Mr. Martin had 7 eggs. He used half (½) of these eggs plus one-half (½) another egg to make an omelet. He then used half (½) of what was left plus half (½) another egg to make a batch of cookies. Finally, he used half (½) of what was left plus one-half (½) an egg to make a meatloaf.

Answers

Answer 1

Answer:

Number of eggs used to make meat loaf = 1

Step-by-step explanation:

The total number of eggs used to make omelet =

\(\frac{7}{2} + \frac{1}{2}\\\frac{8}{2} \\4\)

The total number of eggs used for making cookies

\(\frac{3}{2} + \frac{1}{2} \\\frac{4}{2}\\2\)

He is now left with 7 -4-2 = 1 egg only

So he uses this one egg to make meat loaf


Related Questions

find the multiplier for the rate of exponential growth or decay.

1) 1% growth

 find the multiplier for the rate of exponential growth or decay.1) 1% growth

Answers

1% growth has a multiplier 1+0.01=1.01

What is exponential growth function ?

A process called exponential growth sees a rise in quantity over time. When a quantity's derivative, or instantaneous rate of change with respect to time, is proportionate to the quantity itself, this phenomenon takes place.

The exponential function which models the exponential growth has a form

\(y= C(1+r)^x\)

where C is initial amount, y is final amount, x is time, r is rate (the percent written as a decimal) and 1+r is a multiplier.

The exponential function which models the exponential decay has a form

\(y= C(1-r)^x\)

where C is initial amount, y is final amount, x is time, r is rate (the percent written as a decimal) and 1-r is a multiplier.

Thus,

1. 1% growth has a multiplier 1+0.01=1.01;

To learn more about the exponential growth function from the given link

https://brainly.com/question/13223520

#SPJ1

In the past month, Alonzo rented 7 video games and 6 DVDs. The rental price for each video game was $2.50. The rental price for each DVD was $4.20. What
is the total amount that Alonzo spent on video game and DVD rentals in the past month?

Answers

Step-by-step explanation:

One month Miguel rented 3 movies and 5 video games for a total of $42. The next month he rented 9 movies and 7 video games for a total of $72. Find the rental cost for each movie and each video game.

TO ALL PPL WHO ARE GOOD AT MATH, can u pls help me?
I NEED A FULL ANSWER AND I NEED THIS RN
thank you in advance :)

TO ALL PPL WHO ARE GOOD AT MATH, can u pls help me?I NEED A FULL ANSWER AND I NEED THIS RNthank you in

Answers

Sorry if my handwriting is bad but these are the answers for 1-3
TO ALL PPL WHO ARE GOOD AT MATH, can u pls help me?I NEED A FULL ANSWER AND I NEED THIS RNthank you in

If f(x) = 2x + 7, which of the following shows the correct way to find f(5)? A. (2 + 7)/5 B. 25 +7 C. 2(5) + 7 D. 2(5 + 7)

Answers

Substitute 5 for x in the function f(x) = 2x + 7.

\(\begin{gathered} f(5)=2\cdot5+7 \\ =2(5)+7 \end{gathered}\)

Option C is correct.

2x - 5 = 2x + 8 solving algebraically and graphically

Answers

I solved it in a algebraically way. Have a good day, and hopefully I did it right.
2x - 5 = 2x + 8 solving algebraically and graphically

Solve for x.
3x + 1 = x + 7
x = [?]
X

Answers

Answer:

Step-by-step explanation:

Given: 3x + 1 = x + 7

Firstly, 3x - x = 7 - 1

Then, 2x = 6

x = 6/2

x = 3

The Value of x is 3

Alonso brings \$21$21dollar sign, 21 to the market to buy eggs and avocados. He gets eggs that cost \$2.50$2.50dollar sign, 2, point, 50. Then, he notices that the store only sells avocados in bags of 333 for \$5$5dollar sign, 5. He wants to buy as many avocados as he can with his remaining money.


How do u get 3 bags of avacodes or 9 avacadoes ??

Answers

Based on Alonso's budget, he can get 3.7 bags of avocados and the cost of 3 bags of avacodes or 9 avacadoes is $15.

Equation

Amount Alonso brings to the market = $21Cost of an egg = $2.50Cost of avocados in bags of 3 = $5Number of avocados bought = x

21 = 2.50 + 5x

21 - 2.50 = 5x

18.50 = 5x

x = 18.50 / 5

x = 3.7 bags of avocados

To get 3 bags of avocados or 9 avocados

= $5 × 3

= $15

Therefore, Alonso can get 3.7 bags of avocados and the cost of 3 bags of avacodes or 9 avacadoes is $15.

