dioxide) + H_{2}O (water)\)

In this reaction, the aspirin molecule breaks down into salicylic acid, carbon dioxide, and water. The reaction is typically catalyzed by heat or exposure to acidic or basic conditions.

Aspirin, or acetylsalicylic acid, contains ester functional groups that can undergo hydrolysis. Under suitable conditions, the ester bond in aspirin is cleaved, leading to the formation of salicylic acid, which is the primary decomposition product. Additionally, carbon dioxide and water are released as byproducts of the reaction.

The balanced equation shows that for every two molecules of aspirin, two molecules of salicylic acid, two molecules of carbon dioxide, and one molecule of water are formed. Understanding the decomposition of aspirin is important in pharmaceutical and chemical industries to ensure the stability and shelf-life of the compound, as well as to study its breakdown products and potential side reactions.

Know more about aspirin here:

https://brainly.com/question/13533428

#SPJ8

How many moles of Sb,03 will be formed when you have 20.0 moles of oxygen gases?

Answers

20.0 moles of oxygen react with Antimony to form 13.3 moles of Antimony (III) Oxide. We want to calculate how many moles of Antimony (III) Oxide will be formed from 20.0 moles of oxygen. This is a stoichiometry problem.

What is stoichiometry?

The link between the proportional amounts of components participating in a reaction or generating a compound is known as stoichiometry, and it is often expressed as a ratio of whole integers.

Assuming a balanced chemical equation, the stoichiometric ratio between Antimony (III) Oxide  and oxygen can be used to determine the number of moles of Antimony (III) Oxide  formed.

For example, the balanced equation for the reaction of Antimony with O2 to form Antimony (III) Oxide  is:

4 Antimony + 3 O2 → 2 Antimony (III) Oxide

From this equation, it can be seen that 3 moles of oxygen react with 2 moles of Antimony (III) Oxide . Therefore, if there are 20.0 moles of O2, then the number of moles of Antimony (III) Oxide  formed would be:

20.0 moles oxygen × (2 moles Antimony (III) Oxide  / 3 moles oxygen) = 13.3 moles Antimony (III) Oxide.

To know more about moles visit:-

https://brainly.com/question/26416088

#SPJ1

If 7 g of a gas at 2.0 ATM dissolves in 1 L of water at 25°C how much will dissolve in 2 L of water at 0.6 ATM if the temperature remains constant

Answers

The value of S2 is S₂ = 2.1 g/L.Approximately 2.1 g of the gas will dissolve in 2 L of water at 0.6 ATM, assuming the temperature remains constant.

To determine the amount of gas that will dissolve in 2 L of water at 0.6 ATM, we can use Henry's law, which states that the solubility of a gas is directly proportional to the partial pressure of the gas above the liquid.

According to Henry's law, the solubility of a gas can be represented as:S₁/P₁ = S₂/P₂,,where S₁ and S₂ are the solubilities of the gas at the respective pressures P₁ and P₂.Given that 7 g of the gas dissolves in 1 L of water at 2.0 ATM, we can consider this as our initial condition, denoted by S₁/P₁.

Now, we need to find the solubility at 0.6 ATM in 2 L of water, denoted by S₂/P₂.Since the temperature remains constant, we can assume that the solubility of the gas does not change. Therefore, we can rewrite the equation as:

S₁/P₁ = S₂/P₂,

Substituting the known values, we have:

(7 g/1 L)/(2.0 ATM) = S₂/(0.6 ATM),

Solving for S₂, we get:

S₂ = (7 g/1 L) * (0.6 ATM)/(2.0 ATM),

S₂ = 2.1 g/L.

For more such questions on temperature

https://brainly.com/question/4735135

#SPJ8

Fructose-1-phosphate can be hydrolyzed into fructose + inorganic phosphate (Pi) with a ΔG° of –16.0 kJ/mol. If ATP can be hydrolyzed into ADP + Pi with a ΔG° of –30.5 kJ/mol, what is the free energy change for the reaction of fructose + ATP → fructose 1-phospate + ADP

Answers

To calculate the free energy change (ΔG°) for the reaction of fructose + ATP → fructose 1-phosphate + ADP, we can use the concept of Gibbs free energy and apply the equation:

ΔG° (overall reaction) = ΔG° (sum of products) - ΔG° (sum of reactants)

Given:
ΔG° for the hydrolysis of fructose-1-phosphate = -16.0 kJ/mol
ΔG° for the hydrolysis of ATP = -30.5 kJ/mol

