How many times larger is 2^7 than 2^4 ?

Answers

Answer 1

Answer: 8 times larger

Step-by-step explanation:

It's  \($\frac{2^7}{2^4} = \frac{2 \times 2 \times 2 \times 2 \times 2 \times 2 \times 2}{2 \times 2 \times 2 \times 2} = 2 \times 2 \times 2 = 8$\)  times larger


Related Questions

what is the solution of x-y=4 and 4x+y=1

Answers

Answer:

x= 4+y and the next answer is y= -4x+1

Step-by-step explanation:

First one solve for x and the other one I solved for y

A total solar eclipse in 2003 lasted 8 9/20 minutes and was viewed from the southern hemisphere. The next total solar eclipse in 2005 lasted 3 8/9 minutes and was viewed from the northern hemisphere. How much longer was the 2003 solar eclipse? The 2003 solar eclipse was minutes longer than the 2005 solar eclipse. (Simplify your answer. Type a whole number, proper fraction, or mixed number)​

Answers

Answer:

20 mins

Step-by-step explanation:

2003 17 2005 20

Kevin moved from a city to a small town. The population of the city is 8*10^4 is about 20 times as great as the small town. What is the approximate population of the small town?

Answers

Given:

Population of city = \(8\times 10^4\)

It is about 20 times as great as the small town.

To find:

The approximate population of the small town.

Solution:

Population of city is about 20 times as great as the small town. It means,

\(\text{Population of city}=20\times \text{Population of small town}\)

\(\dfrac{\text{Population of city}}{20}=\text{Population of small town}\)

On substituting Population of city = \(8\times 10^4\), we get

\(\text{Population of small town}=\dfrac{8\times 10^4}{20}\)

\(\text{Population of small town}=\dfrac{8\times 10\times 10^3}{20}\)

\(\text{Population of small town}=4\times 10^3\)

Therefore, the population of the small town is \(4\times 10^3\).

Solve the system of equations using elimination: -8x -9y= -21 and -2x -4y=0.

Answers

Answer:

x=6, y=-3

Step-by-step explanation:

Elimination is literally the process of eliminating one of the variables through the process of making them the same.

\(\left \{ {{-8x-9y=-21} \atop {-2x-4y=0}} \right.\)

After looking at this equation, it is evident that x can be eliminated easier than y. Therefore, we will multiply the bottom line by four to make the top and bottom x the same.

\(\left \{ {{-8x-9y=-21} \atop {-8x-16y=0}} \right.\)

Then, we can eliminate x by subtracting the top equation from the bottom equation.

\(-8x-9y-(-8x-16y)=7y\\-21-0=-21\\7y=-21\)

Thus, y=-3.

If we insert that back into an equation,

\(-2x-4(-3)=0\\-2x+12=0\\-2x=-12\\x=6\)

We get x=6.

what's bigger -1/5 or -0.9

Answers

Answer:

-1/5

Step-by-step explanation:

-1/5=-0.2

-0.9<-0.2

Yall! Do any of you have edge???


ignore my red line it means nothing

Yall! Do any of you have edge??? ignore my red line it means nothing

Answers

In vertex form:
w=(-6, 6)
u=(5, 0)
v=(-2, -1)
u+3v-w/2= (5,0)+(3*-2,3*-1)-(-6/2, 6/2) = (5+3*-2-(-6/2), 0+3*-1-6/2) = (5-6+3, 0-3-3)=(2,-6)

Please hhelpp me with thiss

please, help me out with this

Please hhelpp me with thissplease, help me out with this

Answers

The value of y for the function y = cos(-60°) is y = -1/2, option A is correct.

Define the trigonometric identity?

An equation with trigonometric functions that holds true for all of the variables in it is known as a trigonometric identity. A few normal geometrical characters incorporate the Pythagorean personality, the total and distinction characters, and the twofold point characters.

Using the unit circle and the trigonometric identity for cosine, we know that:

cos(-60°) = cos(360° - 60°)

               = cos(300°)

               = cos(180° + 120°)

               = -cos(120°)

               = -1/2

Therefore, the value of y for the function y = cos(-60°) is y = -1/2.

