Already answered here: https://brainly.com/question/26946183
The length of a rectangle is 4 times the width, w. Which expression represent the perimeter of the rectangle
Answer:
10w
Step-by-step explanation:
→ Work out the length
4 × w = 4w
→ State width
w
→ Find perimeter
4w + 4w + w + w = 10w
A hemispherical clay pot has an inner radius of 8.2cm and outer radius of 9.1cm. Calculate the capacity of the pot.
Answer:
The capacity of the pot can be calculated by finding the volume of the clay pot. We can use the formula for the volume of a sphere to find the volume of the inside and outside of the pot and subtract the smaller volume from the larger volume to find the volume of the clay.
Step-by-step explanation:
The formula for the volume of a sphere is:
V = (4/3)πr^3
Where V is the volume and r is the radius.
First, we will calculate the volume of the inside of the pot:
V_inner = (4/3)π(8.2cm)^3 = (4/3)π(530.24cm^3) = 707.68π cm^3
Then, we will calculate the volume of the outside of the pot:
V_outer = (4/3)π(9.1cm)^3 = (4/3)π(710.29cm^3) = 961.12π cm^3
Finally, we will subtract the volume of the inside of the pot from the volume of the outside of the pot to find the volume of the clay:
V_clay = V_outer - V_inner = 961.12π cm^3 - 707.68π cm^3 = 253.44π cm^3
The capacity of the pot is 253.44π cm^3.
Note: The value of pi is 3.14 or approximately 3.14, you can use this value to calculate the capacity of the pot.
Let sin A = 1/3 where A terminates in Quadrant 1, and let cos B = 2/3, where B terminates in Quadrant 4. Using the identity:
cos(A-B)=cosACosB+sinAsinB
find cos(A-B)
Using trigonometric identity, cos(A-B) is:
\(cos (A-B) = \frac{2\sqrt{8}\ + \sqrt{5}}{9}\)
How to find cos(A-B) using the trigonometric identity?Trigonometry deals with the relationship between the ratios of the sides of a right-angled triangle with its angles.
If sin A = 1/3 and A terminates in Quadrant 1. All trigonometric functions in Quadrant 1 are positive
sin A = 1/3 (sine = opposite/hypotenuse)
adjacent = √(3² - 1²)
= √8 units
cosine = adjacent/hypotenuse. Thus,
\(cos A = \frac{\sqrt{8} }{3}\)
If cos B = 2/3 and B terminates in Quadrant 4.
opposite = √(3² - 2²)
= √5
In Quadrant 4, sine is negative. Thus:
\(sin B = \frac{\sqrt{5} }{3}\)
We have:
cos(A-B) = cosA CosB + sinA sinB
\(cos (A-B) = \frac{\sqrt{8} }{3} * \frac{2}{3} + \left \frac{1}{3} * \frac{\sqrt{5} }{3}\)
\(cos (A-B) = \frac{2\sqrt{8} }{9} + \left\frac{\sqrt{5} }{9}\)
\(cos (A-B) = \frac{2\sqrt{8}\ + \sqrt{5}}{9}\)
Learn more about Trigonometry on:
brainly.com/question/11967894
#SPJ1
Pls halp due today >_<. Thank you!
It is constant because otherwise it wouldn't be proportional
idenify the scale factor length pf room:108 in. length of room on scale drawing:12 in. the scale factor is
Answer:
9Step-by-step explanation:
108 : 12 = 9#Let'sLearn
I need help with this question! Thank you :)
Answer:
hiii
your answer is option d
HOPE IT HELPS YOU OUT PLEASE MARK IT AS BRAINLIEST AND FOLLOW ME PROMISE YOU TO FOLLOW BACK ON BRAINLY.IN
Answer:
y = 7x + 1
Step-by-step explanation:
The equation of a line in slope- intercept form is
y = mx + c ( m is the slope and c the y- intercept )
Here m = 7 and (0, 1 ) ← crosses y- axis ⇒ c = 1
y = 7x + 1 ← equation of line
You deposit $6000 in an account that earns 3% annual interest. Find the balance after 6 years if this interest is
compounded with the given frequency.
