Answer:
So, a full moon rises early in the night and sets early in the morning, it is visible all night long. Contrarily, a new moon rises early in the morning (with the sun) and sets at night (with the sun), and is not visible at night, at all.
Hope that helps!
Answer:
because
Explanation:
A new moon is visible only during a solar eclipse.They are rarely seen.
The Full Moon is visible in the sky approximately from sunset to sunrise.
In order to appear full to us on Earth, we have to see the entire day side of the moon.
That happens only when the moon is opposite the sun in our sky. So a full moon looks full because it's opposite the sun
Suppose you wish to determine the order of the reaction. You initially measure a rate, r0, given some arbitrary concentration of reactants. You then proceed to double the amount of A in the reaction (keeping B the same) and find that the rate is now 2r0. In a reciprocal experiment, you double the amount of B (A same as initial) in the reaction and measure a rate of 8r0. What is the order of this reaction
Answer:
See explanation
Explanation:
Now taking A, we can see that if we double the amount of A while keeping the amount of B constant, the rate of reaction doubles, hence we can write;
2^n = 2^1
hence n =1
For B, when the amount of B is doubled while keeping the amount of A constant, the rate of reaction increases eight times. Hence we can write;
2^n = 8
2^n = 2^3
n=3
Hence this reaction has an overall order of 1 + 3 = 4
So we can write;
rate =k[A] [B]^3
How many L are required to make 3.5 M hydrochloric acid using 1.1 moles?
0.31 L
General Formulas and Concepts:Math
Pre-Algebra
Order of Operations: BPEMDAS Brackets Parenthesis Exponents Multiplication Division Addition Subtraction Left to RightEquality Properties
Multiplication Property of Equality Division Property of Equality Addition Property of Equality Subtraction Property of EqualityChemistry
Atomic Structure
MolesAqueous Solutions
Molarity = moles of solute / liters of solutionEquilibrium - Acid/Base
Strong AcidsWeak AcidsWriting AcidsExplanation:Step 1: Define
[Given] 3.5 M HCl
[Given] 1.1 moles
[Solve] Liters solution
Step 2: Solve
Substitute in variables [Molarity]: \(\displaystyle 3.5 \ M = \frac{1.1 \ moles}{x \ L}\)[Solution] Cross-Multiply [Equality Property]: \(\displaystyle x \ L = \frac{1.1 \ mol}{3.5 \ M}\)[Solution] Divide: \(\displaystyle x = 0.314286 \ L\)Step 3: Check
Follow sig fig rules and round. We are given 2 sig figs.
0.314286 L ≈ 0.31 L
Which of these is a typical property of a substance that is composed of atoms that are held together by covalent bonds?
Answer) It does not conduct electricity in any form. Consider the location of barium, chlorine, iodine, and strontium on the periodic table. It conducts electricity when it is dissolved in water.
I hope it is helpful
Dennie wanted to see if crayfish preferred one kind of food over another. He gave one group of crayfish plants, both living and dead, to eat. He gave the other group insects, living and dead, to eat. What is the independent variable in Dennie's experiment? a)type of food b)weight of crayfish c)typeof water used d)age of crayfish
Answer:
A) type of food.
what is the original pressure of a 750 ml sample of He at 0 degrees Celsius if it exerts 2 atm at 25 degrees Celsius and 500 ml
To determine the original pressure of a 750 ml sample of helium (He) at 0 degrees Celsius, we can use the combined gas law, which relates the initial and final conditions of a gas sample. The combined gas law equation is:
(P1 × V1) / (T1) = (P2 × V2) / (T2)
Where:
P1 and P2 are the initial and final pressures, respectively.
V1 and V2 are the initial and final volumes, respectively.
T1 and T2 are the initial and final temperatures, respectively.
