The equilibrium constant of the reaction is 0.042.
The reaction equation is given as;
PCl5(g) ⇄ PCl3(g) + Cl2 (g)
Recall that this equation shows the decomposition of phosphorus pentachloride.
We have the following equilibrium concentrations;
[PCI5]= 0.0095 M
[PCI3] = 0.020
[CI2] = 0.020 M
The equilibrium constant, K is obtained from;
K = [PCI3] [CI2]/[PCI5]
K = [0.020]^2/[0.0095]
K = 0.042
Learn more: https://brainly.com/question/17960050
What is the main characteristics that makes a biome a desert?
is seh4 ionic or molecular
\(SeH_4^{2+}\) is ionic, SeH4 is inorganic compound. tetrahydridoselenonium is a dication \(SeH_4^{2+}\).
Is seh4 ionic or molecular?tetrahydridoselenonium is a dication \(SeH_4^{2+}\).As a result, they are molecules. We now have S. E. H. Four, as per the second portion. Since then, it is CH 4, and since carbon and hydrogen are not present together, they are inorganic inorganic compounds rather than organic molecules.Compounds classified as organic are those derived either directly or indirectly from plants and animals. Inorganic compounds are those that are created from minerals.The difference in electronegativity between the linked atoms must be smaller than 1.8 in order for there to be a covalent connection. Therefore, each of the bonds between Se and F is a covalent bond. In conclusion, SeF4 (Se e F 4) is a covalent molecule.To learn more about inorganic compound refer,
https://brainly.com/question/13691607
#SPJ1
WILL GIVE BRAINLIEST TO PERSON WHO ANSWERS FASTEST AND CORRECT BUT ANY ANSWERS TO JUST GET POINTS WILL GET REPORTED AND DELETED
Which is an example of condensation? *
5 points
A) water boiling in a pot
B) water being absorbed by plants
C) salt being removed from water
D) moisture on a mirror after a hot shower
Answer:
a
Explanation:
Answer:
D
Explanation:
What is the answer?
Answer:
Option A
Explanation:
The atomic number is the number of protons in the nucleus of an atom.
An éclair is made from which of the following types of dough?
Answer:
Choux pastry
Explanation:
Eclairs are a long, thin pastry made from choux pastry and is filled with cream and topped with icing (usually chocolate).
I hope this helps!!
- Kay :)
Long French pastries composed of choux pastry, filled with custard or pastry cream, and covered with fondant icing are known as éclairs.
What kind of pastry eclair made of ?The fundamental components for choux dough, including as sugar, butter, flour, milk, and egg, are used to make eclairs, cream puffs, and profiteroles. However, it is crucial to read and follow the directions carefully to prevent common eclair blunders such . Eclair shells with broken surfaces.
A choux pastry-based éclair is a long, thin individual cake. This delicious treat is loaded with cream and covered with milk chocolate. A donut is a fried sweet treat made of sweet dough that is often shaped like a ring or ball.
The chocolate éclair, which is covered with chocolate fondant and filled with chocolate custard or pastry cream, is possibly the most well-known type of éclair.
Thus, éclair is made up of choux pastry.
To learn more about eclair follow the link below;
https://brainly.com/question/15283964
#SPJ2
Which type of scientist
studies everything
from the tiniest
organisms to human
beings?
Answer:
Biology
Explanation:
Biology is the study of all living beings. From the smallest algae or micro organism to the biggest living being is all covered under biology. How micro organisms live, how do they function and how they affect other living beings is studied in biology.
Answer:
Micro bioligist
Explanation: hope this helps
PLEASE HURRY 10mins left !!
_______ scientists study the properties of substances that are either synthetic or natural.
Answer:
Chemists
Explanation:
The answer is:
MaterialsWhich molecule is polar?
A. CO2
B. PF3
C. CH4
D. BF3
Hey besties can y'all help me out
you need to lose one electron
how to interpret gel electrophoresis data
Interpreting gel electrophoresis data involves analyzing the separated patterns of macromolecules in the gel.