Assume that the number of liters of water remaining in the bathtub varies
quadratically with the number of minutes which have elapsed since you
pulled the plug. a. If the tub has 38.4, 21.6, and 9.6 liters remaining at 1, 2, and 3 minutes,
respectively, since you pulled the plug, find a function V(t) expressing the
volume of water t minutes after you pulled the plug.
b. How much water was in the tub when you pulled the plug?
c. When will the tub be empty?d. In the real world, the number of liters of water in the tub can never be
negative. What does the model predict is the least amount of water in the
tub? Is this number reasonable?e. Draw a graph of the function in the appropriate domain. Use a dotted curve
for any portion of the graph that is outside the reasonable domain.f. What is the reasonable domain and range for this model?g. Why is a quadratic function more reasonable for this problem than a linear
function would be?
The function expressing the volume of water t minutes after the plug was pulled is V(t) = -2.4t^2 + 11.2t + 46,b)tub had 46 liters of water when the plug was pulled and will be empty at 2.16 minutes,c) the least amount of water predicted by the model is -52.6667 liters which is not reasonable as the volume of water can't be negative.
What is parabola ?
A parabola is a symmetric, U-shaped geometric shape.
a)V(1) = 38.4 = a(1)^2 + b(1) + c
V(2) = 21.6 = a(2)^2 + b(2) + c
V(3) = 9.6 = a(3)^2 + b(3) + c
Solving the system of equations, we get ,
a = -2.4 , b = 11.2 , c = 46 , V(t) = -2.4t^2 + 11.2t + 46.
b)We can find the initial volume of water in the tub by plugging in t = 0 into the function V(t) = -2.4t^2 + 11.2t + 46. This gives us V(0) = 46 liters, so the tub had 46 liters of water when the plug was pulled.
c)t = (-11.2 +/- sqrt(11.2^2 - 4*(-2.4)46))/(2(-2.4))
t = (11.2 +/- sqrt(124.48 + 552.8))/-4.8
t = (11.2 +/- sqrt(677.28))/-4.8 = (11.2 +/- 26.16)/-4.8 = -14.96 or 2.16
d)V(4.6667) = -2.4*(4.6667)^2 + 11.2*(4.6667) + 46 = -2.4*21.778 + 46.4 + 46 = -52.6667. So the least amount of water the model predict is -52.6667 liters. This number is not reasonable as the volume of water can't be negative.
e) The graph of the function V(t) = -2.4t^2 + 11.2t + 46 is a parabola that opens downward and has its vertex at (4.6667, -52.6667). Any portion of the graph for t < 0 or t > 2.
The function expressing the volume of water t minutes after the plug was pulled is V(t) = -2.4t^2 + 11.2t + 46,b)tub had 46 liters of water when the plug was pulled and will be empty at 2.16 minutes,c) the least amount of water predicted by the model is -52.6667 liters which is not reasonable as the volume of water can't be negative.
To learn more about parabola visit : brainly.com/question/21685473
#SPJ4
3.
The area of a rectangular face of a piece of wood is 6m². The length of the wood
is 4 m. What is its width?
Step-by-step explanation:
We can use the formula for the area of a rectangle, which is:
Area = length x width
In this case, we know that the area of the rectangle is 6 m² and the length is 4 m. So we can substitute these values into the formula and solve for the width:
6 m² = 4 m x width
Dividing both sides by 4 m, we get:
width = 6 m² / 4 m
Simplifying, we get:
width = 1.5 m
Therefore, the width of the piece of wood is 1.5 m.
Answer:
1.5m
Step-by-step explanation:
A=LxW
6=4xW
6=4W
6/4=W
1.5=W
#6 Find x to show that Quadrilateral ABCD is a parallelogram.
Answer:
x = 5
Step-by-step explanation:
Diagonals of a parallelogram bisect each other. Based on this knowledge, to show that the quadrilateral is a parallelogram, therefore:
3x - 4 = x + 6
Solve for x
Collect like terms
3x - x = 4 + 6
2x = 10
Divide both sides by 2
x = 5
algebraic expression pretty easy i just forgot sum steps...so yea
Answer: 6 + 4/x
Step-by-step explanation:
Since a quotient is division, the algebraic expression is basically saying that you divide 4 with a number (or variable) and add 6 more to it.
