Help me out here I don’t understand please :((((((, ppl srsly answer my questions a week later :/

Help Me Out Here I Dont Understand Please :((((((, Ppl Srsly Answer My Questions A Week Later :/

Answers

Answer 1

Answer:

2. For any given isotope, the sum of the numbers of protons and neutrons in the nucleus is called the mass number.

3. in fact, electron mass is so small that it is not counted in an atom's mass

Explanation:

Answer 2
You can calculate the mass number by finding the sum of the neutrons and protons. An electron is not counted when calculating mass because it is so small it is nearly massless.

Related Questions

How many molecules are contained in 55.0g of co2??

Answers

Answer: 7.52*10^23 molecules.

Explanation: This is a classic Stoichiometry problem.

In one mole of any substance, there are 6.02*10^23 molecules. This number is called Avogadro's number. We are given 55 grams of Co2 so to convert that to moles, we divided by the molar mass of Co2. We find the molar mass by adding the molar masses of the elements that make up the compound.

There is one molecule of Carbon and two molecules of Oxygen in one molecule of Co2. From the periodic table, the molar mass of Carbon is 12.01 and 16.00 for Oxygen. 1(12.01)+2(16.00) gives us the molar mass. We then divided 55 grams by that mass to find the number of moles. We then multiply the number of moles by Avogadro's number (6.02*10^23) to find the total number of molecules.

You can use this method for solving any problem that asks you to find the number of atoms or molecules of some number of grams of a substance.

PLS HELP ASAP THIS IS DUE TODAY

PLS HELP ASAP THIS IS DUE TODAY

Answers

Answer:      what grade are u in ill help

Explanation:

Okay so basically go to the link and show me a picture of it and I’ll give you the answers

easy chem, Will give brainliest

easy chem, Will give brainliest

Answers

Answer:

5.48 L

Explanation:

We'll begin by calculating the number of mole in 20 g of KClO₃. This can be obtained as follow:

Mass of KClO₃ = 20 g

Molar mass of KClO₃ = 39 + 35.5 + (16×3)

= 39 + 35.5 + 48

= 122.5 g/mol

Mole of KClO₃ =?

Mole = mass / molar mass

Mole of KClO₃ = 20 / 122.5

Mole of KClO₃ = 0.163 mole

Next, the balanced equation for the reaction. This is given below:

2KClO₃ —> 2KCl + 3O₂

From the balanced equation above,

2 moles of KClO₃ decomposed to produce 3 moles of O₂.

Therefore, 0.163 moles of KClO₃ will decompose to produce = (0.163 × 3)/2 = 0.2445 moles of O₂.

Finally, we shall determine the volume of O₂ produced from the reaction. This is can be obtained as illustrated below:

1 mole of O₂ occupied 22.4 L at STP.

Therefore, 0.2445 moles of O₂ will occupy = 0.2445 × 22.4 = 5.48 L at STP.

Thus, 5.48 L O₂ were obtained from the reaction.

Which type of rock forms when an existing rock changes under extreme pressure and intense heat?
A
igneous

B
sedimentary

C
metamorphic

Answers

Answer:

c

Explanation:

metamorphic rocks

Answer:

C. Metamorphic

Explanation:

describe what xeriscaping is and what is involved in a successful xeriscaping project

Answers

Xeriscaping is a landscaping approach that focuses on conserving water by using drought-tolerant plants and efficient irrigation techniques. The goal is to create a visually appealing and sustainable garden while minimizing water usage.

Successful xeriscaping projects involve several key elements. Firstly, careful plant selection is crucial, opting for species that can thrive in arid conditions without excessive watering. Mulching is used to reduce evaporation and retain soil moisture.

Proper soil preparation, such as improving drainage and adding organic matter, promotes healthier plant growth. Efficient irrigation systems, like drip irrigation or soaker hoses, deliver water directly to plant roots, minimizing wastage.

Additionally, controlling erosion through the use of retaining walls or terracing is important. Lastly, regular maintenance, including appropriate pruning and weed control, ensures the longevity and vitality of the xeriscape garden. Overall, a successful xeriscaping project harmonizes sustainable practices with a beautiful outdoor environment.