Let's assign the given values:
P1 = unknown (original pressure)
V1 = 750 ml (initial volume)
T1 = 0 degrees Celsius (initial temperature)
P2 = 2 atm (final pressure)
V2 = 500 ml (final volume)
T2 = 25 degrees Celsius (final temperature)
Before using the combined gas law equation, we need to convert the temperatures to Kelvin scale by adding 273.15 to both T1 and T2:
T1 = 0 + 273.15 = 273.15 K
T2 = 25 + 273.15 = 298.15 K
Now we can plug in the values into the combined gas law equation:
(P1 × 750 ml) / (273.15 K) = (2 atm × 500 ml) / (298.15 K)
To solve for P1, we can cross multiply and rearrange the equation:
P1 = (2 atm × 500 ml × 273.15 K) / (750 ml × 298.15 K)
P1 = 0.924 atm
Therefore, the original pressure of the 750 ml sample of helium at 0 degrees Celsius is approximately 0.924 atm.
The student's lab manual says to mix some of his Na2CO3 solution with an aqueous solution of copper(II) sulfate (CuSO4)
i What evidence of a chemical reaction would he expect to see? Explain your answer.
ii Write a balanced chemical equation to show the reaction. Include state symbols.
iii What kind of reaction is this?
i When sodium carbonate (Na2CO3) is mixed with an aqueous solution of copper(II) sulfate (CuSO4), the student can expect to see several evidence of a chemical reaction:
Formation of a solid precipitate: When these two solutions are mixed, a solid precipitate of copper(II) carbonate (CuCO3) will form. This is a sign that a chemical reaction has occurred.
Change in color: The reaction between sodium carbonate and copper(II) sulfate will also result in a change in color. The solution may turn a blue or green color, indicating the presence of copper(II) ions.
Release of gases: The reaction between sodium carbonate and copper(II) sulfate may also produce gases, such as carbon dioxide (CO2).
ii The balanced chemical equation for the reaction between sodium carbonate and copper(II) sulfate is:
2Na2CO3(aq) + CuSO4(aq) → 2Na2SO4(aq) + CuCO3(s)
iii This is a double displacement reaction, also known as a metathesis reaction. In this type of reaction, the cations (positively charged ions) and anions (negatively charged ions) of the reactant compounds exchange places to form the products. In this case, the sodium ions (Na+) and the copper ions (Cu2+) exchange places to form sodium sulfate (Na2SO4) and copper carbonate (CuCO3).
What is the best reason for carbon dioxide existing as a gas at standard temperature and pressure?
A)
Carbon dioxide molecules have the same spin within each of their orbitals.
As a result, the carbon dioxide molecules are less attracted to each other
when compared to the intramolecular bonds.
B)
Coulomb's law shows that the interaction between protons and electrons
within the atoms of each carbon dioxide molecule is significantly stronger
than the proton-electron interaction between each molecule.
C)
The entropy of carbon dioxide is much greater than the entropy of its
surroundings.
D)
Carbon dioxide has too much internal energy that the molecule-molecule
interaction cannot keep the molecules together.
chemistry homework helpA 100mL sode ash solution was prepared with 5.0g of sodium carbonate/ MW=106 g/mol what is the concentration in M of the solution? What is the concentration of sodium ions?
Answer: the concentration of the prepared solution is 0.47 M and the concentration of Na+ ions in this solution is 0.97 M.
Explanation:
The question requires us to calculate the molar concentration of a prepared sodium carbonate (Na2CO3) solution and the concentration of sodium ions (Na+) in this solution.
The following information was provided by the question:
mass of salt used = m = 5.0 g
volume of solution = V = 100 mL
molar mass of sodium carbonate = MM = 106 g/mol
We can calculate the molar concentration of the solution using the following equation:
\(M=\frac{n\text{ \lparen mol\rparen}}{V\text{ \lparen L\rparen}}\)where M is the molarity of the solution (in mol/L or M), n is the number of moles (in mol), and V is the volume of solution (in L).
Since the volume was given in mL, we need to convert it to L:
\(V=100\text{ mL}\times\frac{1\text{ L}}{1000\text{ mL}}=0.1L\)We also need to determine the number of moles of Na2CO3 in 5.0g of this salt:
106 g Na2CO3 ---------------- 1 mol Na2CO3
5.0 g Na2CO3 ----------------- x
Solving for x, we have that there are 0.047 moles of Na2CO3 in 5.0g of this salt.