6 + 4/x
Therefore, the way to rephrase "6 more than the quotient of 4 and a number' would be 6 + 4/x. I understand sometimes it's very easy to forget the basic things, for example, in my class :). Hope this helps!
-From A 5th Grade Honors Student who loves Algebra!
At Michael’s school, 38% of the students have a pet dog and 24% of the students have a pet cat. Michael found that 11% of the students had both a pet dog and a pet cat. What is the probability that a randomly chosen student at Michael’s school will have a pet dog or a pet cat? A. 51% B. 62% C. 83% D. 40%
Answer:
62%
Step-by-step explanation:
Its addition, 38+24=62
30+20+12=62 to make thing simpler.
[ 7 11] [12 4 5 ]
Find C =AB, if A = [2 9] B = [3 6 1]
[ 10 6]
The exercise involves finding the product C = AB, where matrix A is given by [2 9] and matrix B is given by [3 6 1]. We need to perform the matrix multiplication to obtain the resulting matrix C.
Let's calculate the matrix product C = AB step by step:
Matrix A has dimensions 2x1, and matrix B has dimensions 1x3. To perform the multiplication, the number of columns in A must match the number of rows in B.
In this case, both matrices satisfy this condition, so the product C = AB is defined.
Calculating AB:
AB = [23 + 912 26 + 94 21 + 95]
[103 + 612 106 + 64 101 + 65]
Simplifying the calculations:
AB = [6 + 108 12 + 36 2 + 45]
[30 + 72 60 + 24 10 + 30]
AB = [114 48 47]
[102 84 40]
Therefore, the product C = AB is:
C = [114 48 47]
[102 84 40]
In summary, the matrix product C = AB, where A = [2 9] and B = [3 6 1], is given by:
C = [114 48 47]
[102 84 40]
To learn more about matrix visit:
brainly.com/question/29239316
#SPJ11
Consider an activity with these estimates for optimistic, most likely, and pessimistic time: 11, 21, 35 . Find the mean value of the activity time. (Please provide answer accurate to two decimal place
the main answer is that the mean value of the activity time is 21.67. This is calculated using the formula (optimistic + 4 * most likely + pessimistic) / 6.
To find the mean value of the activity time, we can use the three estimates provided: optimistic, most likely, and pessimistic time.
1. The optimistic time is the shortest possible time for completing the activity, which is 11 units.
2. The most likely time is the time that is most likely to be taken to complete the activity, which is 21 units.
3. The pessimistic time is the longest possible time for completing the activity, which is 35 units.
To calculate the mean value, we can use the following formula:
Mean value = (optimistic + 4 * most likely + pessimistic) / 6
Substituting the given values, we get:
Mean value = (11 + 4 * 21 + 35) / 6
Calculating the numerator first:
11 + 4 * 21 + 35 = 11 + 84 + 35 = 130
Now, we can calculate the mean value:
Mean value = 130 / 6
Dividing 130 by 6, we get:
Mean value = 21.67 (rounded to two decimal places)
Therefore, the mean value of the activity time is 21.67.
the main answer is that the mean value of the activity time is 21.67. This is calculated using the formula (optimistic + 4 * most likely + pessimistic) / 6.
To know more about numerator visit ;
https://brainly.com/question/32564818
#SPJ11
How do you know if HL is congruent?
To determine if two triangles are congruent, the following conditions must be met:
All corresponding pairs of vertical angles are equal.All corresponding pairs of alternate interior angles are equal.All corresponding pairs of alternate exterior angles are equal.All corresponding pairs of consecutive interior angles are supplementary.Determining Congruence of Triangle HLTo determine if triangle HL is congruent, you must first compare the lengths of each side. If the lengths of each side are equal, then the triangles are similar. Next, you must compare the angles of each triangle. If the angles of each triangle are equal, then the triangles are congruent. Finally, you must compare the pairs of vertical angles, alternate interior angles, alternate exterior angles, and consecutive interior angles. If all of these pairs are equal or supplementary, then the triangles are congruent. If all three conditions are met, then it can be concluded that triangle HL is congruent.