For more such questions on Xeriscaping

https://brainly.com/question/12960529

#SPJ11

Two liquids X and Y boil at 110°C and 140°C respectively. Which of them has higher
vapour pressure at 50°C? Why?​

Answers

Answer:

X

Explanation:

Liquid X has higher vapor pressure because the greater the temp the weaker and the lower the temp the stronger/faster... :)

Why can gasses change volume?​

Why can gasses change volume?

Answers

Answer:

b. I've seen a question like this before lol

Answer:

B

Explanation:

The molecules in a gas are very far apart compared with the molecules in a solid or a liquid. The amount of space between the molecules in a gas can change easily.

What type of substance is magnesium carbonate?

Answers

magnesium salt is the type of substance

Answer:

MgCO 3 is an inorganic salt with chemical name Magnesium Carbonate. It is also called Magnesite or Hydromagnesite or Barringtonite. Hydrated forms of magnesite such as di, tri, tetrahydrates are present as minerals. It acts as a fertilizer and as an antacid.

vinegar contains 5g of acetic in 100mL of solution so the (w/v)% concentration is:

Answers

The (w/v)% concentration of vinegar contains 5g of acetic in 100mL of solution is approx 0.5 %

What is Concentration ?

The concentration of a chemical substance expresses the amount of a substance present in a mixture.

There are many different ways to express concentration.(w/v)% is one of them.

Given ;

Mass of solute(acetic acid) is 5.0 g Volume of solution is 100.0 mL.

We need to convert the grams of acetic acid to moles ;

Formula of acetic acid is CH₃COOH

Thus,

Molar mass of acetic acid = 2(12.01) + 4(1.01) + 2(16)  

                                           = 24.02 + 4.04 + 32

                                           = 60.06 grams per mol

Moles of acetic acid = 5.0/60.06

                                 

                                 = 0.083 moles

(w/v)% = 0.083 x 60 / 1000 x 100

          = 0.498 %

          = 0.5 %

Hence, The (w/v)% concentration of vinegar contains 5g of acetic in 100mL of solution is approx 0.5 %

Learn more about weight percentage here ;

https://brainly.com/question/22575652

#SPJ1

what is the maximum amount of KNO3 that can be dissolved in 100 g of 50 C water ? A. 15g B. 36g C. 84g D. 100g

what is the maximum amount of KNO3 that can be dissolved in 100 g of 50 C water ? A. 15g B. 36g C. 84g

Answers

From the solubility curve, it is clear that 84 g of potassium nitrate can be dissolved in 100 g of water at 50°C.

What is solubility?

Solubility is defined as the ability of a substance which is basically solute to form a solution with another substance. There is an extent to which a substance is soluble in a particular solvent. This is generally measured as the concentration of a solute present in a saturated solution.

The solubility mainly depends on the composition of solute and solvent ,its pH and presence of other dissolved substance. It is also dependent on temperature and pressure which is maintained.Concept of solubility is not valid for chemical reactions which are irreversible. The dependency of solubility on various factors is due to interactions between the particles, molecule or ions.

Learn more about solubility,here:

https://brainly.com/question/8591226

#SPJ1

Which of these waves has the greatest wavelength? (3 points) Wave shown with 2 wavelengths. Wave shown with 3 wavelengths. Wave shown with 1 wavelength stretch over a short distance. Wavelength shown with 1 wavelength stretched over a long distance.

Answers

The waves that  has the greatest wavelength is Wavelength shown with 1 wavelength stretched over a long distance.

Waves explained.

A wave could be a disturbance or variety that voyages through a medium or space, carrying vitality without transporting matter. Waves can take different shapes and happen totally different sorts of waves, counting mechanical waves and electromagnetic waves.

Mechanical waves require a medium to propagate, meaning they require a substance like water, discuss, or a strong fabric to transmit the wave. Illustrations of mechanical waves incorporate water waves, sound waves, and seismic waves. In these waves, particles of the medium sway or vibrate in a design, exchanging energy from one molecule to another.

Electromagnetic waves, on the other hand, don't require a medium and can travel through vacuum, such as in space. Electromagnetic waves comprise of electric and attractive areas swaying opposite to each other and to the heading of wave engendering. Illustrations of electromagnetic waves incorporate obvious light, radio waves, microwaves, infrared waves, bright waves, X-rays, and gamma beams.