Learn more about equation:

https://brainly.com/question/2972832

#SPJ1

∠A and \angle B∠B are vertical angles. If m\angle A=(5x+2)^{\circ}∠A=(5x+2)

and m\angle B=(6x-12)^{\circ}∠B=(6x−12)

, then find the value of x.

Answers

Answer:

Step-by-step explanation:

A and \angle BB are vertical angles. If m\angle A=(5x+2)^{\circ}A=(5x+2) and m\angle B=(6x-12)^{\circ}B=(6x12)

Besides being simple for its own sake, what other advantage do simple models usually have?
a) Higher accuracy
b) Greater complexity
c) Easier interpretation
d) More detailed predictions

Answers

The correct option is c) Easier interpretation. One of the main advantages of simple models is their ease of interpretation. Simple models tend to have fewer parameters and less complex mathematical equations, making it easier to understand and interpret how the model is making predictions.

This interpretability can be valuable in various domains, such as medicine, finance, or legal systems, where it is important to have transparent and understandable decision-making processes.

Complex models, on the other hand, often involve intricate relationships and numerous parameters, which can make it challenging to comprehend the underlying reasoning behind their predictions. While complex models can sometimes offer higher accuracy or make more detailed predictions, they often sacrifice interpretability in the process.

To know more about complex visit-

brainly.com/question/28235673

#SPJ11


Is the dilation an enlargement or a reduction? What is the scale factor of the dilation?

O reduction; 1/2

O enlargement; 2

Oreduction; 2

O enlargement;
1/2

Is the dilation an enlargement or a reduction? What is the scale factor of the dilation?O reduction;

Answers

Answer:

enlargement ; 2

Step-by-step explanation:

dilation is change in the size of the figure.

in the given scenario, figure's size is increasing so dilation is called enlargement and scale factor must be greater than 1.

scale factor = dimension of new shape / dimension of original shape

let's calculate the difference in terms of boxes of both figures to calculate the scale factor,

scale factor = 6/3

thus, in the given dilation we have enlargement of 2

Sarah and her children went into a movie theater where they sell bags of popcorn for $7.50 each and drinks for $4.50 each. Sarah has $90 to spend and must buy a minimum of 16 bags of popcorn and drinks altogether. If xx represents the number of bags of popcorn purchased and yy represents the number of drinks purchased, write and solve a system of inequalities graphically and determine one possible solution.

Answers

Answer:

A possible solution is she should by 6 bags of popcorn and 10 drinks

Step-by-step explanation:

The price of each bag of popcorn = $7.50

The price of each drink = $4.50

The amount Sarah has to spend = $90

The number of bags of popcorn and drinks Sarah must buy = 16 bags of popcorn and drinks

Let the number of bags of popcorn purchased be represented by x and the number of drinks purchased be represented by y

Therefore, we have;

x + y ≥ 16.....(1)

x × 7.5 + y × 4.5  ≤ 90

Which gives;

7.5·x + 4.5·y ≤ 90....(2)

Rewriting the inequalities as a function of y, gives;

From inequality (1), x + y ≥ 16, we have;

y = ≥ 16 - x

From inequality (2), 7.5·x + 4.5·y ≤ 90, we have;

7.5·x + 4.5·y ≤ 90

4.5·y ≤ 90 - 7.5·x

y ≤ 90/4.5 - 7.5/4.5·x

y ≤ 20 - 5/3·x

Please find attached, the plot of the inequalities

A possible solution is given as the value of x = 6, where y = 10

Therefore, she should by 6 bags of popcorn and 10 drinks.

Sarah and her children went into a movie theater where they sell bags of popcorn for $7.50 each and drinks

A second function is defined by the formula y = x^2 - 1. Which function, the first or second, has a greater output when the input is 3? Justify (help)

Answers

The second function, y = x^2 - 1, has a greater output when the input is 3.To determine which function has a greater output when the input is 3, we need to evaluate both functions at x = 3 and compare the resulting y-values.

For the first function, f(x) = 3x, substituting x = 3 gives f(3) = 3 * 3 = 9.For the second function, g(x) = x^2 - 1, substituting x = 3 gives g(3) = 3^2 - 1 = 9 - 1 = 8 Comparing the outputs, we find that f(3) = 9 and g(3) = 8. Since 9 is greater than 8, we conclude that the first function, f(x) = 3x, has a greater output when the input is 3. This can also be understood geometrically. The first function, f(x) = 3x, represents a straight line with a slope of 3. When x = 3, the corresponding y-value is 9, indicating that the line passes through the point (3, 9). On the other hand, the second function, g(x) = x^2 - 1, represents a parabola that opens upwards. When x = 3, the corresponding y-value is 8, indicating that the point (3, 8) lies on the parabola.In summary, when the input is 3, the first function f(x) = 3x has a greater output (9) compared to the second function g(x) = x^2 - 1 (8)

learn more about greater here:

https://brainly.com/question/31761155

#SPJ11

PLEASE HELP ME!!!