To know more about trigonometric functions, visit:
https://brainly.com/question/25618616
#SPJ1

Find the length s of the arc that subtends a central angle of measure 3 rad in a circle of radius 5 cm

Answers

Find the length of the area that sun a central abfel180:460 measure the area of your area with the green sun green and orange

Which number is greatest?
2.89 x 10-
O 1.997 x 102
8.9x10-6
o
O Ex. 106

Which number is greatest?2.89 x 10-O 1.997 x 1028.9x10-6oO Ex. 106

Answers

2.89x10- is the correct answer

et C be the curve of intersection of the parabolic cylinder x2 = 2y, and the surface 3z = xy. Find the exact length of C from the origin to the point (4, 8,

Answers

The exact length of curve C, which is the intersection of the given parabolic cylinder and the given surface, from the origin to the given point is 13.14 units.

To find the length of curve C, we can use the arc length formula for curves given by the integral:

L = ∫[a,b] \(\sqrt{(dx/dt)^2 }\)+ \((dy/dt)^2\) + \((dz/dt)^2\) dt

where (x(t), y(t), z(t)) represents the parametric equations of the curve C.

The given curve is the intersection of the parabolic cylinder \(x^2\) = 2y and the surface 3z = xy. By solving these equations simultaneously, we can find the parametric equations for C:

x(t) = t

y(t) =\(t^2\)/2

z(t) =\(t^3\)/6

To find the length of C from the origin to the point (4, 8), we need to determine the limits of integration. Since x(t) ranges from 0 to 4 and y(t) ranges from 0 to 8, we integrate from t = 0 to t = 4:

L = ∫[0,4] \(\sqrt{(1 + t^2 + (t^3/6)^2) dt}\)

Evaluating this integral gives the exact length of C:

L ≈ 13.14 units

Therefore, the exact length of curve C from the origin to the point (4, 8) is approximately 13.14 units.

Learn more about curve here:

https://brainly.com/question/28976035

#SPJ11

convert 2 Bigha into kattha ​

Answers

Answer:

To convert 2 Bigha into Kattha:

If 1 Bigha = 20 Kattha:

2 Bigha = 2 * 20 Kattha = 40 Kattha

If 1 Bigha = 16 Kattha:

2 Bigha = 2 * 16 Kattha = 32 Kattha

Lauren's science class is taking a field trip to the nearest natural history museum. The museum is 62. 5 miles from Lauren's school. The class plans to stop after 30 minutes, or 0. 5 hours, to visit a local wildlife refuge. The bus driver plans to drive at an average speed of 50 miles per hour. How many hours will the second part of the trip take?

Answers

The second part of the trip will take 0.75 hours, or 45 minutes.

To solve this problem, we will need to use the terms "average speed," "distance," and "time."
First, let's find out how far the class travels during the 30-minute stop at the local wildlife refuge.

We can do this using the formula:
distance = average speed × time
In this case, the average speed is 50 miles per hour and the time is 0.5 hours (30 minutes converted to hours).
distance = 50 miles/hour × 0.5 hours = 25 miles
Now, let's find the remaining distance the class needs to travel to reach the natural history museum.

We can do this by subtracting the distance they traveled during the first part of the trip from the total distance:
remaining distance = total distance - distance traveled during the first part
remaining distance = 62.5 miles - 25 miles = 37.5 miles.
Finally, let's find out how long it takes for the class to travel the remaining distance.

We can use the same formula as before, but this time, we'll rearrange it to solve for time:
time = distance ÷ average speed
For the second part of the trip, the distance is 37.5 miles and the average speed is still 50 miles per hour:
time = 37.5 miles ÷ 50 miles/hour = 0.75 hours.

For similar question on distance.

https://brainly.com/question/18312428

#SPJ11

A quantity with an initial value of 650 grows exponentially at a rate of 20% every week. What is the value of the quantity after 70 days, to the nearest hundredth?

