for mn3 , enter an equation that shows how the cation acts as an acid.

Answers

Answer 1

MnO2+ is called manganic ion and is a powerful oxidizing agent. The above equation shows how Mn3+ cation acts as an acid.

Manganese(III) cation (Mn3+) can act as an acid under certain conditions. Mn3+ has an incomplete d-shell, resulting in the availability of electrons to donate, making it a Lewis acid. Mn3+ may react with water or other species as an acid, releasing a proton, which can be expressed in a chemical equation as follows:Mn3+ + H2O ⇌ MnO2+ + H+The above equation displays how the cation, Mn3+ acts as an acid.

In chemistry, Mn3+ or manganese(III) cation refers to the manganese ion with a charge of +3. A cation is an ion that carries a positive charge. Mn3+ has an incomplete d-shell, resulting in the availability of electrons to donate, making it a Lewis acid. Mn3+ can act as an acid, as it can accept a pair of electrons from a species or donate a proton to another species.

To know more about manganic ion visit:-

https://brainly.com/question/29950700

#SPJ11


Related Questions

2) write the relationships between the hydrogen ion and hydroxide ion concentrations for an acid, a base and water. explain why this is the case.

Answers

In an acid, the hydrogen ion (H+) concentration is higher than the hydroxide ion (OH-) concentration. In a base, the hydroxide ion (OH-) concentration is higher than the hydrogen ion (H+) concentration. In water, the hydrogen ion (H+) concentration is equal to the hydroxide ion (OH-) concentration.

The relationship between the hydrogen ion (H+) and hydroxide ion (OH-) concentrations is based on the concept of acidity and alkalinity. In an acid, such as hydrochloric acid (HCl), the acid dissociates in water to release hydrogen ions (H+). This results in a higher concentration of H+ ions than OH- ions, leading to an acidic solution.

In a base, such as sodium hydroxide (NaOH), the base dissociates in water to release hydroxide ions (OH-). This results in a higher concentration of OH- ions than H+ ions, leading to an alkaline solution.

In pure water, there is a balance between the concentration of H+ and OH- ions. The self-ionization of water occurs, where a small fraction of water molecules dissociate into H+ and OH- ions. The concentration of H+ ions equals the concentration of OH- ions, resulting in a neutral solution.

This relationship between H+ and OH- concentrations is a fundamental property of acids, bases, and water and is essential in understanding their behavior and pH levels.

You can learn more about hydrogen ion at

https://brainly.com/question/29033205

#SPJ11

pls help because im not smart.-.

pls help because im not smart.-.

Answers

Answer:

Im not smart either but im pretty sure its D because its a pie chart so its asking how many and pie charts tell you how much something has

Explanation:

I think it’s d, hope this helped :)

please help!!

a motorcycle that travels north 201m in 7s d= t= v=

Answers

Answer:

d=0.4cm

t=0.25km

v=7s of 100m

i hope it helps you

this is my asnwer

correct me if im wrong

#carryonlearning

which of the following is false? group of answer choices applied pressure only refers to atmospheric pressure distillation separates compounds based on boiling point boiling point is the temperature at which the vapor pressure of the liquid equals the applied pressure increasing temperature increases vapor pressure

Answers

The false statement is applied pressure only refers to atmospheric pressure and the correct option is option 1.

It is the ratio of the force applied to the surface area over which the force is applied. Pressure can be defined as the force applied perpendicular to the surface of an object per unit area over which that force is distributed. Atmospheric pressure is the pressure exerted by the atmosphere on the earth.

Thus applied pressure not only represents atmospheric pressure.

Learn more about Pressure, here:

https://brainly.com/question/29341536

#SPJ4

How does Nanoparticles in Medicine relate to quantum numbers

Answers

Using particles that are intended to adhere to specific cells, injured cells can be treated directly. Early disease detection is made possible by this technique, which also causes less damage to the body's healthy cells.

What medical use do nanoparticles have?

Medicine can now be included in nanoparticles the size of viruses thanks to modern research. Because they can locate damaged cells with extreme precision and administer the medication there, nanoparticles are effective for drug delivery—the administration of the medication to the body.

In the body, nanoparticles are active The epidermis, lining of the lungs, or lining of the intestine are some of the exterior layers of the body through which nanoparticles can enter. The specific physical and chemical characteristics of the particle will determine how successfully they migrate from the outside to the inside

to learn more about nanoparticles refer to:

https://brainly.com/question/28817822

#SPJ13

if you start with 5.5 grams of sodium fluoride how many grams of magnesium fluoride will be produced

Answers

From 5.5 grammes of sodium fluoride, 4.1 grammes of magnesium fluoride will be created. The inorganic substance MgF2 stands for magnesium fluoride.

