Help I will give Brainlest​

Help I Will Give Brainlest

Answers

Answer 1

Answer:

B. y + 1 =3/2(x-6)

Step-by-step explanation:

Plz mark brainliest! :D


Related Questions

What is the product of (4i) and (4+i)

Answers

Answer:

-4 + 16 i

Step-by-step explanation:

You are dealing with imaginary numbers so i dont remember y but i know that it is that answer

Answer:

- 4 + 16i.

Step-by-step explanation:

4i(4 + i)

= 16i + 4i^2       Now i^2 = -1 so we have:

16i - 4   (answer)

Find AB.
7.5 big ideas

Find AB.7.5 big ideas

Answers

Answer:

30.4 units

Step-by-step explanation:

Solution

This Question asks on the concept of Similar Triangles.

Given information from the question, we know that:

DM = MA

CN = NB

DC and AB are parallel.

We can use the ratio formula to find the length of AB based on the length ratio between MN and DC.

\(\frac{AB}{MN} =\frac{MN}{DC} \\\frac{AB}{18.7} =\frac{18.7}{11.5} \\AB = \frac{18.7}{11.5} * 18.7\\AB = 30.4\ units\)

Therefore the length of AB is 30.4 units.

67min; 1.1h. Which one is more precise

Answers

Answer:

67 mins= 1 hour and 7 minutes, 1.1 hours is 66 mins so 67 mins

Step-by-step explanation:

Barbara, a school superintendent, asks the local school board for permission to hire an additional teacher whenever the student enrollment at a certain grade level within a school increases by 35 students beyond capacity. This is an example of which type of decision

Answers

Answer:

Programmed

Step-by-step explanation:

Programmed Decisons may be classified as those actions which are routinely carried out or performed based on existing rules and protocol. In programmed decision making, the rules are in place, therefore once the criteria or requirement for which the rule or routine is to be enforced arises, programmed Decisons are made. In the scenario, the superintendent required that a programmed Decison be made in cases or situations where enrollment increases by 35 student beyond capacity, Hence, with this, every time this occurs the additional teachers will be hired.

Higher the weight of the variable in a standardized predictor environment, we can say that the particular variable has a higher discriminating power. True or False?

Answers

False. The weight of a variable in a standardized predictor environment does not necessarily indicate that the variable has a higher discriminating power.

Discriminating power is determined by the correlation of a predictor variable with the outcome variable. We can calculate the correlation between a predictor variable and an outcome variable using Pearson's correlation coefficient, which is represented by the formula:

r = (NΣXY - (ΣX)(ΣY)) / √[(NΣX2 - (ΣX)2)(NΣY2 - (ΣY)2)].

In this formula, N is the sample size, ΣX is the sum of the predictor variable, ΣY is the sum of the outcome variable, ΣXY is the sum of the products of the predictor and outcome variables, and ΣX2 and ΣY2 are the sums of the squares of the predictor and outcome variables, respectively. The Pearson's correlation coefficient ranges from -1 to +1, with +1 indicating perfect positive correlation, 0 indicating no correlation, and -1 indicating perfect negative correlation. A higher correlation coefficient indicates a higher discriminating power.

Therefore, the weight of a variable in a standardized predictor environment does not indicate whether or not the variable has a higher discriminating power; this is determined by the correlation between the predictor and outcome variables.

Learn more about Pearson's correlation here:

https://brainly.com/question/28316863

#SPJ4

Which of the following correctly indicates whether a triangle can have sides with lengths 11.7, 12.4, and 13.3, and also provides the correct explanation?

-Yes; 11.7 + 12.4 is greater than 13.3.
-Yes; 13.3 + 11.7 is not greater than 12.4.
-No; 11.7 + 12.4 is greater than 13.3.
-No; 11.7 + 12.4 is not greater than 13.3.

Answers

-Yes; 11.7 + 12.4 is greater than 13.3

The correct explanation will be;

⇒ Yes; 11.7 + 12.4 is greater than 13.3.

What is mean by Triangle?

A triangle is a three sided polygon, which has three vertices and three angles which has the sum 180 degrees.

Given that;

A triangle can have sides with lengths 11.7, 12.4, and 13.3.

Now,

Since, A triangle can have sides with lengths 11.7, 12.4, and 13.3.

We know that;

In a triangle, The sum of two sides of triangle in always greater than the third side.

Here, The sides of triangle are,

⇒  11.7, 12.4, and 13.3.

