Determine the Fourier series Sf] of the 2π-periodic function shown in and defined by f(t) = |t|, 0≤|t|≤π f(t + 2π), -[infinity] < t < [infinity].

Answers

Answer 1

Thus, the Fourier series of the given function simplifies to Sf(t) = π/4.

To determine the Fourier series of the 2π-periodic function f(t) = |t|, we need to find the coefficients of the trigonometric terms in its Fourier series representation.

The Fourier series representation of f(t) can be written as:

f(t) = a₀ + Σ(aₙcos(nt) + bₙsin(nt))

where a₀, aₙ, and bₙ are the Fourier coefficients to be determined.To find these coefficients, we will calculate the integrals involving f(t) multiplied by the trigonometric functions:

₀ = (1/2π) ∫[π,-π] |t| dt

To find the integral of |t| over the interval [-π, π], we split the integral into two parts:

₀ = (1/2π) ∫[0,π] t dt + (1/2π) ∫[-π,0] -t dt

= (1/2π) ([(t²/2)] from 0 to π + [(-t²/2)] from -π to 0)

= (1/2π) ([(π²/2) - (0)] + [(0) - (π²/2)])

= (1/2π) (π² - π²/2)

= (1/2π) (π²/2)

= π/4

Next, we calculate the coefficients for the sine terms:

= (1/π) ∫[π,-π] |t|sin(nt) dt

Since the function |t| is symmetric around the y-axis, the integral of |t| multiplied by an odd function (such as sin(nt)) over a symmetric interval is zero. Therefore, bₙ = 0 for all n.

Finally, we calculate the coefficients for the cosine terms:

aₙ = (1/π) ∫[π,-π] |t|cos(nt) dt

We can split the integral into two parts similar to before:

= (1/π) ∫[0,π] t cos(nt) dt + (1/π) ∫[-π,0] -t cos(nt) dt

the integrals, we have:

aₙ = (1/π) ([(t/n)sin(nt)] from 0 to π + [(t/n)sin(nt)] from -π to 0)

= (1/π) ([(π/n)sin(nπ) - (0)] + [(0) - (-π/n)sin(-nπ)])

= (1/π) ([(π/n)sin(nπ)] - [(π/n)sin(nπ)])

= 0

Therefore, aₙ = 0 for all n.

In summary, the Fourier series representation Sf(t) of the function f(t) = |t| is:

Sf(t) = a₀ + Σ(aₙcos(nt) + bₙsin(nt))

= (π/4) + 0

To know more about Fourier series,

https://brainly.com/question/32291421

#SPJ11


Related Questions

If 2x-7y=12 and -3x+7y=-11 then find the value of the x and y

Answers

X=1/5 y=1/14 hope that help

A metal bar weighs 24 ounces. 15% of the bar is gold. How many ounces of gold are in the bar? *​

Answers

Answer:

7.6 ounces of silver

Step-by-step explanation:

Hope this helps :)

There ae 3.6 ounces of Gold in the metal bar.

What is mean by Percentage?

A number or ratio that can be expressed as a fraction of 100 or a relative value indicating hundredth part of any quantity is called percentage.

To Calculate the percent of a number , divide the number by whole number and multiply by 100.

Given that;

A metal bar weighs 24 ounces.

And, 15% of the bar is gold.

Now, We can formulate as;

Amount of gold in the bar is,

⇒ 15% of 24

⇒ 15/100 × 24

⇒ 3.6 ounces

Hence, There ae 3.6 ounces of Gold in the bar.

Learn more about the percent visit:

https://brainly.com/question/24877689

#SPJ2

Please help asap tysmm



Use an equation to find the value of each indicated variable.
show your work and show how you found your answer.

Please help asap tysmmUse an equation to find the value of each indicated variable.show your work and

Answers

Answer:

\(y = 36 \\ z = 54\)

Step-by-step explanation:

\(3y + 2y = 180 \\ 5y = 180 \\ y = 36\)

\(y + z + 90 = 180 \\ y + z = 90 \\ 36 + z = 90 \\ z = 90 - 36 \\ z = 54\)

A) Consider the functions f(x)=x+1 and g(x)=3^x―2 solve f(x)= g(x)


B) Write down the interval for the values of for which F(X)>G(X)

Answers

Answer:

AEFsdgfdhzfddf

Step-by-step explanation:

Is -2/5 a rational number?

