if the concentration of chloride is higher inside the cell what does that mean for the nernst potential

Gas legislation

PV = nRT

where P is atmospheric pressure

Volume (measured in litres)

The number of moles is n.

R = gas constant (0.0821 L atm/(mol K))

Temperature (in Kelvin) equals T.

We need to rearrange the ideal gas law to solve for n:

n = PV / RT

To use this equation, we need to know the pressure, temperature, and volume of the carbon dioxide.

0.002355 moles of carbon dioxide are equal to 235.5 litres of the petrol. As a result, 0.002355 moles of carbon dioxide are equivalent to 0.053 litres.

This is because 1 mole of carbon dioxide is equal to 22.4 litres. This indicates that there are 0.002355 moles of carbon dioxide for every 0.053 litres of carbon dioxide.

Therefore, there are 0.002355 moles of carbon dioxide in 235.5 litres of carbon dioxide.

Learn more about carbon dioxide at:

https://brainly.com/question/3049557

#SPJ1

Answer:

During the eclipse season, the Moon is at a low ecliptic latitude (less than around 1.5° north or south), hence the Sun, Moon, and Earth become aligned straight enough (in syzygy) for an eclipse to occur.

Explanation:

The change of the bar's length is ΔL =0. 000312 m if the temperature is raised to 12.2 ∘C∘C above room temperature.

Given that

At  room temperature ( T = 25 ∘C)  ,L= 1 m

L=1+2.4 X 10-5T

So the length at  13.0 ∘C above room temperature:

L=1+2.4 X 10-5T

L=1+2.4 X 10-5x13

L=1.000312 m

So the change in length

ΔL = 1.000312 - 1.0000 m

ΔL =0. 000312  m

Since the length of the aluminum bar, L is given by , L = 1.0000 + 2.4 × 10⁻⁵T and T = 14.1°C, we substitute the value of T into L. So, we have L = 1.0000 + 2.4 × 10⁻⁵ × 14.1°C = 1.0000 + 0.0003384 = 1.0003384 m. The change in length is thus 1.0003384 - 1.0000 = 0.0003384 m ≅ 0.00034 m.

Learn more about temperature:

brainly.com/question/8739174

#SPJ4

The partial pressure of nitrogen on Venus is approximately 321.914 kPa.

To find the partial pressure of nitrogen on Venus, we need to calculate the partial pressure using the mole fraction of nitrogen and the total atmospheric pressure. First, we convert the total atmospheric pressure from psi to kilopascals (kPa) since the mole fraction is given in terms of kPa.

1 psi = 6.89476 kPa

Therefore, the total atmospheric pressure on Venus is:

1334 psi × 6.89476 kPa/psi = 9197.53 kPa

Next, we can calculate the partial pressure of nitrogen using the mole fraction. The mole fraction of nitrogen is given as 0.035, which means that nitrogen makes up 3.5% of the total moles of gas in the atmosphere.

The partial pressure of nitrogen is given by:

Partial pressure of nitrogen = Mole fraction of nitrogen × Total atmospheric pressure

Partial pressure of nitrogen = 0.035 × 9197.53 kPa

Partial pressure of nitrogen = 321.914 kPa

Therefore, the partial pressure of nitrogen on Venus is approximately 321.914 kPa.

It's important to note that the given atmospheric composition of Venus's atmosphere and the total atmospheric pressure are approximate values and can vary depending on specific conditions and measurements.

For more such question on partial pressure visit:

https://brainly.com/question/19813237

#SPJ8

Answer:

4.42 x 10^22 molecules

Explanation:

1 mole of CO2 has 6.022 x 10^23 molecules

=> 0.0734 x 6.022 x 10^23 = 4.420148 x 10^22 or 4.42 x 10^22

According to the placement of elements in the periodic table and the atomic structure, protons from atom on right will attract electrons from atom on left.

Periodic table is a tabular arrangement of elements in the form of a table. In the periodic table, elements are arranged according to the modern periodic law which states that the properties of elements are a periodic function of their atomic numbers.

It is called as periodic because properties repeat after regular intervals of atomic numbers . It is a tabular arrangement consisting of seven horizontal rows called periods and eighteen vertical columns called groups.

Elements present in the same group have same number of valence electrons and hence have similar properties while elements present in the same period show gradual variation in properties due to addition of one electron for each successive element in a period.

Learn more about periodic table,here:

https://brainly.com/question/7373020

#SPJ2

Answer:

d or a

Explanation:

Answer:

chemistry is a physical science

Explanation:

Answer:

NaHCO3 + HCl = NaCl + H2O + CO2

Explanation:

The total number of atoms of each element on either side of the equation must be equal.

The mass of the cereal that you would need to consume can be obtained as 84.8 g

The number of moles, denoted by the symbol "n," is a fundamental unit of measurement in chemistry that represents the amount of a substance. It is used to quantify the quantity of atoms, molecules, or ions in a sample.

Number of moles of sucrose in the cereal = 11g/342 g/mol

= 0.03 moles

Now;

0.03 moles of sucrose is contained in 60 g of cereal

0.0424 moles of sucrose would contain 0.0424 moles * 60 g/0.03 moles

= 84.8 g

Learn more about moles:https://brainly.com/question/15209553

#SPJ1

Answer:

15g

Explanation:

hope this helped

Answer:

Answer Below ↓

Explanation:

If the moving sand hits an obstacle, it stops due to the friction created by the contact and its kinetic energy is then transformed into thermal energy, or heat.

Answer:

It detects negative static electricity when protons are drawn down into the

Explanation:

electroscope, instrument for detecting the presence of an electric charge or of ionizing radiation, usually consisting of a pair of thin gold leaves suspended from an electrical conductor that leads to the outside of an insulating container.

