Answer:
\(\mathbf{E_1 = -40.8 \ eV}\)
\(\mathbf{E_2= -10.2 \ eV}\)
\(\mathbf{E_3=-4.533 \e V}\)
Explanation:
In an hydrogen like atoms, the formula related to the energy of an nth quantum number is:
\(E_n =\dfrac{ -13.6 \times Z}{n^2}\)
where;
lithium Z = 3
therefore, the energy levels for Li²⁺ are
n=1 , n=2, n= 3
\(E_1 =\dfrac{ -13.6 \times 3}{1^2}\)
\(E_1 = -13.6 \times 3\)
\(\mathbf{E_1 = -40.8 \ eV}\)
\(E_2=\dfrac{ -13.6 \times 3}{2^2}\)
\(E_2=\dfrac{ -13.6 \times 3}{4}\)
\(\mathbf{E_2= -10.2 \ eV}\)
\(E_3=\dfrac{ -13.6 \times 3}{3^2}\)
\(E_3=\dfrac{ -13.6 \times 3}{9}\)
\(\mathbf{E_3=-4.533 \e V}\)
What is the mass of 0.2 mole of oxygen atoms.
Please answer step by step.
\(\huge\boxed{3.2 Grams}\)
_____________________________________Moles:Moles is the unit which measures the amount of substance in the System International (SI). A mole is the amount of substance that contains the same amount of substance as the amount of substance exactly in exactly 12 g of carbon-12. C-12 is the standard to measure moles.
I have attached the Equations for moles.
_____________________________________For this question we will use the formula,
\(Moles = \frac{Given Mass}{Atomic Mass}\)
Rearrange the equation,
\(Mass = (Moles)x(Atomic Mass)\)
Given:
Moles = 0.2
Molecular Mass of Oxygen Atom(Not molecule) = 16
Thus,
\(Mass = (0.2)x(16)\\\\Mass = 3.2 grams\)
The mass of 0.2 moles of oxygen atom is 3.2 grams.
_____________________________________Best Regards,'Borz'Given the following reaction:
CO (g) + 2 H2(g) <==> CH3OH (g)
In an experiment, 0.42 mol of CO and 0.42 mol of H2 were placed in a 1.00-L reaction vessel. At equilibrium, there were 0.29 mol of CO remaining. Keq at the temperature of the experiment is ________.
A) 2.80
B) 0.357
C) 14.5
D) 17.5
E) none of the above
Answer:
Option D. 17.5
Explanation:
Equiibrium is: CO + 2H₂ ⇄ CH₃OH
1 mol of CO is in equibrium with 2 moles of hydrogen in order to make, methanol.
Initially we have 0.42 moles of CO and 0.42 moles of H₂
If 0.29 moles of CO remained, (0.42 - 0.29) = 0.13 moles have reacted.
So in the equilibrium we may have:
0.29 moles of CO, and (0.42 - 0.13 . 2) = 0.16 moles of H₂
Ratio is 1:2, if 0.13 moles of CO haved reacted, (0.13 . 2) moles have reacted of hydrogen
Finally 0.13 moles of methanol, are found after the equilibrium reach the end.
Let's make expression for KC: [Methanol] / [CO] . [Hydrogen]²
0.13 / (0.29 . 0.16²)
Kc = 17.5
Identify the activated complex in the following reaction.
a. CuFeSO
b. FeFe
c. FeCuSO4
d. FeSO4
The activated complex in the following reaction is: FeCuSO4. The activated complex is a transition state that is an intermediate structure in a chemical reaction. Option C)
An activated complex is a structure that exists temporarily during a chemical reaction and corresponds to the top of the energy barrier that must be overcome for the reaction to proceed to completion.
The activated complex in the following reaction is: FeCuSO4. The activated complex is a transition state that is an intermediate structure in a chemical reaction. It is the structure with the greatest energy within the reaction process and is used to determine the rate at which the reaction occurs. An activated complex exists when the energy required to break the old bonds and form new ones has been absorbed. It has a specific configuration and energy content that is precisely defined.