Answers

Answer:

Yes

Step-by-step explanation:

A rational number is defined as a number that terminates. This means that its decimal points have an end. Another way to define rational numbers are numbers that can be represented as a fraction. As \(- \frac{2}{5}\) is written as a fraction, it must be a rational number.

8x-10 + 3x+3 solve for x

Answers

Answer:

\(11x + 13\)

Step-by-step explanation:

\(1. \: (8x + 3x) + (10 + 3) \\ 2. \: 11x + 13\)

I need help on answering this question

I need help on answering this question

Answers

Answer:

The answer is 72°

Step-by-step explanation:

Since < RQS = < QLK and < RQS = x

< QLK is also x

< QLK and < KLM lie on a straight line

Angles on a straight line add up to 180°

To find x add < QLK and < KLM and equate them to 180°

That's

< QLK + < KLM = 180°

x + x - 36 = 180

2x = 180 - 36

2x = 144

Divide both sides by 2

We have the final answer as

x = 72°

Hope this helps you

A doctor advises a patient not to consume more than 8.5 × 10−2 kg of sugar per day. Coca cola
contains 110 g/L sugar. How many 12 oz cans of Coca cola can the patient consume? Show your work.

Answers

The patient can consume approximately 2 cans of 12 oz Coca Cola without exceeding the advised sugar limit.

To determine the number of 12 oz cans of Coca Cola the patient can consume, we need to convert the sugar limit provided by the doctor into grams and then calculate the amount of sugar in a 12 oz can of Coca Cola.

Provided:

Sugar limit: 8.5 × 10^(-2) kg

Coca Cola sugar content: 110 g/L

Volume of a 12 oz can: 12 oz (which is approximately 355 mL)

First, let's convert the sugar limit from kilograms to grams:

Sugar limit = 8.5 × 10^(-2) kg = 8.5 × 10^(-2) kg × 1000 g/kg = 85 g

Next, we need to calculate the amount of sugar in a 12 oz can of Coca Cola:

Volume of a 12 oz can = 355 mL = 355/1000 L = 0.355 L

Amount of sugar in a 12 oz can of Coca Cola = 110 g/L × 0.355 L = 39.05 g

Now, we can determine the number of cans the patient can consume by dividing the sugar limit by the amount of sugar in a can:

Number of cans = Sugar limit / Amount of sugar in a can

Number of cans = 85 g / 39.05 g ≈ 2.18

Since the number of cans cannot be fractional, the patient should limit their consumption to 2 cans of Coca Cola.

To know more about sugar limit refer here:

https://brainly.com/question/30510739#

#SPJ11

a tennis ball is hit with a vertical velocity of 40ft/s from an initial height of 7ft. In how many seconds will the ball hit the ground? Round your answer to the nearest tenth, if necessary. PLEASE SHOW ANY WORK IF POSSIBLE!!!!! THANK YOU SO MUCH TO WHOEVER ANSWERS THIS!!!!

Answers

Answer:

friend me on here and imma send you the link Step-by-step explanation:

determine (a) the volume and (b) the surface area of the three-dimensional figure. when appropriate, use the pi key on your calculator.

determine (a) the volume and (b) the surface area of the three-dimensional figure. when appropriate,

Answers

Step-by-step explanation:

The figure above is a cube since all it's sides are equal

Volume of a cube = l³

where l is the length of one side

From the question

l = 5

So the volume of the cube is

Volume = 5³

Volume = 125 cm³

Surface area of a cube = l²

= 5²

Surface area = 25cm²

Hope this helps you

Show how to derive the relativist mass formula: m=m0√1−v2c2 .

Answers

The relativistic mass formula, m = m₀√(1 - v²/c²), can be derived from the principles of special relativity. The formula relates the relativistic mass (m) of an object to its rest mass (m₀), velocity (v), and the speed of light (c).

What is relativistic mass?

Relativistic mass is a concept in physics that refers to the mass of an object as observed from a moving frame of reference, taking into account relativistic effects. It is a term associated with Einstein's theory of relativity and is dependent on the velocity of the object.

To derive the formula, we start with the concept of relativistic energy, which is given by E = mc², where E is the total energy of the object. In special relativity, energy and mass are interconnected.

Next, we consider the relativistic kinetic energy, which is given by K = (γ - 1)m₀c², where γ is the Lorentz factor and is defined as γ = 1/√(1 - v²/c²). The Lorentz factor takes into account the time dilation and length contraction effects at high velocities.