Now, applying these values to the equation for molar concentration:
\(M=\frac{0.047mol}{0.1L}=0.47M\)Therefore, the concentration of the prepared solution is 0.47 M.
The concentration of Na+ ions can be obtained from the dissociation of Na2CO3:
\(Na_2CO_{3(aq)}\rightarrow2Na_{(aq)}^++CO_{3(aq)}^{2-}\)According to the dissociation equation, each mol of Na2CO3 produces 2 moles of Na+. Therefore, a 0.47 M Na2CO3 solution should contain 0.47 * 2 = 0.94 M Na+ ions.
Hydrogen reacts with oxygen according to the balanced equation
2H₂ (g) + O2(g) → 2H₂O(g). If X is the number of molecules of H₂ which react,
then the number of O2 molecules reacting is
Answer:
x/2
Explanation:
X = 2 molecules of H2
For 2 molecules of H2, there's only 1 molecule of O2. Meaning, there's twice the amount of H2, so O2 = x/2 molecules.
I hope I'm understanding this question right.
in a chemical, the bond energy of the reactants is 500J, and the bond energy of the product is 300J, this reaction would be considered
The bond energy of the products (300J) is lower than that of the reactants (500J), it indicates that energy is being released to the surroundings. This release of energy in the form of heat is characteristic of exothermic reactions.This chemical reaction can be considered an exothermic reaction.
In exothermic reactions, the bond energy of the reactants is higher than the bond energy of the products. In this case, the bond energy of the reactants is 500J, while the bond energy of the product is 300J. The difference in bond energy between the reactants and the products represents the energy released during the reaction. The bond energy of the products (300J) is lower than that of the reactants (500J), it indicates that energy is being released to the surroundings. This release of energy in the form of heat is characteristic of exothermic reactions. Exothermic reactions are often accompanied by an increase in temperature in the surroundings. Examples of exothermic reactions include combustion reactions, where a fuel reacts with oxygen to produce heat and light, or reactions that involve the formation of more stable compounds. In this particular chemical reaction, the decrease in bond energy from the reactants to the products suggests that energy is being released, making it an exothermic reaction.
For more such questions on Chemical reaction
https://brainly.com/question/11231920
#SPJ8
State collision theory
Collision theory states that when suitable particles of the reactant hit each other with correct orientation, only a certain amount of collisions result in a perceptible or notable change; these successful changes are called successful collisions.
Explanation:here your answer matehave a great day
Why are cats better than dogs?
Answer:
Cats are eazy to take care for and relatively affordable
Answer:
cats r better cuz there cats ovi
Explanation:
there small, easy to take care of, and the are good with kids depending on the breed.
The absolute temperature of a gas is increased four times while maintaining a constant volume. What happens to the pressure of the gas?
Answer:
The pressure increases by a factor of four
Explanation:
You can tell that temperature and pressure are directly proportional. How? Well if there is more temperature present, molecules tend to increase in kinetic energy, moving faster. Doing so the pressure increases,
______________________________________________________
Now volume also plays a role in this, the greater the volume the less the pressure as the molecules have more room to expand. Thus, they are inversely proportional. Here the volume is constant, so that makes everything simpler. As the temperature of the gas is increases 4 times, the pressure is also increased, by a factor of four.
Hope that helps!
Answer:its B
Explanation:
your welcome
16) Select the best answer.
Round the answer to the correct number of significant figures.
10.05
2.8899 = 29.043495
29.0435
29.04
29.043
29
29 is not the best answer depends on the context and the rules for significant figures.
What is best answer?