What is the value of x?

Enter your answer in the box.

x =

PLEASE HELP ME!!!What is the value of x?Enter your answer in the box.x =

Answers

Your answer What is the value of x, you didn't specify

Value of x is used to consider unknown value. The letter “x” is commonly used in algebra to indicate an unknown value. It is referred to as a “variable” or, in some cases, a “unknown.” In x + 2 = 7, x is a variable. ... A variable need not be “x,” but might be “y,” "w," or any other letter, name, or symbol.

select the correct answer arc located on circle has a length of 40 centimeters. the radius of the circle is 10 centimeters. what is the measure of the corresponding central angle for in radians? a. b. 3 c. d. 4

Answers

Answer:

2 radians

Step-by-step explanation:

the arc length is calculated as

arc = circumference of circle × fraction of circle

let x be the central angle , then

arc = 2πr × \(\frac{x}{2\pi }\) ( cancel 2π on numerator and denominator )

    = 2r × x

given arc length = 40 , then

2 × 10 × x = 40

20x = 40 ( divide both sides by 20 )

x = 2

the central angle has a measure of 2 radians

 

Find the coordinates of the point (x, y, z) on the plane z = 4 x +2 y + 3 which is closest to the origin.
x =
y = z =

Answers

The coordinates of the point on the plane z = 4x + 2y + 3 that  is closest to the origin  (x, y, z) = (0, 0, 3) can be determined using the Method of Lagrange Multipliers. We must find the values of x, y, and z that minimize the distance from the origin, given the constraint that z = 4x + 2y + 3.

Lagrange multiplier equation:

Let L(x,y,z) = x^2 + y^2 + z^2 and f(x, y, z) = 4x + 2y + 3.

The Lagrange multiplier equation is then:
L(x, y, z) = λf(x, y, z)

Partial derivatives:

Taking the partial derivatives of L(x, y, z)  concerning  x, y, and z, and setting them equal to zero yields:
2x = 4λ
2y = 2λ
2z = 3λ

Solution:

Solving the above equations for x, y, and z yields

x = 2λ/4, y = λ/2, and z = 3λ/2.

Substituting this into the equation

f(x, y, z) = 4x + 2y + 3 yields 0 = λ/2, which has no solutions.

Therefore, the coordinates of the point on the plane z = 4x + 2y + 3 that is closest to the origin is (x, y, z) = (0, 0, 3).

Know more about  Lagrange multiplier here:

https://brainly.com/question/31013684

#SPJ4      

     


6.Find the value of x. Don't forget your reasons.
(x-38)

6.Find the value of x. Don't forget your reasons.(x-38)

Answers

Answer:

x = 109

Step-by-step explanation:

The figure has one pair of parallel sides and is a trapezoid.

The lower base angle is supplementary to the upper base angle on the same side, thus

x + x - 38 = 180 , that is

2x - 38 = 180 ( add 38 to both sides )

2x = 218 ( divide both sides by 2 )

x = 109

What is (3.3 x 10^2) (5.2 x 10^8) in scientific notation?

Answers

Answer:

I’ve got a level 4 in pre algebra state test so this should be simple

Step-by-step explanation:

in order to convert this just Move the decimal so there is one non-zero digit to the left of the decimal point. The number of decimal places you move will be the exponent on the 1010. If the decimal is being moved to the right, the exponent will be negative. If the decimal is being moved to the left, the exponent will be positive.


the answer would be: 1.716×10^11

And this is positive and not negative

______. a measurable part of a line that consists of two points, called endpoints, and all of the points between them.

Answers

Line segment is a a measurable part of a line that consists of two points, called endpoints.

What is coordinate Geometry?

a coordinate system is a system that uses one or more numbers, or coordinates, to uniquely determine the position of the points or other geometric elements on a manifold such as Euclidean space.

Given that measurable part of a line that consists of two points, called endpoints is a line segment.

A line segment is a part of a straight line that is bounded by two distinct end points, and contains every point on the line that is between its endpoints.

Hence, line segment is a a measurable part of a line that consists of two points, called endpoints.

To learn more on Coordinate Geometry click:

https://brainly.com/question/18269861

#SPJ1

Find the equation of this line

Find the equation of this line

Answers

Answer:

y=4x-9

Step-by-step explanation:

-9=y intercept

up 4 over 1

4/1=4

slope =4

how do squaring and taking the square root relate

Answers

Answer:

Finding the square root of a number is the inverse operation of squaring that number.

