classify N a + as cation, anion or neither

Answers

Answer 1
Na+ is a cation because it has a positive charge. Think of the t in cation as a + sign.

Related Questions

25POINTS!! useless answers will be reported

Assignment Summary
For this assignment, you will ask questions about the factors that have caused a rise in global
temperatures over the past century. Then, you will conduct research to answer your questions. You will
also graph provided information, analyze the graphs, and make conclusions based on the graphs. Finally,
you will write a paper describing the conclusions of your research and graphs.

Answers

Answer:

Life on Earth depends on energy coming from the Sun. About half the light reaching Earth's atmosphere passes through the air and clouds to the surface, where it is absorbed and then radiated upward in the form of infrared heat. About 90 percent of this heat is then absorbed by the greenhouse gases and radiated back toward the surface. Scientists attribute the global warming trend observed since the mid 20th century to the human expansion of the "greenhouse effect"  warming that results when the atmosphere traps heat radiating from Earth toward space.

Certain gases in the atmosphere block heat from escaping. Air pollution is the main cause of rise in temperature over the past century. Due to increase in the industrialization in different countries of the world and also burning of more fossil fuels in the engines of vehicles and jets are the main reasons for increasing global temperature. On Earth, human activities are changing the natural greenhouse. Over the last century the burning of fossil fuels like coal and oil has increased the concentration of atmospheric carbon dioxide (CO2). This happens because the coal or oil burning process combines carbon with oxygen in the air to make CO2. To a lesser extent, the clearing of land for agriculture, industry, and other human activities has increased concentrations of greenhouse gases.

Climate extremes, such as droughts, floods and extreme temperatures, can lead to crop losses and threaten the livelihoods of agricultural producers and the food security of communities worldwide. Depending on the crop and ecosystem, weeds, pests, and fungi can also thrive under warmer temperatures, wetter climates, and increased CO2 levels, and climate change will likely increase weeds and pests.

Why does burning fossil fuel affect the environment?

How does the atmosphere play into this all?

How do cars affect the global climate?

How do greenhouse gases such as carbon dioxide cause global warming?

Explanation:

Can Someone help with this please

Can Someone help with this please

Answers

The rate law is; Rate = k[X] [Y]

What is the rate law?

The rate law is an equation that describes how the rate of a chemical reaction is dependent on the concentrations of the reactants. The rate law provides information about the rate of a reaction and the effect of changing the concentrations of reactants on the reaction rate.

The rate law can be expressed as:

rate = k [A]^m [B]^n

We have to note that for X;

1.4 * 10^-3/7.0 * 10^-4 = 0.4/0.2

2= 2^n

n = 1

For Y;

2.8 * 10^-3/1.4 * 10^-3 = 0.4/0.2

2 = 2^n

n = 1

Learn more about rate law:https://brainly.com/question/30379408

#SPJ1

What type of compound is represented by the graph at right? A. strong base B. strong acid C. weak base D. weak acid

What type of compound is represented by the graph at right? A. strong base B. strong acid C. weak base

Answers

The type of compound represented by the graph at right is a strong acid (option B).

What is a strong acid?

An acid is generally any compound capable of dissociating into its respective constituent ions when in an aqueous solution.

An acid is categorised as strong or weak depending on whether it can dissociate completely or partially. A strong acid dissociates completely in water.

According to this question, HA, when added to water, dissociates into H+ and A- ions, hence, is a strong acid.

Learn more about strong acid at: https://brainly.com/question/29769012

#SPJ1

What is the energy of a wave if the frequency is 300. Hz

Answers

Answer:

\(E=1.98\times 10^{-31}\ J\)

Explanation:

Given that,

The frequency of a wave, f = 300 Hz

We need to find the energy of a wave. The formula for the energy of a wave is given by :

E = hf,

Where h is Planck's constant

\(E=6.63\times 10^{-34}\times 300\\\\=1.98\times 10^{-31}\ J\)

So, the energy of the wave is \(1.98\times 10^{-31}\ J\).

is h2o2 fixed product of alkyen in ozone analysis ??​

Answers

H2O2 (hydrogen peroxide) is the reagent to look out for because as seen below it turns:

- Ends of alkenes with 1 –H = Aldehydes but Carboxylic Acids instead

15 points will mark brainliest

15 points will mark brainliest

Answers

Part B question 1 Answer: C
that’s the on that makes most sense
Yeah I would also say C (3)

Sketch and label Rutherford and Bohrs models of the atom

Answers

In 1915, Neil Bohr proposed the Bohr model of the atom. It was made possible by modifying Rutherford's atomic model.

