Answer:
C. Lightening
You can change a subscript in an equation, but you cannot change the
coefficient.
O True
O False
Answer:
false
because you can't change a subscript ,
but you can change the coefficient.
1. A student dissolved 36.8 grams of KF into 1.2 L of water. What is molarity of the final solution?
The molarity of the final solution is 1.00 M.
The molarity of the final solution when a student dissolved 36.8 grams of KF into 1.2 L of water is 1.00 M.Molarity is a unit of concentration that measures the amount of a solute present in a solution. Molarity is defined as the number of moles of solute per liter of solution.
The formula for molarity is given as;Molarity (M) = moles of solute / liters of solution.The following steps should be followed to calculate the molarity of a solution:Convert the mass of the solute to moles using its molar mass.Divide the number of moles of solute by the volume of the solution in liters.
The volume of the solution in liters can be measured in any units (mL, L, etc.).
Example:A student dissolved 36.8 grams of KF into 1.2 L of water.
Mass of KF = 36.8 gMolar mass of KF = 58.1 g/mol
Number of moles of KF = mass / molar mass= 36.8 / 58.1= 0.632 M
Divide the number of moles of solute by the volume of the solution in liters= 0.632 M / 0.6 L= 1.00 M
Therefore, the molarity of the final solution is 1.00 M.
Know more about molarity here:
https://brainly.com/question/30404105
#SPJ8
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
what element has more protons than other elements in its group
Answer:
umm i am not sure i really understand the question but uranium has the highest number of Protons. It has a total of 92 protons. And if that doesn't work than the Atomic number should tell the number of protons are in the element
Explanation:
If a reaction starts with 4 Cu atoms, 5 0 atoms, and 10 H atoms, what is known about the products?
A. The products will contain no oxygen because it is a gas.
B. The products will contain 4 Cu atoms and 5 H₂O molecules.
C. The products will contain 4 Cu atoms, 5 0 atoms, and 10 H atoms
D. The products will contain 19 atoms of unknown type.
Answer:
B. The products will contain 4 Cu atoms and 5 H₂O molecules.
Explanation:
Why were people from lower castes drawn to Buddhism?
O The Buddhist belief in equality appealed to them.
O Buddhism allowed people from all castes to participate.
People from the lower castes were born into Buddhism.
O People in the lower castes wanted to choose their own religi
Answer:
During the Maurya empire, the Indian culture and way of life were deeply influenced by Buddhism. Buddhism appealed to people of lower castes because it emphasized individuals' path to enlightenment and salvation, which could be attained in this life.
Explanation:
A template of a Venn diagram representing common and differentiating characteristics of covalent and ionic bonds is shown. Which of the following characteristics can be written only in space C?
Covalent and ionic bonds refer to atoms joined by their electrons. In covalent bonds, electrons are shared by the involved non-metal atoms. Option 2 is correct. Occurs due to the sharing of electrons between two non-metal atoms.
What are covalent and ionic bonds?
Both of them, covalent and ionic bonds, are chemical bonds that can form between atoms.
Ionic bonds occur between atoms with different electronegativity. When they bind, they transfer electrons from one atom to the other creating ions with opposite charges that attract each other.
Ionic compounds are formed by anions and cations.
• Cations are positive ions derivated from metals.
• Anions are negative ions derivated from non-metals.
The metal atoms share its electrons with the non-metal ones, creating stable configurations. Ionic bonds do not create molecules.
Covalent bonds are formed between atoms share electrons to be more stable. Atoms involved share electrons equally, creating a strong bond between them.
Covalent bonds are usually formed between non-metal atoms.
Option 2 is correct. Occurs due to the sharing of electrons between two non-metal atoms
You can learn more about covalent and ionic bonds at
https://brainly.com/question/19739192
#SPJ1
Complete question
A template of a Venn diagram representing common and differentiating characteristics of covalent and ionic bonds is shown.
Which of the following characteristics can be written only in space C?