Remember, the square of a number is that number times itself.

The perfect squares are the squares of the whole numbers.

The square root of a number, n, written below is the number that gives n when multiplied by itself.

Step-by-step explanation:

look above

Answer:

Finding the square root of a number is the inverse operation of squaring that number.

Remember, the square of a number is that number times itself.

The perfect squares are the squares of the whole numbers.

The square root of a number, n, written below is the number that gives n when multiplied by itself.

Step-by-step explanation:

Find the total cost if the price of a netbook is 375.00.

Answers

Answer:

387.50.

Step-by-step explanation:

in statistics, an association refers to group of answer choices the existence of an overall pattern of joint variation between variables, regardless of origin or cause. a linear or curved pattern of joint variation between two quantitative variables. the existence of a causal pattern of joint variation between variables, based on sample data. a linear pattern of joint variation between two quantitative variables.

Answers

The additional analysis and evidence may be needed to establish a causal relationship between variables.

What is the pattern of joint variation between variables?

The existence of an overall pattern of joint variation between variables, regardless of origin or cause.

In statistics, an association refers to the presence of a relationship or pattern of joint variation between two or more variables. This pattern can take various forms, including linear or curved, but the key characteristic is that the variables tend to vary together in some way.

However, an association alone does not necessarily imply causation. In other words, just because two variables are associated or vary together does not mean that one variable causes the other. Additional analysis and evidence may be needed to establish a causal relationship between variables.

Learn more about variables

brainly.com/question/17344045

#SPJ11

As light from a star spreads out and weakens, do gaps form between the photons?

Answers

Answer:

(-1.5, 0.25)

Step-by-step explanation:

This image will show you the intersection of the two graphs. Enjoy :)

Please mark as brainliest.

As light from a star spreads out and weakens, do gaps form between the photons?

Need help with Part A and Part B

Need help with Part A and Part B

Answers

It’s easy the answer is 5 bc the Leigh of it is 10 so take 5 and it’s 5

Which expressions are equivalent to 2 + 2 + 2 + 2
Choose 2 answers:
A. 3x + 2
B. 3 + 230
C. 3(x + 2)
D. 2(x + 1) + x
E. 5.3

Which expressions are equivalent to 2 + 2 + 2 + 2Choose 2 answers:A. 3x + 2B. 3 + 230C. 3(x + 2)D. 2(x

Answers

Answer:

A) 3x+2

Step-by-step explanation:

Bill started west on road u. S. 50, riding a bicycle at an average rate of 9 mph. Four hours later charles started after bill on a motor cycle and overtook him in 2 hours. What was charles' rate? which equation could be used to solve for charles' rate if it is represented by x? 6 x = 54 2 x = 54 2 x = 36.

Answers

The equation could be used to solve for charles' rate if it is represented by x is 2x=54.

In the given question wehave to find the equation could be used to solve for charles' rate if it is represented by x.

Bill riding a bicycle at an average rate of 9 mph.

Charles' rate is x.

So the relative rate = x−9 mph

Distance traveled by Bill in 4 hours = 9*4 =36 mph

Charles' overtook Bill in 2 hours. So

Relative Rate = Distance/Time

x−9=36/2

Multiply by 2 on both side. We get

2(x−9)=36

Simplifying

2x−18=36

Add 18 on both side, we get

2x=36+18

2x=54

Hence, the equation could be used to solve for charles' rate if it is represented by x is 2x=54.

To learn more about speed formula link is here

brainly.com/question/7359669

#SPJ4

there are basic chart types and specialized chart types. a gantt chart is a specialized chart type.

Answers

A Gantt chart is indeed a specialized chart type. Basic chart types include bar charts, line charts, and pie charts, which are commonly used for visualizing data. Specialized chart types, such as Gantt charts, serve more specific purposes.

Yes, there are indeed basic chart types as well as specialized chart types. Basic chart types include things like bar graphs, line graphs, and pie charts, while specialized chart types are designed for more specific purposes, such as organizational charts, flowcharts, and Gantt charts.

In particular, a Gantt chart is a specialized chart type that is commonly used in project management to help visualize the tasks, milestones, and dependencies involved in a project. It is designed to show a timeline of when each task or activity needs to be completed, as well as how long it will take and what resources will be needed.

Overall, while basic chart types are great for general data visualization purposes, specialized chart types like Gantt charts can be incredibly useful for specific tasks or industries, and can help users to more effectively communicate and manage complex information.