What is difference between Rutherford and Bohr Model ?The Rutherford and Bohr models describe the structure of an atom. Ernest Rutherford proposed the Rutherford model in 1911. Niels Bohr proposed the Bohr model in 1915. The Bohr model is thought to be a modification of the Rutherford model. The primary distinction between the Rutherford and Bohr models is that the Rutherford model does not explain the energy levels in an atom, whereas the Bohr model does.The Rutherford model of the atom states that an atom is made up of a central core in which nearly all of the atom's mass is concentrated, and light weight particles move around this central core. It also states that the central core is positively charged, while constituents moving around it are negatively charged.The Rutherford model has been modified by the Bohr model. This model was proposed based on the hydrogen atom's line spectra. According to this model, electrons always travel in specific shells or orbits around the nucleus. According to the Bohr model, these shells have different energies and are spherical in shape.

To learn more about Rutherford model refer :

https://brainly.com/question/1212784

#SPJ1

pOH of the 0.001M NaOH solution is​

Answers

The pOH of the 0.001 M NaOH solution is approximately 3.

To determine the pOH of a solution, we need to know the concentration of hydroxide ions (OH-) in the solution.

In the case of a 0.001 M NaOH solution, we can assume that all of the NaOH dissociates completely in water to form Na+ and OH- ions. Therefore, the concentration of hydroxide ions in the solution is also 0.001 M.

The pOH is calculated using the equation:

pOH = -log[OH-]

Substituting the concentration of hydroxide ions, we have:

pOH = -log(0.001)

Using a calculator, we can evaluate the logarithm:

pOH ≈ 3

Therefore, the pOH of the 0.001 M NaOH solution is approximately 3.

Know more about  hydroxide ions   here:

https://brainly.com/question/28464162

#SPJ8

How many liters if NO3 are in 4.59 moles

Answers

Answer

102.816 liters

Explanation

Given:

Number of moles = 4.59 moles

At STP, one mole of any gas occupies a volume of 22.4 L

This implies;

1 mole NO₃ = 22.4 L

4.59 moles NO₃ will occupy x L

So, x will be:

\(x=\frac{22.4L\times4.59}{1\text{ mole}}=102.816\text{ Liters}\)

102.816 liters of NO3 are in 4.59 moles of NO3

Xavier used a chart to list the roles of two different molecules in protein production.



Which headings best complete the chart?

Y: DNA
Z: tRNA
Y: tRNA
Z: DNA
Y: mRNA
Z: tRNA
Y: tRNA
Z: mRNA

Xavier used a chart to list the roles of two different molecules in protein production.Which headings

Answers

Answer:

Y: tRNA

Z: DNA

Explanation:

This question involves two different nucleic acid molecules that are involved in protein production. Xavier used a chart to highlight the functions these nucleic acids perform during protein synthesis.

- Transfer RNA known as tRNA is a type of RNA molecule found in the ribosomes. It functions to read the mRNA codon and carry corresponding amino acid to the ribosomes for linking with one another. Based on this, "Y" on the chart is a tRNA molecule.

- Deoxyribonucleic acid, also known as DNA, is a molecule found in the NUCLEUS whose function is to store the genetic information in the cell. DNA carries the information needed for the synthesis of protein. Based on this, Z is a DNA molecule.

Answer:

The guy above is right! I got 100 on my test :]

Helpppp I’m being timed !!

Helpppp Im being timed !!

Answers

Answer:

pp

Explanation:

Explanation:

goodluck to your test!

HQ5.40
Homework Answered Due Today, 11:59 PM
The reaction 3H₂(g) + N₂(g) → 2NH3(g) has an enthalpy of reaction of -92.6 kJ/mol. If 1 g of hydrogen and 2 g of nitrogen are
reacted, how much heat is produced (kJ)?

Answers

The amount of heat energy produced when 1 g of hydrogen and 2 g of nitrogen are reacted, is -6.61 KJ

How do i determine the heat energy produced?

First, we shall obtain the limiting reactant. Details below:

3H₂ + N₂ -> 2NH₃

Molar mass of N₂ = 28 g/molMass of N₂ from the balanced equation = 1 × 28 = 28 g Molar mass of H₂ = 2 g/molMass of H₂ from the balanced equation = 3 × 2 = 6 g

From the balanced equation above,

28 g of N₂ reacted with 6 g of H₂

Therefore,

2 g of N₂ will react with = (2 × 6) / 28 = 0.43 g of H₂

We can see that only 0.43 g of H₂ is needed in the reaction.