A chemical reaction is the process by which atoms or groups of atoms in molecules interact to form new molecules. A chemical reaction is caused by the motion of electrons, which are negatively charged particles that surround atomic nuclei. The reaction proceeds through the formation of an intermediate species known as the transition state or activated complex. Reaction mechanisms are the sequence of steps involved in a chemical reaction. These steps describe the intermediate species formed as the reactants are converted to products. Hence option C) is correct.
for more questions on reaction
https://brainly.com/question/25769000
#SPJ8
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
a fertilizer manufacturer makes a batch of 20kg of ammonium nitrate. what mass of ammonia in kg, does the manufacturer need to start with?
Answer:
\(m_{NH_3}=4.25kgNH_3\)
Explanation:
Hello,
In this case, for the production of ammonium nitrate we shall consider the following chemical reaction:
\(NH_3+HNO_3\rightarrow NH_4NO_3\)
Hence, since the molar mass of ammonium nitrate is 80 g/mol and the molar mass of ammonia is 17 g/mol, we could compute the required mass of ammonia to produce 20 kg of ammonium nitrate by using kilo-based units:
\(m_{NH_3}=20kgNH_4NO_3*\frac{1kmol}{80kgNH_4NO_3}*\frac{1kmolNH_3}{1kmolNH_4NO_3}*\frac{17kgNH_3}{1kmolNH_3} \\\\m_{NH_3}=4.25kgNH_3\)
Best regards.
2.
101.3 Kpa
In a balloon, the pressure is 385 atm with a volume of 1.5 L at 25 °C. What is the new pressure
when the temperature increases to 32 °C causing the balloon to expand to 2.2 L?
The new pressure of the balloon, given that the temperature increases to 32 °C causing the balloon to expand to 2.2 L is 268.97 atm
How do i determine the new pressure of the balloon?From the question given above, the following data were obtained:
Initial pressure (P₁) = 385 atmInitial volume (V₁) = 1.5 LInitial temperature (T₁) = 25 °C = 25 + 273 = 298 KNew temperature (T₂) = 32 °C = 32 + 273 = 305 KNew volume (V₂) = 2.2 LNew pressure (P₂) = ?The combined gas equation states shown as below:
P₁V₁ / T₁ = P₂V₂ / T₂
Inputting the various parameters, we can obtain the new pressure as follow:
(385 × 1.5) / 298 = (P₂ × 2.2) / 305
Cross multiply
298 × 2.2 × P₂ = 385 × 1.5 × 305
Divide both sides by (298 × 2.2)
P₂ = (385 × 1.5 × 305) / (298 × 2.2)
P₂ = 268.97 atm
Thus, from the above calculation, it is evident tha the new pressure of the balloon is 268.97 atm
Learn more about pressure:
https://brainly.com/question/15343985
#SPJ1
PLEASE HELP...
Balance this nuclear reaction by supplying the missing nucleus. Replace each question mark with an appropriate integer or symbol.
Cf98249 + ? ⟶Db105260+410n
The balanced form of the nuclear equation is as follows; 249/98 Cf + 15/7 N⟶ 260/105 Db + 4(1/0) n.
What is a nuclear equation?A nuclear equation is process such as the fission of an atomic nucleus, or the fusion of one or more atomic nuclei and/or subatomic particles in which the number of protons and/or neutrons in a nucleus changes.
According to this question, Californium element is a reactant to produce dubnium and a neutron as products.
However, the law of conservation of mass must be fulfilled by ensuring the mass and atomic numbers of elements in reactant and product side are the same.
249/98 Cf + 15/7 N⟶ 260/105 Db + 4(1/0) n
Learn more about nuclear equation at: https://brainly.com/question/13315150
#SPJ1
Nadia runs from her house to a fiend's house that is 24 meters away. How much time she will take to reach her friend's house, knowing that Nadia's speed is 3 m/s .
Nadia will take 8 seconds to reach her friend's house.