The best answer depends on the context and the rules for significant figures. If we assume that we need to round to three significant figures:
10.05 has three significant figures, so it is already rounded correctly.2.8899 has four significant figures, so we need to round it to three significant figures. The third significant figure is 9, which is greater than 5, so we round up the second significant figure (which is 8) to 9. Therefore, 2.8899 rounded to three significant figures is 2.89.29.0435 has five significant figures, so we need to round it to three significant figures. The third significant figure is 0, which is less than 5, so we do not round up the second significant figure (which is 4). Therefore, 29.0435 rounded to three significant figures is 29.0.29.04 has four significant figures, so it is already rounded correctly.29.043 has four significant figures, so we need to round it to three significant figures. The third significant figure is 3, which is less than 5, so we do not round up the second significant figure (which is 4). Therefore, 29.043 rounded to three significant figures is 29.0.29 has one significant figure, so it is not rounded correctly to three significant figures.Therefore, 29 is not the best answer.
To know more about significant figures, visit:
https://brainly.com/question/30465808
#SPJ1
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
The side chain of histidine has a pKa of about 6. What percent of histidine side chains would be deprotonated at pH 7.5
The percent of histidine side chains would be deprotonated at pH 7.5 is 5.77 %.
What is pKa?The term pKa refers to the negative logarithm of the acid dissociation constant (Ka). The pH is the negative logarithm of the hydrogen ion concentration.
Hence;
Ka = Antilog (-6) =\(1 * 10^-6\)
[H^+] = Antilog (-7.5) = \(3 * 10^-8 M\)
We now have to use the formula;
α = \(\sqrt{} \frac{Ka}{[H^+] }\)
α = \(\sqrt{} \frac{ 1 *10^-6}{3 *10^-8 }\)
α = 5.77 %
Hence, the percent of histidine side chains would be deprotonated at pH 7.5 is 5.77 %.
Learn more about percent dissociation: https://brainly.com/question/12273293
After assembling a gravity filtration apparatus, begin the separation of a mixture by_____it into the filter paper. Pour the entire contents of the mixture into the filter paper, ______the solid in the filter paper if needed to speed up the filtration. After all the liquid has drained through the filter paper, finish by rinsing the solid with_____.
Answer:
decanting
stirring
solvent
Explanation:
Gravity filtration consists of a pump and a filter (to be placed outside the basin, above the water level). The pump is placed in the water. Connected by a hose to the filter, water is sucked up to the device.
In the gravity-type configuration, water is sucked into the filter, which causes an imbalance between the levels of the basin and the filter: this imbalance causes the movement of water - with the dirt - from the basin to the filter via the main drain and the skimmer.
The fill in the blanks with decanting, stirring, and solvent
Gravity filtration:It comprises of a pump & a filter.The pump should be placed in the water. In the gravity-type configuration, water could be into the filter, which resulted an imbalance between the levels of the basin and the filter: this imbalance causes the movement of water.
Learn more about the liquidity here: https://brainly.com/question/24395831
11
Lab Assignment 6 = 13%
Complete the following table
ATOM/ION
120Sn
25Mg²+
#PROTONS
I
# ELECTRONS
For Sn;
Protons = 50, Electrons = 50
For Mg^2+
Protons 12, Electrons = 10
How do you determine the number of protons or electrons?
The number of protons in an atom is called the atomic number and determines the chemical identity of the element. Each element has a unique atomic number, which is equal to the number of protons in the nucleus of one of its atoms.
To determine the number of protons in an atom, you can look up the atomic number of the element in the periodic table. The periodic table is a chart that organizes elements based on their atomic number and other properties. The atomic number is listed for each element and indicates the number of protons in its nucleus.
Learn more about protons:https://brainly.com/question/1252435
#SPJ1
What is the binding energy for the nuclide 199F (atomic mass: 18.9984 amu) in MeV per nucleus?
The binding energy per nucleon for the ¹⁹F nucleon is equal to 7.786 MeV/nucleon.
What is binding energy?Binding energy can be defined as the minimum quantity of energy that is required to remove the particle from the system. Nuclear binding energy can be described as the energy required to dismantle a nucleus of an atom into free neutrons and protons.
The binding energy will be determined from the mass defect. Mass defect is calculated from the difference between the mass observed and the expected combined mass.
