Photon is particle of electromagnetic radiation , spectral lines are discrete pattern of narrow bands produced by heated gases , excited means states with higher energy than ground state , quantum is discrete amount of energy, electromagnetic spectrum is range of different types of electromagnetic radiation , wave-particle duality is having characteristics of both wave and particle.
What is electromagnetic radiation?The electromagnetic radiation consists of waves made up of electromagnetic field which are capable of propogating through space and carry the radiant electromagnetic energy.
The radiation are composed of electromagnetic waves which are synchronized oscillations of electric and magnetic fields . They are created due to change which is periodic in electric as well as magnetic fields.
Learn more about electromagnetic radiation,here:
https://brainly.com/question/10759891
#SPJ1
round 77.616 to two significant figures
Answer:
The answer to the question is 78
Answer:
78
Explanation:
In rounding off to two, we consider the third digit. if it is more than five we ad one to the second digit otherwise we truncate.
in the case of 77.616, we add one to the second digit and truncate the rest.
match the following pairs of atoms with the statement that correctly describes both atoms in the pair.
They have the same number of electrons in their outermost shells.---Nitrogen & Phosphorus
2. They have two electron shells.----Carbon & Nitrogen
3. Their outermost electron shell is full.---Helium & Argon
4. They have one electron shell. ----Hydrogen & Helium
5. They have three electron shells.-----Sodium & Chlorine
The protons in the carbon atom's nucleus attract the two valence electrons of both oxygen atoms. They form a double covalent bond because they both have a lot of attraction and room for electrons.
Which pair of atoms is held together by a covalent bond?Nonmetal atoms are the only ones that can form covalent bonds. A covalent bond can bind two atoms from the same element or from different elements together. A covalent compound is formed when elements' atoms join together.
Incomplete question :
Match the following pairs of atoms with the statement that correctly describes both atoms in the pair.
1. They have the same number of electrons in their outermost shells.
2. They have two electron shells.
3. Their outermost electron shell is full.
4. They have one electron shell.
5. They have three electron shells.
Pairs given :
Helium & Argon
Nitrogen & Phosphorus
Carbon & Nitrogen
Hydrogen & Helium
Sodium & Chlorine
Learn more about pair of atoms :
brainly.com/question/29117040
#SPJ1
How many grams of Cu are there in a sample of Cu that contains 1.09×1024 atoms?
1.15 g of Cu are there in a sample of Cu that contains\(1.09*10^{24}\)atoms
The number of grams of Cu in a sample containing\(1.09*10^{24}\)atoms can be determined using Avogadro's number, which is \(6.02*10^{23}\)atoms/mol.
First, we need to calculate the number of moles of Cu in the sample. To do this, we divide the number of atoms by Avogadro's number to get the number of moles:
\(\frac{1.09*10^{24} atoms }{6.02*10^{23} atoms/mol }= 1.81*10^{-1 }mol\)
The sample's mass needs to be determined next. Since copper has an atomic mass of 63.55 g/mol, we can use this to determine the sample's mass:
\(1.81*10^{-1} mol * 63.55 g/mol = 1.15 g\)
Therefore, the sample contains 1.15 g of Cu.
learn more about Avogadro's number refer:brainly.com/question/11907018
#SPJ1
What type of boundary exists at letter b?
Answer:
Convergent boundaries
Explanation:
Calculate the pH when 90.0 mL of 0.200 M HBr is mixed with 30.0 mL of 0.400 M CH₃NH₂ (Kb = 4.4 × 10⁻⁴).
The pH of the solution is 10.82.
To solve this problem, we need to determine the concentration of the hydronium ion (\(H_3O^+\)) in the solution. This can be done using the following steps:
Write the balanced chemical equation for the reaction between HBr and CH₃NH₂.
HBr + CH₃NH₂ → CH₃NH₃⁺ + Br⁻
Write the expression for the base dissociation constant (Kb) for CH₃NH₂.