The reaction we want to calculate the ΔG° for is:

fructose + ATP → fructose 1-phosphate + ADP

From the given information, we can break down the reactants and products:

Sum of reactants:
fructose + ATP

Sum of products:
fructose 1-phosphate + ADP

Now, we can calculate the ΔG° for the overall reaction:

ΔG° (overall reaction) = ΔG° (sum of products) - ΔG° (sum of reactants)
ΔG° (overall reaction) = (-16.0 kJ/mol) + (-30.5 kJ/mol)

ΔG° (overall reaction) = -46.5 kJ/mol

Therefore, the free energy change (ΔG°) for the reaction of fructose + ATP → fructose 1-phosphate + ADP is -46.5 kJ/mol.

Solar and wind energy are both intermittent resources that cannot be relied upon for a constant stream of energy production. Explain why developing better ways to store energy is an important part of making these energy sources more practical to use.

Answers

By removing the need to build additional transmission lines and equipment, energy storage may reduce costs for utilities and their customers.

By removing the need to build additional transmission lines and equipment, energy storage may reduce costs for utilities and their customers. Energy storage's inherent ability to offer backup power in the event of grid failure is a feature that both residential consumers and commercial owners find highly desirable.

To know more about energy, here:

https://brainly.com/question/1932868

#SPJ1

The meaning of the word symptom:​

Answers

The word "symptom" refers to a specific manifestation or indication of a condition, disease, or disorder that is experienced or observed by an individual.

Symptoms are subjective or objective changes in the body's normal functioning that may be recognized as abnormal, uncomfortable, or problematic. Symptoms can manifest in various ways depending on the nature of the underlying condition. They can be physical, such as pain, rash, cough, fever, or fatigue, indicating an illness or injury affecting the body. Symptoms can also be psychological, such as anxiety, depression, or confusion, reflecting disturbances in mental health.

Symptoms serve as important clues for medical professionals to identify and diagnose diseases or disorders. They provide valuable information about the nature, severity, and progression of an illness, helping healthcare providers formulate appropriate treatment plans. Additionally, symptoms may also be important for individuals to self-assess their own health status and seek appropriate medical attention.

It is essential to note that symptoms alone may not provide a definitive diagnosis, as they can overlap across different conditions. Further evaluation, including medical tests and examinations, is often necessary to confirm a diagnosis and determine the appropriate course of action.

for more such questions on symptom

https://brainly.com/question/21078887

#SPJ8

A physical change does not involve a change in the substance’s chemical identity. Which of these statements describes a physical change?
Group of answer choices

A banana starts to smell as it ripens.

Onions taste sweeter after being cooked.

Aluminum cans get crushed before recycling.

Copper turns green when exposed to air.

Answers

Answer: the answer is C Aluminum cans get crushed before recycling.

Explanation:

Answer:

it will option C because it had no change in chemical reaction

Compared to the number of electron shells and radius of an aluminum atom in the ground state a boron atom in the ground state has ?

Answers

Fewer electron shells exist for boron. Smaller radius results from fewer electron shells.

The total distance from an atom's nucleus to its outermost electron orbital is typically defined as the atomic radius. It can be described more simply as something akin to the radius of a circle, with the nucleus acting as the circle's centre and the outermost orbital of the electron as the circle's perimeter. Trends that help explain how atomic radii change start to appear as you start moving across or down the periodic table. The radius of atoms increases as you move down a particular group in the periodic table of elements because an atom grows larger as the number of electronic shells increases. In general, when you move from the left to the right of a particular period, an atom's size will decrease.

Let's start by looking up aluminium and boron on our reference table's periodic table. The numbers 13 and 5 correspond to aluminium (Al) and boron (B).

While boron is in the second period and has two electron shells, aluminium is in the third period (row) and has three. Borium thus has fewer electron shells. Smaller radius results from fewer electron shells.