Given the mass of the ¹⁹F = 18.9984 a.m.u.
The mass defect for the ¹⁹F can be calculated as:
Δm = \((M _n +M_p) - M_F\)
\(\triangle m =( 9\times 1.0078 + 10 \times 1.0087 )- 18.9984\)
\(\triangle m =0.1588 \;a.m.u.\)
The binding energy for the fluorine can be calculated as:
E = Δmc²
E = 0.1588 × 931.5
E = 147.92 MeV
The binding energy per nucleon of ¹⁹F can be calculated as:
B.E.N. = 147.92/18.9984 = 7.786 MeV per nucleon
Learn more about binding energy, here:
https://brainly.com/question/10095561
#SPJ1
(b) Washing soda crystals react with acid to give off carbon dioxide.
If you added some washing soda crystals to vinegar,
what would you see happening?
Do you think more chemical reactions that occur in the human body are endothermic or exothermic? Justify your answer.
Answer:
Exothermic
Explanation:
We as humans do not absorb heat. A good way to think about it is that when we workout we use energy from our body which causes our body temperature to rise. The energy used from food maintains our blood, respiration, and other systems in optimal condition. This requires energy from our body which ends up leaving the body as heat.
What is an example of a change in the genetic traits of an organism due to human influence? OA. Humans breed dogs to be smaller and more friendly. B. Humans train dolphins to perform tricks for audiences at an aquarium. C. Humans destroy a tree frog's habitat, and the tree frogs become extinct. D. Humans feed bears, and the bears begin to enter campsites to look for food.
An example of human intervention in the genes is; humans breed dogs to be smaller and more friendly. Option A
What is the gene?We know that the gene is the unit of inheritance that can be found in the chromosome of the organism. The genes that the organism does have is what would tell must the observed traits of the organism and this is called the phenotype of the organism.
We know that human's do have an impact with the fact that the genes can spread in an organism. In many cases, we can see the alteration of the genes when we deal with the genetic make up of the pets.
Learn more about genes:https://brainly.com/question/8832859
#SPJ1
What pressure is required to compress 200 liters of air at 1.00 atmosphere into a cylinder whose
volume is 20.0 liters?
Answer:think it’s 10
Explanation:
What kind of bonds are hydrogen bonds?
O A. Polar covalent bonds that form between hydrogen and another
atom
B. Any bond between hydrogen and a highly electronegative atom
C. An intramolecular covalent bond in the H2 molecule
O D. Strong polar attractions between molecules involving H, F, 0, and N
SUBMIT
Answer:
extra strong intermolecular attractions between polar molecules
Explanation:
you're welcome .
Hydrogen bonds can be strong polar attractions between molecules involving H, F, O, and N. Therefore, option (D) is correct.
What is hydrogen bonding?Hydrogen bonding can be described as a special category of intermolecular attractive forces forming from the dipole-dipole interaction between a hydrogen atom bonded with a strongly electronegative atom and another strong electronegative atom.
For example, in water molecules, a hydrogen atom is bonded with an electronegative oxygen atom. Hydrogen bonds form between the water molecules because of the dipole-dipole interaction between the H-atom of a water (H₂O) molecule and the O-atom of another molecule.
The hydrogen atom gets a partial positive charge as it is bonded with an electronegative oxygen atom and the oxygen gets a partial negative charge.
Therefore, hydrogen bonds are polar attractions between molecules involving electropositive hydrogen and electronegative atoms such as F, O, and N.
Learn more about hydrogen bonding, here:
brainly.com/question/15099999
#SPJ2
Do any of the spheres exist on their own or are they intertwined?
Answer:
show me a pic of the problem
Explanation:
show me a pic of the problem
A block has a mass of 30g and dimensions of 1.5cm by 4.8cm by 2.3cm. Calculate the density (round to TWO sig figs).
Answer:
1.8g/cm³
Explanation:
Density is defined as the ratio of the mass of a substance and the space this subtance occupies. It is usually given in g/cm³.
The mass of the block is 30g.