So, We get;

⇒ 11.7 + 12.4 = 24.1 > 13.3

Hence, We get;

The triangle is formed because 11.7 + 12.4 is greater than 13.3.

Learn more about the triangle visit:

https://brainly.com/question/1058720

#SPJ2

how does attitude, beliefs and knowledge impact how a teacher delivers a lesson

Answers

Attitude, beliefs, and knowledge shape a teacher's delivery: attitude affects engagement, beliefs influence instructional decisions, and knowledge enables effective communication and learning facilitation.

Attitude, beliefs, and knowledge play crucial roles in shaping how a teacher delivers a lesson. Here's a detailed explanation of their impacts:

Attitude:

Attitude refers to a teacher's mindset, emotions, and approach towards teaching. A positive attitude fosters enthusiasm, motivation, and a genuine passion for the subject matter. This translates into an engaging and dynamic teaching style, creating an environment conducive to learning. Conversely, a negative attitude can lead to disinterest, lack of enthusiasm, and a disengaged teaching approach, which can hinder students' engagement and comprehension.

Beliefs:

A teacher's beliefs influence their instructional decisions and pedagogical strategies. Beliefs about students' capabilities, learning styles, and the purpose of education can shape the teacher's approach to delivering a lesson. For example, if a teacher believes that all students have the potential to succeed, they may employ differentiated instruction techniques to cater to diverse learning needs. Conversely, if a teacher holds limiting beliefs about students' abilities, they may adopt a one-size-fits-all approach, which may hinder student progress.

Knowledge:

A teacher's knowledge encompasses both subject matter expertise and pedagogical content knowledge. Profound knowledge of the subject allows a teacher to effectively structure and present the lesson, answer student queries, and provide relevant examples. Pedagogical content knowledge helps in selecting appropriate instructional strategies, adapting to student needs, and assessing learning effectively. Without a strong knowledge base, a teacher may struggle to deliver accurate information, engage students, or address misconceptions.

Collectively, attitude, beliefs, and knowledge significantly impact a teacher's delivery of a lesson. A positive attitude enhances student motivation and engagement. Strong beliefs in students' potential and individualized instruction foster a supportive learning environment. Adequate subject knowledge and pedagogical skills enable effective communication and facilitate meaningful learning experiences. By combining these elements, teachers can create an impactful and effective learning environment that nurtures student growth and achievement.

for such more question on learning facilitation.

https://brainly.com/question/23008798

#SPJ8

need help !! Please somebody help

need help !! Please somebody help

Answers

Answer:

The bottom Option

Note:

Due to my sus vibes from your questions, this is the last one I am answering from you. this is basic and easy if you read it.

Find the product using the FOIL method.
(q-2)(q-8)

Answers

q^2-2q-8q+16
=q^2-10q+16

Answer:

q²-10q+16

Step-by-step explanation:

FOIL stands for:

First -> (q-2)(q-8)

Outer -> (q-2)(q-8)

Inner -> (q-2)(q-8)

Last -> (q-2)(x-8)

Following FOIL, we get:

(q-2)(q-8)

(q)(q)+(q)(-8)+(-2)(q)+(-2)(-8)

q²-8q-2q+16

q²-10q+16

Therefore, the expanded form is q²-10q+16

In , both feet can be off the ground at once. To avoid full impact on the joints, use . can be a better activity type for overweight individuals. increase(s) the number of calories used in a workout. Running is an example of . Short, high intensity segments included in a workout is/are called .

Answers

Introducing short, high-intensity segments in a workout is called interval training. This method can help boost calorie expenditure and improve overall fitness.

When engaging in running, there are moments during the running gait cycle where both feet are off the ground simultaneously. This phenomenon is known as the flight phase. Running is considered a high-impact activity, which means it puts stress on the joints, especially for individuals who are overweight or have joint-related issues. To mitigate this impact, low-impact exercises such as swimming or cycling can be more suitable for overweight individuals as they provide cardiovascular benefits with reduced stress on the joints.

While running may not be the ideal choice for overweight individuals concerned about the joint impact, it can be advantageous for increasing the number of calories burned during a workout. Running is a weight-bearing exercise that engages multiple muscle groups and requires more energy expenditure compared to low-impact exercises. This increased calorie burn can be beneficial for weight loss and improving cardiovascular fitness.

