If 5 g of Al (26.98g/mol) reacts with 9 g of O2 (32 g/mol), how many grams of Al2O3 (101.56 g/mol) can be formed/

A player can obtain the desired outcome by sticking to their initial strategy, according to the Nash equilibrium, a decision-making theorem in game theory. Each player's approach in the Nash equilibrium is the best one given what the other players have decided.

A Nash equilibrium is a situation in which no participant would profit from altering their current course of action. This implies that even if a player were to know the plans of every opponent, they would still decide to stick with their original plan. Assuming that the other players maintain their initial plans, a player does not benefit from changing their approach under the Nash equilibrium. There could be several Nash equilibria in a game, or none at all. One of the fundamental ideas in game theory is Nash equilibrium.

Assign A the probability of playing H and (1p) of playing T, and B the probability of playing H and (1q) of playing T to calculate the mixed-strategy Nash equilibrium. In this game, the mixed-strategy Nash equilibrium is for each player to select H or T at random with p = 1/2 and q = 1/2.

To know more about Nash equilibrium, click on the link below:

https://brainly.com/question/17515037

#SPJ4

ANSWER

Keq is 3798.42 or 3.798 x 10^3

EXPLANATION

Given that;

The concentration of NH3 is 0.31M

The concentration of N2 is 0.85M

The concentration of H2 is 0.031M

Follow the steps below to find the chemical equilibrium constant of the reaction

Step 1; Write the balanced equation of the reaction

Step 2; Write the chemical equilibrium constant for the reaction

Step 3; Substitute the kf and kb into the formula above

Recall, that

[NH3] = 0.31M

[H2] = 0.031M

[N2] = 0.85M

Therefore, Keq is 3798.42 or 3.798 x 10^3

The molarity of the ammonium nitrate solution is 2281 M.

Molarity is defined as the number of moles of solute per liter of solution. It is also known as molar concentration of the solution and is used to calculate amount of substances in the solution.

Molarity = n/M

n = m / MW

m = 2 lbs = 1000/2.2 = 909 g

V = 53 x 3.79/1 = 200.9

MW = 80.04 g

M = m/Mw / V

M = 909/80.04 /200.9

M = 2281 M

Thus, the molarity of the ammonium nitrate solution is 2281 M.

To learn more about molarity, refer to the link below:

https://brainly.com/question/8732513

#SPJ1

Nuclear modifications are alterations that take place inside an atom's nucleus. The amount of protons and neutrons in the nucleus may change, and this is the most fundamental degree of change that can take place in a material.

The atom is considered to have experienced a nuclear transition and is now a distinct atom when the number of protons or neutrons changes. This is thus because the element is determined by the number of protons, and the element changes if the number of protons varies.

If an atom of uranium contains 92 protons, for instance, it is uranium; nevertheless, if it has 91 protons, it is protactinium. This nuclear shift produces a distinct atom with different properties.

Learn more about Nuclear reactions at:

https://brainly.com/question/16526663

#SPJ1

Answer:

b

Explanation:

Higher temperatures tend to increase the rate of a chemical reaction because the particles move faster and therefore collide more often.

Rate of reaction tells about the speed of the reaction or at what duration of time a reaction gets completed.

When we increases the temperature of any chemical reaction, then the kinetic energy of the molecules increases, due to which they move fast in the chemical reaction. Due to this random and fast movement molecules get collide with each other rapidly and easily form the product.

Hence option (c) is correct i.e. particles move faster and therefore collide more often when temperature increases.

To learn more about rate of reaction, visit the below link:

https://brainly.com/question/19513092

Answer:

Pressure, P = 67.57 atm

Explanation:

Given the following data;

Conversion:

We would convert the value of the temperature in Celsius to Kelvin.

T = 273 + °C

T = 273 + 159

T = 432 Kelvin

To find the pressure of the gas, we would use the ideal gas law;

PV = nRT

Where;

Making P the subject of formula, we have;

\( P = \frac {nRT}{V} \)

Substituting into the formula, we have;

\( P = \frac {0.467*0.08206*432}{0.245} \)

\( P = \frac {16.5551}{0.245} \)

Pressure, P = 67.57 atm

Answer:

6. 7870 kg/m³ (3 s.f.)