The volume this mass occupies is 1.5cm × 4.8cm × 2.3cm = 16.56cm³.
The density is:
30g / 16.56cm³ =
1.8g/cm³Ag3P ionic or molecular
Answer:
ionic ionic ionic
Explanation:
it just is
calculate the volume of hydrogen in the reaction of 73 grams of zinc and 73 grams of hydrochloric acid (under normal conditions) please help
The volume of hydrogen gas produced in the reaction of 73 grams of zinc and 73 grams of hydrochloric acid (under normal conditions) is approximately 22.4 liters.
To calculate the volume of hydrogen gas produced in the reaction of zinc and hydrochloric acid, we need to use the principles of stoichiometry and the ideal gas law.
First, let's write the balanced chemical equation for the reaction between zinc (Zn) and hydrochloric acid (HCl):
Zn + 2HCl →\(ZnCl_2\)+ H2
From the equation, we can see that one mole of zinc reacts with two moles of hydrochloric acid to produce one mole of hydrogen gas. To determine the number of moles of zinc and hydrochloric acid, we need to convert the given masses into moles.
The molar mass of zinc (Zn) is approximately 65.38 g/mol, so 73 grams of zinc is equal to:
73 g Zn * (1 mol Zn / 65.38 g Zn) ≈ 1.116 mol Zn
Similarly, the molar mass of hydrochloric acid (HCl) is approximately 36.46 g/mol, so 73 grams of HCl is equal to:
73 g HCl * (1 mol HCl / 36.46 g HCl) ≈ 2.002 mol HCl
According to the balanced equation, the reaction produces one mole of hydrogen gas for every two moles of hydrochloric acid. Therefore, since we have 2.002 moles of HCl, we expect to produce half that amount, or approximately 1.001 moles of hydrogen gas.
To calculate the volume of hydrogen gas, we can use the ideal gas law, which states:
PV = nRT
Where P is the pressure, V is the volume, n is the number of moles, R is the ideal gas constant, and T is the temperature. In this case, we assume the reaction is conducted under normal conditions, which means a pressure of 1 atmosphere and a temperature of 273.15 Kelvin.
Rearranging the equation to solve for V, we have:
V = nRT / P
Substituting the values, we get:
V = (1.001 mol) * (0.0821 L·atm/(mol·K)) * (273.15 K) / (1 atm) ≈ 22.4 L
Therefore, the volume of hydrogen gas produced in the reaction is approximately 22.4 liters.
For more such information on: volume
https://brainly.com/question/29796637
#SPJ8
Write a chemical equation representing the second ionization energy for lithium. Use e− as the symbol for an electron.
Answer: Li^+ (g) ----> Li^2+ (g) + e^-
Considering the definition of first and second ionization energy, the second ionization energy of lithium is:
Li⁺ → Li²⁺ + 1 e-
In first place, the electrons are attracted to the nucleus and it is necessary to provide energy to start them. Ionization energy is the energy required to remove an electron from a gaseous atom, isolated and in a ground state. The electrons in the last shell, which are the weakest attracted to the nucleus, are always lost. In this way the neutral atom becomes a gaseous cation (ion with a positive charge).
So, in this case, the first ionization energy of lithium is:
Li → Li⁺ + 1 e-
The energy required to remove a second electron is called the second ionization energy and due to the difficulty of removing an electron from a positive particle, its value is greater than the first ionization energy (the volume of a positive ion is less than that of the neutral atom and the electrostatic force is greater in the positive ion than in the atom)
Finally, in this case, the second ionization energy of lithium is:
Li⁺ → Li²⁺ + 1 e-
Learn more:
brainly.com/question/16243729?referrer=searchResults brainly.com/question/11623163?referrer=searchResults brainly.com/question/1602374?referrer=searchResults
How many moles are in 3.65x10^27 atoms of Magnisium?
Answer:
6060 moles
Explanation:
3.65x10^27 atoms *( 1 mol/6.02*10^23 atoms)= 6063 moles ≈ 6060 moles