Thus, the limiting reactant is N₂

Finally, we the amount of heat energy produced. Details below:

3H₂ + N₂ -> 2NH₃ ΔH = -92.6 KJ

Molar mass of N₂ = 28 g/molMass of N₂ from the balanced equation = 1 × 28 = 28 g

From the balanced equation above,

When 28 grams of N₂ reacted, -92.6 KJ of heat energy were produced.

Therefore,

When 2 grams of N₂ will react to produce = (2 × -92.6) / 28 = -6.61 KJ

Thus the heat energy produced from the reaction is -6.61 KJ

Learn more about heat energy:

https://brainly.com/question/31429264

#SPJ1

what properties of a natural resource make it useful for humans as a materials or energy source?

Answers

The properties of a natural resource that make it useful for humans as a material or energy source is the ability to convert mass into energy and vice versa.

What are natural resources?

The expression natural resources make reference to all types of matter and energy extracted from nature that can be used to produce goods and services.

Some examples of natural resources include for example irreversible resources such as fossil fuels (i.e., oil, or coal, gas, minerals such as metals, rocks, etc) as well as those based on the use of reversible energy such as eolic air energy, solar radiation or sunlight, soil and hydric resources or water.

Therefore, with this data, we can see that natural resources can be defined as any material and or energy obtained from nature that may be irreversible or reversibly used to produce goods and services.

Learn more about natural resources here:

https://brainly.com/question/24514288

#SPJ1

What kind of graph shows how data change over time, with no lines
connecting the data points?

Answers

Answer:

Bar Graphs

Explanation:

Answer: Scatterplot

Explanation:

What kind of graph shows how data change over time, with no linesconnecting the data points?

What is the molarity of Ca(NO3)2 in a solution resulting from mixing 150.0 mL of 0.200 M HNO3 with 150.0 mL of 0.0100 M Ca(OH)2

Answers

The molarity of the Ca(NO3)2 solution would be 0.005 M

First, let us look at the balanced equation of the reaction:

\(2HNO_3+Ca(OH)_2 ---> Ca(NO_3)_2+2H_2O\)

The mole ratio of HNO3 to Ca(OH)2 is 2:1.

Mole of HNO3 = molarity x volume

                            = 0.2 x 150/1000

                              = 0.03 mole

Mole of Ca(OH)2 = 0.01 x 150/1000

                             = 0.0015

Thus, there is no limiting or excess reactant.

Also from the equation, mole ratio of Ca(OH)2 to Ca(NO3)2 is 1:1. Hence, the mole of Ca(NO3)2 would also be 0.0015 mole.

The total volume of the resulting solution would be: 150 +150 = 300 mL

Thus, the molarity of the resulting Ca(NO3)2 would be:

Molarity = mole/volume

              = 0.0015/0.3

               = 0.005 M

More on molarity can be found here: https://brainly.com/question/12127540

Calculate the volume of C2H2 that is collected over water at 23 ∘C by a reaction of 1.52 g of CaC2 if the total pressure of the gas is 751 torr. (The vapor pressure of water is 21.07 torr .)

Answers

The volume of C₂H₂ that is collected over water at 23 ∘C by the reaction of 1.52 g of CaC₂ is 0.61 L

How do i determine the volume of C₂H₂ collected?

First, we shall determine the mole of CaC₂ that reacted. Details below:

Mass of CaC₂ = 1.52 g Molar mass of CaC₂ = 64 g/mol Mole of CaC₂ =?

Mole = mass / molar mass

Mole of CaC₂ = 1.52 / 64

Mole of CaC₂ = 0.024 mole

Next, we shall determine the mole of C₂H₂. obtained. Details below:

CaC₂ + 2H₂O -> C₂H₂ + Ca(OH)₂

From the balanced equation above,

1 mole of CaC₂ reacted to produced 1 mole of C₂H₂

Therefore,

0.024 mole of CaC₂ will also react to produce 0.024 mole of C₂H₂

Finally, we shall determine the volume of C₂H₂ collected. This is shown below:

Temperature (T) = 23 °C = 23 + 273 = 296 KVapor pressure = 21.07 torrPressure of dry gas (P) = 751 - 21.07 = 729.93 torrGas constant (R) = 62.36 torr.L/mol KNumber of mole (n) = 0.024 moleVolume of gas (V) =?