Answers

Answer:

4024.62

Step-by-step explanation:

the value in 70 days can be determined using his formula

FV = P (1 + r)^n

FV = Future value  

P = Present value = 650

R = growth rate = 20%

N = number of weeks = 70 / 7 = 10 weeks

650 x (1.2)^10 = 4024.62

Answer:

The Answer is 4024.62

for the curve r(t), write the acceleration in the form atT+anN. r(t)=(9sin(5t/9)+2)i+(9cos(5t/9)-7)j+12tk
A) a=25T
B) a=25N
C) a=25T+25N
D) a=T+25N

Answers

The acceleration vector can be written as a = (25/9)T + 0N, or simply a = (25)T. (option a).

To find the acceleration, we need to take the second derivative of the position vector r(t) with respect to time, which represents the rate of change of velocity. Let's start by finding the first derivative of r(t):

r'(t) = (d/dt)(9sin(5t/9) + 2)i + (d/dt)(9cos(5t/9) - 7)j + (d/dt)(12t)k

The unit tangent vector T is defined as the normalized version of the velocity vector, which is r'(t)/||r'(t)||. To find T, we calculate the magnitude of r'(t) and normalize it:

||r'(t)|| = √((25/9)²(sin²(5t/9) + cos²(5t/9))) = √((25/9)²) = 25/9

Therefore, the unit tangent vector T is given by:

T = r'(t) / ||r'(t)|| = [(25/9)(-sin(5t/9))i - (25/9)(cos(5t/9))j] / (25/9) = (-sin(5t/9))i - (cos(5t/9))j

The unit normal vector N is perpendicular to the unit tangent vector T and is given by N = (cos(5t/9))i - (-sin(5t/9))j, or simplifying it, N = (cos(5t/9))i + (sin(5t/9))j.

Now, we can express the acceleration vector in the form atT + anN by taking the dot product of r''(t) with T and N:

aT = r''(t) · T = (25/9)(-sin(5t/9))(-sin(5t/9)) + (25/9)(cos(5t/9))(-cos(5t/9)) = 25/9

aN = r''(t) · N = (25/9)(-sin(5t/9))(cos(5t/9)) + (25/9)(cos(5t/9))(sin(5t/9)) = 0

Therefore, the correct answer is: A) a = 25T

To know more about acceleration here

https://brainly.com/question/2303856

#SPJ4

How to solve 3 3/5 - 2/3?

Answers

Conversion a mixed number 3 3/
5
to a improper fraction: 3 3/5 = 3 3/
5
= 3 · 5 + 3/
5
= 15 + 3/
5
= 18/
5


To find new numerator:
a) Multiply the whole number 3 by the denominator 5. Whole number 3 equally 3 * 5/
5
= 15/
5

b) Add the answer from previous step 15 to the numerator 3. New numerator is 15 + 3 = 18
c) Write a previous answer (new numerator 18) over the denominator 5.

Three and three fifths is eighteen fifths
Subtract: 18/
5
- 2/
3
= 18 · 3/
5 · 3
- 2 · 5/
3 · 5
= 54/
15
- 10/
15
= 54 - 10/
15
= 44/
15

For adding, subtracting, and comparing fractions, it is suitable to adjust both fractions to a common (equal, identical) denominator. The common denominator you can calculate as the least common multiple of the both denominators - LCM(5, 3) = 15. In practice, it is enough to find the common denominator (not necessarily the lowest) by multiplying the denominators: 5 × 3 = 15. In the next intermediate step the fraction result cannot be further simplified by canceling.
In words - eighteen fifths minus two thirds = forty-four fifteenths.

The value of the expression 3 ³/₅ - 2/3 in mixed fraction number will be 2 ¹⁴/₁₅.

What is Algebra?

Algebra is the study of abstract symbols, while logic is the manipulation of all those ideas.

The acronym PEMDAS stands for Parenthesis, Exponent, Multiplication, Division, Addition, and Subtraction. This approach is used to answer the problem correctly and completely.