Learn more about Triangles: brainly.com/question/25215131
#SPJ4
A city that has an elevation of 15 meters is closer to sea level than a city that has an elevation of -10 meters. True or false
Show that for Poiseuille flow in a tube of radius R the magnitude of the wall shearing stress, T_r_1, can be obtained from the relationship |(T_r2)_wall| = 4 mu Q/pi R^3 for a Newtonian fluid of viscosity mu. The volume rate of flow is Q. (b) Determine the magnitude of the wall shearing stress for a fluid having a viscosity of 0.004 N middot s/m^2 flowing with an average velocity of 130 mm/s in a 2-mm-diameter tube.
For Poiseuille flow in a tube of radius R, the magnitude of the wall shearing stress can be obtained using the relationship
|(T_r2)_wall| = 4μQ/πR³
where μ is the viscosity of the fluid and Q is the volume rate of flow.
To determine the magnitude of the wall shearing stress for a fluid with a viscosity of 0.004 N·s/m² flowing at an average velocity of 130 mm/s in a 2-mm-diameter tube, we can substitute the given values into the equation.
In Poiseuille flow, the wall shearing stress can be calculated using the equation |(T_r2)_wall| = 4μQ/πR³. Here, μ represents the viscosity of the fluid and Q is the volume rate of flow.
To determine the magnitude of the wall shearing stress for a fluid with a viscosity of 0.004 N·s/m² flowing at an average velocity of 130 mm/s in a 2-mm-diameter tube, we need to convert the given values to the appropriate units.
First, convert the diameter of the tube to radius by dividing it by 2: R = 2 mm / 2 = 1 mm = 0.001 m.
Next, convert the average velocity to volume rate of flow using the equation Q = A·v, where A is the cross-sectional area of the tube and v is the velocity.
The cross-sectional area of a tube with radius R is A = πR². Substituting the values, we have Q = π(0.001 m)² · 130 mm/s = π(0.001 m)² · 0.13 m/s.
Now, we can substitute the viscosity and volume rate of flow into the equation for wall shearing stress: |(T_r2)_wall| = 4(0.004 N·s/m²) · π(0.001 m)² · 0.13 m/s / π(0.001 m)³ = 4(0.004 N·s/m²) · 0.13 m/s / (0.001 m)³ = 0.052 N/m².
Therefore, the magnitude of the wall shearing stress for a fluid with a viscosity of 0.004 N·s/m² flowing at an average velocity of 130 mm/s in a 2-mm-diameter tube is 0.052 N/m².
To learn more about Poiseuille flow visit:
brainly.com/question/30970200
#SPJ11
The weights of 6-week-old poults (juvenile turkeys) are normally distributed with a mean 9.0 pounds and standard deviation 2.4 pounds. A turkey farmer wants to provide a money-back guarantee that her 6-week poults will weigh at least a certain amount. What weight should she guarantee so that she will have to give her customer's money back only 1% of the time
The turkey farmer should guarantee a weight of approximately 4.57 pounds to have to give her customers' money back only 1% of the time.
To determine the weight that the turkey farmer should guarantee, we need to find the value that corresponds to the 1st percentile of the weight distribution. This value represents the weight below which only 1% of the poults' weights would fall.
To find the 1st percentile, we can use the z-score formula: z = (x - μ) / σ, where x is the value, μ is the mean, and σ is the standard deviation. We want to find the value of x that corresponds to a z-score of -2.33, which corresponds to the 1st percentile in a standard normal distribution.
Rearranging the formula, we have x = z * σ + μ. Plugging in the values, we get x = -2.33 * 2.4 + 9.0 ≈ 4.57 pounds.
Therefore, the turkey farmer should guarantee a weight of approximately 4.57 pounds to have to give her customers' money back only 1% of the time. This ensures that the majority of the poults' weights will exceed the guaranteed weight, satisfying the money-back guarantee condition.
Learn more about approximately here
https://brainly.com/question/29669607
#SPJ11
answers for both boxes please
Step-by-step explanation:
4x + y = 6 => 8x + 2y = 12.
8x + 2y = 12
+ (-5x - 2y = -3)
=> 3x = 9, x = 3.