Gel electrophoresis is a laboratory technique used to separate and analyze macromolecules, such as DNA, RNA, and proteins. To interpret gel electrophoresis data, one needs to examine the patterns of separated macromolecules in the gel.
Gel electrophoresis works by applying an electrical field to a gel matrix containing the sample of macromolecules. The macromolecules move through the gel matrix in response to the electric field, and are separated based on their size and charge. The separated macromolecules can then be visualized and analyzed.
When interpreting gel electrophoresis data, one should examine the patterns of separated macromolecules in the gel. The patterns can provide information about the size and charge of the macromolecules, and can be compared to reference patterns or standards to identify specific macromolecules. For example, in DNA gel electrophoresis, the separated DNA fragments can be compared to a size marker or reference DNA to determine the size of the fragments. The interpretation of gel electrophoresis data can also involve comparing results from multiple samples to identify differences or changes in macromolecule patterns.
To learn more about electrophoresis visit here:
https://brainly.com/question/28709201
#SPJ11
The pain reliever mefenamic acid contain an active ingredient called Ibuprofen C13H18O2. What i the molar ma of thi compound?
Molar mass of Ibuprofen is 206.29 g/mol.
A non-steroidal anti-inflammatory medicine called ibuprofen is used to treat inflammation, fever, and pain. This includes rheumatoid arthritis, migraines, and painful menstrual cycles. It can also be used to close a premature baby's patent ductus arteriosus. It can be administered intravenously or orally. Ibuprofen is a pain reliever that can be purchased without a prescription over-the-counter. It belongs to the class of medications known as non-steroidal anti-inflammatory medicines (NSAIDs) and is used to treat mild to severe pain, including toothache, migraine, and period pain. If you have ever experienced an allergic reaction or signs like wheezing, avoid taking ibuprofen by mouth or applying it to your skin. Ibuprofen is C13H18O2 so
Molar mass= 13*12+ 18*1 + 16*2 = 206
Learn more about Ibuprofen
brainly.com/question/29807990
#SPJ4
Why can a soil scientist be part of the agriculture?help ASAP I’ll give brainliest
Not a timed or graded assignment. Quick answering will get an amazing review, thank you :)
This law states that matter can neither be created nor destroyed in an ordinary chemical reaction, but can change from one form to another.
What this implies is that when two elements or compound combine as a reactant to form a product, there's no loss of matter and the mass of the reactants must be equal to the mass of the product.
Given that
AlBr₃ + K₂SO₄ → KBr + Al₂(SO₄)₃
If we look closely at the above reaction, we would see that aluminuim is not balanced, potassium is also not balanced, bromine is not balance as well as sulphur and oxygen.
Let's put two moles attached to the AlBr₂ and three moles of K₂SO₄
2AlBr₃ + 3K₂SO₄ →
This would give us
6KBr + Al₂(SO₄)₃
If we add the two equations together,
2AlBr₃ + 3K₂SO₄ → 6KBr + Al₂(SO₄)₃
From the above, we have
2 atoms of Al on the reactant side and 2 atoms of Al on the product side
6 atoms of Br on the reactant side and 6 atoms of Br on the product side
6 atoms of K on the reactant side and 6 atoms of K on the product side
3 atoms of S on the reactant side and 3 atoms of S on the product side
12 atoms of O on the reactant side and 12 atoms of O on the product side
In a molecule of calcium sulfide, calcium has two valence electron bonds, and a sulfur atom has six valence electrons. How many lone pairs of electrons are present in the Lewis structure of calcium sulfide? Also, state why.