The expression is given below.

⇒ 3 ³/₅ - 2/3

Convert the mixed fraction number into a fraction number. Then we have

⇒ 3 ³/₅

⇒ 18 / 5

Then the expression is written as,

⇒ 3 ³/₅ - 2/3

⇒ 18/5 - 2/3

⇒ (18 x 3 - 2 x 5) / 15

⇒ (54 - 10) / 15

⇒ 44 / 15

⇒ 2 ¹⁴/₁₅

The worth of the articulation 3 ³/₅ - 2/3 in the blended part number will be 2 ¹⁴/₁₅.

More about the Algebra link is given below.

https://brainly.com/question/953809

#SPJ2

sin² x + cos²x = 1

Which Trigonometric Identity is given above?

- Pythagorean Identity

- Lagrange's Trigonometric Identity

- Angle Sum and Difference Identity

- Tangent Identity

Answers

The  Trigonometric Identity sin² x + cos²x = 1 is: A. Pythagorean Identity.

What is Pythagorean Identity?

The Pythagorean Identity which  tend to asserts that for every angle x, the sum of the squares of the sine and cosine of x is equal to one  is known as or called a  trigonometric identity.

The  Pythagorean identity can be expressed as:

sin² x + cos² x = 1

This identity is crucial to understanding trigonometry and tend to have several uses in numerous branches of science and engineering.

Therefore the correct option is A.

Learn more about Pythagorean Identity here:https://brainly.com/question/24287773

#SPJ1

Identify each group of segments that can form a right triangle. Select all
that apply. *
7, 24, 25
9, 40, 41
24, 69, 74
39, 52, 65
8, 15, 19
11. 60, 61
30, 60, 68
40, 42, 58

Answers

Answer:

1, 2, 4, 6, 8

Step-by-step explanation:

Right triangles have a property of:

c² = a² + b², as per Pythagorean

Let's try each group:

25² - 24² = (25+24)(25-24) = 49 = 7² - yes41² - 40² = (41 + 40)(41-40) = 81 = 9² - yes74² - 69² = (74 + 69)(74 - 69) = 143*5 ≠ 24² - no65² - 52² = (65 + 52)(65 - 52) = 117*13 = 13*9*13 = 39² - yes19² - 15² = (19 + 15)(19 - 15) = 34*4 = 17*8 ≠ 8² - no61² - 60² = (61+60(61 - 60) = 121 = 11² - yes68² - 60² = (68 + 60)(68 - 60) = 128*8 ≠ 30² - no58² - 42² = (58 + 42)(58 - 42) = 100*16 = 40² - yes

Calculate all four second-order partial derivatives of f (x, y) = 5x2y + 8xy3 and check that fxy = fyx . Assume the variables are restricted to a domain on which the function is defined.

Answers

The second-order partial Derivatives of  f(x, y) = 5x^2y + 8xy^3, we need to first find the first-order partial derivatives, and then differentiate them again.\(fxy = fyx for f(x, y) = 5x^2y + 8xy^3.\)

\(∂f/∂x = 10xy + 8y^3\) // Partial derivative with respect to x

\(∂f/∂y = 5x^2 + 24xy^2\) // Partial derivative with respect to y

Now we can differentiate again to find the second-order partial derivatives:

∂^2f/∂x^2 = 10y // Second-order partial derivative with respect to x

∂^2f/∂y^2 = 48x // Second-order partial derivative with respect to y

∂^2f/∂x∂y = 10x + 24y // Mixed partial derivative

∂^2f/∂y∂x = 10x + 24y // Mixed partial derivative (same as fxy)

We can see that the mixed partial derivatives are equal, which means that the function has continuous second-order partial derivatives in a domain around the point (x,y).

Therefore, the function satisfies the conditions for the Clairaut's theorem, which states that if the second-order mixed partial derivatives are continuous on a domain, then they are equal at any point in that domain. In other words, fxy = fyx.