7. 33.4 g (3 s.f.)

8. 12600 kg/m³ (3 s.f.)

Explanation:

6. The SI unit for density is kg/m³. Thus convert the mass to Kg and volume to m³ first.

1 kg= 1000g

1m³= 1 ×10⁶ cm³

Mass of iron bar

= 64.2g

= 64.2 ÷1000 kg

= 0.0642 kg

Volume of iron bar

= 8.16 cm³

= 8.16 ÷ 10⁶

\( = 8.16 \times 10^{ - 6} \: kg\)

\(\boxed{density = \frac{mass}{volume} }\)

Density of iron bar

\( = \frac{0.0642}{8.16 \times 10^{ - 6} } \)

= 7870 kg/m³ (3 s.f.)

7.

\(\boxed{mass = density \: \times volume}\)

Mass

= 1.16 ×28.8

= 33.408 g

= 33.4 g (3 s.f.)

8. Volume of brick

= 12 cm³

\( = 12 \times 10^{ - 6} \: m^{3} \\ = 1.2 \times 10^{ - 5} \: m ^{3} \)

Mass of brick

= 151 g

= 151 ÷ 1000 kg

= 0.151 kg

Density of brick

= mass ÷ volume

\( = \frac{0.151} {1.25 \times 10^{ - 5} } \\ = 12600 \: kg/ {m}^{3} \)

(3 s.f.)

J.J. Thomson discovered electrons and their negative charge through the cathode ray experiment, leading to the development of the plum pudding model of the atom.

J.J. Thomson, a British physicist, was the first to discover electrons in 1897.

He conducted the cathode ray experiment to identify the negatively charged particles.

The cathode ray tube is a vacuum-sealed glass tube with two electrodes at each end: a cathode and an anode.

When a high voltage electrical current is applied to the electrodes, the tube glows, indicating that the cathode rays are being emitted from the cathode and traveling through the tube towards the anode.

The cathode rays were found to have a negative charge, according to Thomson.

These rays were identified as particles by the presence of a magnet, which caused the particles to bend in the direction opposite to the magnet's polarity.

This discovery indicated that the particles had a charge on them because they were deflected by the magnetic field, which is only possible if the particles have an electric charge.

Thomson further concluded that these particles were about 1,000 times smaller than hydrogen atoms because of the degree of deflection they experienced in the magnetic field.

Furthermore, Thomson created the plum pudding model of an atom, in which electrons are dispersed throughout a positively charged matrix, based on his findings.

For more such questions on electrons

https://brainly.com/question/26084288

#SPJ8

movement of water from high potential to low potential

We can consider the hydrogen gas of the first trial like an ideal gas and use the ideal gas law.

P * V = n * R * T

Where P is the pressure of the gas, V is the volume, n is the number of moles, R is the ideal gas constant and T is the temperature. We already have those values.

P = 753.8 mmHg (Pressure of Dry Hydrogen Gas)

760 mmHg = 1 atm

P = 753.8 mmHg * 1 atm/(760 mmHg)

P = 0.9918 atm

V = 40.3 mL (Volume of Hydrogen Gas Collected)

1000 mL = 1 L

V = 40.3 mL * 1 L/(1000 mL)

V = 0.0403 L

R = 0.082 atm*L/(mol*K) (ideal gas constant)

T = 295.6 K (Temperature in K)

Finally we can replace these values into the formula and solve it for n.

P * V = n * R * T

n = P * V /(R * T)

n = (0.9918 atm * 0.0403 L)/(0.082 atm*L/(mol*K) * 295.6 K)

n = 0.00165 moles

Answer: the number of moles of Hydrogen gas collected in trial 1 is 0.00165 mol.