A. one
B. two
C. three
D. four
E. none
There are 2 lone pairs
Further explanationGiven
a molecule of calcium sulfide
two valence electron of Calcium(Ca)
six valence electrons of Sulfur(S)
Required
number of lone pairs of electrons
Solution
Lewis structure shows the form of bonds that occur in the valence electrons of an element or compound
Valence electrons are electrons used in a chemical bond
To achieve stability, the element S needs 2 more electrons which are obtained from 2 electrons from the Ca element,
A lone pair electrons means refers to an unshared pair of electrons(not bonding to the other atoms)
Why should the y-intercept of your plot equal 0? (Lab 2)
A y-intercept of zero is desirable and indicates that the experiment and analysis were properly conducted.
In many experiments, a plot is created with the dependent variable (y-axis) against the independent variable (x-axis). In some cases, the y-intercept of the plot may have a physical meaning or significance. In the context of Lab 2, which I don't have the specific details of, the y-intercept should be zero because it indicates that when the independent variable is zero, the dependent variable is also zero.
This means that there is no contribution from the independent variable when its value is zero. If the y-intercept is not zero, it could indicate a systematic error in the experiment or an incorrect assumption made during data analysis.
Therefore, having a y-intercept of zero is desirable and indicates that the experiment and analysis were properly conducted.
Learn more about y-intercept
https://brainly.com/question/13200019
#SPJ4
Can somebody help me. Will mark brainliest.
Answer:
2.27%
Explanation:
The observed value of the boiling point = 71.8°C
The actual value of the boiling point = 70.2°C
We need to find the percentage error of the student's measurement. The percentage error in any value is given by :
\(\%=\dfrac{\text{calculated value-actual value}}{\text{actual value}}\times 100\\\\=\dfrac{71.8-70.2}{70.2}\times 100\\\\=2.27\%\)
So, the required percentage error is 2.27%.
Use the bond energies provided to estimate ΔH°rxn (in kJ) for the reaction below.
XeF2 + 2 F2 → XeF6
Bond Bond energy (kJ/mol)
Xe-F 147
F-F 159
Answer: kJ ?
The estimated ΔH°rxn for the given reaction is 24 kJ/mol.
To estimate ΔH°rxn for the given reaction, we will use bond energy values provided for Xe-F and F-F bonds.
Reaction: XeF2 + 2 F2 → XeF6
First, identify the bonds broken and formed during the reaction.
Bonds broken:
1 Xe-F bond in XeF2
2 F-F bonds in 2 F2 molecules
Bonds formed:
3 Xe-F bonds in XeF6
Now, calculate the total bond energy for the bonds broken and formed.
Energy of bonds broken:
1 Xe-F bond * 147 kJ/mol = 147 kJ/mol
2 F-F bonds * 159 kJ/mol = 318 kJ/mol
Total energy = 147 + 318 = 465 kJ/mol
Energy of bonds formed:
3 Xe-F bonds * 147 kJ/mol = 441 kJ/mol
Finally, calculate ΔH°rxn as the difference between the energy of bonds broken and bonds formed:
ΔH°rxn = Energy of bonds broken - Energy of bonds formed
ΔH°rxn = 465 kJ/mol - 441 kJ/mol
ΔH°rxn = 24 kJ/mol
The estimated ΔH°rxn for the given reaction is 24 kJ/mol.
To know about reaction :
https://brainly.com/question/30464598
#SPJ11
What are some of the difficulties in identifying particular drugs? Why is it important for forensic scientists to be able to identify particular drugs?
Answer:
The forensic scientist must be able to tell the difference between the substances.
Explanation:
It is important for forensic scientists to be able to identify particular drugs so they have evidence for the case that a certain drug was present.
The goal of forensic drug chemistry is to determine whether the material submitted contains an illegal substance.
Which of the following ionic compounds has the highest (most negative) lattice energy? SrF2 MgF2 SrI2 KCl NaF LiF CaCl2
Highest lattice energy present in MgF₂.
Ionic compounds having following properties has highest lattice energy.