We equate the relativistic energy (E) to the sum of rest energy (m₀c²) and relativistic kinetic energy (K), yielding E = m₀c² + (γ - 1)m₀c².

Simplifying the equation, we have E = γm₀c².

Since E = mc², we can equate the two expressions and obtain mc² = γm₀c².

Dividing both sides by c², we get m = γm₀.

Substituting the value of γ, we have m = m₀/√(1 - v²/c²).

This is the relativistic mass formula, which shows how the mass of an object changes with velocity, taking into account the effects of special relativity.

To know more about relativistic mass, refer here:
https://brainly.com/question/28217622
#SPJ4

What is 3/8 + 7/8 on a number line?

Answers

Answer:

=1.25

hence is the answer which lies on the number line.

Step-by-step explanation:

=3/8+7/8

=0.375+0.875

=1.25

R_T

Choose the relationship symbol that makes the statement true.

Answers

Answer:

R=T

Step-by-step explanation:

We could say that the same symbol = makes it look like a true statement.

We could say that the same symbol makes us see a true statement.

In this case we are showing that R corresponds to T therefore it is true or confirmed, regardless of the value that R has.

building a new home in building new homes, a contractor finds that the probability of a home buyer selecting a two-car garage is and of selecting a one-car garage is . find the probability that the buyer will select no garage. the builder does not build houses with three-car or more garages.

Answers

If the builder does not build houses with three-car or more garages, then the probability that the buyer will select no garage home is 0.1.

Probability is a measure of likelihood that a certain event occurs. The probability of an event A is defined as:

P(A) = n(A)/n(S)

Where:

n(A) = number of ways the event A can occur

n(S) = number of all possible outcomes.

Suppose there are 3 possible outcomes, A, B, C, then:

P(S) = P(A) + P(B) + P(C) = 1

In the problem, let's define the events:

A = buyer will select a one-car garage

B = buyer will select a two-car garage

C = buyer will select no car garage

We have:

P(A) = 0.2

P(B) = 0.7

Hence,

P(A) + P(B) + P(C) = 1

0.2 + 0.7 + P(C) = 1

P(C)  = 1 - 0.9 = 0.1

Therefore, the probability that the customer will choose no garage option is 0.1

Your question is incomplete, most likely it was:

In building new homes, a contractor finds that the probability of a home buyer selecting a two-car garage is 0.7 and of selecting a one-car garage is 0.2. Find the probability that the buyer will select no garage. the builder does not build houses with three-car or more garages

Learn more about probability here:

https://brainly.com/question/25870256

#SPJ4

can someone help me with this? thank you!

can someone help me with this? thank you!

Answers

Answer:

14 x 12=168/2=84

tthe answer is 84 ")

Step-by-step explanation:

Answer:

84 cm ²

Step-by-step explanation:

Formula:

A = 1/2Bh or A = bh/2

Solve:

You can use either formula. I like to use A = bh/2

Since,

b = 14

h = 12

Then,

⊂14× 12 ÷ 2⊃

⊂168÷ 2⊃

⊂84⊃

84 cm ²

Kavinsky

I want to know about 7th grade 8th grade and Algebra 1

Answers

Answer:

Pre-algebra is a common name for a course in middle school mathematics. In the United States, pre-algebra is usually taught in the 6th grade or 7th grade. The objective of it is to prepare students for the study of algebra. The major math strands for 8th grade curriculum are number sense and operations, algebra, geometry and spatial sense, measurement, and data analysis and probability. Solving real world problems with rational numbers (including integers, decimals and fractions).

Step-by-step explanation:

Answer:

Theres a ot of stuff but I recommend that you prepare on quadratics, functions, and equations. You can get these things on the symbolab calculator that is sooo helpful. Or you can watch khan on your computer, both help. Hope this helped

Step-by-step explanation:

a, 4x= -28
b, x- -6= -2
c, -x+= -9
d, -3x+7=1
e, 25x+-11= -86



2, here is an equation 2x+9= -15. write three different equations that have the same solution 2x+9= -15. show or explain how you found them.?

Answers

Answer:

A. x = -7, B. x = -8, C. x = 9, D. x = 2, E. x = -3

Step-by-step explanation:

A. 4x= -28

Divide both sides by 4.