Interval training refers to a workout method that involves alternating periods of high-intensity exercise with periods of low-intensity or rest. This technique can be applied to various exercises, including running. By incorporating short, high-intensity segments, such as sprinting or running at a faster pace, into a workout, individuals can challenge their cardiovascular system, improve endurance, and burn more calories in a shorter amount of time. Interval training is known for its efficiency and effectiveness in boosting overall fitness levels.

To learn more about Interval training click here: brainly.com/question/13003179

#SPJ11

HELP 5TH GTRADE MATH HELPP

HELP 5TH GTRADE MATH HELPP

Answers

Answer:

The answer is (C)

Step-by-step explanation:

You was correct with ur answer

Answer:

(0.6, -1.4) is correct

Step-by-step explanation:

The lines are separated every 0.2 and if you count to the right 3x, it's 0.6. And then go down 7x, it's -1.4.

Need help what is the answer, please.
I am so confused

NO SPAM ANSWERS!!!!
(YOU HAVE BEEN WARNED)
NO LINKS AS WELL!!!
(WILL BE REPORTED IF NOT APPLICABLE)

Need help what is the answer, please. I am so confused NO SPAM ANSWERS!!!!(YOU HAVE BEEN WARNED) NO LINKS

Answers

Answer:

V = 405.04

Step-by-step explanation:

Volume of a cone:

V = πr²(h/3)

V = 3.14(6.1²)(10.4/3)

V = 3.14(37.21)(10.4/3)

V = 405.04

What are the domain and range of g

of g(x) = (x-17] +612

o

Domain: x< 17

Range: g(x) = 61

O

Domain: All real numbers

Range: x<17

Domain: g(x) 2 61

Range: x 17

Domainc All real numbers

Range: g(x) = 61

Answers

The domain of g(x) is all real numbers, and the range is (61, ∞) and the range is (61, ∞).

The domain of a function is the set of all possible input values for which the function is defined, while the range is the set of all possible output values.

For the given function g(x) = -1/4 (x−17)² + 61, the domain is all real numbers since there are no restrictions on the input values.

To find the range, we can use the fact that the vertex of the parabola is at (17, 61) and the coefficient of the squared term is negative, indicating a downward opening parabola.

Thus, the maximum value of the function occurs at the vertex and is 61, which is also the minimum possible value. Therefore, the range is (61, ∞).

In summary, the domain of g(x) is all real numbers, and the range is (61, ∞).

For more questions like Domain click the link below:

https://brainly.com/question/28135761

#SPJ4

What are the domain and range of gof g(x) = (x-17] +612oDomain: x&lt; 17Range: g(x) = 61ODomain: All

what are the slope and y intercept of the linear function graphed to the left

Answers

The slope and y-intercept of the linear function graphed include the following:

slope = -1/2.

y-intercept = 1.

What is the slope-intercept form?

In Mathematics and Geometry, the slope-intercept form of the equation of a straight line is given by this mathematical expression;

y = mx + c

Where:

m represents the slope or rate of change.x and y are the points.c represents the y-intercept or initial value.

First of all, we would determine the slope of this line;

Slope (m) = (y₂ - y₁)/(x₂ - x₁)

Slope (m) = (0 - 1)/(0 - 2)

Slope (m) = -1/2

For the y-intercept, we have:

y-intercept = 1.

Read more on slope-intercept here: brainly.com/question/4074155

#SPJ1

Missing information:

The question is incomplete and the complete question is shown in the attached picture.

what are the slope and y intercept of the linear function graphed to the left

A spinner with repeated colors numbered from 1
to 8 is shown. Sections 1 and 8 are purple.
Sections 2 and 3 are yellow. Sections 4, 5, and 6
are blue. Section 7 is orange.
Which statement about probability is true?
The probability of landing on orange is greater
than the probability of landing on purple.
The probability of landing on yellow is less than
the probability of landing on blue.
The probability of landing on orange is equal to
the probability of landing on yellow.
The probability of landing on purple is equal to
the probability of landing on blue.

A spinner with repeated colors numbered from 1to 8 is shown. Sections 1 and 8 are purple.Sections 2 and

Answers

Answer: The probability of landing on orange is equal to the probability of landing on purple

Step-by-step explanation:

The spinner has a total of 8 equally-sized sections, and each section has a unique color. Therefore, the probability of landing on any particular section is 1/8 or 0.125.

Looking at the colors on the spinner, we can see that there are two purple sections, two yellow sections, three blue sections, and one orange section.