(i) Ions having small radii
(ii) Compound having high charge
KCl, NaF and LiF all are +1 and -1 charges respectively
But in SrF₂, MgF₂ and CaCl₂ , each cation is dipositive
But size order of cations is:
Mg < Ca< Sr
Thus, Answer is MgF₂.
In chemistry, the lattice energy is the energy exchange upon formation of one mole of a crystalline ionic compound from its constituent ions, which can be assumed to initially be within the gaseous kingdom. It's far a measure of the cohesive forces that bind ionic solids.
Lattice energy may be described because the energy required to transform one mole of an ionic stable into gaseous ionic parts. Alternatively, it may be described as the power that ought to be provided to one mole of an ionic crystal with a purpose to separate it into gaseous ions in a vacuum thru an endothermic system.
Learn more about lattice energy here:- https://brainly.com/question/4792664
#SPJ4
What is the [OH) if the poH is 4.9?
a) 4.9 x 10-10 M
Ob) 1.0 x 10-4 M
C) 1.25 x 10-5 M
O d) 7.94 x 10-10 M
Answer:
the answer is 4.9×10-10M
4. Given the balanced equation: 2Na + S → Na₂S
How many grams of sulfur are needed to react with 43 grams of Na? Round to the nearest whole number.
a. 119 g
b. 158 g
c. 32 g
d. 30 g
Answer:
Option D. 30 g
Explanation:
The balanced equation for the reaction is given below:
2Na + S —> Na₂S
Next, we shall determine the masses of Na and S that reacted from the balanced equation. This is can be obtained as:
Molar mass of Na = 23 g/mol
Mass of Na from the balanced equation = 2 × 23 = 46 g
Molar mass of S = 32 g/mol
Mass of S from the balanced equation = 1 × 32 = 32 g
SUMMARY:
From the balanced equation above,
46 g of Na reacted with 32 g of S.
Finally, we shall determine the mass sulphur, S needed to react with 43 g of sodium, Na. This can be obtained as follow:
From the balanced equation above,
46 g of Na reacted with 32 g of S.
Therefore, 43 g of Na will react with = (43 × 32)/46 = 30 g of S.
Thus, 30 g of S is needed for the reaction.
Draw periodic table electron configuration
The periodic table is a graphical representation of the elements, arranged by atomic number and electron configuration. Electron configuration refers to the arrangement of electrons in an atom's outermost shell, also known as the valence shell. This configuration determines an element's chemical properties and reactivity.
Each element in the periodic table is represented by a unique symbol, and the elements are arranged in rows and columns according to their electron configuration. The rows, known as periods, represent the number of electron shells in an atom. The columns, known as groups or families, represent the number of electrons in the valence shell.
The first period of the periodic table, for example, includes elements with one electron shell. These elements, such as hydrogen and helium, have only one electron in their valence shell. The second period includes elements with two electron shells, such as lithium and beryllium, which have two electrons in their valence shell.
As we move across a period from left to right, the number of electrons in the valence shell increases by one. As we move down a group or family, the number of electron shells increases by one. For example, the elements in Group 1, also known as the alkali metals, have one electron in their valence shell. The elements in Group 2, the alkaline earth metals, have two electrons in their valence shell.
Each element's electron configuration can be represented using the notation of the noble gas that precedes it in the periodic table. For example, the electron configuration of carbon is [He] 2s2 2p2, where [He] represents the electron configuration of helium, and 2s2 2p2 represents the additional electrons in carbon's valence shell.
It's also important to note that the electron configurations follow a set of rules known as the Aufbau principle, Hund's rule and Pauli exclusion principle. The Aufbau principle states that electrons fill orbitals of lower energy first. Hund's rule states that electrons in a sub-shell fill the orbitals singly before filling them doubly. Pauli exclusion principle states that no two electrons in an atom can have the same set of quantum numbers.
Overall, the electron configuration of an element plays a crucial role in determining its chemical properties and reactivity, and the periodic table arranges the elements according to their electron configurations, making it a useful tool for predicting and understanding chemical behavior.