Speed is the measure of the distance traveled by an object per unit of time. It is a scalar quantity and is typically expressed in units such as meters per second (m/s), miles per hour (mph), or kilometers per hour (km/h).
To calculate the time Nadia will take to reach her friend's house, we can use the formula;
time = distance / speed
where distance is the amount of space traveled by an object, and time is the duration of travel.
Put the values given in the problem, we have:
time = 24 meters / 3 m/s
time = 8 seconds
Therefore, Nadia will take 8 seconds.
To know more about time here
https://brainly.com/question/15356513
#SPJ1
Of the following regions of the electromagnetic spectrum, which one has the shortest wavelength?
a.
gamma rays
b.
infrared
c.
radio waves
d.
X rays
e.
microwaves
f.
ultraviolet
Answer:
A ---->gamma ray
Explanation:
Gamma rays have the highest frequencies among all electromagnetic waves and therefore have the shortest wavelengths.
If given 12 moles of Cl2, how many moles of HCl can form?
CH4+ 4Cl2——CCI4 + 4HCI
A. 4 moles HCl
B. 12 moles HCI
C. 1 mole HCI
D. 3 moles HCI
Answer:
B
Explanation:
4moles of Cl2 produces 4moles of HCl therefore 12moles of Cl2 will produce 12moles of HCl
Nitrogen-13 has a half-life of 20 minutes. how much of a 100 mg sample would remain after 60 minutes?
The amount of nitrogen-13 sample that remained after 60 minutes has been 25mg.
Half-life can be described as the time required by the substance to reduce half of its initial concentration.
The half-life of Nitrogen-13 has been 20 minutes. In 20 minutes, the sample will be reduced to half of its concentration,
The total time has been 60 minutes.
The number of half-life experienced by the sample has:
Number of half life= Total time/half life
Number of half life cycles= 60/20=3
The number of half-life cycles = 3
The sample has been reduced to 50% in the first half-life cycle and reduced to 25% by the end of 2nd half-life cycle.
The sample remained = 25% of the initial concentration.
The sample remained = 25/100.100 mg
The sample remained = 25 mg
Therefore, the amount of nitrogen-13 sample that remained after 60 minutes has been 25mg.
To learn more about half-life from the given link.
https://brainly.com/question/1160651
#SPJ1
Identify the type of reaction and predict the product: Calcium + water -->
Answer:
Exothermic Reaction
Product = Calcium hydroxide + hydrogen
Explanation:
Is anyone good at chemistry if so Is it possible could someone help me please
NO LINKS I REPEAT NO LINKS
344.0 / 68.8 = 5 (no.of half life that have elapsed)
Mass remains = (1/2)^n × (original mass)
= (1/2)^5 × 200
= (0.5) ^5 × 200
= 0.03125 × 200
= 6.25 grams
Determine the mass of 15 mol N.
Answer in units of g.
Answer:
210.15 g
Explanation:
The molar mass of nitrogen is approximately 14.01 g/mol.
14.01*15=210.15
How much heat is gained by nickel when 31.4 g of nickel is warmed from 27.2 °C to 64.2 °C? The specific heat of nickel is 0.443 J/g · °C.
Explanation:
To calculate the heat gained by nickel, we can use the formula:
q = m * c * ΔT
where q is the heat gained, m is the mass of the nickel, c is the specific heat of nickel, and ΔT is the change in temperature.
Given:
- Mass of nickel, m = 31.4 g
- Specific heat of nickel, c = 0.443 J/g · °C
- Change in temperature, ΔT = 64.2 °C - 27.2 °C = 37.0 °C
Substituting the values into the formula, we get:
q = (31.4 g) * (0.443 J/g · °C) * (37.0 °C)
Simplifying the calculation, we get:
q = 584 J
Therefore, the heat gained by nickel when 31.4 g of nickel is warmed from 27.2 °C to 64.2 °C is 584 J.
Guysss how to explain nuclear chemistry? And define nuclear chemistry ?
Answer:
How do amoeba respire.
Define Diffusion.