Therefore 4(3) + y = 6, 12 + y = 6, y = -6.
The solutions are x = 3 and y = -6.
1) A 6.7 ft by 6.8 ft by 4 ft aquarium holds 16 fish. Based on the population density of this aquarium, how
many fish can an aquarium in the shape of a cylinder with height of 4 ft and diameter of 3.2 ft hold?
the cylinder-shaped aquarium can hold approximately 2.78 fish.by calculating the volume of the original aquarium. Since it is a rectangular prism we can solve this .
what is approximately ?
Approximately means close to, but not exactly equal to, a certain value. It is often used when giving an estimate or an approximation of a value, especially when the exact value is not known or is difficult to calculate
In the given question,
First, we need to calculate the volume of the original aquarium. Since it is a rectangular prism, we use the formula V = lwh, where l is length, w is width, and h is height:
V = 6.7 ft * 6.8 ft * 4 ft = 183.424 cubic feet
Next, we can use the formula for the volume of a cylinder, V = πr²h, where r is the radius and h is the height. We know the height is 4 ft, and the diameter is 3.2 ft, so the radius is half of that, or 1.6 ft:
V = π(1.6 ft)² * 4 ft = 32.0768 cubic feet
To find out how many fish the cylinder can hold, we can set up a proportion using the population density of the original aquarium (16 fish / 183.424 cubic feet) and the volume of the cylinder we just calculated:
16 fish / 183.424 cubic feet = x fish / 32.0768 cubic feet
Cross-multiplying and solving for x, we get:
x = (16 fish / 183.424 cubic feet) * 32.0768 cubic feet
x ≈ 2.78 fish
Therefore, the cylinder-shaped aquarium can hold approximately 2.78 fish.
To know more about approximately , visit:
https://brainly.com/question/30945002
#SPJ1
The world's largest pizza, upon its completion, "measured 122 feet, 8 inches in diameter, weighed 26,883 pounds, and contained 9,920 pounds of flour, 3,960 pounds of cheese, 1 763 pounds of mushrooms, 1,984 pounds of tomato puree, and 1,984 pounds of chopped tomatoes." Clearly, this was a massive undertaking. A few questions:
-Identify which type of manufacturing process this was. What considerations, from a planning standpoint, do you think were made? How might the process change if you were planning the manufacturing process for a pizza available at pie craft? What about a pizza that you can buy in the frozen section of the supermarket? What are the elements [of the manufacturing process] that change as we transition from the world's largest pizza, to a completely standardized frozen one?
The type of manufacturing process used to create the world's largest pizza can be classified as batch processing. Considerations such as ingredient sourcing, logistics, equipment capacity, and coordination among multiple teams were likely made during the planning stage. The process would change when planning the manufacturing process for a pizza available at Pie Craft or a pizza in the frozen section of a supermarket, with a shift towards more standardized and automated production methods.
World's Largest Pizza:
The manufacturing process for the world's largest pizza was a massive undertaking due to its size and quantity of ingredients. It involved batch processing, where a specific quantity of the product was produced at one time. During the planning stage, considerations were made regarding ingredient sourcing, logistics, equipment capacity, and coordination among multiple teams.
Pizza at Pie Craft:
If planning the manufacturing process for a pizza available at Pie Craft, a more standardized and streamlined approach would be adopted. The emphasis would be on consistency and quality. This would involve creating standardized recipes, portion control, and training staff to follow specific procedures. Some manual steps might still be involved, but automation could be introduced to streamline processes such as dough mixing and ingredient assembly.
Frozen Supermarket Pizza:
For a pizza in the frozen section of a supermarket, the manufacturing process would undergo significant changes. It would be highly automated and designed for mass production. The emphasis would be on consistency, convenience, and shelf life. The dough would be mechanically mixed, shaped, and portioned, while ingredients would be applied using automated systems. Packaging and freezing processes would also be optimized to maintain product quality.
In summary, the manufacturing process for the world's largest pizza was a massive undertaking, involving batch processing and careful planning regarding ingredient sourcing, logistics, and equipment capacity. For a pizza at Pie Craft, a more standardized approach would be adopted with a balance of manual and automated processes. In contrast, a frozen supermarket pizza would undergo a highly automated process to achieve consistency, convenience, and extended shelf life.