Therefore, the probability of landing on orange is 1/8 or 0.125, which is equal to the probability of landing on purple (sections 1 and 8). So the statement "The probability of landing on orange is equal to the probability of landing on purple" is true.

On the other hand, the probability of landing on yellow is 2/8 or 0.25, which is greater than the probability of landing on blue (sections 4, 5, and 6), which is 3/8 or 0.375. So the statement "The probability of landing on yellow is less than the probability of landing on blue" is false.

Therefore, the correct statement about probability is "The probability of landing on orange is equal to the probability of landing on purple."

Can y’all help me with the answer please

Can yall help me with the answer please

Answers

Answer:

the volume of the tent is 30ft³

It’s 30 ft or 30^2 yaaaaa

What is the equation of the circle with a center located at ( 5, 2) and is tangent at the y-axis?
a. x2 + y2 – 10x – 4y + 4 = 0
b. x2 + y2 + 10x – 4y + 25 = 0
c. x2 + y2 + 10x – 4y + 4 = 0
d. x2 + y2 – 10x – 4y + 25 = 0

Answers

The equation of a circle with center located at (5,2) and that is tangent to the y-axis is given as follows:

C. x² + y² - 10x - 4y + 4 = 0.

What is the equation of a circle?

The equation of a circle of center \((x_0, y_0)\) and radius r is given by:

\((x - x_0)^2 + (y - y_0)^2 = r^2\)

Considering the center, we have that:

(x - 5)² + (y - 2)² = r².

The circle is tangent to the y-axis, meaning that it passes through the point (0, 2), thus the radius is obtained as follows:

r² = 25.

Then the equation in standard form is given as follows:

x² - 10x + 25 + y² - 4y + 4 - 25 = 0.

x² + y² - 10x - 4y + 4 = 0.

Meaning that option C is correct.

More can be learned about the equation of a circle at https://brainly.com/question/1506955

#SPJ1

The number of loaves of bread purchased and the total cost of the bread in dollars can be modeled by the equation c = 3. 5b. Which table of values matches the equation and includes only viable solutions?.

Answers

The dependent variable is the variable that depends on the value of other variable and keeps on changes with change in the value of one variable. The values given in the table 3 matches the equation and includes the viable solutions.

Given information-

The number of loaves of bread purchased and the total cost of the bread in dollars can be modeled by the equation,

\(c=3.5b\)

The quantity of the bread depends on the quantity of the loaves.

Dependent variable

The dependent variable is the variable that depends on the value of other variable and keeps on changes with change in the value of one variable.

Lets check which table satisfy the above equation.

Table 1-

In the table the first values of the bread and the loves is -2 and -7. The quantity of a bread and loves can not be negative. Thus the table 1 does not provides the viable solution.

Table 2-

In the table 2 the value of the third row is 1.5 loaves and 5.25 breads. Check this by the given equation. When the value of loaves is 1.5 then the value of the bread is,

\(c=3.5\times1.5\)

\(c=4.5\)

The value of bread must be 4.5. Thus the table 2 does not provides the viable solutions.

Table 3-

Put the values of the loaves in the given equation one by one,

When the value of loaves is 0 then the value of the bread is,

\(c=3.5\times0=0\)

When the value of loaves is 3 then the value of the bread is,

\(c=3.5\times3=10.5\)

When the value of loaves is 6 then the value of the bread is,

\(c=3.5\times=21\)

When the value of loaves is 9 then the value of the bread is,

\(c=3.5\times9=31.5\)

All the values of the table 3 satisfies the given equation.

Hence, the values given in the table 3 matches the equation and includes the viable solutions.

Learn more about the dependent variables here;

https://brainly.com/question/967776

The rim of the volcanic crater shown below is a circle. The diameter is 840 m.
What is the circumference of the rim of the crater in kilometres (km)?
Give your answer to 1 d.p.
840 m
Not drawn accurately

Answers

Answer:

2.6 kilometers

Step-by-step explanation:

To find the circumference of a circle, we can use the formula:

Circumference = π * diameter

Given that the diameter of the volcanic crater is 840 meters, we can substitute this value into the formula:

Circumference = π * 840

Using the approximate value of π as 3.14159, we can calculate the circumference:

Circumference = 3.14159 * 840

Circumference ≈ 2643.1796 meters

To convert the circumference to kilometers, we divide the value by 1000:

Circumference in kilometers = 2643.1796 / 1000

Circumference ≈ 2.6432 kilometers

Therefore, the circumference of the rim of the volcanic crater is approximately 2.6 kilometers (rounded to 1 decimal place).