It naturally occurs as the rare mineral sellaite and is a white crystalline salt that is transparent over a broad range of wavelengths and has commercial use in optics used in space telescopes. With the formula NaF, sodium fluoride (NaF) is an inorganic substance. It is utilised in minute quantities in toothpaste, metallurgy, and as a flux in addition to fluoridating drinking water. It is a white or colourless substance that easily dissolves in water. Pharmaceutical manufacturers frequently use it as a source of fluoride. Mass in grammes is equal to 0.06548 times 62.301 grammes of MgF2.

= 0.06548 /62.301 = 4.1grams

Learn more about sodium fluoride here

https://brainly.com/question/2807538

#SPJ4

Please answer these questions:

Please answer these questions:
Please answer these questions:

Answers

The RK of methyl orange is 3.5, as it changes color from red to yellow at a pH of 3, and has its most intense color (yellow) at pH 6.

What is methyl?

Methyl is an organic compound with a formula of CH3, which is a single carbon atom bonded to three hydrogen atoms. It is a type of hydrocarbon and is the simplest of all alkyl compounds. Methyl is a versatile molecule that can be found in a variety of compounds, including pharmaceuticals, solvents, fragrances, and food additives. It is also used in the production of plastics, rubber, dyes, and other synthetic materials. Additionally, methyl is a key component of natural gas, oil, and coal, and can also be produced from biomass. In the body, methyl is used for a variety of biological processes, such as the metabolism of proteins, carbohydrates, and fats.

To learn more about methyl
https://brainly.com/question/28543544
#SPJ1

colour of anhydrous copper II sulphate​

Answers

Answer:

White color

Explanation:

This compound when heated losses its water of crystallization and become anhydrous copper sulphate

Find the mass of 250 ml of water. The density of water is 1 g/ml. D= M= V=

Answers

The mass of 250 ml of water is 250 g.

The mass of a substance, when volume and density are given can be found by using the following formula:

mass = density × volume

Here,

density = 1 g/ml

volume = 250 ml

mass = 1 g/ml × 250 ml

         = 250 g

Therefore, the mass of 250 ml of water is 250 g.

To know more about density:

https://brainly.com/question/26364788

which quantum number does not give information about an individual orbital?

Answers

Answer:

the spin quantum number.

what unit of temperature is used in gas law calculations

Answers

Answer:

Kelvin scale.

Explanation:

the lelvin scale is used in gas law problems because the pressure and volume of gas depend on the kinetic energy or motion of the particles.

Who do you think should be responsible for cleaning up all the space junk orbiting the earth?
Please I really really needed help

Answers

Answer:

astronots there already up there so they might as well do it.

let me rephrase that: assuming the strength of an acid is determined by how well a substance is willing to let go of its proton and taking into consideration the fact that electrons are bound to orbitals (BUT may move between them) is true, then would acids still be possible if the positions of electrons and protons were swapped?

Answers

The strong acid and strong base has high rate constant of dissociation. The rate constant for weak acid and base for the dissociation is low, they do not easily dissociate in water. Therefore, no, acid would not remain acid  if the positions of electrons and protons were swapped.

What are acid and base?

Acid is a solution which releases H⁺ hydrogen ion when dissolved in water. Base releases hydroxide ion OH⁻ ion when dissolved in water.

pH is a measurement of amount of hydronium ion H₃O⁺ in a given sample. Strength of acidic nature is directly proportional to the concentration of hydronium ion.

On subtracting pH from 14, we get pOH which measures the concentration of hydroxide ion in a given solution. Temperature affect the pH. At room temperature pH scale is between 0 to 14. 7 is the pH of neutral solution. No, acid would not remain acid  if the positions of electrons and protons were swapped.

Therefore, no, acid would not remain acid  if the positions of electrons and protons were swapped.

To know more about acid and bases, here:

https://brainly.com/question/27228111

#SPJ1

can some one please answer these chemistry questions

can some one please answer these chemistry questions

Answers

Hello your answer is:

A: Cesium
B: Argon
C: Iodine
D: Phosphorus


Potassium (K): 1s22s22p63s23p64s1
Calcium: (Ca): 1s22s22p63s23p64s2
Iodine (I): 1s22s22p63s23p64s23d104p65s24d105p5
Arsenic(As): 1s22s22p63s23p64s23d104p3

chemistry help please!! ​

chemistry help please!!