For more such questions on electrons , Refer:

https://brainly.com/question/371590

#SPJ4

A ________ force is the total force felt by the object.
sum
net
strong
balanced

Answers

Answer:

the answer is net

Explanation:

here the help

net would be the answer

HELP ME PLSSSSSSSSSSSSAA

HELP ME PLSSSSSSSSSSSSAA

Answers

Answer:

If capital R is round, than the RR and Rr will mean round, and the two rr's are wrinkled. that means the answer to both is 50%

Explanation:

hope that helps

Which specialized structures allow dolphins to breathe?
A. Watertight eggs
O B. Gills
C. Lungs
D. Milk-producing glands

Which specialized structures allow dolphins to breathe?A. Watertight eggsO B. GillsC. LungsD. Milk-producing

Answers

Answer:

lungs

Explanation:

they don't have gills, and the milk producing glands and watertight eggs have nothing to do with it

Answer:

lungs

Explanation:

dolphins are mammals not fish


Atoms of the main group elements either gain or lose electrons so they have eight electrons in the outermost energy level. In
doing so, they attain a noble gas electron configuration. Match these elements with the number of electrons they gain or
lose. Consult the periodic table to help answer the question.
Drag each tile to the correct box.
Ma

Answers

Answer:

Hey there can you post the complete question ,i cannot find any element

Answer:

Explanation:

PLATO ANSWER

Atoms of the main group elements either gain or lose electrons so they have eight electrons in the outermost

Find the volume of 0.7 mol of butane gas at STP.

Find the volume of 0.7 mol of butane gas at STP.

Answers

STP stands for Standard Temperature and Pressure, so a gas in STP conditions are at a set of Temperature and Pressure that are standardized.

The STP are standards, so they can change. The STP changed years ago, but sometimes the old STP are used.

The old STP conditions were defined as 1 atm pressure and 273.15 K temperature. In such conditions, 1 mol of gas (assuming ideal gas) oocupies approximately 22.4 L.

The currect STP conditions are 1 bas pressure and 273.15 K temperature. In such conditions, 1 mol of gas (assuming ideal gas) occupies approximately 22.7 L.

Since we have options, we can test which STP the question is using.

We can do this as a rule of three.

Using the old STP, we have:

Volume ---- Number of moles

V ---- 0.7 mol

22.4 L ---- 1.0 mol

\(\begin{gathered} \frac{V}{22.4L}=\frac{0.7}{1} \\ V=0.7\cdot22.4L \\ V=15.68L \end{gathered}\)

Using the new STP, we would have:

Volume ---- Number of moles

V ---- 0.7 mol

22.7 L ---- 1.0 mol

\(\begin{gathered} \frac{V}{22.7L}=\frac{0.7}{1} \\ V=0.7\cdot22.7L \\ V=15.89L \end{gathered}\)

As we can see, although the correct STP to use currenctly is the second one, we only have answer for the old STP.

So, the correct option in this question is 15.68 L (using the old STP).

What would be the volume in liters of an 25.15 liter sample of gas at 201 °C and 2.31 atm if conditions were changed to STP?

Answers

The volume of the gas at STP would be 23.93 liters.

The volume of gas at STP (Standard Temperature and Pressure), we need to use the Ideal Gas Law, which states that PV = nRT, where P is pressure, V is volume, n is the number of moles of gas, R is the gas constant, and T is temperature. First, we need to calculate the number of moles of gas in the initial sample. We can use the formula n = PV/RT, where P is the initial pressure, V is the initial volume, R is the gas constant, and T is the initial temperature.
n = (2.31 atm) x (25.15 L) / [(0.0821 L atm/mol K) x (201 + 273.15 K)]
n = 1.067 moles

Now, we can use the molar volume of gas at STP, which is 22.4 L/mol, to calculate the volume of gas at STP.
V = n x 22.4 L/mol
V = 1.067 moles x 22.4 L/mol
V = 23.93 L
Therefore, the volume of the gas at STP would be 23.93 liters.

For more such questions on gas

https://brainly.com/question/25736513

#SPJ11

31. Adding an additional oxygen atom to 02 creates....
ozone
oxygen
methane
CFC

PLEASE HELP

Answers

It creates chlorofluorocarbons(CFCs) also would create biooxygen but in the multiple choice it only shows the CFCs

Answer:

a

Explanation:

Neutralization is a type of chemical reaction in which an acid and a base react with each other to form water and a salt.
Calculate the % yield of a reaction that combined 28.0 grams of sodium hydroxide with 125.0 mL of 3.10 M solution of sulfuric acid hat produced 24.5 g of Na2SO4 in the laboratory.

Balanced equation:
2 NaOH + H₂SO4 → Na₂SO4 + 2 H₂O

Answers

The percent yield of the reaction is 45.44%

Percentage yield is basically,

 \(\rm Percent\ yield\ = \frac{actual\ yield}{theoretical\ yield} \times 100\)

2 NaOH + H₂SO₄ → Na₂SO₄ + 2 H₂O

To calculate the theoretical yield, consider the stoichiometry of the reaction.