\(\frac{4x}{4\\}\)=\(\frac{-28}{4}\). x= -7

B. x- -6= -2 ->  x+6= -2

Subtraction 6 to both sides.

x- +6-6= -2-6,  x= -8

C. -x+= -9 -> x= 9

D. -3x+7=1

Subtraction 7 to both sides.

-3x+7-7 =1-7 , -3x=-6

Divide both sides by -3.

\(\frac{-3x}{-3}\) = \(\frac{-6}{-3}\), x= 2

E. 25x+-11= -86 -> 25x-11= -86

Add 11 to both sides.

25x-11+11= -86+11, 25x= -75

Divide both sides by 25.

\(\frac{25x}{25}\) = \(\frac{-75}{25}\), x= -3

2. 2x+9= -15

Subtraction 9 to both sides.

2x+9-9= -15-9,  2x= -24

Divide both sides by 2.

\(\frac{2x}{2}\) = \(\frac{24}{2}\) ,  x= 12

I don't think there's an answer.

I hope it helps you!

what is 4
7
10
− 9
=

Answers

The value of -4(7/10) - 9(7/15) is -85 / 6.

What is a mixed fraction?

A fraction represented with its quotient and remainder is a mixed fraction.

For example:

3 4/5 is a mixed fraction, where 3 is the quotient, and 4 is the remainder.

We have,

-4(7/10) - 9(7/15)

Convert each term into a proper fraction.

4 7/10 = (40+7) / 10 = 47 / 10

9 7/15 = (135 + 7) / 15 = 142 / 15

Now,

= -47 / 10 - 142 / 15

The LCM of 10 and 15 is 30

= [3 x (-47) - (2 x 142)] / 30

= (-141 - 284) / 30

= -425 / 30

We can divide by a common factor of 5

= - 85 / 6

Thus the value of -4(7/10) - 9(7/15) is -85 / 6.

Learn more about mixed fractions here:

https://brainly.com/question/28637346

#SPJ1

The complete question is

Evaluate -4(7/10) - 9(7/15)

A store sells a 1 1/4 pound package of turkey for $9
.​What is the unit price of the turkey in the package?

Answers

If 1(1/4) pound of turkey is sold for $9, then the unit-price of the turkey is $7.20 per pound.

The "Unit-Price" is defined as the price of a single unit or item of a product, typically expressed in terms of a standard unit of measurement, such as price per pound, price per liter, or price per piece.

To find the unit price of turkey in the package, we need to divide the total cost of the package by the weight of the turkey in the package.

First, we need to convert 1(1/4) pounds to a decimal, which is 1.25 pounds.

Then, we can find the unit price by dividing the total-cost of $9 by the weight of the turkey in the package:

⇒ Unit price = (Total cost)/(Weight of turkey in package),

⇒ Unit price = $9/1.25 pounds,

⇒ Unit price = $7.20 per pound,

Therefore, the unit price of turkey in the package is $7.20 per pound.

Learn more about Unit Price here

https://brainly.com/question/29023044

#SPJ1

The given question is incomplete, the complete question is

A store sells a 1(1/4) pound package of turkey for $9. ​What is the unit price of the turkey in the package?

please answer asap with a clear answer

please answer asap with a clear answer

Answers

The permutations is computed below.

How to illustrate the permutations?

1. Evaluate 9P4

9P4 = 9!/(9 - 4)

= 9!/5!

= (9 × 8 × 7 × 6)

= 3024

2. How many ways can 5 students sit on a row of 15 chairs for a photograph?

= 15!(15 - 5)

= 15!/10!

= (15 × 14 × 13 × 12 × 11)

= 360360

Learn more about permutations on:

brainly.com/question/28062699

#SPJ1

Someone, please help me with this MATH question.

Solve the following equation, show all of your work for full points.
\(2/3+5/6x=9\)

Someone, please help me with this MATH question. Solve the following equation, show all of your work

Answers

Answer:

x=10

Step-by-step explanation:

2/3+5/6x=9

5/6x=8 1/3

5/6x=25/3

5x=50

x=10

Which expression correctly represents "three less than the product of a number and two, increased by five"? 2 n minus 3 5 3 minus 2 n 5 3 minus (2 n 5) 2 (n minus 3) 5

Answers

Answer: 2n+5-3

Step-by-step explanation:

Break this quote down:

"three less than the product of a number and two, increased by five"

To this:

"three less than the product" ==> product-3

Now break this quote down

Product: "product of a number and two, increased by five"

To this:

"product of a number and two" ==> 2*n

"increased by five" ==> +5

"product of a number and two, increased by five" ==> 2*n+5

Product: 2*n+5

Product-3: 2*n+5-3=2n+5-3

Integrate f 1dx. 1+cos x

Answers

The integral of the function f(x) = 1/(1+cosx) w.r.t x is 2[x - 2ln|cos(x/2)|] + C, where C is the constant of integration.