So, we have:

\(fxy = ∂^2f/∂x∂y = 10x + 24y\\fyx = ∂^2f/∂y∂x = 10x + 24y\)

Therefore, fxy = fyx for f(x, y) = 5x^2y + 8xy^3.

To Learn More About Derivatives

https://brainly.com/question/23819325

#SPJ11

WILL VOTE BRAINLIEST IF POSSIBLE!!
What is the relationship between the following two sequences? Sequence 1: 0, 1, 2, 3, 4, 5… Sequence 2: 0, 4, 8, 12, 16, 20… Group of answer choices The terms in Sequence 2 are four times as large as the terms in Sequence 1. The terms in Sequence 2 are twice as large as the terms in Sequence 1. The terms in Sequence 2 are three times as large as the terms in Sequence 1. The terms in Sequence 2 are half as large as the terms in Sequence 1.

Answers

Answer:

The terms in Sequence 2 are four times as large as the terms in Sequence 1.

Step-by-step explanation:

If we take a look at the numbers,

Sequence 1: 0, 1, 2, 3, 4, 5

Sequence 2: 0, 4, 8, 12, 16, 20

We can see that 0 × 4 = 0,

1 × 4 = 4,

2 × 4 = 8,

And so on.

We can also see in sequence 2 that 4 is added to each of the numbers every time, whereas the first sequence is simply counting up.

Therefore, we can conclude that the terms in Sequence 2 are four times as large as the terms in Sequence 1.

As a Senior Surveyor you have been assigned a task to plan a Side Scan operation in search of an object in 200 m water. Explain the factors taken into consideration to officer-in-charge of the boat proceeding for a Side Scan survey.

Answers

As a Senior Surveyor planning a Side Scan operation in search of an object in 200 meters of water, there are several important factors to consider. Here are the key considerations that should be communicated to the officer-in-charge of the boat:

1. Object characteristics: Gather information about the object you're searching for, including its size, shape, and material composition. This will help determine the appropriate sonar frequency and settings to use during the Side Scan survey.

2. Bathymetry: Obtain accurate bathymetric data for the survey area to understand the water depths, contours, and potential obstacles. This information is crucial for planning the survey lines, ensuring safe navigation, and avoiding any hazards.

3. Side Scan sonar equipment: Assess the capabilities and specifications of the Side Scan sonar system to be used. Consider factors such as the operating frequency range, beam width, and maximum range. Ensure that the equipment is suitable for the water depth of 200 meters and can provide the required resolution for detecting the target object.

4. Survey area and coverage: Determine the extent of the search area and establish the coverage requirements. Plan the survey lines, considering the desired overlap between adjacent survey lines to ensure complete coverage. Account for any factors that may affect the survey, such as current conditions, tidal movements, or known features in the area.

5. Survey vessel and navigation: Assess the capabilities and suitability of the survey vessel for the Side Scan operation. Consider factors such as stability, maneuverability, and the ability to maintain a steady course and speed. Ensure the vessel is equipped with accurate navigation systems, such as GPS and heading sensors, to precisely track the survey lines.

6. Environmental conditions: Consider the prevailing weather conditions, such as wind, waves, and visibility. Ensure that the operation can be conducted safely within the given weather window. Additionally, be aware of any environmental regulations or restrictions that may impact the survey.

7. Data processing and analysis: Plan for the post-survey data processing and analysis, including the software and tools required to interpret the Side Scan sonar data effectively. Determine the desired resolution and sensitivity settings to optimize the chances of detecting the target object.

8. Safety and emergency procedures: Communicate the necessary safety precautions and emergency procedures to the officer-in-charge, ensuring the crew is aware of potential risks and how to mitigate them. This includes safety equipment, communication protocols, and emergency response plans.

By considering these factors and effectively communicating them to the officer-in-charge, you can help ensure a well-planned Side Scan operation in search of the object in 200 meters of water.

Learn more about bathymetry here: brainly.com/question/30586043

#SPJ11

Find the 8th term of the geometric sequence 10, -20, 40, ...