Learn more about waves  below.

https://brainly.com/question/26116832

#SPJ1

what pressure would 1.75 L of disulfur monoxide gas have if it occupied a volume of 16.60 L at 1 atm?​

Answers

Okay, let's solve this step-by-step:

* We are given that the initial volume of the gas is 1.75 L at 1 atm pressure

* We want to know the pressure if the volume increases to 16.60 L

* According to Boyle's Law: Pressure x Volume = Constant

* Since the initial pressure is 1 atm and volume is 1.75 L, the constant is:

1 atm x 1.75 L = 1.75 atm*L

* When the volume increases to 16.60 L, plugging into Boyle's Law:

P x 16.60 L = 1.75 atm*L

* Solving for P (pressure):

P = 1.75 atm*L / 16.60 L

P = 0.105 atm

Therefore, the pressure of the 1.75 L of disulfur monoxide gas if it occupied a volume of 16.60 L would be 0.105 atm.

Coal, which is formed from the decomposed remains of dead plants and animals, is an example of
A) diesel fuel
B) fossil fuel
C) gasoline fuel
D) natural gas
E) petroleum

Answers

The answer is b. Fossil fuel

Chase went for a hike. He left at 8:00 A.M. At 10:00 A.M., he took a half-hour rest.
Chase returned home at 12:00 noon. While walking, Chase averaged 5 km/h. How
far did he hike?

Answers

Answer:

17.5 Km

Explanation:

T = 3.5 hours

v = 5 K/hr

S = VT

S = 5 × 3.5

S = 17.5 Km

given the incomplete reaction which compound is represented by x

given the incomplete reaction which compound is represented by x

Answers

The compound that is shown as X can be seen in the option labelled C

What is esterification?

The process of esterification involves the condensation of an alcohol (or phenol) with an acid to produce an ester. To create the ester bond, the water molecule must be removed from the alcohol and acid (dehydration).

Usually, an acid catalyst is used to catalyze the reaction, which makes it easier to remove water and encourages the creation of the ester. The acid catalyst aids in protonating the acid's carbonyl oxygen, which increases its electrophilicity and makes it more vulnerable to alcohol's nucleophilic attack.

Learn more about esterification:https://brainly.com/question/31118260

#SPJ1

Which combination makes up most of the mass of an atom?

A. Electron and proton
B. Electron and neutron
C. Proton and neutron
D. None of these make up atom’s mass

Answers

Answer:

Explanation:

its c. protons and neutron

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

A mixture of 40 mol % isopropanol in water is distilled at 1 atm by differential distillation until 70 mol % of the charge has been vaporized (equilibrium data are given in Exercise 7.33). What is the composition of the liquid residue in the still pot and of the collected distillate

Answers

Answer:

Explanation:

From the given information:

The percentage wieght of mixture \(x_w\) = 0.4

The distillate = 70

From equilibrium data in Exercise 7.33

The Feed W = 100

The Liquid residue F = Feed(W) - Distillate (D)

= 100 - 70 = 30

By applying rayleigh equation;

\(In \bigg (\dfrac{F}{W}\bigg)= \int^{xF}_{x_w}\dfrac{1}{y-x} \ dx\)

From the plot of the graph of \(\dfrac{1}{y-x} \ vs \ x\); the area under the curve is being calculated between the point {\(x_1 = 0.4 \ and \ x_2\) }.

Such that; the area \(= In \bigg( \dfrac{100}{30}\bigg)\) = 1.209

Similarly, the value of xF = 0.067

\(y_D = \dfrac{F_{xF} - W_{xW}}{D}\)

\(y_D = \dfrac{30(0.067)-100(0.4)}{70}\)

\(y_D = 0.543\)

what happens to the amount of energy in the air of ChristChurch and El nino years

Answers

Answer:

I t transfers from the ocean to the air, however the current is not as warm so less energy will transfer from the current to the air making ChrisstChurch cooler than usual.

When 12 oz. cans of regular Coke and Diet Coke are placed in a large container of water, some float while others sink.

Diet Coke will
[ Select ]
in a large container of water because
[ Select ]
and therefore has
[ Select ]
.

Answers

Diet Coke will float in a large container of water because it has less mass and therefore has less density than regular Coke.