The volume of the gas produced by the reaction, given that the displacement of the gas decrease the water level from 95.0 mL to 32.5 mL is 62.5 mL

We know that the volume of irregular objects can be obtained by using displacement method. This method is shown by the following formula:

Volume of irregular object = Original volume of water - new volume of water

With the above information, we can easily determine the volume of the gas produced. Details below

Volume of irregular object = Original volume of water - new volume of water

Volume of gas produced = 95.0 - 32.5

Volume of gas produced = 62.5 mL

Thus, we can conclude from the above calculation that the volume of the gas produced is 62.5 mL

Learn more about volume of gas:

https://brainly.com/question/29298251

#SPJ1

The ionic and net ionic equation for HCl + Mg(C2H3O2)2 ⇒ MgCl2 + HC2H3O2 is H⁺ + Cl⁻ + Mg⁺ + C₂H₃O₂⁻ → Mg⁺ + Cl₂⁻ +  H⁺ + C₂H₃O₂⁻.

Ionic equations are chemical equations that only show the ions involved in a chemical reaction. In other words, ions that combine in solution to form new substances. The ions that do not participate are referred to as spectator ions.

A net ionic equation depicts only the chemical species involved in a reaction, whereas a complete ionic equation depicts the spectator ions as well.

Thus,  H⁺ + Cl⁻ + Mg⁺ + C₂H₃O₂⁻ → Mg⁺ + Cl₂⁻ +  H⁺ + C₂H₃O₂⁻ this is the net ionic equation.

To learn more about the ionic equation, follow the link;

https://brainly.com/question/29299745

#SPJ9

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

First, we write the reaction to solve this:

Al(NO₃)₃(aq) => Al³⁺(aq) + 3NO₃⁻(aq)

We need to calculate the concentration of the salt:

Molarity = moles of Al(NO₃)₃ / Volume of solution (L)

Molarity = 2.00 moles / 2.00 L = 1.00 mol/L

The salt is completely disociated, so the concentration of NO3- ion is:

Concentration NO3- = 3 x Concentration of the salt = 3 x 1.00 mol/L = 3.00 mol/L

Answer: 3.00 mol/L

The most reactants in the system are the oxygen molecules while the least reactants in the system is carbon sulfide. As such carbon sulfide is the limiting reactant.

We know that when we talk about a chemical reaction, what we are referring to is the interaction that is able to occur between the reactants and the products that are found in the system. We know that when we write down a chemical reaction, the species that are combined are the species that we can find on the left hand side and they are called the reactants. The species that we obtain in the reaction are the species that we can find on the right hand side and they are called the products of the reactions.

If we look at the reaction as it has been shown, we can see that there are ten oxygen molecules and three carbon sulfide molecules that were initially present in the system as we can see here. The entire reaction equation is given as; CS₂(g)+30₂(g) → CO₂(g) +2 SO₂(g).

Learn more about reaction equation:https://brainly.com/question/3588292

#SPJ1

Answer:

The answer is D) 51.2%

Explanation:

5.12g of 10.00g of the substance is water:

percentage of water= 5.12 x 10.00 =51.2%

Answer:

b

Explanation:

For an electron as a particle, E = \(1/2mv^2\)

For an electron as a particle, the energy E can be described using the equation:

E =  \(1/2mv^2\)

where

This equation represents the kinetic energy of the electron, which is the E is the energy

energy associated with its motion.

This equation assumes classical mechanics and does not take into account relativistic effects that become significant at high speeds close to the speed of light.

More on electrons can be found here: https://brainly.com/question/12001116

#SPJ1

Answer:

C, energy cannot be created nor destroyed.

Explanation:

Answer:

y¹³

Explanation:

because it's a multiplication question we add exponents

8 + 5 = 13

so it's y¹³

Answer:

A chemical bond is a lasting attraction between atoms, ions or molecules that enables the formation of chemical compounds.

Explanation:

The bond may result from the electrostatic force of attraction between oppositely charged ions as in ionic bonds or through the sharing of electrons as in covalent bonds.

If an equation includes 7(CrO₄)₂, the numbers of Cr's and O's atoms that are there are 14 and 56 respectively.

The number of atoms present in a chemical compound can be calculated by multiplying the subscript of the particular element by any coefficient.

According to this question, 7 moles of chromate with the chemical formula; (CrO₄)₂ is given. The number of oxygen and chromium atoms in this compound can be calculated as follows:

Learn more about no of atoms at: https://brainly.com/question/14190064

#SPJ1

Answer:

Since the gravitational force is directly proportional to the mass of both interacting objects, more massive objects will attract each other with a greater gravitational force. So as the mass of either object increases, the force of gravitational attraction between them also increases.

Explanation:

Can you give me brainliest

Answer:

The lid is successful and so is the handle. I dont think the thick glass would work out as good unless you only keep inside and the compartment cylinder is what made thier beverages taste different from what I think. 

Explanation:

Answer: Yo! hope this helps you dude

When ice is placed into a beaker filled with water, the water level does not drop because of the concept of displacement. When the ice is added, it displaces an amount of water equal to its own volume. This means that the ice takes up space in the beaker, pushing out an equal amount of water to make room for itself. Therefore, the total volume of water and ice in the beaker remains the same, and the water level does not drop.

This is due to the fact that the density of ice is lower than that of water and when the ice is placed into the water, it will float on the surface, pushing out an amount of water equal to its own volume.

Additionally, when the ice melts, it will release the same amount of water it displaced before and the water level will not change.

Explanation:

Answer:

ks

Explanation:

Is it right