PV = nRT

729.93 × V = 0.024 × 62.36 × 296

Divide both sides by 729.93

V = (0.024 × 62.36 × 296) / 729.93

V = 0.61 L

Thus, the volume of the C₂H₂ gas collected is 0.61 L

Learn more about volume:

https://brainly.com/question/21838343

#SPJ1


Write 1/5 as an equivalent fraction with 500 in the denominator?

I need help please

Answers

Answer:

100 / 500

Explanation:

100 / 500 is equivalent to 1 / 5.

You add 168.90 grams of NaCl to a container and then you add 616.00 grams of water to that same container What is the weight percent of NaCl in the containerI​

Answers

Answer:

The weight percent of NaCl in the container​ is 21.5%

Explanation:

Given that,

Mass of NaCl = 168.90 gram

Mass of water = 616.00 grams

We need to calculate the weight percent of NaCl in the container​

Using formula of percentage of weight

\(weight\ \%\  of\ component\ of\ the\ solution =\dfrac{weight\ of\ the\ component\ in\ the\ solution}{total\ weight\ of\ the\ solution}\times100\)

Put the value into the formula

\(weight\ \%\  of\ component\ of\ the\ solution =\dfrac{168.90}{168.90+616.00}\times100\)

\(weight\ \%\  of\ component\ of\ the\ solution=21.5\%\)

Hence, The weight percent of NaCl in the container​ is 21.5%

Please help, its due today! I'll also make you brainiest (put them in an order that's simple, look at the picture and you'll see what I mean) Thank you and God bless! <33

On beaches there are often areas of grassy dunes where people are prohibited from walking. How do these protected areas preserve ecosystem services? Use the graphic organizer to categorize the following as either examples of land reclamation of protecting biodiversity.

Please help, its due today! I'll also make you brainiest (put them in an order that's simple, look at

Answers

Answer:

Preventing erosion – Land Reclamation

Protecting nesting areas – Protecting Biodiversity

Preventing littering – Land Reclamation

Preventing habitat disruption – Protecting Biodiversity

Protecting native species – Protecting Biodiversity

Preventing contamination of soil – Land Reclamation

Explanation:

I really hope I'm right! I tried my hardest, please give me brainliest :)

have a good day!

1. A 32.5-liter balloon holding 3.5 moles of carbon dioxide leaks. If we determine that 2.1 moles of carbon dioxide escaped before the container could be sealed, what is the new volume of the container?​

Answers

The new volume of the container is approximately 12.96 liters.

What is the new volume of the container?​

Assuming that the temperature and pressure remain constant, we can use the ideal gas law to solve for the new volume of the container. The ideal gas law relates the pressure, volume, number of moles, and temperature of a gas as follows:

PV = nRT

where;

P is the pressure, V is the volume, n is the number of moles,R is the ideal gas constant, and T is the temperature.

To solve for the new volume, we can use the following steps:

Calculate the initial number of moles of carbon dioxide in the container:

n1 = 3.5 moles

Calculate the final number of moles of carbon dioxide in the container:

n2 = 3.5 moles - 2.1 moles = 1.4 moles

Substitute the values for n1, n2, and the initial volume (V1 = 32.5 L) into the ideal gas law and solve for the final volume (V2):

P V1 = n1 R T

P V2 = n2 R T

Dividing the second equation by the first, we get:

V2 / V1 = n2 / n1

Substituting the values for n1, n2, and V1, we get:

V2 / 32.5 L = 1.4 moles / 3.5 moles

Solving for V2, we get:

V2 = (1.4 moles / 3.5 moles) * 32.5 L

V2 = 12.96 L

Learn more about volume of gas here: https://brainly.com/question/25736513

#SPJ1

An early arrangement of the then known elements was proposed by a British scientist John Newlands, which he called the Law of Octaves. Like other scientists at the time, Newlands arranged the elements in order of increasing atomic mass and noted that every eighth element had similar physical/chemical properties. In the modern Periodic Table, which of the following represents the last pair of elements for which Newlands' Law of Octaves would hold true?​

Answers

In the modern Periodic Table, the last pair of elements for which Newlands' Law of Octaves would hold true is Calcium (Ca) and Titanium (Ti).