Answers

Answer:

-1280

Step-by-step explanation:

10×(-2)= -20

-20×(-2)= 40

4th term: 40×(-2)= -80

5th term: -80×(-2)= 160

6th term: 160×(-2)= -320

7th term: -320×(-2)= 640

8th term: 640×(-2)= -1280

Need help with this is geometry

Need help with this is geometry

Answers

The length of the radius AB is 6 units.

How to find the length of an arc?

The angle ∠BAC is 90 degrees. The length of arc BC is 3π. The length of  

radius AB can be found as follows:

Hence,

length of arc = ∅ / 360 × 2πr

where

r = radius∅ = central angle

Therefore,

length of arc = 90 / 360 × 2πr

3π = 1 / 4 × 2πr

cross multiply

12π = 2πr

divide both sides by 2π

r = 6 units

Therefore,

radius AB = 6 units

learn more on arc here: https://brainly.com/question/1582130

#SPJ1

HELP ASAP!! I think it’s 5 but not sure if I’m right

HELP ASAP!! I think its 5 but not sure if Im right

Answers

Answer:

I think it's five but I'm not sure

it could be -5 or 5  but I think it it is -5

Answer:

-5

Step-by-step explanation:

Slope is change in y/change in x. You are going down 5 units and to the right one unit so -5/1 =-5.

HELP ME PLEASE

is y=4x^2-6x+10 a linear function

Answers

Answer:

NO

Step-by-step explanation:

It is a parabola, you can tell cuz of the x^2

:)

Answer is no, it is not linear

Explanation

The exponent of ^2 means there are two solutions and it will be a parabola, not a straight line.

A parabola is a plane curve which is mirror-symmetrical and is a U-shape

42% into a fraction and simplify the fraction

Answers

The fraction form of 42% is 21/50.

What is a fraction?

Every fraction's numerator and denominator are split in half by a horizontal bar known as the fractional bar.

The denominator displays the number of pieces into which the whole has been divided. It is situated below the fractional bar in the lower part of the fraction.

The numerator indicates how many portions of the fraction are selected or displayed. It is located at the upper part of the fraction, above the fractional bar.

We have to write 42% into the simplest form fraction.

So, Explicit 42%

42 /100

Now, simplify the fraction by making it in its lowest form

42 /100

2 x 21/ 2x 50 = 21/50

Hence, the fraction is 21/50.

Learn more about fractions, here:

https://brainly.com/question/8482939

#SPJ1

5x2-5x+1 - (2x2+9x-6)

Answers

Answer:

3x^2−14x+7

Step-by-step explanation:

Find the rate of change of the function by using two points from the table.



x y
1 15
2 11
3 7
4 3

Answers

1/-4 is the roc for this function

The rate of change of the function is -4.

What is the slope of a line?

The slope of a line indicates the direction and the steepness of the line. The formula for the slope of a line passing through the points (x₁,y₁) and (x₂, y₂) is m = (y₂-y₁)/(x₂-x₁).

Consider the two points (1,15) and (2,11).

The rate of change of the function is nothing but the slope of the line passing through the points (1,15) and (2,11) which is:

m = (11 - 15)/(2 -1)

m = -4

Hence, the rate of change of the function is -4.

To learn more about slopes, click here:

https://brainly.com/question/3605446

#SPJ2

Fill in the blank with the correct term or number to complete the sentence : a fraction is written in simplest form when the GCF of the numerator and the denominator is

Answers

Answer:

A fraction is written in simplest form when the GCF of the numerator and the denominator is 1.