Hydrazine, N2H4, reacts with oxygen to form nitrogen gas and water.
N2H4(aq)+O2(g)⟶N2(g)+2H2O(l)
If 3.45 g of N2H4 reacts with excess oxygen and produces 0.650 L of N2, at 295 K
and 1.00 atm, what is the percent yield of the reaction?
Four peripheral hydrogen atoms and two singly-bonded nitrogen atoms make up the molecule of hydrazine.
Thus, It is a colourless, poisonous irritant and sensitizer in its anhydrous form, which harms the central nervous system and causes symptoms as severe as tumours and convulsions.
In addition to having a strong reducing agent that makes it highly explosive, hydrazine has a strong smell that is similar to that of ammonia.
Given this, it appears odd that over 100,000 metric tonnes of the substance are produced annually throughout the world. But hydrazine does have an impact on our daily activities. It can save our lives, give us food and clothing, keep us warm, and even transport us to the moon. It even has the ability to go back in time.
Thus, Four peripheral hydrogen atoms and two singly-bonded nitrogen atoms make up the molecule of hydrazine.
Learn more about Hydrazine, refer to the link:
https://brainly.com/question/1065759
#SPJ1
Calculate the pressure exerted by 2 moles of CO2 gas at 27 degree Celsius and volume of 4 litters (dm3)
Calculate the pressure that 2 moles if CO2 gas exert at 27 degrees Celsius. The result was 46 g L1.
What is the pressure unit?The basic pressure measurement, known as the pascal, is the force with one newton applied perpendicularly to a surface area with one square metre. Nonetheless, the US Actually common System is more common in North America. This is based upon imperial measurements like the pound (lb), inch (in), and foot (ft) (ft).
The p1 v1 pressure formula is what?According to Boyle's Law, P1V1=P2V2 while the temperature is constant. In accordance with Boyle's Law, pressure and volume are inversely linked. In other words, volume decreases as pressure rises (and vice versa).
To know more about moles visit:
https://brainly.com/question/26416088
#SPJ1
Milk of magnesia, which is an aqueous suspension of magnesium hydroxide, is used as an antacid in the reaction below. How many molecules of HCl would have to be present to form 34.52 g of MgCl₂?
Mg(OH)₂(s) + 2 HCl(aq) → 2 H₂O(l) + MgCl₂(aq)
Approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.
To determine the number of molecules of HCl required to form 34.52 g of MgCl₂, we need to use the molar mass and stoichiometry of the balanced equation:
Mg(OH)₂(s) + 2 HCl(aq) → 2 H₂O(l) + MgCl₂(aq)
The molar mass of MgCl₂ is 95.21 g/mol.
First, we need to calculate the number of moles of MgCl₂ formed:
Moles of MgCl₂ = mass of MgCl₂ / molar mass of MgCl₂
Moles of MgCl₂ = 34.52 g / 95.21 g/mol
Moles of MgCl₂ = 0.363 mol
According to the balanced equation, the stoichiometric ratio between HCl and MgCl₂ is 2:1. Therefore, the moles of HCl required can be calculated as follows:
Moles of HCl = 2 * Moles of MgCl₂
Moles of HCl = 2 * 0.363 mol
Moles of HCl = 0.726 mol
To calculate the number of molecules, we need to use Avogadro's number, which is approximately 6.022 x 10^23 molecules/mol.
Number of molecules of HCl = Moles of HCl * Avogadro's number
Number of molecules of HCl = 0.726 mol * 6.022 x 10^23 molecules/mol
Number of molecules of HCl = 4.37 x 10^23 molecules
Therefore, approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.
For more such questions on molecules
https://brainly.com/question/1351818
#SPJ8
calculate the number of molecules in 4.48dm3 of hydrogen at STP
Answer: 1 more of hydrogen =22.4dm3
X moles of hydrogen =4.48dm3
22.4dm3x = 4.48dm3
4.48dm3\22.4dm3
X=0.2 moles
Explanation: 1 volume of hydrogen at STP is 22.4dm3
Does anyone know these answers?