Learn more about Manufacturing.
brainly.com/question/32717570
#SPJ11
A hypothesis regarding the weight of newborn infants at a community hospital is that the mean is 19. 1 pounds. A sample of seven infants is randomly selected and their weights at birth are recorded as 18. 1, 21. 1, 22. 1, 23. 1, 21. 1, 27. 1, and 27. 1 pounds. If α = 0. 200, what is the critical value? The population standard deviation is unknown
Since the population standard deviation is unknown, we use a t-distribution to find the critical value. The degrees of freedom for the t-distribution is n-1, where n is the sample size. In this case, n = 7, so the degrees of freedom is 7-1 = 6. The critical value for a t-distribution with 6 degrees of freedom and a significance level of α = 0.200 (two-tailed) can be found using a t-table or calculator. The critical value is approximately ±1.94.
Identify the independent variable and dependent variable in the situation:
Dollars earned, d, and the number of hours spent babysitting, h.
Independent variable
[Choose ]
Dependent variable
[Choose]
the data collected from the customers in restaurants about the quality of food is an example of a(n)... select one: variable study. cross-sectional study. experimental study. observational study.
The data collected from the customers in restaurants about the quality of food is an example of a(n); Observational Study
What type of statistical study is used?There are four types of statistical studies namely;
Observational studies
Surveys
Experiments
Meta-analytical studies.
1) An observational study involves observing and recording data on some variable(s) of interest.
2) A (sample) survey uses questioning to gather data.
3) An experiment also referred to as experimental study attempts to give an answer to a statistical question by manipulating all or part of the sample.
Now, we are told that some data was collected from the customers in restaurants about the quality of food.
This is a type of observational study because it involves observing and recording data on an interest which is quality of food
Read more about statistical study at; https://brainly.com/question/17149873
#SPJ1
I need help. What does n equal.
\(5n^{2}=7n-2\)
Answer:
\(\boxed{\sf n= \dfrac{2}{5} ,\: n=1}\)
Step-by-step explanation:
\(\rightarrow 5n^2 = 7n -2\)
\(\rightarrow 5n^2 - 7n +2=0\)
\(\rightarrow 5n^2 - 5n -2n+2=0\)
\(\rightarrow 5n(n - 1) -2(n-1)=0\)
\(\rightarrow (5n-2)(n-1)=0\)
\(\rightarrow 5n-2= 0,\: n-1=0\)
\(\rightarrow 5n= 2,\: n=1\)
\(\rightarrow n= \dfrac{2}{5} ,\: n=1\)
Step-by-step explanation:
\(\hookrightarrow\sf{5n^2 = 7n -2}\\\\\hookrightarrow\sf{5n^2 - 7n +2=0}\\\\\hookrightarrow\sf{5n^2 - (5+2)n +2=0}\\\\\hookrightarrow\sf{5n^2 - 5n -2n+2=0}\\\\\hookrightarrow\sf{ 5n(n - 1) -2(n-1)=0}\\\\\hookrightarrow\sf{ (5n-2)(n-1)=0}\\\\\hookrightarrow\sf{ 5n-2= 0\:or~ n-1=0}\\\\\hookrightarrow\sf{ 5n= 2\:or~n=1}\\\\\hookrightarrow\bold{ n= \dfrac{2}{5} \:or~ n=1}\)
please help im not good with trig
Jason and his 3 brothers want to buy a gift for their mother. They have $314 saved. Each of them will save $17 a week until they have at least $515 for her gift. How much money will they save after 3 weeks? Will they have enough money to buy the gift?
A. What are the hidden questions?
B. Write an equation that can be used to answer each hidden question. Then solve.
C. Write and solve an equation to find how much money they will save after 3 weeks. Will they have enough to buy the gift? Explain
if u show points I give u 200 points
The equation to find how much money they will save after 3 weeks is y = 68x, and they will save $518, so yes they have enough money to buy the gift.
What is equation?An assertion that two mathematical expressions have equal values is known as an equation. An equation simply states that two things are equal. The equal to sign, or "=," is used to indicate it.