Answers

Answer:

no so boring........................

In an ideal situation where no heat energy is produced, what is the relationship between the chemical energy provided by the battery and the electrical energy produced according to the Law of Conservation of Energy?

Answers

Answer:

See explanation

Explanation:

The principle of conservation of energy states that energy can neither be created nor destroyed but can be converted from one form to another. Hence, chemical energy in a battery can be converted to electrical energy.

Usually, the conversion of energy from one form to another is not 100% efficient according to the second law of thermodynamics. Some energy is wasted in the process, sometimes as heat.

Hence, in an ideal situation where no heat energy is produced; all the chemical energy is converted to electrical energy (100% energy conversion). There will be no energy loss if no heat is produced.

Which acid is commonly responsible for the dissolution of limestone? Carbonic Sulfuric Nitric Hydrochloric

Answers

Answer: A: Carbonic

Explanation: Quizlet confirmed

.The C-C stretching vibration of ethylene can be treated as a harmonic oscillator.
a. Calculate the ratio of the fundamental frequencies for ethylene and deuterated ethylene
b. Putting different substituents on the ethylene can make the C-C bond longer or shorter. For a shorter C-C bond, will the vibrational frequency increase or decrease relative to ethylene? Why?
c. If the fundamental vibrational frequency for the ethylene double bond is 2000 cm^-1,
what is the wavelength in nm for the first harmonic vibration frequency?

Answers

A. The ratio of the fundamental frequencies for ethylene and deuterated ethylene is 1.07.

b. It should be noted that the vibrational frequency increase relative to ethylene?

c The wavelength in nm for the first harmonic vibration frequency is 2500nm

WHat is a wavelength?

Wavelength is the distance between two consecutive peaks or troughs in a wave. It is usually denoted by the Greek letter lambda (λ) and is measured in meters (m) or other units of length.

Wavelength is an important characteristic of all types of waves, including electromagnetic waves (such as light and radio waves) and mechanical waves (such as sound waves).

The calculation is attached.

Learn more about wavelength on

https://brainly.com/question/10728818

#SPJ1

.The C-C stretching vibration of ethylene can be treated as a harmonic oscillator.a. Calculate the ratio


Most matter in the universe is made up of me.
A
Metal
B
Nonmetal

Answers

Answer:

A. Metals

Explanation:

a) Suppose you wanted to produce 1.00L of a 3.59M solution of H2SO4

1) what is the solute?
2)what is the solvent?
3) how many grams of solute are needed to make this solution?


b) how many grams of salute are needed to make 2.50 of a 1.75M solution Ba(NO3)2?

Answers

Answer:

1. The solute in this case is H₂SO₄, which stands for sulfuric acid.

2. The solvent is the substance in which the solute is dissolved. In this case, the solvent is not explicitly mentioned, but it is typically water (H₂O) for most aqueous solutions.

3.

Given:

Molarity (M) = 3.59 M

Volume (V) = 1.00 L

The formula to calculate the number of moles (n) of solute is:

n = M * V

Substituting the given values:

n = 3.59 mol/L * 1.00 L = 3.59 mol

To determine the mass of the solute in grams, we need to know the molar mass of H₂SO₄. The molar mass of sulfur (S) is approximately 32.07 g/mol, oxygen (O) is approximately 16.00 g/mol, and hydrogen (H) is approximately 1.01 g/mol.

The molar mass of H₂SO₄ is:

2(1.01 g/mol) + 32.07 g/mol + 4(16.00 g/mol) = 98.09 g/mol

Finally, we can calculate the mass of the solute:

mass = n * molar mass

mass = 3.59 mol * 98.09 g/mol ≈ 350.96 g

Therefore, approximately 350.96 grams of H₂SO₄ are needed to make a 1.00 L solution with a molarity of 3.59 M.

Question 2 of 30
A television commercial shows happy people while describing some medical
symptoms. These symptoms include feeling tired and sad. The medication
being advertised by the commercial was approved by the FDA to treat a
disease that causes these symptoms. The narrator says that it is available by
prescription only and contains 1% of the active ingredient. What can you infer
about this medication?
OA. The people in the commercial are happy because they were
treated by the medication.
B. The medication would be more effective if it contained 10% of the
active ingredient.
C. Anyone who has the symptoms should request a prescription
from his or her doctor.
D. The medication can treat people who have the disease described.

Answers

The medication can treat people who have the disease described. According to the commercial, the drug has FDA approval to treat a condition whose symptoms are listed.