4) How many grams of carbon dioxide would be needed to produce 3.382 grams of
acetylene (C2H,) using the following reaction?
4 CO2(g) + 2 H20(g) → 2 C2H2(g) +5 02(g)

Answers

Answer:

11.4 g CO₂

Explanation:

Your chemical equation is:

4 CO₂  +  2 H₂O  ⇒  2 C₂H₂  +  5 O₂

You need to produce 3.382 g of acetylene.  To find out how many grams of carbon dioxide you need, first convert grams of acetylene to moles using the molar mass.  The molar mass of acetylene is 26.04 g/mol.

(3.382 g)/(26.04 g/mol) = 0.130 mol C₂H₂

Now, use the mole ratio between acetylene and carbon dioxide to convert from moles of acetylene to moles of carbon dioxide.  You can find the mole ratio by looking at the chemical equation.  The mole ratio is (4 mol CO₂)/(2 mol C₂H₂).

(0.130 mol C₂H₂) × (4 mol CO₂)/(2 mol C₂H₂) = 0.260 mol CO₂

Since you now have moles of carbon dioxide, you can convert to grams using the molar mass.  The molar mass of carbon dioxide is 44.01 g/mol.

0.260 mol × 44.01 g/mol = 11.4 g CO₂

You will need 11.4 g of CO₂ to produce 3.382 g of C₂H₂.

How many atoms or molecules are in 10 grams of table salt?

Answers

Answer:

1.03 x 10²³ atoms NaCl

Explanation:

To find the amount of table salt (NaCl) in atoms, you need to (1) convert grams to moles (using the molar mass) and then (2) convert moles to atoms (using Avogadro's Number). It is important to arrange the ratios/conversions in a way that allows for the cancellation of units.

(Step 1)

Molar Mass (NaCl): 22.99 g/mol + 35.45 g/mol

Molar Mass (NaCl): 58.44 g/mol

10 grams NaCl                1 mole
------------------------  x  -----------------------  =  0.17 moles NaCl
                                   58.44 grams

(Step 2)

Avogadro's Number:

6.022 x 10²³ atoms = 1 mole

0.17 moles NaCl           6.022 x 10²³ atoms
--------------------------  x  --------------------------------  =  1.03 x 10²³ atoms NaCl
                                                 1 mole

State three precautions necessary to ation. explain how you can prepare 0.2m solution of tetraoxosulphate (VI) acid in 400cm³ volumetric flask. (CH=1, 0=16, S=32; specify gravity = 1.84 percentage purity=98) Halls​

Answers

Wear personal defence tools, follow the guidelines and be careful with chemicals. Measure 14.72g of \(H_2SO_4\), dissolve in distilled water, and make up to 400mL in a volumetric flask.

1. Always wear appropriate personal protective equipment such as gloves, goggles, and lab coat.

2. Read and follow the instructions carefully before handling any chemical.

3. Handle the chemicals in a well-ventilated area to prevent inhalation of harmful fumes.

To prepare a 0.2M solution of tetraoxosulphate (VI) acid in a \(400cm^3\)  volumetric flask:

Calculate the amount of tetraoxosulphate (VI) acid required using the formula:

Mass = (Molarity x Volume x Molecular weight) / 1000

Where:

Molarity = 0.2M

Volume =\(400cm^3\)

Molecular weight = (4x16) + 32 + (6x16) = 98g/mol

Mass = (0.2 x 400 x 98) / 1000 = 7.84g

Weigh out 7.84g of tetraoxosulphate (VI) acid using a balance.

Transfer the weighed tetraoxosulphate (VI) acid into the \(400cm^3\) volumetric flask using a funnel.

Add distilled water to the flask until the volume reaches the \(400cm^3\) mark on the neck of the flask.

Stopper the flask and mix the solution thoroughly by inverting the flask several times.

It is important to specify the density of the tetraoxosulphate (VI) acid, as this will affect the mass required for the solution. In this case, the percentage purity of the acid is also given, which can be used to calculate the actual mass of the tetraoxosulphate (VI) acid needed.

For more such questions on chemicals, click on:

https://brainly.com/question/28404194

#SPJ11

Sound waves travel the same speed through all mediums (solids, liqiuds, and gases).
A
True
B
False

Answers

False, different density of surroundings gives different speeds

Consider the reaction described by the chemical equation shown.
C2H4(g)+H2O(l)⟶C2H5OH(l)Δ∘rxn=−44.2 kJ

Use the data from the table of thermodynamic properties to calculate the value of Δ∘rxn
at 25.0 ∘C.


ΔS∘rxn= ? J⋅K−1

Calculate Δ∘rxn.