Given:
Total money Jason and his 3 brothers have = $314,
Each of them will save $17 a week until they have at least $515,
At the end of three weeks, the money saved by Jason and his brothers,
Money saved = 17 × number of person × number of weeks
Assume the number of weeks is x and the money saved is y then,
y = 17x × 4
y = 68x
Money saved, y = 68 × 3
Money saved = $204
Total money after the end of three weeks = $314 + $204
Total money after the end of three weeks = $518
To know more about equation:
https://brainly.com/question/12788590
#SPJ1
8. Mrs. Jackson, an English teacher, gives pop quizzes to her students every marking period. This is an example of: * 0/1 A. Variable interval schedule of reinforcement B. Variable ratio schedule of reinforcement C. Fixed ratio schedule of reinforcement D. Fixed interval schedule of reinforcement E. Interval ratio schedule of reinforcement
An English teacher, gives pop quizzes to her students every marking period. (D. Fixed interval schedule of reinforcement.)
The other options listed are not applicable in this scenario:
A. Variable interval schedule of reinforcement: This schedule involves providing reinforcement after varying time intervals. Mrs. Jackson's quizzes occur at fixed intervals, not varying intervals.
B. Variable ratio schedule of reinforcement: This schedule involves providing reinforcement after a varying number of responses. The pop quizzes are not contingent on the number of responses from the students.
C. Fixed ratio schedule of reinforcement: This schedule involves providing reinforcement after a fixed number of responses. The pop quizzes are not contingent on the number of responses from the students.
D. Fixed interval schedule of reinforcement :fixed interval schedule of reinforcement involves providing reinforcement at a fixed time interval. Mrs. Jackson gives the pop quizzes every marking period, which is a predetermined fixed interval of time. This schedule of reinforcement is characterized by a steady rate of response from the students, with an increase in responding closer to the time when the reinforcement is expected.
E. Interval ratio schedule of reinforcement: This is not a recognized schedule of reinforcement. The correct term would be fixed interval or variable interval schedule of reinforcement.
To know more about quizzes here
https://brainly.com/question/29969202
#SPJ4
On to the assignment:
1. Compute the mathematical quantity ei. [Hint: The imaginary number i can be created using 5 the expression (0+1i) in R.] 2. > exp(pi+li) 3. [1] 12.50297+19.47222is
1cos(l) = 12.50297 and-sin(l) = 19.47222i.
1. The mathematical quantity ei can be computed using the expression ei = cosθ + i sinθ where θ is the argument of the complex number ei.
Since e is a real number, it follows that the argument of ei is purely imaginary, i.e. θ = ki where k is a real number and i is the imaginary unit, i.e. i2 = -1.
Therefore,
ei = cos(ki) + i sin(ki)
= (eik + e-ik)/2 + (eik - e-ik)/(2i)2.
The expression exp(pi + li) can be simplified using Euler's formula:eiθ = cosθ + i sinθ,where e is Euler's number, i is the imaginary unit and θ is an angle in radians.
The formula states that the exponential function of a purely imaginary number is equal to the sine and cosine of that number multiplied by the imaginary unit i.
Thus,
exp(pi + li) = exp(pi) exp(li)
= -1 exp(li)
= -1(cos(l) + i sin(l)).
Now we have: exp(pi+li) = -1cos(l) - i sin(l)3.
Therefore, the answer to the question is [1] 12.50297+19.47222i, since:-1cos(l) = 12.50297 and-sin(l) = 19.47222i.
Learn more about cos from the given link
https://brainly.com/question/24305408
#SPJ11
Solve each equation. Be sure to check for extraneous solution -7= |a-3|/-2
Answer:
a = -11, 17.
Step-by-step explanation:
-7 = |a-3| / -2
Multiply both sides by -2:
|a - 3| = 14
So a - 3 = 14
Giving a = 17
or
a - 3 =- -14
giving a = -11.
Checking these values:
-7 = |17-3| / -2 = 14/-2 = -7
- so a = 17 is a solution.
-7 = |-11-3| / -2 = 14/-2 = -7
so a = -11 is also a solution.