Kb = [CH₃NH₃⁺][OH⁻]/[CH₃NH₂]
Calculate the concentration of hydroxide ions (OH⁻) in the solution using the Kb value and the concentration of CH₃NH₂.
Kb = [CH₃NH₃⁺][OH⁻]/[CH₃NH₂]
4.4 × 10⁻⁴ = x² / (0.400 M)
x = 6.63 × 10⁻³ M
[OH⁻] = 6.63 × 10⁻³ M
Calculate the concentration of \(H_3O^+\) using the equilibrium constant for the reaction between HBr and \(H_2O\).
\(HBr + H_2O = H_3O^+ + Br^-\)
\(Kw = [H_3O^+][OH^-] = 1.0 * 10^{-14}\\[H_3O^+] = Kw/[OH-] = 1.51 * 10^{-11}\)
Calculate the pH using the concentration of \(H_3O^+\).
\(pH = -log[H_3O^+]\\pH = -log(1.51 * 10^{-11})\)
pH = 10.82
For more question on pH click on
https://brainly.com/question/172153
#SPJ11
How many mL are in 0.365 L?
Answer:
365 mL
Explanation:
There are 1,000 mL per every 1 L. As such, to convert between the two measurements, you need to multiply the given volume (0.365 L) by the conversion. To allow for the cancellation of units (liters), liters should be in the denominator of the conversion.
1,000 mL = 1 L
0.365 L 1,000 mL
---------------- x ----------------- = 365 mL
1 L
Fill in the blank: If an atom is in column V (or 15), it will most likely ____________ to fulfill the octet rule.
Gain 3 electrons
Lose 5 electrons
Gain 5 electrons
Lose 5 protons
Gain 3 protons
Answer:
If an atom is in column V (or 15), it will most likely gain 3 electrons to fulfill the octet rule.
Explanation:
The octet rule defines the property that atoms have to complete their last energy level with eight electrons to achieve stability through an ionic, covalent or metallic bond.
The pair of electrons that are transferred or gained belong to the last shell of the atom. If an atom is in column V (or 15), it means that it has 5 electrons in its last shell. So an atom in this group is more likely to gain 3 electrons to achieve stability than to lose the 5 electrons it has.
If an atom is in column V (or 15), it will most likely gain 3 electrons to fulfill the octet rule.
A. Gain 3 electrons
What does Octet rule say?The octet rule defines the property that atoms have to complete their last energy level with eight electrons to achieve stability through an ionic, covalent or metallic bond.
The pair of electrons that are transferred or gained belong to the last shell of the atom. If an atom is in column V (or 15), it means that it has 5 electrons in its last shell. So an atom in this group is more likely to gain 3 electrons to achieve stability than to lose the 5 electrons it has.
Thus, correct option is A.
Find more information about Octet rule here:
brainly.com/question/865531
Which statement best describes the mass numbers of the atoms in the reaction?
OThere is one atom with a mass number of 1
O There are two atoms with mass numbers of 2.
OThere is one atom with a mass number of 2.
O There are two atoms with mass numbers of 1.
There are two atoms with mass numbers of 2 best describes the mass numbers of the atoms in the reaction
What is a Mass number ?The sum of protons and neutrons in an atomic nucleus is known as the mass number, often known as the atomic mass number or nucleon number. It roughly equates to the atom's atomic mass given in atomic mass units.
They are collectively referred to as nucleons since protons and neutrons are both present in the atomic nucleus. An atom of carbon, for instance, has 6 protons and 6 neutrons. Its mass number is therefore 12. All atoms of an element have the same number of protons, but their neutron counts can differ.Learn more about Mass number here:
https://brainly.com/question/28409714
#SPJ13
According to erikson, unsuccessful completion of the first psychosocial stage will result in
Answer:
Unsuccessful completion of this stage can result in an inability to trust, and therefore an sense of fear about the inconsistent world. It may result in anxiety, heightened insecurities, and an over feeling of mistrust in the world around them.