On the diagram,
The non-overlapping space on the left is marked A, and belongs to the IONIC BOND side of the diagram.The overlapping space is marked B The non-overlapping space on the right is marked C, and belongs to the COVALENT BOND side of the diagram.Options,
Formed between positively and negatively charged ionsOccurs due to the sharing of electrons between two non-metal atomsOccurs in substances that are mostly solids at normal temperature and pressureFormed between an atom with very high electronegativity and an atom with very low electronegativityCa(OH)2 - How many Carbon, how many oxygen, and how many hydrogen in this formula? - please explain
Answer: 1Ca + 2O + 2H
Explanation:
Ca is 1 since there is no subscript
O and H each have 2 because the subscript 2 is outside the parenthesis so you multiply their subscript (1) by 2
How many moles of sodium chlorate would be produced if 4.250 moles of oxygen react completely with sodium chloride? Balanced Chem. Eq.:
Answer: 2.125 moles of NaClO4 would be produced if 4.250 moles of O2 reacted completely with NaCl.
Explanation:
The question requires us to calculate the amount of moles of sodium chlorate (NaClO4) that would be produced when 4.250 moles of oxygen (O2) react completely with sodium chloride (NaCl).
The unbalanced chemical equation for the reaction between O2 and NaCl to form NaClO4 can be written as:
\(NaCl+O_2\rightarrow NaClO_4\)Note that the equation above is not balanced: we need to adjust the amount of O atoms.
There are 2 O atoms on the left side, while there are 4 O atoms on the right side, thus we can adjust the coefficient of O2 from 1 to 2. The balanced chemical equation can be written as:
\(NaCl+2O_2\operatorname{\rightarrow}NaClO_4\)From the balanced chemical equation, we can see that 2 moles of O2 are necessary to produce 1 mol of NaClO4. With this information, we can calculate how many moles of NaClO4 would be obtained from 4.250 moles of O2:
2 mol O2 --------------------------- 1 mol NaClO4
4.250 mol O2 -------------------- x
Solving for x, we'll have:
\(x=4.250mol\text{ O}_2\times\frac{1mol\text{ NaClO}_4}{2mol\text{ O}_2}=2.125mol\text{ NaClO}_4\)Therefore, 2.125 moles of NaClO4 would be produced if 4.250 moles of O2 reacted completely with NaCl.
Convert 65.4 m to mm.
Helppp please
Answer:65.4 meters= 65400 millimeters
Which one of the following is a balanced equation?
Nerve impulses are picked up by a neuron’s:
(1) dendrites
(2) axon
(3) synapse
(4) neurotransmitter
98.96g/mol of CH2O what will be the chemical formula
Photosynthesis in a plant is an example of which characteristic of living things?
1. Reproduction
2. Response to the environment
3. Growth and development
4. Ability to obtain and use energy
Answer:
4. Ability to obtain and use energyWhat type of reaction is this?
Cu + O2 ---> CuO2 -The first reaction is a combustion reaction
2 HCl + Mg → H2 + MgCl2- The second reaction is a Single replacement reaction
What is a combustion reaction?A combustion reaction is a type of chemical reaction that occurs between a fuel and an oxidizer in the presence of heat or light, resulting in the release of energy in the form of heat and light.
In other words, it is a reaction in which a substance reacts with oxygen to produce heat and light.
Combustion reactions are important in many aspects of daily life, including the burning of fossil fuels for energy production, the combustion of wood or other materials for heating or cooking, and the combustion of fuels in internal combustion engines.
Learn more about combustion reaction:https://brainly.com/question/30562669
#SPJ1
which type of severe weather is related to high pressure systems?
A.Hurricane
B.Heat Wave
C.Tornado
D.Thunderstorm
Answer:
Heat waves
Explanation:
A 16.45 gram sample of iron is heated in the presence of excess oxygen. A metal oxide is formed with a mass of 21.16 g. Determine the empirical formula of the metal oxide
One mole of iron is equal to one mole of oxygen. As a result, FeO is the empirical formula for the metal oxide.
What is rust's empirical formula?Rust has the chemical formula Fe2O3, also known as ferric oxide or iron oxide. The result is a chain of chemical processes that can be summed up as follows: The formula for rusting iron is 4Fe + 3O2 + 6H2O 4Fe (OH) 3. Water and oxygen are both necessary for the rusting process.