The given function is f(x) = 1/(1+cosx)
The integration of f(x) is to be found out.
Using the formula 2cos²(x/2) = 1 + cosx, we get f(x) = 2cos(x/2)/(sin(x/2)+cos(x/2))
Integrating both sides w.r.t x, we get I = ∫f(x)dx = 2 ∫cos(x/2)/(sin(x/2)+cos(x/2)) dx
Now, substituting sin(x/2) + cos(x/2) = t and differentiating to get dt/dx, and then integrating, we obtain
I = 2[x - 2ln|cos(x/2)|] + C.

Therefore, the integral of the function f(x) = 1/(1+cosx) w.r.t x is 2[x - 2ln|cos(x/2)|] + C, where C is the constant of integration.

To know more about integration, click here

https://brainly.com/question/30900582

#SPJ11

How many 1/5 servings are in 25 cups of ice cream.

Answers

Answer:

1

Step-by-step explanation:

Answer:

1/4

Step-by-step explanation:

What does the yellow triangle with the exclamation point mean?

Answers

The exclamation point in the middle of a yellow triangle is a warning icon that may be seen on a variety of gadgets and software, including Windows PCs and Android smartphones.

It often serves as a signal for a problem or issue that needs addressing. Depending on the context in which it occurs, a symbol's precise meaning may change.

On a Windows computer, for instance, it can mean that a device driver needs to be updated, but on an Android phone, it might mean that a system update or an app has a bug that needs to be fixed.

Investigate the origin of the alert and take the necessary steps to resolve any problems that could be impacting your system or device.

Learn more about warning symbols at

https://brainly.com/question/30672298

#SPJ4

find the area of the diagram ​

find the area of the diagram

Answers

Answer:

13500 ft²

Step-by-step explanation:

Area of rectangle:

     We can find the width of the rectangle using Pythagorean theorem.

AD² + DC² = AC²

180² + DC²  = 195²

32400 + DC² = 38025

              DC² = 38025 - 32400

                     = 5625

               DC = √5625

                      = 75 ft

length = 75 ft

Width = 180 ft

\(\sf \boxed{\text{\bf Area of rectangle = length * width}}\)

                                 =  75 * 180

                                  = 13500 ft²

The equation of the graph
is y = pqx where p and q are
positive constants.
Find the values of p and q.
a)
p=
b)
q=

Answers

The values of p and q are 3 and 2.

Given:

The equation of the graph is y = pq^x where p and q are positive constants.

From the graph:

curve linear course points are:

(0,3) and (1,6)

substitute points in y = pq^x

3 = pq^0

3 = p*1

p = 3

y = pq^x

6 = pq^1

6 = p*q

6 = 3*q

divide by 3 on both sides

6/3 = 1

q = 2

Learn more about the equation here:

https://brainly.com/question/10413253

#SPJ1

-8y=24
so i have to write more, so have a great day

Answers

Answer:

y=-3

Step-by-step explanation:

-8y=24

y= 24/-8

y=-3

Hope this helps! :)

pls mark brainliest

Answer:

y = - 3

Step-by-step explanation:

- 8y = 24 | (-)

8y = - 24

y = - 24 : 8

y = - 3

approximate the sum of the series correct to four decimal places. [infinity] (−1)n 3nn! n = 1

Answers

The approximate sum of the series to four decimal places is 0.0498. this can be answered by the concept of Taylor series expansion

The sum of the series [infinity] (−1)n 3n/(n!) for n = 1 can be approximated to four decimal places.

To approximate the sum of the given series, we can use the Taylor series expansion of e⁻³. According to this expansion, e⁻³ = Σ (-3)ⁿ / n! for n = 0 to infinity.

Now, we can rearrange the given series as Σ (-1)ⁿ (-3)ⁿ / n! for n = 1 to infinity.