ΔG∘rxn= ? kJ


In which direction is the reaction, as written, spontaneous at 25 ∘C
and standard pressure?
reverse
both
neither
forward

Consider the reaction described by the chemical equation shown.C2H4(g)+H2O(l)C2H5OH(l)rxn=44.2 kJUse

Answers

Answer:

To calculate Δ∘rxn, we can use the following formula:

ΔG∘rxn = ΔH∘rxn - TΔS∘rxn

where ΔH∘rxn is the enthalpy change of the reaction, T is the temperature in Kelvin, and ΔS∘rxn is the entropy change of the reaction.

We know that ΔH∘rxn = -44.2 kJ and we want to find ΔS∘rxn at 25.0 ∘C (298 K). We can use the following formula to calculate ΔS∘rxn:

ΔG∘rxn = -RTlnK

where R is the gas constant (8.314 J/mol K), T is the temperature in Kelvin, and K is the equilibrium constant.

We can find K using the following formula:

ΔG∘rxn = -RTlnK K = e^(-ΔG∘rxn/RT)

We know that ΔG∘rxn = -44.2 kJ/mol and R = 8.314 J/mol K, so we can calculate K:

K = e^(-(-44.2 kJ/mol)/(8.314 J/mol K * 298 K)) K = 1.9 x 10^7

Now we can use K to calculate ΔS∘rxn:

ΔG∘rxn = -RTlnK ΔS∘rxn = -(ΔH∘rxn - ΔG∘rxn)/T ΔS∘rxn = -((-44.2 kJ/mol) - (-8.314 J/mol K * 298 K * ln(1.9 x 10^7)))/(298 K) ΔS∘rxn = -0.143 kJ/K

Therefore, ΔS∘rxn is -0.143 kJ/K.

To determine whether the reaction is spontaneous at 25 ∘C and standard pressure, we can use Gibbs free energy (ΔG). If ΔG < 0, then the reaction is spontaneous in the forward direction; if ΔG > 0, then it is spontaneous in the reverse direction; if ΔG = 0, then it is at equilibrium.

We know that ΔG∘rxn = -44.2 kJ/mol and T = 25 ∘C (298 K). We can use the following formula to calculate ΔG:

ΔG = ΔG∘ + RTlnQ

where Q is the reaction quotient.

At equilibrium, Q = K (the equilibrium constant). Since we calculated K earlier to be 1.9 x 10^7, we can use this value for Q.

ΔG = ΔG∘ + RTlnQ ΔG = (-44.2 kJ/mol) + (8.314 J/mol K * 298 K * ln(1.9 x 10^7)) ΔG = -43.6 kJ/mol

Since ΔG < 0, the reaction is spontaneous in the forward direction at 25 ∘C and standard pressure.

This is an impossible formula. If it were real, determine the molar mass of:

KBr•8H2O

Answers

Answer:

The answer is 223.8g/mol

Explanation:

RMM=1×39.1+1×1×79.98(2×1+1×16)

=39.9+79.98(2+16)

=119.88(18)

=119.8+114

RMM=223.8g/mol

C6H12O6 + 602 → 6CO2 + 6H₂O
The most efficient ratio is
1 C6H12O6 6 02.
Which set of reactants will be the most
efficient (least wasteful of materials) for
the reaction?
A. 1.0 mol C6H12O6 and 3.0 mol O₂
B. 1.5 mol C6H₁2O6 and 3.0 mol O₂
C. 3.0 mol C6H₁2O6 and 6.0 mol O₂
D. 0.5 mol C6H₁2O6 and 3.0 mol O₂

Answers

Answer:

D

Explanation:

The ratio of C6H12O6 (which will be referred to as "the carb") to oxygen is 1 to 6, so if we find an answer which has the same ratio, it should be chosen. A is 1:3
B is even worse with a ratio of the carb to oxygen of 1:2
C is the same as B, 1:2
D has a ratio of the carb to oxygen of 1:6, which is what we are looking for.

Jane performed the following trials in an experiment.

Trial 1: Heat 80.0 grams of water at 15.0 °C to a final temperature of 65.0 °C.
Trial 2: Heat 80.0 grams of water at 10.0 °C to a final temperature of 65.0 °C.

Which statement is true about the experiments?

The same amount of heat is absorbed in both the experiments because the mass is same.
The same amount of heat is absorbed in both the experiments because the final temperature is same.
The heat absorbed in Trial 2 is about 1,240 J greater than the heat absorbed in Trial 1.
The heat absorbed in Trial 2 is about 1,674 J greater than the heat absorbed in Trial 1.