Additionally, the narrator notes that the medication only comes with a prescription and has 1% of the active substance. We can deduce from this information that the drug can effectively treat persons who have the condition generating these symptoms, but obtaining it requires a prescription. The commercial provides no support for the other possibilities.

Therefore, the correct option is D.

Learn more about Medication, here:

https://brainly.com/question/11098559

#SPJ1

Hydrogen and oxygen react under a specific set of conditions to produce water according to the following equation.
2 H2(g) + O2(g) 2 H2O(g)
(a) How many moles of hydrogen would be required to produce 2.8 mol of water?
(b) How many moles of oxygen would be required?

Answers

Answer:

fccdsetyujvreettyukknop

In hot dry conditions, rubisco can attach O2 to RuBP in a process called ______. which ultimately produces CO2.

Answers

In hot dry conditions, rubisco can attach O₂ to RuBP in a process called photorespiration, which ultimately produces CO₂.

Rubisco, or ribulose-1,5-bisphosphate carboxylase/oxygenase, is an enzyme involved in the process of carbon fixation during photosynthesis.

Under normal conditions, rubisco catalyzes the attachment of CO₂ to RuBP (ribulose-1,5-bisphosphate), leading to the formation of an unstable 6-carbon molecule that quickly breaks down into two 3-carbon molecules, which are then utilized in subsequent steps of the Calvin cycle to produce carbohydrates.

However, in hot dry conditions, a phenomenon known as photorespiration can occur. Photorespiration is a wasteful process in which rubisco mistakenly attaches O₂ instead of CO₂ to RuBP. This reaction is referred to as oxygenation. The resulting compound breaks down to release CO₂, thus reducing the efficiency of photosynthesis.

Photorespiration is considered wasteful because it consumes energy and produces no useful organic molecules. It occurs because rubisco has a higher affinity for O₂ than for CO₂ when the concentration of CO₂ is low and the concentration of O₂ is high, as is the case in hot dry conditions. The resulting breakdown of the oxygenated product in photorespiration releases CO₂, contributing to the net loss of fixed carbon.

Overall, in hot dry conditions, rubisco's oxygenation of RuBP in the process of photorespiration leads to the production of CO₂, which is ultimately released into the environment.

To know more about photorespiration refer here:

https://brainly.com/question/30900066#

#SPJ11

explain why the lower vapor pressure for a solution containing a nonvolatile solute results in a higher boiling point and lower melting point compared to the pure solvent.

Answers

The lower vapor pressure results in a depressed freezing point. As a result, the graph shifts, and the triple point is lowered resulting in a lower melting point.

The boiling factor of a substance is the temperature at which the vapor stress of a liquid equals the stress surrounding the liquid and the liquid modifications right into a vapor. the warmth of vaporization is the energy required to convert a given amount (a mol, kg, pound, and so on.) of a substance from a liquid right into gasoline at a given pressure (frequently atmospheric stress).

The boiling point of a liquid varies consistent with the carried-out strain; the normal boiling point is the temperature at which the vapor stress is equal to the same old sea-stage atmospheric pressure (760 mm [29.92 inches] of mercury). At sea level, water boils at 100° C (212° F). The boiling factor of a natural substance is the temperature at which the substance transitions from a liquid to the gaseous phase.

To learn more about Boiling point visit here:

brainly.com/question/28203474

#SPJ4

please help pls help 20 points Which of the following is a myth about water conservation? An important part of water conservation is preventing water pollution. Using an electric clothes dryer conserves more water than air-drying clothes. Buying bottled water does not conserve more water than drinking from the tap. A front-loading washing machine uses less water than a top-loading washing machine.

Answers

Answer:

Air-drying clothes conserves more water than using an electric clothes dryer.

Rebecca placed an uncharged object next to an electrically charged object, and they were attracted to each other. She moved the charged object and placed it next to another uncharged object, and they were attracted to each other. What is the best explanation as to why this happened? The charged object kept its charge.
The charged object lost its charge.
The second object had a stronger charge.
The second object had a weaker charge.(PLEASE HELP)

Answers

Answer:

the second object had a weaker charge

Explanation:

the charged object had a stronger charge and opposite to that of the uncharged hence causing attraction

Answer:

d

Explanation:

The second object had a weaker charge.