Answer:
Explanation:
Na & I -> NaI (Sodium iodide)Be & Br -> BeBr2 (beryllium bromide)Ca & S -> CaS (Calcium sulfide)Ca & N -> Ca3N2 (Calcium Nitride)Al & P -> AlP (Aluminum phosphide)Al & Te -> AlTe (Aluminum telluride)K & O -> KO (Potassium oxide)Na & S -> Na2S (Sodium sulfide)Sr & Cl -> SrCl2 (Strontium chloride)Sr & S -> SrS (Strontium sulfide)Al & F -> AlF3 (Aluminum fluoride)Mg & S -> MgS (Magnesium sulfide)Rb & Se -> RbSe (Rubidium selenide)Al & O -> Al2O3 (Aluminum oxide)Ba & P -> Ba3P2 (Barium phosphide)It is important to note that these compounds are formed by ionic bonding where the metal atom loses electrons to form a positive ion ( cation) and the non-metal atom gains electrons to form a negative ion (anion). The cation and anion combine to form a neutral compound.Also, the nomenclature of these compounds follow the IUPAC rules, which have a set of conventions to name compounds based on the elements present and their oxidation states, and the number of atoms of each element in the compound.
Write a balanced chemical equation based on the
following description:
the reaction of powdered aluminum and powdered iron(III)
oxide produces solid aluminum oxide and liquid iron metal
Answer:
See below
Explanation:
Start with the equation unbalanced: (s)=solid and (l)=liquid
Al(s) + Fe₂O₃(s) ----> Al₂O₃(s) + Fe(l)
Now balance the equation:
2Al(s) + Fe₂O₃(s) ---> Al₂O₃(s) + 2Fe(l)
Make sure you have the same number of atoms on each side
Al = 2
Fe = 2
O = 3
SOME PEOPLE PLACE GLOW STICKS IN
THE FREEZER TO MAKE THEM LAST
LONGER. WHY DO YOU THINK THIS
WORKS?
Please help, its due today! I'll also make you brainiest (put them in an order that's simple, look at the picture and you'll see what I mean) Thank you and God bless! <33
On beaches there are often areas of grassy dunes where people are prohibited from walking. How do these protected areas preserve ecosystem services? Use the graphic organizer to categorize the following as either examples of land reclamation of protecting biodiversity.
Answer:
Preventing erosion – Land Reclamation
Protecting nesting areas – Protecting Biodiversity
Preventing littering – Land Reclamation
Preventing habitat disruption – Protecting Biodiversity
Protecting native species – Protecting Biodiversity
Preventing contamination of soil – Land Reclamation
Explanation:
I really hope I'm right! I tried my hardest, please give me brainliest :)
have a good day!
Calculate the maximum mass of aluminium metal that can be extracted from 25.5 tonnes of aluminium oxide?
One mole of aluminum oxide or Al₂O₃ is 102 g/mol . It contains 54 g of Al metal. Thus, 25.5 tones of aluminum oxide contains 13.5 tones of Al. Therefore, the maximum mass of aluminum that can be extracted is 13.5 tones.
What is aluminum?Aluminum is 13 the element in periodic table. It is an electropositive element and exhibit metallic properties. Aluminum easily forms its oxides by reacting with atmospheric oxygen.
The molar mass of aluminum oxide Al₂O₃ is 102 g/mol. The atomic mass of Al is 27 g/mol. Thus 102 g of Al₂O₃ contains 54 g of Al. Therefore, the mass of Al in 25.5 tones or 25.5 ×10⁶ g of Al₂O₃ is calculated as follows:
mass of Al = (25.5 ×10⁶ g × 54 g) / 102 g
= 13.5 ×10⁶ g = 13.5 tones.
Therefore, the maximum mass of aluminum that can be extracted is 13.5 tones
To find more on aluminum, refer here:
https://brainly.com/question/12768349
#SPJ1
The half-life of radon-222 is 3.8 days. If the original activity of this source was 2400Bq, what do you expect it to be after 15.2 days ?