By deducting the mass of the iron from the overall mass of the metal oxide, we can determine the mass of oxygen that combined with the iron:
mass of oxygen = mass of metal oxide - mass of iron
mass of oxygen = 21.16 g - 16.45 g
mass of oxygen = 4.71 g
Then, using their respective molar masses, we can convert the masses of iron and oxygen to moles:
moles of iron = 16.45 g / 55.85 g/mol = 0.294 mol
moles of oxygen = 4.71 g / 16.00 g/mol = 0.294 mol
To know more about empirical formula visit:-
https://brainly.com/question/14044066
#SPJ1
Calculate the concentration (in molarity) of an NaH solution if 25.0 mL of the solution is needed to neutralize 19.7 mL of a 0.463 M HCI solution.
Answer:
0.11 m
Explanation:
H Ci + NaOH H2 O+ NaC1
by titration
0.0025 L of 0.13 mol Na OH = 0.00325 Mol NaOH
L
0.00325 Mol NaOH 1 Mol Hcl/I Mol NaOH = 0.00325 Mol hcl
now 0.00325 mol Hcl/ 0.030 L = 0.0108 M hcl
Which type of biochemical is shown in this illustration?
carbohydrate
nucleic acid
lipid
protein
Option b is the correct answer. Nucleic acid is a type of biochemical is shown in this illustration.
The representation gave is an improved on variant of the design of a nucleotide, which is a structure block of nucleic acids like DNA and RNA. The nucleotide comprises of three parts: a sugar particle (displayed in the representation as CH2OH), a nitrogenous base (not displayed in this delineation), and a phosphate bunch (displayed in the representation as - O-P=O). The phosphate bunch is adversely charged and can shape hydrogen bonds with different nucleotides to make the foundation of the nucleic corrosive strand. The plan of nucleotides and the arrangement of the nitrogenous bases decide the hereditary code and capability of the nucleic corrosive.
To learn more about nucleic acid, refer:
https://brainly.com/question/30972834
#SPJ1
How do you determine the mass number of an atom?
Explanation:
The number of protons and neutrons. you can simply subtract the number of protons, or atomic number, from the mass number to get your final answer.
How many different types of elements make up one molecule of potassium perbromate, KBrO4?
Answer:
3.
Explanation:
potassium
bromine
oxygen
When you need to produce a variety of diluted solutions of a solute, you can dilute a series of stock solutions. A stock solution has a significantly higher concentration of the given solute (typically 101 to 104 times higher than those of the diluted solutions). The high concentration allows many diluted solutions to be prepared using minimal amounts of the stock solution. What volume of a 6.01 M stock solution do you need to prepare 100. mL of a 0.3624 M solution of HCl?
Answer:
Volume of stock solution needed = 6.0299 mL
Explanation:
Dilution consists of lowering the amount of solute per unit volume of solution. It is achieved by adding more diluent to the same amount of solute.
This is deduced when thinking that both the dissolution at the beginning and at the end will have the same amount of moles.
Data:
M1 = 6.01 M stock solution concentration
M2 = 0.3624 M diluted solution concentration
V2 =100 mL diluted solution volume
V1 = ? stock solution volume
M1 * V1 = M2 * V2
\(V1=\frac{M2*V2}{M1} =\frac{0.3624M*100mL}{6.01M} =6.0299 mL\)
if the climate warmed which of the following would be caused by rising temperatures? .a. an increase in sea levels. b. an increase in the amount of solar energy that gets reflected. c. a decrease in sea levels. d. a decrease in the amount of flooding in coastal areas. this subject is for science
A warming climate can cause seawater to expand and ice over land to melt, both of which can cause a rise in sea level. Storm surge on a Louisiana highway shows the effects of rising sea levels. Many people are interested in climate change and how a changing climate will affect the ocean.
If the climate warmed then the cause of rising temperatures is an increase in sea levels.
What is the effect of temperature on energy?When the temperature of the atmosphere increases then the heat energy or kinetic enrgy of the particles present in the atmosphere also increases.
When temperature increases then the melting of the ice present in the glacier takes place due to which level of the sea increases. And another reason for the increasing sea level is the expanssion of molecules due to heat.
Rather than this the options like decrease in sea levels, decrease in the amount of flooding in coastal areas and an increase in the amount of solar energy that gets reflected are incorrect.
Hence correct statement is an increase in sea levels.