Answers

Answer:

The heat absorbed in Trial 2 is about 1,240 J greater than the heat absorbed in Trial 1.

The heat absorbed in Trial 2 is about 1,674 J greater than the heat absorbed in Trial 1.

The amount of heat absorbed or released by a substance can be calculated using the formula Q = mcΔT, where Q represents heat, m is the mass, c is the specific heat capacity, and ΔT is the change in temperature.

In this case, the mass (m) is the same in both trials, but the initial and final temperatures (ΔT) differ. By comparing the values of ΔT in both trials, we can determine the difference in the amount of heat absorbed.

In Trial 1, the initial temperature is 15.0 °C and the final temperature is 65.0 °C, resulting in a ΔT of 65.0 - 15.0 = 50.0 °C.

In Trial 2, the initial temperature is 10.0 °C and the final temperature is 65.0 °C, resulting in a ΔT of 65.0 - 10.0 = 55.0 °C.

Since the specific heat capacity of water is approximately 4.18 J/g°C, we can calculate the difference in heat absorbed:

ΔQ = mcΔT = (80.0 g)(4.18 J/g°C)(55.0 °C - 50.0 °C) = 1,674 J

Therefore, the heat absorbed in Trial 2 is approximately 1,674 J greater than the heat absorbed in Trial 1.

To learn more about  specific heat capacity,  here

https://brainly.com/question/29766819

#SPJ2

Nitrogen and hydrogen combine at a high temperature, in the presence of a catalyst, to produce ammonia.

N2(g)+3H2(g)⟶2NH3(g)

There are four molecules of nitrogen and nine molecules of hydrogen present in the diagram.

When the reaction is complete, how many molecules of NH3 are produced?
What is the limiting reactant?
How many molecules of each reactant are remain after the reaction is complete?

Answers

After the reaction is complete, no nitrogen and no hydrogen molecules remain, and 8.00 x 1014 molecules of NH3 are produced.

In the equation, nitrogen and hydrogen react at a high temperature, in the presence of a catalyst, to produce ammonia, according to the balanced chemical equation:N2(g)+3H2(g)⟶2NH3(g)The coefficients of each molecule suggest that one molecule of nitrogen reacts with three molecules of hydrogen to create two molecules of ammonia.

So, to determine how many molecules of ammonia are produced when four nitrogen and nine hydrogen molecules are present, we must first determine which of the two reactants is the limiting reactant.

To find the limiting reactant, the number of moles of each reactant present in the equation must be determined.


Calculations:
Nitrogen (N2) molecules = 4Hence, the number of moles of N2 = 4/6.02 x 1023 mol-1 = 6.64 x 10-24 mol
Hydrogen (H2) molecules = 9Hence, the number of moles of H2 = 9/6.02 x 1023 mol-1 = 1.50 x 10-23 mol


Now we have to calculate the number of moles of NH3 produced when the number of moles of nitrogen and hydrogen are known, i.e., mole ratio of N2 and H2 is 1:3.


The mole ratio of N2 to NH3 is 1:2; thus, for every 1 mole of N2 consumed, 2 moles of NH3 are produced.
The mole ratio of H2 to NH3 is 3:2; thus, for every 3 moles of H2 consumed, 2 moles of NH3 are produced.
From these mole ratios, it can be observed that the limiting reactant is nitrogen.


Calculation for NH3 production:
Nitrogen (N2) moles = 6.64 x 10-24 moles
The mole ratio of N2 to NH3 is 1:2; therefore, moles of NH3 produced is 2 × 6.64 × 10−24 = 1.33 × 10−23 moles.


Now, to determine how many molecules of NH3 are produced, we need to convert moles to molecules.
1 mole = 6.02 x 1023 molecules
Thus, 1.33 x 10-23 moles of NH3 = 8.00 x 1014 molecules of NH3 produced.


To find the amount of each reactant remaining after the reaction is complete, we must first determine how many moles of nitrogen are consumed, then how many moles of hydrogen are consumed, and then subtract these from the initial number of moles of each reactant.