Consider the equation a y ' ' +b y ' +c=0, where a ,b , and c are constants with a>0.
Find conditions on a, b, and c such that the roots of the characteristic equation are: a) Real, different, and negative b) Real, with opposite signs c) Real, different, and positive.
In each case, determine the behavior of the solution as t→[infinity], and give an example.

2.Given a differential equation t y ' '−(t+1) y ' + y=t 2 a)
Determine whether the equation is a linear or nonlinear equation. Justify your answer.

Answers

1. a) Real, different, and negative roots: For the roots to be real, different, and negative, we require the discriminant to be positive: b² - 4ac > 0.

b) Real, with opposite signs: For the roots to be real and with opposite signs, the discriminant should be negative: b² - 4ac < 0.

c) Real, different, and positive roots: For the roots to be real, different, and positive, the discriminant must be positive: b² - 4ac > 0.

2. the equation is linear because it is a linear combination of y

To find the conditions on constants a, b, and c in the differential equation ay'' + by' + c = 0 for different types of roots, we can consider the characteristic equation associated with it:

ar² + br + c = 0

a) Real, different, and negative roots:

For the roots to be real, different, and negative, we require the discriminant to be positive: b² - 4ac > 0. Additionally, since a > 0, the coefficient of r², the discriminant must also be negative: b² - 4ac < 0.

b) Real, with opposite signs:

For the roots to be real and with opposite signs, the discriminant should be negative: b² - 4ac < 0. Note that the roots may be equal or distinct, but they should have opposite signs.

c) Real, different, and positive roots:

For the roots to be real, different, and positive, the discriminant must be positive: b² - 4ac > 0. Additionally, since a > 0, the coefficient of r², the discriminant must also be positive: b² - 4ac > 0.

Now let's determine the behavior of the solution as t approaches infinity for each case:

a) Real, different, and negative roots:

As t approaches infinity, the solution will exponentially decay to zero. An example of such a differential equation is y'' - 2y' + y = 0, with roots r = 1 and r = 1.

b) Real, with opposite signs:

As t approaches infinity, the solution will oscillate between positive and negative values. An example of such a differential equation is y'' + 2y' + y = 0, with roots r = -1 and r = -1.

c) Real, different, and positive roots:

As t approaches infinity, the solution will diverge to positive or negative infinity, depending on the signs of the roots. An example of such a differential equation is y'' - 3y' + 2y = 0, with roots r = 1 and r = 2.

2. The given differential equation is t * y'' - (t + 1) * y' + y = t²

To determine whether the equation is linear or nonlinear, we examine the highest power of y and its derivatives:

The highest power of y is 1, and its derivative has a power of 0. Therefore, the equation is linear because it is a linear combination of y, y', and y'' without any nonlinear terms like y² or (y')³

Learn more about Differential equation here

https://brainly.com/question/25731911

#SPJ4

What is the point slope of a line with the slope 4 that contains the point (-3, -4) ?
A. y + 4 = -4 (x + 3)
B. y - 4 = -4 (x - 3)
C. y - 4 = 4 (x - 3)
D. y + 4 = 4 (x + 3)

Answers

Answer:

Correct choice: D.

\(y+4=4(x+3)\)

Step-by-step explanation:

The point-slope form of the equation of a line is:

\(y-k=m(x-h)\)

Where m is the slope and (h,k) is a point through which the line passes.

According to the question, the slope of a line is m=4 and it contains the point (-3,-4), thus, replacing the values:

\(y-(-4)=4(x-(-3))\)

Operating:

\(\boxed{y+4=4(x+3)}\)

Correct choice: D.

Find the exact value of cos(5pi/6)cos(pi/12)+sin(5pi/6)sin(pi/12)

Answers

solve the system of equations algebraically -5x+2y=4 2x+3y=6

Answers

(-5x+2y=4).2
(2x+3y=6).5

-10x+4y=8
10x+15y=30

[10x+(-10x)]+[15y+4y]=[30+8]

19y=38

y=38/19

y=2

2x+3y=6
2x+3(2)=6
2x=6-6=0

x=0

Step-by-step explanation:

-5x+2y= 4         <==== Multiply entire equation by -3 to get:

15x-6y = -12  

2x+3y= 6          <====  Multiply entire equation by 2 to get :

4x+6y = 12    Add the two underlined equations to eliminate 'y'

19x = 0     so x = 0

sub in x = 0 into any of the equations to find:  y = 2

(0,2)

find the exact value of the given expression. sin 2 cos−1 12 13 calculator

Answers

The exact value of the given expression. sin 2 cos−1 12 13 is 240/169.