Here you can learn more about electron configuration
https://brainly.com/question/29757010#
#SPJ11
a 6.00-cm-diameter sphere with a mass of 89.3 g is neutrally buoyant in a liquid.
A 6.00-cm-diameter sphere with a mass of 89.3 g is neutrally buoyant in a liquid will be 5358 n.
The propensity of an element to float in such a fluid is known as buoyancy. The buoyant force is an upward force that all liquids as well as gases in the absence of gravity apply to any object submerged in them.
the formula Fb=Vg to determine the buoyant force. F b = dV g, where F b is still the buoyant force expressed in Newtons, would be the fluid density expressed in kilograms per cubic metre, V is the volume of the displaced fluid expressed in cubic meters, and g would be the acceleration brought on by gravity.
Put the values in formula:
F b = dV g,
Fd = 6.00-cm × 89.3 g × 10
Fd = 5358 n
To know more about buoyant
https://brainly.com/question/21990136
#SPJ4
The weak acid HY is much stronger than weak acid HX. Which one of the following statements is true?A) Y is a stronger base than X-. B) Y is a weaker base than X-. C)Y- and X- will be bases of approximately the same strength
a student has a sample of CO2 gas that has a mass of 22.0g
a. explain how she would find the volume of the sample at STP.
b. what is the volume of 22.0g of CO2 at STP? Show your work.
Answer:
The answer to question A is given below.
B. 11.2 L at STP.
Explanation:
From the question given above, the following data were obtained:
Mass of CO2 = 22 g
A. To obtain the volume of the sample of CO2 gas, we must calculate the number of mole in 22 g of CO2.
Finally, we shall determine the volume of the sample of CO2 gas occupied by the number of mole of the gas calculated for, knowing that 1 mole of any gas occupies 22.4 L at STP.
B. Determination of the volume of 22 g of CO2 at STP.
We'll begin by calculating the number of mole in 22 g of CO2. This can be obtained as follow:
Mass of CO2 = 22 g
Molar mass of CO2 = 12 + (2×16) = 12 + 32 = 44 g/mol
Mole of CO2 =?
Mole = mass /Molar mass
Mole of CO2 = 22/44
Mole of CO2 = 0.5 mole.
Finally, we shall determine the volume occupied by 0.5 mole of CO2 at STP. This can be obtained as follow:
Recall:
1 mole of CO2 occupies 22.4 L at STP.
Therefore, 0.5 mole of CO2 will occupy = 0.5 × 22.4 = 11.2 L at STP.
Thus, 22 g of CO2 occupies 11.2 L at STP.
HELPPPP PLEASEEEE NAME THESE MOLECULES PLEASEEE
Answer:
1. carboxylic acid
2. ether
3. aldehyde
4. ketone
5. amine
6. alcohol
Explanation:
Know the functional groups. If you would like me to teach you them let me know.
- Hope that helps! Please let me know if you need further explanation.
What does an isochron represent?
A) the age of a rock, given the composition of minerals
B) the rate of radioactive decay of elements
C) the ratios of all the different elements within a rock
D) the different ages of rocks, given a single mineral
An isochron represents the age of a rock, given the composition of minerals. In geochronology, isochron dating is a technique used to determine the age of rocks or geological samples.
Isochron dating relies on analyzing the ratios of isotopes within the minerals present in the rock. Isotopes are variants of an element with different numbers of neutrons in their atomic nuclei. By measuring the isotopic ratios, specifically the parent and daughter isotopes, scientists can calculate the time elapsed since certain geological events, such as the crystallization of the rock or a metamorphic event.
The isochron method involves plotting the isotopic ratios on a graph, typically using a set of minerals from the same rock sample. If the minerals formed at the same time, the data points will fall along a straight line known as an isochron. The slope of the isochron line provides the age of the rock, while the intercept with the y-axis indicates the initial isotopic composition. This technique helps to overcome challenges such as the presence of inherited isotopes or disturbances in the isotopic system, providing a reliable estimate of the rock's age.