2 moles of NaOH reacts with 1 mole of H₂SO₄ to give 1 mole of Na₂SO₄ and 2 moles of H₂O. The mole ratio of H₂SO₄ and Na₂SO₄ is 1:1

For this mole ratio to be useful, convert the given concentration of H₂SO₄ into moles.  

     \(\rm Molarity\ =\ \frac{No.\ of\ moles}{Volume\ of\ solution (L)}\)

            \(\rm 3.10\ =\ \frac{No.\ of\ moles}{0.125}\)

\(\rm No.\ of\ moles\ =\ 3.10 \times 0.125\\)

                     \(=\ 0.38\)

Since, mole ratio of H₂SO₄ and Na₂SO₄ is 1:1

Amount of Na₂SO₄ formed would be also 0.38 mol

Convert this amount in moles to amount in grams

\(\rm No.\ of\ moles\ =\ \frac{Mass\ formed\ }{Molecular\ mass}\)

\(\rm Mass\ formed\ =\ No.\ of\ moles\times molecular\ mass\)

                     \(\rm =\ 0.38\times 142.04\)

                     \(\rm =\ 53.97\ grams\)

Theorical yield of Na₂SO₄ is 53.97 grams

Therefore,   \(\rm Percent\ yield\ = \frac{actual\ yield}{theoretical\ yield} \times 100\)

                                          \(\rm =\ \frac{24.5}{53.97}\times 100\)

                                          =  45.44%

The percent yield of the reaction is 45.44%

To know more on percent yield, click on

https://brainly.com/question/12704041

#SPJ1

Electrons farther away from the nucleus in an atom have _______ compared to those closer to the nucleus.Question options:A) lower energyB) higher energyC) higher or lower energy, depending on the elementD) the same energy

Answers

Answer

B) higher energy

Explanation

The closer the electrons are to the nucleus, the lower the energy level. The farther the electrons are from the nucleus, the higher the energy level. In the lowest energy level, only one orbital exists that can carry a maximum of two electrons.

Therefore, electrons farther away from the nucleus in an atom have higher energy compared to those closer to the nucleus.

The correct answer is option B) higher energy

Why was the morning session stopped unsuccessfully?

The reactor was overheating.
The automatic control system was not adjusted properly.
The vernier control rod became stuck.
The emergency rod failed.

Answers

Answer:

the reactor was overheating

Identify three ways you could increase the rate of an aspirin tablet dissolving in a glass of water.

Answers

Answer:

If you are trying to dissolve a substance, you have three primary avenues to increase the dissolution rate: decreasing the particle size of the solid, increasing the temperature and/or increasing the mixing or stirring rate.

Explanation:

help please i have 5 minutes to do this !!!

help please i have 5 minutes to do this !!!

Answers

Answer:

A) One that occurs on its own

Determine the empirical formula. a 3.880g sample contains 0.691g of magnesium , 1.84 g of sulfur , and 1.365 g of oxygen .

Answers

Answer:

Mg S2 O3

Explanation:

.691 g of Mg  is .284 mole

1.84 g of S    is .5739 mole

1.365 g of O is  .8531 mole      you can see the ratio is ~  1 :2 :3

                                                        Mg S2 O3

A .60 L sample of nitrogen is heated from 27℃ to 77℃ at a constant pressure. What is the final volume of the gas?

(show work please)

Answers

Answer:

CHARLES' LAW

given:

= 600 mL = 0.6 L

= 27 °C = 300.15 L

= 77 °C = 350.15 L

conversion:

= 600 mL (1 L / 1000 mL)

= 0.6 L

= 27 °C + 273.15 K

= 300.15 K

= 77 °C + 273.15 K

= 350.15 K

solution:

= ( × ) ÷

= (0.6 L × 350.15 K) ÷ 300.15 K

= 0.7 L

9.In the reaction 2 Na(s) + Br2 ---> 2 NaBr(s). the (s) stands for...Select one:a. soft sodium.b. solid.c. solution.d. synthesis.

Answers

Answer:

\(B\text{ : solid}\)

Explanation:

Here, we want to what the s stands for

In the equation of reaction, s represents the state of reaction of the reactant

We have that as solid state

When Carl Woese developed the modern system of classification, he broke the previous kingdom of into the two kingdoms of Bacteria and Archaea

Answers

Answer:

the answer is monerans

Explanation:

When Carl Woese developed the modern system of classification, he broke the previous kingdom of Monera into the two kingdoms of Bacteria and Archaea.