WRITE THE FORMULAS FOR THE COMPOUNDSCobalt(II) Bromide Heptahydrate

Answers

.ANSWER

\(\text{CoBr}_2.7H_{2_{}}O\)

STEP-BY-STEP EXPLANATION

From the question given, you were asked to name a compound

Cobalt (II) Bromide Heptahydrate

The heptahydrate in the compound means it has 7 molecules of water

Therefore, the chemical formula can be written below as

\(\text{CoBr}_2.7H_2O\)

What is the process called when the moon bagins to fade from full moon to new moon

Answers

Waining there’s not much to explain here it’s simple moon phases

Does Jupiter revolve faster than earth? My school platform says it doesn't but I thought I did.

Answers

Answer:

Yes, Jupiter does revolve faster than the earth.

Earth rotates once in 24 hours; whereas, Jupiter rotates more quickly, taking only about 10 hours. This means that Jupiter rotates about 2 1/2 times faster than the Earth

Explanation:

Hope this helps

Yes it does. I know because it is in my book for 10th grade

21. What is the frequency, given 2-3 x 10¹m? Show all work

Answers

Answer:

Frequency is 2Hz

Explanation:

Other Questions
documents that are error-free tend to create a favorable impression. group of answer choices true false A group of nutritionists are hoping to prove that a new soy bean compound has more protein per gram than roast beef, which has a mean protein content of 20 . A random sample of 5 batches of the soy compound have been tested, with the following results: protein content: 15,22,17,19,23 Assuming that the protein content of the soy bean compounds is normal, what is the value of the test statistic? Z=(19.220)/sqrt(8.96/5)T=(19.220)/sqrt(11.2/5)Z=(19.220)/sqrt(11.2/5)T=(19.220)/sqrt(8.96/5) A boxer hits a punching bag. Her fist's velocity decreases from 9.9 m/s to 0 m/s during an impact lasting 0.8s. If her fist's mass is 0.51 kg, what was the force of her punch What is the value of x in the equation 2(x - 4) = 4(2x + 1)? 2. Filename: assign4-6.py Write a program and create the following functions: shapes (): takes the shape name and a number as parameters, and calls the proper function to calculate the area. areacircle(): take one number as a parameter, calculates the area of the circle, and print the result. Round the output to 2 decimal places. areasquare (): takes one number as a parameter, calculates the area of the circle, and prints the result. Round the output to 25 decimal places. You can assume the shape names will be circle or square (nothing else). The program output is shown below. Input: a) python C:\Users\neda\DataProgramming\M4\assign4-6.py circle 10 b) python C:\Users\neda\DataProgramming\M4\assign4-6.py square 5 Output: a) The circle area is 314.16 b) The square are in 25 IUPAC NAME FOR:CH2(OH)-CH2-CH(C2H5)-OH Use the tangent plane to approximate a function of two variables at a point. Use a tangent plane to approximate the value of the following function at the point (4.1, 4.9). Give your answer accurate to 4 decimal places. f(x, y) = /73 2a? y? what vehicle uses the chademo standard charging port? Hemoglobin can carry three different molecules or ions. Whatare they, and for each of them explain how hemoglobin'sability to bind to them contributes to homeostasis of thebody. in an economics class with 30 students, the teacher wants 2 different students to answer problems 4 and 9 in front of the class. in how many ways can the teacher pick students for the problems? What is the term used when a ball is hit and the batter reaches the following bases safely (without being called out)?please help me a) first baseb)second basec)third based) homerun Which choice shows three lengths that cannot be the lengths of the three sides of a triangle? 2 cm, 8 cm, 8 cm B. 2 cm, 3 cm, 6cm C. 4cm, 5 cm, 7 cm . D. S cm. 6 cm. 9 cm what negative influences must be avoided to be able to achieve your goal mention at least 3 14. Reflected ray 30 Fig 6.31 reflection on a plane mirror. In Fig 6.31 the angle between the plane mirror and the incident ray is 30. Find the a. Angle of incidence b. Angle of reflection Incident ray 2. current real gdp is $6 trillion and potential gdp is $7.5 trillion. draw a correctly labeled ad/as graph to show this problem in the economy. the government is prepared to pass a spending package to return the economy to full employment. what kind of spending package should be passed and how big does it need to be? assume that the mpc The student then sets up two more test tubes containing iron nails.Explain why SIMPLIFY THIS EXPRESSION:2(z + 3) + 3(5 - 3z) help me with this composite figure The steps a student took to solve an equation are shown below.(-8(-8x+20) = -8(-*-3)Step 1: -6x +15 = 8x + 24Step 2:15 = 2x + 24Step 3: -9 = 2xStep 4: x==3What error did the student make and what is the correct value of x?Explain your answer HELP PLS! IS THIS RIGHT? ONLY ANSWER IF YOU KNOW! THANKS!