Hope this helps!
Answer: Unsuccessful completion of this stage can result in an inability to trust, and therefore an sense of fear about the inconsistent world. It may result in anxiety, heightened insecurities, and an over feeling of mistrust in the world around them.
Explanation:
a. Identify the structures shown in the diagram. b. Identify the information that is contained within these structures. c. Describe how the structures from this cell would compare to the structures in the nucleus of another body cell from the same person. d. Explain why the structures are in pairs.
The answer responses to the structures shown in the diagram are:
A. chromosomes
C. They would be the same.
B. They are in pairs because each one comes from a different parent.
What is the structure about?The chromosomes are in pairs because humans have a diploid number of chromosomes, meaning they have two sets of chromosomes, one inherited from each parent.
The nucleus is important in eukaryotic cells and has many important parts that help the cell work properly. There are some parts inside cells called the nuclear membrane, nucleoplasm, nucleolus, and chromatin. Chromatin is made up of DNA and other proteins.
Every part of a person's body has the same genes, but the way they are organized can be different in different types of cells. The chromosomes in our skin cells might not be the same as the chromosomes in our muscle cells, even if they come from the same person.
Learn more about nucleus from
https://brainly.com/question/9376695
#SPJ1
Identify the structures shown.
A. chromosomes
B. mitochondria
C. nuclei
D. vacuoles
C
Describe how the structures from this cell would compare to the structures in the nucleus of another body cell from the same person.
A. There would be longer.
B. They would be shorter.
C. They would be the same.
D. They would be different.
Describe how the structures from this cell would compare to the structures in the nucleus of another body cell from the same person.
A. There would be longer.
B. They would be shorter.
C. They would be the same.
D. They would be different.
Explain why the structures are in pairs.
A. They aren't in pairs.
B. They are in pairs because each one comes from a different parent.
C. This cell is making a copy of itself.
D. The cell always has 2 copies in case 1 is damaged.
When you convert a measurement from SI to English, what changes? units , values , error , or resolution
When you convert a measurement from SI to English, units and values are changed. The correct options are A and B
What are SI units?SI units are measurement units. It is the international system of measurement. There are five main SI units. These units are meters, kilometers, ampere, second, and kelvin.
These units are used to write after the measurement values. Like, are we calculating the length? Length is measured in meters and kilometers. So we will write the meter and kilometer after the value.
The English measurement system is discovered in England. The main units of this system are the inch, foot, yard, and mile. So if we convert the SI to an English measurement system. The units of the value will be changed and the value also change.
Thus, the correct option is A, unit, and B, values.
To learn more about SI units, refer to the link:
https://brainly.com/question/12750330
#SPJ2
What is the heat capacity (J/°C) of a 250.0 g block of metal whose specific heat is 0.220 J/gºC ?
Answer:
0.220 J/gCº * 250.0 g = 55.0 J/Cº
The theory of evolution states
Answer:
the theory of evolution states that all living things which exist today, and many more that are now extinct, evolved from simple life forms which first developed 3 billion years ago.
Explanation:
FILL THE BLANK In the bicarbonate buffering system, carbon dioxide and water join to form ___________, which dissociates into hydrogen and ________________
In the bicarbonate buffering system, carbon dioxide and water join to form carbonic acid, which dissociates into hydrogen and bicarbonate ions.
The blood's bicarbonate buffer system keeps the pH or H+ ion concentration where it needs to be.
The majority of blood is water, which breaks down into the hydroxide ions H+ and OH-.
The pH of the blood is set by the hydrogen ions, or H+. The blood's acidity or basicity will have an impact on how the body functions. A byproduct of respiration is dissolved carbon dioxide, or CO2, which is found in blood. When these react, carbonic acid, or H2 CO3, can be created. Being a weak acid, carbonic acid is willing to give up an H+ ion.