If we use R = 62.358 L-torr/mol-K we need:

T = 295.6 K

V = 0.0403 L

P = 753.8 mmHg = 753.8 torr

n = P * V /(R * T)

n = (753.8 torr * 0.0403 L)/(62.358 torr*L/(mol*K) * 295.6 K)

n = 0.00165 moles

sutures are nonmoving joints that connect bones of the skull. These joints have serrated edges that lock together with fibers or connective tissue.

Answer:

Explanation:

1,2,4,

The equations that show combustion are equations A, B and D.

When we talk about combustion, the idea is that the substance would be burnt in oxygen. In other words, the combustion can be taken to be an oxidation reaction. It is an oxidation reaction in the sense that the oxidation number of the substance that is reacting with the oxygen would become increased.

When we look at the equations that we have, it is quite easy to pick out among the balanced reaction equations that are shown here the ones that has to do with the burning of the substance in oxygen and a consequent rise in the oxidation number.

Learn more about combustion:https://brainly.com/question/15117038

#SPJ1

Answer:

The answer is D

Explanation:

Non metals are:

Hydrogen (H)

Sulphur (S)

Phosphorus (P)

Carbon (C)

Fluorine (F)

Oxygen (O)

Nitrogen (N)

Chlorine (Cl)

Bromine (Br)

Helium (He)

Argon (Ar)

Iodine (I)

Neon (Ne)

Krypton (Kr)

Radon (Rn)

Selenium (Se)

Xenon (Xe)

a) In the reaction \(H_2CO_3 + CN^- = HCN + HCO^{3-}\), \(H_2CO_3\) acts as an acid by donating a proton (\(H^+\)) to \(CN^-\).

b) In the reaction \(F^- + HSO_4^{-} = HF + SO_4^{2-}\), \(HSO_4^{-}\) acts as an acid by donating a proton (\(H^+\)) to \(F^-\).

c) In the reaction \(HSO_4^- + H_2O = H_3O^+ + SO_4^{2-\), \(HSO_4^{-}\) acts as an acid by donating a proton (\(H^+\)) to \(H_2O\).

a) The acid is both an Arrhenius acid (produces \(H^+\) ions in water) and a Bronsted-Lowry acid (donates a proton to a base).

b) The acid is both an Arrhenius acid (produces \(H^+\) ions in water) and a Bronsted-Lowry acid (donates a proton to a base).

c) The acid is a Bronsted-Lowry acid (donates a proton to a base) but not an Arrhenius acid because it does not produce \(H^+\) ions in water. However, the \(H_3O^+\) ion that is formed can be considered an Arrhenius acid because it produces \(H^+\) ions in water.

For more question on proton click on

https://brainly.com/question/17351413

#SPJ11

Answer:

9.01 grams

Explanation:

~18.02 grams are in 1 mole of water so you'd divide that in half to get 9.01 grams.

The R or S designation is assigned to each stereogenic center based on the priority of the substituents attached to that carbon atom.

Enantiomers are pairs of molecules that are non-superimposable mirror images of each other. Enantiomers have the same chemical and physical properties, except for their interaction with polarized light. Enantiomers have opposite configurations at every stereogenic center, so they have opposite R or S designations.

Diastereomers, on the other hand, are stereoisomers that are not mirror images of each other. Diastereomers have different physical and chemical properties, and they have different configurations at one or more stereogenic centers. Unlike enantiomers, diastereomers do not have opposite R or S designations.

To identify stereogenic centers in a molecule, one needs to determine the number of different substituents attached to a carbon atom. The R or S designation is assigned to each stereogenic center based on the priority of the substituents attached to that carbon atom.

Learn more about Enantiomers :

https://brainly.com/question/21506956

#SPJ4

Answer:

0.3529moles

Explanation:

no of moles =mass ÷molar mass

molar mass =17+17

=34

12÷34

=0.3529moles

According to the mole concept, the number of moles of molecules in a 12.0-gram sample of Cl₂ is equal to 0.169  moles.

Mole is defined as the unit of amount of substance . It is the quantity measure of amount of substance of how many elementary particles are present in a given substance.