What is the relationship between density and floating?

The relationship between density and floating is that an object will float in a fluid if it is less dense than the fluid. This is because buoyant force, which is the upward force exerted by a fluid on an object immersed in it, is greater than the weight of the object.

On the other hand, an object will sink in a fluid if it is more dense than the fluid, because the weight of the object is greater than the buoyant force acting on it.

Learn more on density here: https://brainly.com/question/6838128

#SPJ1

What type of wave is it ?

What type of wave is it ?

Answers

Answer:

transverse wave

Explanation:

Type your answer here:
Table 1. Measurements Taken from a Simulation of a [insert mass value] kg Ball Released from Various Heights on a Ramp
Mass of ball (kg) Drop height on-ramp (m) Potential energy (J) Time to travel 1.0 m (s) Speed (m/s) Kinetic energy (J)
0.5
1.0
1.5
2.0
2.5
3.0
Conclusions
1. What conclusions can you draw about how the amount of potential energy stored in a system changes as a ball is placed at varying heights on a ramp? Write an evidence-based claim.
Type your answer here:
2. What conclusions can you draw about how the final kinetic energy of a ball in a system changes as a ball is placed at varying heights on a ramp? Write an evidence-based claim.
Type your answer here:
3. Develop a model (diagram) that shows how different amounts of gravitational potential energy (GPE) are stored in the earth-ball system when the ball is raised to different heights on the ramp.
Type your answer here:
4. How did you use what you learned from the first part of the experiment to design a marble run?
Type your answer here:

Answers

I used the results from the first part of the experiment to design a marble run by understanding the principles of potential and kinetic energy.

What is kinetic energy?

Kinetic energy is the energy of motion. It is the energy an object has due to its motion. When an object is moving, it has kinetic energy. This energy is dependent on the mass of the object and its velocity. Kinetic energy can be calculated by multiplying the mass of the object by the square of its velocity and then dividing the result by two. Kinetic energy is one of the two main types of energy, along with potential energy. It has the ability to cause change within a system, such as breaking chemical bonds. When an object is at rest, it does not have kinetic energy. However, as soon as it begins to move, it acquires kinetic energy. Kinetic energy can be changed or transferred from one object to another, or from one form to another.

To learn more about kinetic energy

https://brainly.com/question/20005035

#SPJ1

A chemist wants to increase the solubility of a solid in water. Which of the
following will NOT help? *
-increase the temperature
-decrease the particle size
-Increase stirring
-increase pressure

Answers

Answer:

- Increase pressure .

Explanation:

Hello,

In this case, during the dissolution process, the solute's molecules rearrange in order to get together with the solvent's molecules, in this case water.

Now, since we are talking about a solid whose particles are intimately held together, the only way to separate them is by increasing the temperature because the molecules start moving so they can join water's molecules, decreasing particle size since they will be more likely to separate to each other and increasing stirring since the applied energy will break the solid's intramolecular forces.

In such a way, since pressure significantly affects gases and slightly affects liquid, it is not able to modify a solid, just extreme pressures such as it needed to produce diamonds, is able to affect a solid. For that reason, increasing the pressure will not increase the solid's solubility.

Best regards.

What changes sodium pellets to liquid​

Answers

Answer:

when placed in water, a sodium pellet catches on fire as hydrogen gas is liberated and sodium hydroxide forms. chemical change = fire is a sign of chemical reaction.

Explanation:

When placed in water the sodium pellets catch the fire and liberate the hydrogen gas. On mixing with water solid sodium forms a colorless basic solution.

What are the properties of sodium?

Sodium is a soft metal. It is a very reactive element with a low melting point. Sodium reacts very quickly with water, snow, and ice to produce sodium hydroxide and hydrogen. It is an alkali metal and the sixth most abundant metal on earth. It has a silvery white color.

It has a strong metallic luster. On reacting with oxygen it produces sodium oxide which on reacting with the water produces sodium hydroxide.

It is used to improve the structure of certain alloys and soaps. It is also used in the purification of metals. Sodium is also present in sodium chloride, an important compound found in the environment.