What kingdom of Monera ?

Some biologists believed it made sense to classify prokaryotes as belonging to their own kingdom, the Monera. That served as the foundation for Richard Whittaker  and Lynn Margulis's five-kingdom proposal, which enhanced the Haeckel plan by include a kingdom of fungus.

Protists, protozoa, monera, fungi, and viruses have long been proposed as belonging to different kingdoms, but traditional evolutionists during the majority of the 20th century had given none of them any thought.

Later, the Monera kingdom was split into Eubacteria and Archaebacteria by Carl Woese .  Moreover, he divided the five kingdoms into three domains: Eukaryotes, Archaea, and Bacteria.

Find more on Kingdom Monera:

https://brainly.com/question/30621598

#SPJ3

Your question is incomplete. But your complete question is as follows:

When Carl Woese developed the modern system of classification, he broke the previous kingdom of into the two kingdoms of  _____  into  Bacteria and Archaea.

Since models are representations, they have limits on how precisely they describe reality. Consider your model. What approximations or assumptions does your model contain? How does each one limit your model’s explanatory power?

Answers

Some assumptions which can limit how much a model closely replicates reality is that a model can only have a finite number of factors, in most cases, models assume these factors to be static. This limits the model's explanatory power because, in life, factors can be vast and dynamic.

What is Scientific Model?

A scientific model is a rendition or portrayal that can be in the mathematical form or physical form, of an idea, a system of ideas or various kinds of processes or events.

The various types of models are:

Computer modelsMathematical models (such as equations)Visual models (such as diagrams etc.)

See the link below for more about Scientific Models:
https://brainly.com/question/18603376

Answer:A model is a representation of an economic theory based on logical relationships using economic variables. Option (a) is wrong because a model is not an exact representation of reality; otherwise, there will be no requirement of building an economic model.

How many seconds are in72 milliseconds?Give your answer in standard form.Ent

How many seconds are in72 milliseconds?Give your answer in standard form.Ent

Answers

1) Convert milliseconds to seconds.

1 s = 1000 ms

\(s=72\text{ }ms*\frac{1\text{ }s}{1000\text{ }ms}=0.072\text{ }s\)

72 ms is equal to 0.072 s.

A 125 g sample of ground beef contains 26.2 grams of protein and 31.5 grams of fat. Assume the ground beef contains only protein, fat, and water.
a. How many grams of water are in the beef sample?
b. Calculate the percentage of fat, by mass, in the ground beef.
c. Calculate the percentage of water, by mass, in the ground beef.
d. Calculate the percentage of protein, by mass, in the sample of beef?
e. How many grams of fat are in a 6.2 oz sample of this beef

Answers

There are 67.3 grams of water (a), the percentage of fat is 25.2%  (b), the percentage of water is  53.84% (c), the percentage of protein is 20.96%(d), and there are grams of fat  44.22 grams(e).

How many grams of water are there?

26.2 + 31.5 = 57.7 - 125 = 67.3 grams of water

What percentage does each nutrient represent?


Knowing the total 125 represents 100%, let's calculate the percentages:

Fat: 31.5 x 100 /125 = 25.2%

Protein: 26.2 x 100 / 125 = 20.96%

Water: 67.3 x 100 / 125 = 53.84%

How many grams of fat are there in a 6.2 oz sample of this beef?

6.2 ounces = 175.76 grams (1 ounce = 28.34 grams)

125 = 31.5

175.75 = x

x = 31.5 x 175.5 / 125 = 44.22 fat grams

Learn more about nutrients in https://brainly.com/question/1268939

#SPJ1

A contest asks entrants to guess how many tennis balls can fit in a rectangular swimming pool that is 4 feet deep. The pool is 98 feet long and 35 feet across. Each tennis ball takes up 8 cubic inches of space. Which of the following would make the best scale model of the pool?

Answers

So the total volume is 1035 cubic meters. A tennis ball, according to the International Tennis Federation (ITF), has the official diameter of 6.54–6.86 cm.

What is International Tennis Federation?

The International Tennis Federation (ITF) is the organization in charge of wheelchair tennis, beach tennis, and international tennis. The International Lawn Tennis Federation was established in 1913 by twelve national tennis associations. The ITF has 211 national associations and six regional associations as of 2016.