A Gantt chart is indeed a specialized chart type. Basic chart types include bar charts, line charts, and pie charts, which are commonly used for visualizing data. Specialized chart types, such as Gantt charts, serve more specific purposes. A Gantt chart is designed for project management and helps visualize a project's timeline, tasks, and progress, making it easier to manage and allocate resources.

Learn more about Gantt chart:

brainly.com/question/31247294

#SPJ11

At the end of the baseball season the chargers and the renegades have won a total of 31 games the chargers had 15.2 times as many games as the renegades how many games did each team win​

Answers

Answer: the answers should be 15.2% of 30 = 4.56

Step-by-step explanation:

The length of a rectangle is 4 less than 2 times the width. The perimeter is 40 units.
Find the dimensions of the rectangle.
First equation:
Second equation:

Answers

Answer:

Let l be length and w be width.

First equation:

l = 2w-4

Second equation:

perimeter = 40 units

Perimeter of a rectangle: 2(l+w)

2(2w-4+w)=40

2(3w-4)=40

6w-8=40

6w=40+8

6w=48

w=48/6

w=8

Therefore the width=8;

length= 2w-4 = 2(8)-4  = 16-4  = 12

perimeter = 40 units

Ty, who weighs 120 lbs, sits 5 ft to the left side on a seesaw. In order to balance the seesaw, Charley has to sit 6 ft to the right. How much does Charley weigh?

Answers

Ans: 144

Step-by-step explanation:

24 pounds per foot.

120+24=144

pls mark brainliest

Other Questions
A $10,000 bond with 18%/year, compounded semi-annually (interest is paid every six month) is available in the market. The bond matures in 10 years. The closest PW of this bond if the purchaser can earn 12%/year, compounded quarterly is:_____. How do quantum computers perform operations? how latitude affects the climate If Nominal GDP is $22,000 billion and the GDP deflator is 110, then Real GDP is ________.A) $24,200 billionB) $11,000 billionC) $20,000 billion From a macroeconomic point of view, which of the following is a source of demand for financial capital?A. savings by households and firmsB. foreign financial investmentC. domestic household private savingsD. government borrowing Green Holdings has current sales of RM7,000 and a profit margin of 6.5 percent. The firm estimates that sales will increase by 5.5 percent next year and that all costs will vary in direct relationship to sales. What is the pro forma net income? Select one: A. RM705.25 RM250.25 RM438.70 RM405.60 O B. OC. O D. ake feels a hunger growing in his stomach. the more he feels the hunger, the more he wishes lunchtime would hurry and arrive. he is already planning what he will eat and how good it will taste. which of the following processes most accurately identifies what jake is feeling? question 8 options: a) the motivation process b) the goal process c) the involvement process d) the directionality process Users of accounting information can be divided into two main groups. these groups include:____. Which statement does NOT represent a plot?A. The structure and organization of a storyB. The events in a storyC. The beginning, middle, and end of a storyD. The problems and struggles a character faces in a story. Find the solution to the boundary value problem: The solution is y = cos(5t)-(sin(2)/sin(5))sin(2t) dy dt dy dt +10y = 0, y(0) = 1, y(1) = 9 PLEASE HELP ME It snowed 2/3 of a foot in January and 1/2 of a foot in February. How much more did it snow in January than in February? Luke did not go to work on Monday. what is its complete verb? Assuming the data were normally distributed, what percent of schools had percentages of students qualifying for FRPL that were less than each of the following percentages (use Table B.1 and round Z-scores to two decimal places)a. 73.1b. 25.6c. 53.5 Where do fossil fuels get their name Directions: Write on the line the letter of the phrase or sentence that best answers each question.15. Economics is the study of how people and nations use their limited supply of which of thefollowing items to satisfy their wants and needs? (economics)a. social programsd. incentivesC. resourcesb. wages What is the expected return of a portfolio that has invested $9,805 in Stock A, $18,289 in Stock B, and $6,201 in Stock C? (Hint: calculate weights of each stock first). Enter the answer with 4 decimals (e.g. 0.1234). Angel has a deck that measures 20 feet by 25 feet. He wants to increase each dimension by equal lengths so that its area is increased by 50%. By how much should he increase each dimension? i have dream about South Africa becoming a better country a tine test is commonly used to determine whether a person has been exposed to tuberculosis. approximately 4% of people in the united states have been exposed to tuberculosis. when the tine test is administered, 98% of all people who have been exposed test positive and 95% of those not exposed test negative. suppose a person is randomly selected and given the tine test The concept of ______ is probably the best single measure of an industry's impact.A. total outputB. total spendingC. aggregate market value of firms in industryD. value added