To find the exact value of the given expression, we need to use the identity sin(2θ) = 2sin(θ)cos(θ) and the information provided. The expression you want to find is sin(2 * cos^(-1)(12/13)).

First, let's find the angle θ, which is cos^(-1)(12/13). In a right triangle with the adjacent side = 12 and hypotenuse = 13, we can use the Pythagorean theorem to find the opposite side: Opposite side = √(13^2 - 12^2) = √(169 - 144) = √25 = 5

Now, we can find sin(θ) and cos(θ): sin(θ) = opposite/hypotenuse = 5/13 cos(θ) = adjacent/hypotenuse = 12/13 Next, use the sin(2θ) identity: sin(2θ) = 2sin(θ)cos(θ) = 2(5/13)(12/13) = (10/169)(24) = 240/169 So, the exact value of the given expression is 240/169.

Visit here to learn more about the Right Triangle:

brainly.com/question/2437195

#SPJ11



Find the inverse of each function. Is the inverse a function?

y=5-2 x

Answers

The inverse of the function `y = 5 - 2x` is `y = (5 - x)/2` and it is a function.

To find the inverse of the given function `y = 5 - 2x`, we have to replace `y` with `x` and `x` with `y` and solve for `y`. Therefore, we have;

`x = 5 - 2y`

Add `2y` to both sides to isolate `y` on one side.

`x + 2y = 5`

Subtract `x` from both sides.

`2y = 5 - x`

Divide both sides by `2` to get `y` on its own.

`y = (5 - x)/2`

Therefore, the inverse of the function `y = 5 - 2x` is `y = (5 - x)/2`.

To check whether the inverse is a function or not, we can perform the vertical line test. If any vertical line intersects the graph of the inverse function at more than one point, then the inverse is not a function.

However, in this case, the inverse function passes the vertical line test and therefore it is a function.

To know more about inverse refer here:

https://brainly.com/question/33520209

#SPJ11

Name the angles that are adjacent to

Name the angles that are adjacent to

Answers

Answer:

angle k and n are adjacent to angle j

Which ordered pair is a solution of the equation?
7x – 2y = -5

Answers

I think (1,6) is hope it’s right !!

triangle abc is translated and reflected over the x axis. use the drawing tools to draw the triangle a'b'c

please show work if possible)

Answers

Answer:

Your a cheater

Step-by-step explanation:

let γ1, γ2, . . . , γp be cycles of generalized eigenvectors of a linear operator t corresponding to an eigenvalue λ. prove that if the initial eigenvectors are distinct, then the cycles are disjoint.

Answers

If the initial eigenvectors corresponding to distinct eigenvalues are different, then the cycles of generalized eigenvectors for each eigenvalue will be disjoint.

Let's assume that γi and γj are cycles of generalized eigenvectors corresponding to eigenvalues λi and λj, respectively. Since the initial eigenvectors are distinct, λi ≠ λj.

Now, let's suppose there exists a vector v that belongs to both cycles γi and γj. Then, by definition, we have t(v) = λi(v) and t(v) = λj(v). Since λi ≠ λj, this implies that v is a common eigenvector for two distinct eigenvalues, which contradicts the assumption that the initial eigenvectors are distinct.

Therefore, our assumption that there exists a vector v belonging to both γi and γj is false. Thus, the cycles γi and γj are disjoint.

By extension, we can apply the same reasoning to any pair of cycles γi and γj where i ≠ j, ensuring that all cycles corresponding to distinct eigenvalues will be disjoint.

Learn more about eigenvectors here:

https://brainly.com/question/31669528

#SPJ11

Use basic identities to simplify the following expression.


\(\frac{tan^2x-sec^2x}{cosx}\)


A. tanx

B. - tanx

C. secx

D. - secx

Answers

The simplified expression is \(\tan x+\sec x\), we arrive at this after performing mathematical calculations using basic identities.

What are basic mathematical identities?