Step-by-step explanation:

if both still shared common factors you could keep reducing the fraction

Help! :(

It’s in the pic :3

Help! :(Its in the pic :3

Answers

Answer:

\(\frac{3}{2}\)

Step-by-step explanation:

Answer:

(4)

Step-by-step explanation:

The equation of a line in slope- intercept form is

y = mx + c ( m is the slope and c the y- intercept )

y = - \(\frac{2}{3}\) x - 5 ← is in slope- intercept form

with slope m = - \(\frac{2}{3}\)

Given a line with slope m then the slope of a line perpendicular to it is

\(m_{perpendicular}\) = - \(\frac{1}{m}\) = - \(\frac{1}{-\frac{2}{3} }\) = \(\frac{3}{2}\) → (4)

use what you know about factor pair to complete the table

use what you know about factor pair to complete the table

Answers

Answer:

See below

Step-by-step explanation:

\(1\cdot24=2\cdot12=3\cdot8=4\cdot6=24\)

Answer:

1. 24

2. 12

3. 8

4. 6

Step-by-step explanation:

2 x 12 = 24, 3 x 8 = 24, 4 x 6 = 24

Other Questions
What is the primary focus of the industry analysis carried out by an entrepreneur of a new venture? the generic top-level domain (gtld) for the united nations is _____. One of the groups that opposed the king during the English Civil War was:A. the Roundheads.B. ParliamentC. the Puritans.D. All of the choices are correct Membranes consist of many different types of fatty acids, which confer different properties, including membrane fluidity. Which of the following fatty acids is the LEAST adaptive to maintaining a fluid membrane at cold temperatures?a)Myristoleic CH3(CH2)3CH=CH(CH2)7COOHb)Arachidonic CH3(CH2)4CH=CHCH2CH=CHCH2CH=CHCH2CH=CH(CH2)3COOHc) Caprylic CH3(CH2)6COOHd) Linoleic CH3(CH2)4CH=CHCH2CH=CH(CH2)7COOH which of the following indicates the direction of the electric field at point p and the reason it has that direction?A) The electric field is in the +x direction because the charges are equal and opposite (B) The electric field is in the -y direction because point P is farther from the positively charged plate. (C) The electric field is in the -y direction because electric fields point away from positive charge and toward negative charge. (D) The electric field is in the ty direction because electric fields point away from negative charge and toward positive charge What is the main purpose of including this information? It shows how Ginny was a burden to her owner. It shows how Ginny and her owner worked together to help cats. It shows that Ginnys owner was not helpful. It shows how wild cat populations are in great need. Why was the Charter of 1732 granted? it is essential to become familiar with the various parts of a camera in order to take advantage of all that it can do. Imagine that of all the many features and functions on your camera that you can alter, you could only choose three features or functions to use and adjust during a photo shoot -which three would you choose? Why? Explain how you think this would impact your finished product? How does the section "Life in the wild" contribute to the author's argument in "Excerpt from Marine Mammals in Captivity"? Use two details from the excerpt to support your response. How is the theme of revenge best revealed through Montresors reaction to Fortunato? Eli needs to export files from his mailbox into a single file that is portable and can be backed up to removable media. Which file type will he use? PST OST MSG ZIP Look at the image. Which one of the five Georgia regions would you find this skyline of midtown Atlanta?A.PiedmontB.Coastal PlainC.Appalachian PlateauD.Blue RidgeHELP PLEASE ! which machine has a mechanical advantage of 1? block and tackle wheel and axle inclined plane single pulley SOMEBODY PLEASE HELP ME WITH THIS ASAP, WILL GIVE BRAINLIESTIn parallelogram KLMN, KN = 10, MN = 7 and mK = 50Find the measures of the remaining angles of parallelogram KLMN. Justify each of the measures with a theorem.Find the measures of the remaining side lengths of parallelogram KLMN. Justify each of the measures with a theorem. 7 cakes cost 5.60. How much do 10 cakes cost? Briefly explain Bennetts interpretation of world war 1???Briefly explain how One specific historical event or development from the period between 1918 and 1945 could be used to support Bennetts interpretation???? according to the two column model of air pressure, the column of air becomes ____________________ when the air inside the column warms. How many different monosubstituted productsare possible when methylbenzene reacts withone equivalent of bromine in the presence oflight?A. 1B. 2C. 4D. 6 true or false: less than 100 organisms are associated with food-related illnesses. which disorder is not associated with an elevated protein level in cerebrospinal fluid?