The ITF's governance duties include upholding and implementing tennis regulations, overseeing global team events, marketing the game, and protecting the integrity of the sport through anti-doping and anti-corruption initiatives. The Women's Tennis Association (WTA) and the Association of Tennis Professionals (ATP) are partners with the ITF in governing professional tennis.

The ITF coordinates annual team tournaments for men's (Davis Cup), women's (Billie Jean King Cup), and mixed teams (Hopman Cup) as well as the Grand Slam events.

To learn more about International Tennis Federation from the given link:

https://brainly.com/question/18076254

#SPJ4

Other Questions
DIRECTIONS: Matching Match each item with its description.Put responses in the correct input to answer the question. Select a response, navigate to the desired input and insert the response. Responses can be selected and inserted using the space bar, enter key, left mouse button or touchpad. Responses can also be moved by dragging with a mouse.period of artistic and intellectual activityperiod between a.d. 500 and 1500capital of the eastern Roman Empireindependent country located within the city of Rome. powerful Greek city-stateThe option "Middle Ages" (1 of 5) has been selected. Press tab to choose a response area, and spacebar to insert it. Press escape to cancel. "The founders of legalism." Which sentence from the section shows why Confucian scholars disapproved of Li Si? What is the slope of the line shown in the graphA). -1B). -2C). -1/2D). 2 Research suggests that children will usually model what parents. Which of the following describes how Harrison feels about his handicaps?He believes they have failed to make him equal to others.He believes they have made him weaker than others.He thinks everyone but him should wear handicaps.He thinks they have made him stronger the nurse learns that a client with a seizure disorder has a serum phenytoin level of 35 mcg/ml. which action does the nurse take first? please help meplease look at both of the questions if you can the latest recommendations from the food and nutrition board are called:________ If xcos(x)= 2, find (-x) cos(-x) why might washington have been a good decision maker? China produces more - than any other nation i can't stand any kind of routine or repetition, or even having the same people around for an extended period of time without any kind of separation. how do i overcome this? I ___________ (see) a car accident yesterday. i ____________ (wait) on the corner for the green light. i __________ (pay attention) to the drivers and i ___________ (notice) something weird. then i ____________ (see) a sports car. the man driving the sports car _____________ (drive) very fast. he __________ (speed) actually! he __________ (want) to cut other drivers off! on the other street, a tow truck __________(start) to move forward. the driver of the sports car _________ (try) to stop but it ________ (be) too late. he _______(hit) the side of the tow truck. the man in the sports car ___________ (get out) of his car and he ________ (be) confused. he ___________ (have) a cut on his head and he ___________ (stumble) around. the man in the tow truck_________ (not be) hurt. he_________ (call) an ambulance with his cell phone. some people __________ (watch) from a distance, others __________ (help) the injured man. then the ambulance _________ (arrive). the paramedics _________ (drive) both men to the hospital, to make sure they were fine. fish swim to the surface of the water when a human nears the tank. which behavior is exhibited by the fish? HELP ASAP!! GIVING 30 POINTS!PLEASE ANSWER IN COMPLETE SENTENCESEven though doctors recommend checkups and preventative screening for some diseases, these visits and tests can be expensive for those who do not have health insurance to cover them. Pick one specific preventative health measure, such as yearly mammograms or six-month dental cleanings. Conduct some research on how much they cost and what can happen if they are neglected. Then, using what you discovered, write a paragraph that answers this question: How does a persons access to health care affect their health status? 10. Several genes in humans in addition to(1) give rise to recognizable antigens on the surface ofred blood cells. The MN and Rh genes are two exam-ples. The Rh locus can contain either a positive or anegative allele, with positive being dominant to nega-tive. M and N are codominant alleles of the MN gene.The following chart shows several mothers and theirchildren. For each mother-child pair, choose the fatherof the child from among the males in the right col-umn, assuming one child per male.a.b.C.d.MotherOM Rh(pos)B MN Rh(neg)OM Rh(pos)AB N Rh(neg)ChildB MN Rh(neg)ON Rh(neg)AM Rh(neg)B MN Rh(neg)MalesOM Rh(neg)AM Rh(pos)O MN Rh(pos)B MN Rh(pos) please help me with question 21 what is 4.6783 x 10 to the third power Hi,Question: "We Will Not Help Them" into Passive Voice White phosphorus is one of several forms of phosphorus and exists as a waxy solid consisting of P4 molecules. How many atoms are present in 0.350mol of P4? Answer should be in scientific notation.