To learn more about sodium, refer to the link:

https://brainly.com/question/29327783

#SPJ2

(80 points)
Requirements
You must include each of the following in your diagram, story/explanation:
1. precipitation
2. runoff
3. evaporation
4. condensation
5. transpiration
6. infiltration
7. groundwater
8. clouds
9. collection areas (example: ocean or lake)
Instructions
1. Complete either the diagram or written explanation – 10 points
• Diagram – you will draw the water cycle process. You must include each of the required items and label each. You are not required to color it, but it is encouraged to help differentiate between the processes.
• Written Explanation – for either of these options you need to include each of the processes. It may be beneficial to explain them in the order in which they occur but is not necessary.
2. Answer the questions


Questions
1. What process drives evaporation and transpiration? Explain how this process operates in the water cycle? (2 Points)


2. What role does gravity play in the water cycle? Hint: it is in more than 1 process (2 Points)


3. What states of matter will your find water in going through the water cycle? (1 Point)

Answers

Answer:

1.solar energy drives the cycle by evaporating water from its source and water moves from plants by the process of transpiration

2. in precipitation because the water falls from the sky

3.liquid and gas

which of the following statements best explains the trend in the molar solubility of in various concentrations of shown in the graph above? (a) higher concentrations of allow less to dissolve before the solution becomes saturated. (b) higher concentrations of lead to more favorable attractions between ions and ions, thus less dissolves. (c) higher concentrations of produce more through hydrolysis, causing to precipitate, thus more dissolves. (d) higher concentrations of cause the

Answers

The trend in the molar solubility of in different concentrations seen in the graph above appears to be best explained by the statement (a) "increasing concentrations of allow less to dissolve before the solution

The amount of a material present in a mixture or solution is referred to as its concentration. Different units, such as molarity (moles of solute per litre of solution), molality (moles of solute per kilogramme of solvent), or mass percentage, can be used to quantify them (mass of solute as a percentage of total mass). Concentrations play a key role in chemistry for predicting reaction behaviour and figuring out how much of a material to add to a solution. Concentrations are crucial in figuring out how various chemicals affect living things and the environment in sectors like environmental science and medicine.

Learn more about concentrations here:

https://brainly.com/question/10725862

#SPJ4

5.4g of aluminum reacts with sulfuric acid (H₂SO4) to form aluminum sulfate and hydrogen.
a. Write the chemical equation.
b. Find mass of required sulfuric acid.
C. Find volume of the obtained gas.
(AI=23, S = 32, O=16, H =1, 2g of H2 has 22.4L).​

Answers

Answer:

a. The chemical equation for the reaction is:

2Al + 3H₂SO₄ → Al₂(SO₄)₃ + 3H₂

b. To find the mass of required sulfuric acid, we need to use stoichiometry. We can start by finding the number of moles of aluminum used in the reaction:

Molar mass of Al = 27 g/mol

Number of moles of Al = 5.4 g / 27 g/mol = 0.2 mol

According to the balanced equation, 3 moles of H₂SO₄ are required to react with 2 moles of Al. Therefore, the number of moles of H₂SO₄ required is:

Number of moles of H₂SO₄ = 3/2 x 0.2 mol = 0.3 mol

Molar mass of H₂SO₄ = 2 x 1 g/mol + 32 g/mol + 4 x 16 g/mol = 98 g/mol

Mass of H₂SO₄ required = 0.3 mol x 98 g/mol = 29.4 g

Therefore, 29.4 g of sulfuric acid is required to react with 5.4 g of aluminum.

c. To find the volume of hydrogen gas obtained, we need to use the ideal gas law:

PV = nRT

where P is the pressure of the gas, V is its volume, n is the number of moles of the gas, R is the universal gas constant (0.0821 L atm/mol K), and T is the temperature in Kelvin.

We can start by finding the number of moles of hydrogen gas produced in the reaction. According to the balanced equation, 3 moles of H₂ are produced for every 2 moles of Al. Therefore, the number of moles of H₂ produced is:

Number of moles of H₂ = 3/2 x 0.2 mol = 0.3 mol

Assuming the reaction occurs at standard temperature and pressure (STP), which is 0°C (273 K) and 1 atm, we can use the molar volume of a gas at STP, which is 22.4 L/mol. Therefore:

V = nRT/P = 0.3 mol x 0.0821 L atm/mol K x 273 K / 1 atm = 6.58 L

Therefore, the volume of hydrogen gas produced at STP is 6.58 L.