Learn more about bicarbonate buffering system:
https://brainly.com/question/22821585
#SPJ4
what is the name of the product when 3-methyl-2-butanol is oxidized?
Answer:
3-methyl-2-butanone.
Explanation:
Hello there!
In this case, for these types of oxidation of secondary alcohols, due to the 2-butanol, it is possible for us to remember that the product is a ketone exhibiting a carbonyl (C=O) group as the product of the oxidation. In such a way, the reaction would be:
CH3 - CH - CH - CH3 -------> CH3 - C - CH - CH3
| | || |
OH CH3 O CH3
Therefore, the product would be 3-methyl-2-butanone.
Best regards!
In 24 g of carbon ,how many number of carbon atoms.
There are 1.204 × 10²⁴ atoms in 24 grams of carbon.
How to calculate number of atoms?The number of atoms present in a substance can be calculated by multiplying the number of moles in the substance by Avogadro's number as follows;
no of atoms = no of moles × 6.02 × 10²³
According to this question, there are 24 grams of carbon atom. The number of moles in this carbon is as follows:
no of moles = 24g ÷ 12g/mol = 2mol
no of atoms = 2 × 6.02 × 10²³
no of atoms = 1.204 × 10²⁴ atoms.
Learn more about atoms at: https://brainly.com/question/14190064
#SPJ1
identify the part of the slow carbon cycle in whitch the total amount of carbon is most likely decreasing and explain why this decrease occurs
Answer:
i just had gthe sme question looked it up and got it WRONG
Explanation:
sorry i ont have a clue
In the slow carbon cycle, carbon moves through rocks, soil, oceans, and the atmosphere over a period of 100–200 million years through a series of chemical reactions and tectonic activity.
What is carbon cycle?Carbon cycle is defined as the exchange of carbon compounds between the earth's biosphere, geosphere, pedosphere, hydrosphere, and atmosphere. Life on Earth is reliant on the carbon cycle. Because nature tends to keep carbon levels in balance, the amount of carbon that is naturally released from reservoirs equals the amount that is naturally absorbed by reservoirs.
The slow carbon cycle is the term used to describe the flow of carbon compounds between the atmosphere and the Earth. The carbon cycle processes of combustion and breakdown are primarily involved in this process. The annual average for the slow carbon cycle is 1013 to 1014 grams of carbon.
Thus, in the slow carbon cycle, carbon moves through rocks, soil, oceans, and the atmosphere over a period of 100–200 million years through a series of chemical reactions and tectonic activity.
To learn more about carbon cycle, refer to the link below:
https://brainly.com/question/1627609
#SPJ2
If we put 1g samples of all four of these into a hot oven, which would absorb the most heat in order to reach 100 degrees Celsius?
Answer:
Alluminum
I have to extend the answer: wedfojnwenlgeqoirhgkreqh
Janelle hikes along the beach every morning at the same time. Throughout the month, she notices the shoreline follows a pattern of receding and advancing. What causes the shoreline to follow this pattern?
tides
water cycle
chemical weathering
erosion and deposition
Answer:
Erosion and deposition
Answer:
Tides
Explanation:
just did it:)
After performing a western blot analysis, you obtain a blot showing a single band. Plotting electrophoretic mobility of the marker proteins and the protein of interest, you determine that the molecular weight of the protein is 213 kD . Estimate the number of amino acids in the protein.
Answer:
The estimate is \(N = 1936 \)
Explanation:
From the question we are told that
The molecular weight of the protein is \(MW_p = 213 kD = 213 *10^{3} \ D\)
Generally the average molecular weight of amino acid is \(MW_a = 110 \ D\)
Generally the number of amino acids in the protein is mathematically represented as
\(N = \frac{MW_p}{MW_a}\)
\(N = \frac}{213 *10^{3}{110}\)
=> \(N = 1936 \)
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
the lewis dot structure for CSBr2?