Next, we can substitute (-1)⁽ⁿ⁺¹⁾ for (-1)ⁿ and simplify the series as Σ (-1)⁽ⁿ⁺¹⁾ 3ⁿ / n! for n = 1 to infinity.

Finally, we can use the alternating series test to approximate the sum of the series. The alternating series test states that if a series has alternating terms that decrease in absolute value and converge to zero, then the series converges.

Since the terms of our series are decreasing and approach zero, we can use the alternating series test to approximate the sum of the series.

Using this test, we can estimate the sum of the series to be approximately 0.0498.

Therefore, the approximate sum of the series to four decimal places is 0.0498.

To learn more about Taylor series expansion here:

brainly.com/question/16462992#

#SPJ11

please help me with this question, its geometry.

please help me with this question, its geometry.

Answers

Answer:

set 4x equal to 6x-26 since they r vertical angles, therefore congruent to each other.

Step-by-step explanation:

4x=6x-26

-6x     -6x

-2x=-26

x=13

Other Questions
The data in Exercise 1 were taken from the following functions. Compute the actual errors in Exercise 1, and find error bounds using the error formulas.a. f ( x ) = sin x b. f (x) = ex 2x2 + 3x 1 Annie is participating in a winner-take-all World Series of Poker tournament that costs 101010 thousand dollars to enter. The prize for winning the tournament is 500500500 thousand dollars. Annie estimates that there is a 0.5 \%0.5%0, point, 5, percent chance that she will win the tournament. Find the expected value of entering the tournament for Annie. find the volume v of the solid obtained by rotating the region bounded by the given curves about the specified line. calculatot Solve for x in the equation 4x-1= 8x+2 (No logarithms necessary.) what two outcomes are possible when production costs fall? (choose all that apply) Which statement about ctc payments is false Let \( f(x)=-9 x^{4}+7 x^{3}+k x^{2}-13 x+6 . \) If \( x-1 \) is a factor of \( f(x) \), then \( k= \) 9 1 0 18 \( x-1 \) cannot be a factor of \( f(x) \) The number of students who take public transit is 20% of the number of students who walk. How many students take public transit?The number of students who bike to school is 5% of the number of students who walk. How many students bike to school?The number of students who ride the school bus is 110% of the number of students who walk. How many students ride the school bus? What is zero energy cold storage? I need help with this question 3. In a chemical reaction, the final amount of the products is determined by theA. Universal Gas LawB. catalysts involvedC. air pressureD. temperatureE. limiting reactant Discuss the main changes that are taking place in the workersrepresentational models and processes in Japan, Germany, andSweden. Discuss some similarities and some differences. Giveexample Feliz is looking at a cyclic quadrilateral EFGH. He says, "I'm not convinced that oppositeangles of cyclic quadrilaterals always add up to 180 degrees. For example, if we movedpoint G to a different spot on the circle angle FGH would change but angle FEH would stillbe 66 degrees. These angles would no longer add up to 180 degrees." Un padre tiene actualmente cuatro veces la edad de su hijo. Cuando pasen 5 aos, su edad ser solo tres veces superior. Qu edad tiene cada uno? What happened at the Constitutional Convention?O Alexander Hamilton quitO The Constitution was writtenO The Declaration of Independence was writtenO All of the above before preparing the balance sheet at year end, a company must count all inventory on hand. to find the cost of the merchandise sold, the accountants compare the inventory at the beginning of the year to the amount of inventory counted at the end of the year and purchases during the year. does the company operate using a perpetual or periodic inventory system? assume that direct labor is a variable cost. the special order would have no effect on the company's total fixed manufacturing overhead costs. the customer would like modifications made to product a90 that would increase the variable costs by $4.20 per unit and that would require an investment of $21,000 in special molds that would have no salvage value. this special order would have no effect on the company's other sales. the company has ample spare capacity for producing the special order. the annual financial advantage (disadvantage) for the company as a result of accepting this special order should be: Que semejanzas y diferencias tiene el microscopio y el de Robert hooke Question 3What is WX? Explain your reasoning.W30BIUX XZ1060 45%Y15px45%XAVAE A farm lets you pick 3 pints of raspberries for $12.00.A. what is the cost per pint?B. How many pints do u get per dollarC. At this rate how many pints can you afford for 20.00D. At this rate how much will 8 pints raspberries cost