It is defined as exactly 6.022×10²³ elementary entities. The elementary entity can be a molecule, atom ion depending on the type of substance. Amount of elementary entities in a mole is called as Avogadro's number.

It is widely used in chemistry as a suitable way for expressing amounts of reactants and products.For the practical purposes, mass of one mole of compound in grams is approximately equal to mass of one molecule of compound measured in Daltons. Molar mass has units of gram per mole . In case of molecules, where molar mass  in grams present in one mole  of atoms is its atomic mass.Number of moles is mass/molar mass= 12/70.90=0.169 moles.

Learn more about mole,here:

https://brainly.com/question/20486415

#SPJ6

The new volume of the gas is 62.2 L

Charles's Law, also known as the Law of volumes, states that at a constant pressure, the volume of a gas is directly proportional to its absolute temperature. This means that as the temperature of a gas increases, its volume will also increase, and vice versa.

Mathematically, it can be expressed as: V/T = k, where V is the volume of the gas, T is its absolute temperature, and k is a constant.

We know that;

V1/T1 = V2/T2

V1T2 = V2T1

V2 = 60 * 313 /301.5

V2 = 62.2 L

Learn more about Charles law:https://brainly.com/question/16927784

#SPJ1

Answer:

Cell

Explanation:

I just passed this unit a month ago.

Answer:

It is 6. Cell

Explanation:

Cells make up the smallest level of a living organism such as yourself and other living things. The cellular level of an organism is where the metabolic processes occur that keep the organism alive. That is why the cell is called the fundamental unit of life.

I really hope this helped. God bless you and have a great day! :-)

The percent yield of the reaction is 45.44%

Percentage yield is basically,

 \(\rm Percent\ yield\ = \frac{actual\ yield}{theoretical\ yield} \times 100\)

2 NaOH + H₂SO₄ → Na₂SO₄ + 2 H₂O

To calculate the theoretical yield, consider the stoichiometry of the reaction.

2 moles of NaOH reacts with 1 mole of H₂SO₄ to give 1 mole of Na₂SO₄ and 2 moles of H₂O. The mole ratio of H₂SO₄ and Na₂SO₄ is 1:1

For this mole ratio to be useful, convert the given concentration of H₂SO₄ into moles.  

     \(\rm Molarity\ =\ \frac{No.\ of\ moles}{Volume\ of\ solution (L)}\)

            \(\rm 3.10\ =\ \frac{No.\ of\ moles}{0.125}\)

\(\rm No.\ of\ moles\ =\ 3.10 \times 0.125\\)

                     \(=\ 0.38\)

Since, mole ratio of H₂SO₄ and Na₂SO₄ is 1:1

Amount of Na₂SO₄ formed would be also 0.38 mol

Convert this amount in moles to amount in grams

\(\rm No.\ of\ moles\ =\ \frac{Mass\ formed\ }{Molecular\ mass}\)

\(\rm Mass\ formed\ =\ No.\ of\ moles\times molecular\ mass\)

                     \(\rm =\ 0.38\times 142.04\)

                     \(\rm =\ 53.97\ grams\)

Theorical yield of Na₂SO₄ is 53.97 grams

Therefore,   \(\rm Percent\ yield\ = \frac{actual\ yield}{theoretical\ yield} \times 100\)

                                          \(\rm =\ \frac{24.5}{53.97}\times 100\)

                                          =  45.44%

The percent yield of the reaction is 45.44%

To know more on percent yield, click on

https://brainly.com/question/12704041

#SPJ1

Answer:

the relationship between the relative quantities of substances taking part in a reaction or forming a compound, typically a ratio of whole integers.

Explanation:

G o o g l e

Explanation:

Stoichiometry is the calculation of reactants and products in chemical reactions in chemistry.