The half-life of radon-222 is 3.8 days. If the original activity of this source was 2400Bq. After 15.2 days the radon-222 will degraded rapidly and 6.25 grams will left.
What is the most straightforward way to define half-life?The time required during a process to, example, cut something in half. how long it takes for a radioactive substance's atoms to divide in half.
What is the calculation of the given problem?Half-life given = 3.8 days
Total time of decay given = 15.2 days
Initial amount of the given material = 100. g
Number of half-lives past: 15.2/3.8 = 4 half-lives
4 half-lives = 1/16 remains
100. g x 1/16 = 6.25 g
To know more about Half life visit:
https://brainly.com/question/24710827
#SPJ9
At 25∘C, the Henry's law constant for CO2 is 0.034Matm. What pressure of carbon dioxide is needed to maintain a CO2 concentration of 0.80 M?
Answer:
P = (Henry's law constant) * (CO2 concentration)
P = (0.034 M/atm) * (0.80 M) = 0.027 atm.
In order to maintain a CO_2 concentration of 0.80 M at 25 degrees Celsius, a pressure of about 23.53 atm would be needed according to Henry's Law.
In the field of Chemistry, Henry's law is used to describe the solubility of gases in liquids. This law states that at a constant temperature, the amount of a given gas that dissolves in a given type and volume of liquid is directly proportional to the partial pressure of that gas in equilibrium with the liquid.
Using the given values from the problem, where the Henry's Law constant (KH) is 0.034 M⋅atm and the desired CO_2 concentration (C) is 0.80 M, we can insert these into the formula for Henry's law: P = C/KH.
By substituting the relevant values, you get P = 0.80 M / 0.034 M⋅atm which equates to approximately 23.53 atm. Therefore, a pressure of about 23.53 atm of carbon dioxide would be needed to maintain a CO_2 concentration of 0.80 M at 25 degrees Celsius.
Learn more about Henry's Law here:
https://brainly.com/question/35540348
#SPJ2
How much heat is required to raise the temperature of 1,500 g of water from 25°C to 52°C? The specific heat of water is 4.184 J/g-oC.
Apply thermodynamics
\(\\ \rm\rightarrowtail Q=mc\delta T\)
Q is heat\(\\ \rm\rightarrowtail Q=1500(4.184)(27)\)
\(\\ \rm\rightarrowtail Q=169452J\)
Which type of biochemical is shown in this illustration?
carbohydrate
nucleic acid
lipid
protein
Option b is the correct answer. Nucleic acid is a type of biochemical is shown in this illustration.
The representation gave is an improved on variant of the design of a nucleotide, which is a structure block of nucleic acids like DNA and RNA. The nucleotide comprises of three parts: a sugar particle (displayed in the representation as CH2OH), a nitrogenous base (not displayed in this delineation), and a phosphate bunch (displayed in the representation as - O-P=O). The phosphate bunch is adversely charged and can shape hydrogen bonds with different nucleotides to make the foundation of the nucleic corrosive strand. The plan of nucleotides and the arrangement of the nitrogenous bases decide the hereditary code and capability of the nucleic corrosive.
To learn more about nucleic acid, refer:
https://brainly.com/question/30972834
#SPJ1
How many grams of CO2 are produced from the burning of 3.0 mol of amyl alcohol?
2C5H11OH + 15O2➡️ 10CO2 + 12H2O
*Please show work
The amount, in grams, of \(CO_2\) that would be produced from the burning of 3.0 mol amyl alcohol would be 660.15 grams
Stoichiometric calculationFrom the equation of the reaction:
\(2C_5H_1_1OH + 15O2 ---- > 10CO_2 + 12H_2O\)
The mole ratio of amyl alcohol to the \(CO_2\) produced is 2:10.
Thus, for 3.0 mol of amyl alcohol, 15 mol of \(CO_2\) would be produced.
Mass of 15 mol \(CO_2\) = 15 x 44.01 = 660.15 grams
More on stoichiometric calculations can be found here: https://brainly.com/question/8062886