To know more about isochron, click here, https://brainly.com/question/31478583
#SPJ11
Calculate the pH at 25°C of a 0.97M solution of potassium butanoate KC3H7CO2. Note that butanoic acid HC3H7CO2 is a weak acid with a pKa of 4.82. Round your answer to 1 decimal place.
The pH of the 0.97M solution of potassium butanoate at 25°C is 7.0.
To calculate the pH of the solution, we need to first determine the concentration of the butanoate ion, C3H7CO2-. Since KC3H7CO2 is a salt of butanoic acid, it will dissociate in water to form the conjugate base, C3H7CO2- and K+ ion. Therefore, the concentration of the butanoate ion can be calculated as:
[C3H7CO2-] = 0.97 M
Now, we can use the equation for the dissociation of a weak acid to calculate the concentration of the butanoic acid:
Ka = [H+][C3H7CO2-]/[HC3H7CO2]
10^-pKa = [H+][C3H7CO2-]/[HC3H7CO2]
10^-4.82 = [H+][0.97]/[HC3H7CO2]
[HC3H7CO2] = [H+][0.97]/10^-4.82
Next, we can use the equation for the ion product constant of water to calculate the concentration of H+ ions:
Kw = [H+][OH-]
10^-14 = [H+][OH-]
[H+] = 10^-7
Finally, we can use the equation for pH to calculate the pH of the solution:
pH = -log[H+]
pH = -log(10^-7)
pH = 7.0
Therefore, the pH of the 0.97M solution of potassium butanoate at 25°C is 7.0.
To know about potassium :
https://brainly.com/question/13321031
#SPJ11
How many grams are 7. 00 x 10^22 molecules of NaOH?
The mass of 7,00 × 10²² NaOH molecules is 4,64 gram. 7,00 × 10²² NaOH molecules equal 0.116 moles NaOH.
To find out the mass of 7,00 × 10²² NaOH molecules you can use the following steps
Step 1: The first step is to calculate the number of moles of the compound.
mol = number of particles ÷ Avogadro's number
= 7,00 × 10²² ÷ 6,022 × 10²³
= 0,116 mol
Step 2: The next step is to calculate the mass of the molecules.
mass = mol × relative molecular mass
= 0,116 mol × 40 gram/mol
= 4,64 gram
So the mass of 7,00 × 10²² NaOH molecules is 4,64 gram.
Learn more about number of particles here: https://brainly.com/question/29367909
#SPJ1
In order for a reaction to occur, which action must happen?(1 point) Molecules must divide at a high enough energy to break bonds. Molecules must divide at a high enough energy to break bonds. Molecules must collide at a low enough energy to break bonds. Molecules must collide at a low enough energy to break bonds. Molecules must divide at a low enough energy to break bonds. Molecules must divide at a low enough energy to break bonds. Molecules must collide at a high enough energy to break bonds
Based on effective collision, in order for a reaction to occur, molecules must collide at a high enough energy to break bonds.
What are effective collisions?Effective collision are collision between reactant particles which result in the formation of product from reactant molecules.
For effective collisions to occur, the reactant molecules must possess a minimum amount of energy known as activation energy which is required to break the bonds present in the reactant molecules.
Therefore, in order for a reaction to occur, molecules must collide at a high enough energy to break bonds.
Learn more about effective collisions at: https://brainly.com/question/14566831
Answer:
1.) Molecules must collide at a high enough energy to break bonds.
2.) the minimum amount of energy required to break bonds and start a chemical reaction
3.) Which change can encourage a reaction? adding heat
4.) More energy is released when forming the bonds of the products because a lot of heat is given off, which indicates energy was released.
5.) Two H–H bonds are broken, one O=O bond is broken, and four H–O bonds are
formed.Explanation:
^^ (be carefull with the last question, the answers look very similar)