To know more about effect of temperature, visit the below link:
https://brainly.com/question/26308464
#SPJ2
the valency of magnesium is 2 why
The valency of magnesium is 2 because it has two valence electrons in its outermost shell. Magnesium belongs to the second group of the periodic table, which means it has two electrons in its outermost shell or valence shell. In order to achieve a stable configuration, magnesium tends to lose these two valence electrons to form a positively charged ion with a charge of 2+. This makes magnesium a bivalent or divalent element with a valency of 2.
Answer:
Because the outer shell of magnesium contains 2 atoms
Calculate the wavelength and frequency of an emitted photon of gamma radiation that has energy of 2.93 × 109 J/mol
Answer:
Explanation: Calculate the wavelength and frequency of an emitted photon of gamma radiation that has energy of 2.93 × 109 J/mol
I need help with this
As a result, the ideal gas law is applied, and the pressure of the gas in the container is 1.44 atm.
How does Charles Law compute pressure?The Kelvin temperature and hence the volume are going to be in direct proportion when the pressure on a sample of a dry gas is held constant, according to the definition of the Charles Law Formula. PV = k is the law's equation, and k might be a constant.
This issue can be resolved by applying the ideal gas law:
PV = nR
T = -52 °C + 273.15 = 221.15 K
n = 0.642 mol
V = 8.6 L
T = 221.15 K
\(R = 0.0821 L·atm/mol·K (gas constant for ideal gases)\)
PV = nRT
P = nRT/V
P = (0.642 mol)(0.0821 L·atm/mol·K)(221.15 K)/(8.6 L)
P = 1.44 atm
To know more about ideal gas visit:-
https://brainly.com/question/28257995
#SPJ1
An empty container weighs 80.21 g. it is filled with 20.14 mL of an unknown liquid, and the total weight of the container and liquid is 105.22 g. What is the density of the liquid?
Answer:
1.242 g/mL
Explanation:
Step 1: Given data
Mass of the empty container (m₁): 80.21 g
Mass of the filled container (m₂): 105.22 g
Volume of the unknown liquid (V): 20.14 mL
Step 2: Calculate the mass of the liquid
The mass of the liquid is equal to the difference between the mass of the filled container and the mass of the empty container.
\(m = m_2 - m_1 = 105.22g - 80.21 g = 25.01 g\)
Step 3: Calculate the density of the unknown liquid
The density of the liquid is equal to its mass divided by its volume.
\(\rho = \frac{m}{V} = \frac{25.01g}{20.14mL} = 1.242 g/mL\)
is energy from the light source conduction convention or radiation
An aqueous solution ggggggggggggg
Answer:
cool
Explanation:
Give the name of one or more polysaccharides that matches each of the following descriptions:
a. not digestible by humans
b. the storage form of carbohydrates in plants
C. contains only oc (1-4)-glycosidic bonds
d. the most highly branched polysaccharide
Answer:
A Cellulose not digested by humans.
b. the storage form of carbohydrates in plants is starch
C amylose contains 1-4 glycosidic bond
D Glycogen and starch are highly branched polysaccharides.
Explanation:
The name of one or more polysaccharides that matches each of the following descriptions are given as: a. not digestible by humans- cellulose, b. the storage form of carbohydrates in plants-starch, c. contains only oc (1-4)-glycosidic bonds-amylose, d. the most highly branched polysaccharide-glycogen.
Monosaccharides—repeated sugar units—are joined by glycosidic linkages to form polysaccharides, which are large, complex carbohydrates. They are polymers consisting of hundreds of monosaccharide molecules or even thousands of them.
a. Humans cannot digest the carbohydrate known as cellulose. It is a part of the structure of plant cell walls.
b. The plant stores carbohydrates in the form of starch. It functions as a store of energy and is made up of the molecules amylose and amylopectin.
c. A polysaccharide called amylose only has linkages that are (1-4)-glycosidic. It consists of glucose units joined together by (1-4)-glycosidic linkages, and is a linear polymer.
d. The polysaccharide that has the most branches is glycogen. In particular, the liver and muscles, it is the most prevalent form of carbohydrate storage in both animals and people.
To know more about polysaccharides, here:
https://brainly.com/question/28264521
#SPJ4