Basic mathematical identities refer to fundamental equations or relationships between mathematical functions that are true for all values of the variables involved.

For example,  a + b = b, a x 0 = 0 are basic identities. Applying the same principle we can simply the mathematical expression with the basic identities provided below:

\(= \frac{\tan^2x-\sec^2x}{\cos x}\)

= \(\frac{\sin^2x-\cos^2x}{\cos x\cdot\cos^2x} \quad\text\)

\(=\frac{\sin^2x}{\cos^2x}\text{ and }\sec^2x\)

= \(\frac{1}{\cos^2x} \ =\frac{(\sin x+\cos x)(\sin x-\cos x)}{\cos^3x}\)

factoring the numerator using the difference of squares.

\(=\frac{\sin x}{\cos^2x}+\frac{\cos x}{\cos^2x} \\)

\(&=\tan x+\sec x\)

You can learn more about solving basic mathematical identities here https://brainly.com/question/28853516

#SPJ1


Other Questions
You wish to test the following claim ( H a ) at a significance level of = 0.002 .H o : = 88.7H a : > 88.7You believe the population is normally distributed and you know the standard deviation is =11.5=11.5. You obtain a sample mean of M=94.6M=94.6 for a sample of size n=36n=36.What is the critical value for this test? (Report answer accurate to three decimal places.)critical value =What is the test statistic for this sample? (Report answer accurate to three decimal places.)test statistic =The test statistic is...in the critical regionnot in the critical regionThis test statistic leads to a decision to...reject the nullaccept the nullfail to reject the nullAs such, the final conclusion is that...There is sufficient evidence to warrant rejection of the claim that the population mean is greater than 88.7.There is not sufficient evidence to warrant rejection of the claim that the population mean is greater than 88.7.The sample data support the claim that the population mean is greater than 88.7.There is not sufficient sample evidence to support the claim that the population mean is greater than 88.7. asking an applicant to describe how they would handle a situation with an employee who is consistently late for work is an example of using which type of interviewing? i.box-1-100w-1/2hrs find the kwh Discuss thoroughly all the questions ask below:1. Financial Management have two goals, these are profit maximization and wealth maximization. Discuss the difference between the two. Do you agree that the fundamental aim within financial management is to create and sustain shareholders wealth? Substantiate your arguments.2. There are 4 financial statements a business is preparing at year end. Discuss the features of the 4 financial statements using the accounting equation Assets = Liabilities + Owners Equity/Shareholders Equity. Can a business prepare a financial statement before year end? What do you call those financial statements? Devise a test to demonstrate the validity of the following formulas. What values of A and B should be used to test these function thoroughly? (a). Sin (A+B) = Sin(A)cos(B)+cos(A)sin(B) (b). Sin (2A) = 2sin(A)cos(A) (c). Sin2 (A) = (1-cos (2A)). supermarkets, discount stores, and hypermarkets can all be classified as -156 - (-4) Find the difference What effect did the leak of the dobbs draft opinion have on abortion rights?? i dunno TvTSAYS I NEED MORE WORDS OK HERE I AM The innate immune system recognizes double-stranded rna (dsrna), an indicator of viral replication in the host cell, and signals the immune response with? Suppose you have a camera attached to a telescope, and you want to record an image of a very faint galaxy. Which of the following will help most?a. A lot of pixels and a short exposure time.b. A lot of pixels and a long exposure timec. A small number of pixels and a short exposure timed. A small number of pixels and a long exposure time Hello. I have an exam tomorrow and I dont know to solve this excercises. where was gettysburg located relative to the rest of the fighting Faithful poem with 5 senses. principal $2000 rate of interest 4% time 3 years Sam washed his favorite pair of jeans. He hung the wet jeans on a clothesline outside. An hour later the jeans were dry.Which answer best describes that happened to the water that was in the wet jeans an hour later?State your answer and provide an explanation for your answerA It soaked into the ground.B It disappeared and no longer exists.C It is in the air in an invisible form.D It moved up to the clouds.E It chemically changed into a new substance.F It went up to the Sun.G It broke down into atoms of hydrogen and oxygen.Please help D: What does it mean to be a good economic citizen Two parents have a boy. The woman is pregnant. What is the likelihood she will have a boy for her second child?50%75%0%100% 1, 1, 2, 3, 5, 8 are the first six numbers of the fibonacci sequence. what is the eighth number? PLEASE HELP WILL GIVE BRAINLIEST