Explanation:

Stephan’s mother cuts a twig from a rose bush and plants it in the soil. After a few days, Stephan observes a new plant growing. Which characteristic does the growth of the new plant depict?

Answers

The growth of the new plant depicts the asexual reproduction characteristic. The characteristic that describes the growth of the new plant in Stephan's mother cutting a twig from a rose bush and planting it in the soil is asexual reproduction.

Asexual reproduction is the mode of reproduction by which organisms generate offspring that are identical to the parent's without the fusion of gametes. Asexual reproduction is a type of reproduction in which the offspring is produced from a single parent.

The offspring created are clones of the parent plant, meaning they are identical to the parent.The new plant in Stephan’s mother cutting a twig from a rose bush and planting it in the soil depicts the process of asexual reproduction, which is the ability of a plant to reproduce without seeds. In asexual reproduction, plants can reproduce vegetatively by cloning themselves using their roots, bulbs, or stems.

Know more about    characteristic  here:

https://brainly.com/question/28790299

#SPJ8

Give the symbols for the following elements: nitrogen sodium chromium

Answers

nitrogen = N

sodium = Na

chromium = Cr

A chemical reaction has the equation 2AgNO3 (aq) + Zn (s) 2Ag (s) + Zn(NO3)2 (aq). What type of reaction occurs between AgNO3 and Zn?

Answers

Answer: single replacement reaction

Explanation:

A single replacement reaction is one in which a more reactive element displaces a less reactive element from its salt solution. Thus one element should be different from another element.

A general single displacement reaction can be represented as :

\(X+YZ\rightarrow XZ+Y\)

The reaction \(2AgNO_3(aq)+Zn(s)\rightarrow 2Ag(s)+Zn(NO_3)_2(aq)\)

When zinc metal is added to aqueous silver nitrate, zinc being more reactive than silver displaces silver atom from its salt solution and lead to formation of zinc nitrate and silver metal.

Other Questions
When a neuron is at rest, the K+ ________gradient favors K+ diffusion out of the cell while the ________ gradient favors K+ diffusion into the cell .A. concentration; electricalB. concentration; concentrationC. electrical; electricalD. electrical; concentration 11h-5(h+3)=-63 find they value of h if given the mass number and the number of protons in a reaction how can you showthat the number of protons are conserved? Help ASAP its due in 55 minutes ahh Four less than ten times a number is one hundred twenty six What are the 5 unifying themes in the study of biology?. What eventually became of some of the gold when Masa Musa took power in Western Africa? THIS IS A QUESTION FROM THE BOOK GATHERING BLUE PLEASE HELP4. Why do you think jamison wanted to help kira?How did Kira know he was on her side and was looking out for her?Connect to self-if you were Kira, would you have allowed jamison to help you? explain Let X and Y be independent x random X 1. Show that for sufficiently large m, m variables with m, n degrees of freedom. approximately normal (1, 25 m The nurse discovers the IV infusion tubing disconnected from a central venous access device, and the client is coughing, short of breath, and cyanotic. Which action will the nurse take immediately?1. Reconnect the tubing to the central venous access device.2. Measure vital signs.3. Notify the health care provider.4. Clamp the central venous access device. if a star is found by spectroscopic observations to be about 500 parsecs distant, its parallax is: What is the proper treatment on the bank reconciliation of a note collected by the bank for the depositor? A. Addition per book balance of cash B. Deduction per book balance of cash C. Addition per bank statement balance D. Deduction per bank statement balanceE. None of the above In which subregion of the United States is the Providence Canyon located? explain the term human rights violations Solve for x -2(3x-5)=16 Which molecule is needed for photosynthesis to occur?glucoseoxygencarbon dioxidenitrogen Samanthas offer different tarts (buck,ube,pineapple,yema,and mango)A box of tart contains 9pieces and you are allowed to have a maximum of three different flavour per box how many different combination are there? If a person consistently eats 2000 kcalories a day but only expends 1800 kcalories each day, he/she will gain weight. a. true b. false find the domain and rangey = -log(x - 2) + 1 To hedge a receivable position with a currency option hedge, an MNC would buy a ___