Answer:
See attached picture.
Explanation:
Hello!
In this case, by considering that the carbon has four valence electrons as it is in group IVA, sulfur has six valence electrons as it is in group VIA and bromine has seven valence electrons as it is in group VIIA we infer that the carbon is the central atom in CSBr2 so one double bond between carbon and sulfur makes it complete the octet and two carbon-to-bromine bonds are formed in order to complete the octets of both carbon and bromine as shown on the attached picture.
Best regards!
A sample of hydrogen takes up 34.0 dm3 of space when it is under 500.0 kPa of pressure. When the pressure is changed to 340.0 kPa, what is the new volume? dm3 H2
Answer:
50 dm³
Explanation:
Assuming constant temperature, we can solve this problem using Boyle's law, which states:
P₁V₁=P₂V₂Where in this case:
P₁ = 500.0 kPaV₁ = 34.0 dm³P₂ = 340.0 kPaV₂ = ?We input the data:
500.0 kPa * 34.0 dm³ = 340.0 kPa * V₂And solve for V₂:
V₂ = 50.0 dm³Thus the answer is 50.0 dm³ H₂.
(GIVING BRAINLIEST)Match the type of chemical bond with the best description:
A.) ionic bonding
B.) covalent bonding
C.) metallic bonding
-------------------------------------------
1.)sea of electrons surrounding metal cations
2.) sharing of electrons between nonmetal atoms
3.) transfer of electrons from cation to anion
Answer:
A and 3
B and 2
C and 1
Explanation:
Ionic bonding is the transfer of electrons from a cation to an anion.
Covalent bonding is the sharing of electrons between nonmetal atoms.
Metallic bonding is the sea of electrons metal cations.
Hope this helped!
Which statement is best supported by this scale? (LT 2)
(Insert Mohs Hardness scale)
Your answer:
A fingernail will scratch calcite, but not quartz.
A piece of glass can be scratched by calcite, but not quartz.
A piece of glass can be scratched by quartz, but not calcite.
Answer:
The answer is C I think..
Where are the metals located on the periodic table? the nonmetals?
Answer:
The metals are located on the left and the non-metals are located on the right.
Explanation:
Hope this helps :)
What systems keep something inside them the same temperature (either hot or cold) without using electricity?
Answer:
Solar Gain. Solar gain is our bread and butter, defined as an object's increase in temperature from solar radiation. ...
Thermal Mass. If an object has great thermal mass, it is capable of retaining heat for long periods of time. ...
Insulation. ...
Orientation. ...
Convection. ...
Cooling Tubes. ...
Deflection. ...
Explanation:
if 2.22 moles of ammonia (NH3) decomposes according to the reaction shown how many moles of hydrogen (H2) are formed?
Answer:
five(5) hydrogen are formed
33) Which is the correct name for the molecule depicted below?
A. 2-isopropyl-2,3,4-trimethylbutane
B. 2-isopropyl-2,3-dimethylpentane
C. 2,3,3,4-tetramethylhexane
D. 1,1,2,2,3-pentamethylpentane
E. None of these choices is correct.
Answer:
C. 2,3,3,4-tetramethylhexane
Explanation:
calculate
ture
chemical equation:
2S03(g) 2502(g) + O2(g)
(a)
temperature and give its units.
In the vapour phase, sulphur trioxide dissociates according to the follow
Write , expression for this dissociation reaction.
producing a pressure of 10 atm. Calculate the value of Kp
At a particular temperature, 75% of sulphur trioxide is dissociate
Answer:
calculate
ture
chemical equation:
2S03(g) 2502(g) + O2(g)
(a)
temperature and give its units.
In the vapour phase, sulphur trioxide dissociates according to the follow
Write , expression for this dissociation reaction.
producing a pressure of 10 atm. Calculate the value of Kp
At a particular temperature, 75% of sulphur trioxide is dissociate