Answer:

See figure 1

Explanation:

In this question, we have to find first the chiral carbons on 1,2-difluoro-1,2-dimethylcyclopentane. Carbons 1 and 2. Then, using the Cahn–Ingold–Prelog priority rules. We can draw all the stereoisomers. If we have 2 chiral carbons we will have (\(2^n=2^2=4\)) 4 isomers. With this in mind we can have the R,R isomer; the S,S isomer; the S,R isomer, and the R,S isomer. We have to remember that:

Priority 1 = "F"

Priority 2= "C"

Priority 3= "CH2"

Priority 4 = "CH3"

I hope it helps!

Answer

The empirical formula for this compound is K₂CO₃

Explanaion

Given:

% composition: 56.4% potassium, 8.7% carbon, 34.9% oxygen.

What to find:

The empirical formula for the compound.

Step-by-step Solution:

Assume we have 100 grams total of the substance.

Grams Potassium: 56.4 g

Grams Carbon: 8.7 g

Grams Oxygen: 34.9 g

Now, let's convert the number of grams of each element into moles below:

Moles potassium: 56.4 g/39.1 g/mol = 1.44 mol

Moles carbon: 8.7 g/12.0 g/mol = 0.725 mol

Moles oxygen: 34.9 g/16.0 g/mol = 2.18 mol

Now, let's divide the number of moles of each element by the smallest number obtained:

Potassium = 1.44 mol/0.725 mol = 2

Carbon = 0.725 mol/0.725 mol = 1

Oxygen = 2.18 mol/0.725 mol = 3

Therefore, the empirical formula for this compound is K₂CO₃

Answer:

A covalent bond, also called a molecular bond, is a chemical bond that involves the sharing of electron pairs between atoms. These electron pairs are known as shared pairs or bonding pairs, and the stable balance of attractive and repulsive forces between atoms, when they share electrons, is known as covalent bonding.Explanation:have a good day :P

80 mL of 0.25 M Pb(NO₃)₂ solution are needed to react with 0.40 L of 0.10 M NaCl solution according to the given reaction.

Double displacement reactions, also known as double replacement reactions or metathesis reactions, are chemical reactions in which two ionic compounds react with each other and exchange ions to form two new compounds.

First, we need to determine the limiting reagent in the reaction between NaCl and Pb(NO₃)₂ . The balanced equation shows that the mole ratio of NaCl to Pb(NO₃)₂ is 2:1, so we can calculate the number of moles of each reactant:

moles NaCl = 0.10 M x 0.40 L = 0.04 moles

moles Pb(NO₃)₂  = 0.25 M x V

where V is the volume of Pb(NO₃)₂  solution needed in litres.

To react completely with the NaCl, we need 2 moles of Pb(NO₃)₂  for every 1 mole of NaCl. So, we can set up an equation to solve for V:

0.04 moles NaCl / 2 x (1 molePb(NO₃)₂  / 1 mole NaCl) = 0.25 M x V

Simplifying, we get:

V = (0.04 / 2) / 0.25 = 0.08 L = 80 mL

Therefore, 80 mL of 0.25 M Pb(NO₃)₂ solution are needed to react with 0.40 L of 0.10 M NaCl solution

To find out more about double displacement reactions, visit:

https://brainly.com/question/29307794

#SPJ1

Answer:

0.05257 L/s

Explanation:

Step 1: Given data

The school uses 1200 gallons/day

Step 2: Convert "gal/day" to "L/day"

We will use the conversion factor 1 gal = 3.785 L.

1200 gal/day × (3.785L/gal) = 4542 L/day

Step 3: Convert "L/day" to "L/s"

We will use the following conversion factors:

4542 L/day × (1 day/24 h) × (1 h/3600 s) = 0.05257 L/s

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

The predominant form of ethylenediamine at pH 6.184 is H2NCH2CH2NH+3.

At pH 6.184, which is slightly acidic, the amino groups in ethylenediamine (H2NCH2CH2NH2) can partially protonate, resulting in the formation of ammonium ions (H+3NCH2CH2NH+3). The equilibrium between the neutral form and the protonated form is pH-dependent.

Therefore, at pH 6.184, the predominant form of ethylenediamine is H2NCH2CH2NH+3.