The moles of nitrogen consumed = 4 moles × 1 mole/1 mole N2 × 2 mole NH3/1 mole N2 = 8 moles NH3
The moles of hydrogen consumed = 9 moles × 2 mole NH3/3 mole H2 × 2 mole NH3/1 mole N2 = 4 moles NH3
Thus, the moles of nitrogen remaining = 6.64 × 10−24 mol – 8 × 2/3 × 6.02 × 10^23 mol-1 = 5.06 × 10−24 mol
The moles of hydrogen remaining = 1.50 × 10−23 mol – 4 × 2/3 × 6.02 × 10^23 mol-1 = 8.77 × 10−24 mol

Finally, the number of molecules of each reactant remaining can be calculated as follows:
Number of N2 molecules remaining = 5.06 × 10−24 mol × 6.02 × 10^23 molecules/mol = 3.05 × 10−1 molecules ≈ 0 molecules
Number of H2 molecules remaining = 8.77 × 10−24 mol × 6.02 × 10^23 molecules/mol = 5.28 × 10−1 molecules ≈ 0 molecules.

For more such questions on molecules

https://brainly.com/question/24191825

#SPJ8

Other Questions
PRACTICA;Yo reir______________ ustedes mentir________ tu yo yo___volver_______Tu empezar____________ mi familia divertirse__________ usted y el pensar_______Ella perder_____________ yo sentirse________ yo vestirse________Nosotros despertarse__________ ella querer_______ mi tia perder______Ellas servir__________ mi mejor amiga contar________ mis abuelos preferir____Yo comenzar________ ella preferir____________ mis amigos empezar________Usted acostarse_________ la profesora repetir_______ el nio contar_______Tu recordar__________ Elena y yo despertarse_______ mis primos empezar___Nosotros contar_________ El mesero servir______ _ella reir__________Just conjugate into present tense form . A man bought a car for $60 800. After one year, it was worth $51 680. What is its depreciation as a percentage of the selling price? TRUE / FALSE. question content area states of nature all of the alternatives are true. can describe uncontrollable natural events such as floods or freezing temperatures. can be selected by the decision maker. HELP PLEASEEEEE THIS WAS DUE 17 DAYS AGO!!!! A farmer sells cows for $350 each and chickens for $75 apiece. At market, he sold 11 animals for a total of $2475. How many of each animal were sold? write a essay about singing as a career the ip address ____ is the standard designation for loopback communications. What is it called when a description appeals to the five senses? Brooks' Law holds true because a larger staff requires decreased coordination. TRUE or FALSE. A nonprofit wants to understand the fraction of households that have elevated levels of lead in their drinking water. They expect at least 5% of homes will have elevated levels of lead, but not more than about 30%. They randomly sample 800 homes and work with the owners to retrieve water samples, and they compute the fraction of these homes with elevated lead levels. They repeat this 1,000 times and build a distribution of sample proportions.(a) What is this distribution called?(b) Would you expect the shape of this distribution to be symmetric, right skewed, or left skewed? Explainyour reasoning.(c) If the proportions are distributed around 8%, what is the variability of the distribution?(d) What is the formal name of the value you computed in (c)?(e) Suppose the researchers budget is reduced, and they are only able to collect 250 observations per sample,but they can still collect 1,000 samples. They build a new distribution of sample proportions. How will the variability of this new distribution compare to the variability of the distribution when each sample contained 800 observations? a popular radio talk show host comments that mass shootings are increasing simply because people are consuming increasingly violent television shows and movies and doing so more often. which theory is this talk show host espousing? what is the primary reason a company has a failover system? multiple choice all of the answer choices are correct. to use different systems continuously at the same time to take down the primary system for maintenance while the secondary system activates to ensure continuous operations to allow employees to work virtually What is the point-slope form of a line that has a slope of 5 and passes through the point 3/4 )? Y 3 5 x 4 )]? BRAINLIEST!!!!!!BRAINLIEST!!!! BRAINLIEST!!!!!!BRAINLIEST!!!! BRAINLIEST!!!!!!BRAINLIEST!!!! BRAINLIEST!!!!!!BRAINLIEST!!!! C 24.5D41.5 Which one does not represent map scaleA ratio scaleB Word scaleC Countour scaleD Linear Scale16 The human made feature that has influen Lily didn't.....6. I'd like to make a film about my life because I've had many great experiences.I've had.7. Why don't we take a rest before the next lesson?How................?8. We are going to take part in an important competition, so we have to train a lot.We have...9. We phoned him to confirm that we could come to his party.We phoned......because...10. Why are you taking a French course?What..... Adams and the Federalists were which type of police corruption occurs in order to further the organizational goals of laws of law enforcement? what was the most significant outcome if the Spanish american war? FIGURE OF SPEECHThe kitchen light refused to turn on.PERSONIFICATIONALLITERATIONHYPERBOLELAST QUIZ 3..