Answer:
D) increasing land area on islands
Explanation:
Because one of the results of the global warming is rising sea level so it will not increase the land area on island.
Cells grouped together to make a specific part of the body of a plant or animal are called:
A. an organism
B. photosynthesis
C. a tissue
Wavelength measures the length of an
individual color
individual sound
individual wave
all radiation on earth
Answer: individual wave
Hope this helps! :)
A basic solution contains an excess of H^+ ions.
O True
O False
Answer:
true
Explanation:
Yes basic solutions also have H+ ions.
Thermal Energy moves from a colder region to a warmer region. *
True
False
False.
There is more thermal energy (faster moving particles) in a warmer region, so they spread out over time, warming up the other regions and losing energy.
Please mark as Brainliest.
How many jouls are required to boiling 21.1 g of water at 100 c
Answer:
The needed heat is 47,65 Joules.
The number of Joules of heat is required to change the 21.1g of liquid water into steam at 100°C is 47686 Joules.
What is the latent heat of vaporization?The latent heat of vaporization is defined as the amount of heat needed at a constant temperature for the conversion of a liquid at its boiling point to gas. The latent heat of vaporization is different for different liquids.
The particles of water vapor at 100°C have more energy than that of liquid water. Because the extra energy is in the form of latent heat of vaporization. The word “latent” from the Latin word “latere" means to cover up or hide.
Given, the amount of water, m= 21.1 g
We know that, the heat of vapourization of water = \(2260 J/g\)
The latent heat of vaporization (q) is calculated as:
q = mH
q = (21.1 g) × (2260J/g)
q = 47686 J
Therefore, the 47686 Joules are required to boil 21.1 g of water at a temperature of 100°C.
Learn more about latent heat of vaporization, here:
https://brainly.com/question/5401454
#SPJ5
How many grams of NaOH are present in a 1.3 mole sample?
52 grams
Explanations:Given the following parameters from the question:
Moles of NaOH = 1.3 moles
The formula for calculating the mass of a compound is expressed as;'
\(Mass\text{ of NaOH}=mole\times molar\text{ mass}\)Determine the molar mass of NaOH
\(\begin{gathered} molar\text{ mass }of\text{ NaOH}=23+16+1 \\ molar\text{ mass of NaOH}=40g\text{/mol} \end{gathered}\)Determine the mass of NaOH
\(\begin{gathered} Mass=moles\times molar\text{ mass} \\ Mass=1.3moles\times40\frac{g}{mol} \\ Mass=52grams \end{gathered}\)Hence the mass of NaOH present in a 1.3moles of the sample is 52 grams
Use this information to calculate AGxn-
2C₂H₂(g) +50₂(g) →4CO₂(g) + 2H₂O(g)
AGCH₂=209.2 kJ/mol
AGE.co=-394.4 kJ/mol
AGHO-228.57 kJ/mol
AG
=
DONE
2,453.1
-1,616.7
-2,453.1
kJ
-1,616.7 kJ/mol
2C₂H₂(g) +50₂(g) →4CO₂(g) + 2H₂O(g)
AGC₂H₂=209.2 kJ/mol
AGE.co2=-394.4 kJ/mol
AG H2O-228.57 kJ/mol
AG 5O2 = ?
Now From the above given equation , we have got the enthalpy of no. of moles in reaction
4 moles of CO₂ contains = 4 -394.4 kJ/mol = -1577.6
2 moles of H₂O contains = 2 -228.57 kJ/mol = - 457
2 moles of C₂H₂ contains = 2 209.2 kJ/mol = +418.4
now putting all the values in equation
50₂(g) = 4CO₂(g) + 2H₂O(g) - 2C₂H₂(g)
50₂(g) = -1577.6-457-418
50₂(g) = -1,616.7 kJ/mol
The amount of heat that a system releases or absorbs during a chemical reaction is known as the enthalpy change. The symbol for it is HEnthalpy is measured in the same SI unit as energy, the joule. At constant pressure, the expression known as "enthalpy change" is computed or determined. It is impossible to measure a system's absolute enthalpy. As a result, the enthalpy change is measured. In endothermic processes, the change in enthalpy is positive, while in exothermic reactions, it is negative.To know more about Enthalpy visit : https://brainly.com/question/13775366
#SPJ9
Read the chemical equation shown.
2Ag + H2S → Ag2S + H2
Which statement is true about this chemical equation?
Ag (silver) is oxidized and H (hydrogen) is reduced.
Ag (silver) is reduced and H (hydrogen) is oxidized.
S (sulfur) is reduced and H (hydrogen) is oxidized.
S (sulfur) is oxidized and Ag (silver) is reduced.
Answer:
ag (silver) is oxidized and H(hydrogen ) is reduced
The oxidation state of an element is calculated by subtracting and the total sum of oxidation states of all the individual atom (excluding the one that has to be calculated) from total charge on the molecule. The correct option is option B that is Ag (silver) is reduced and H (hydrogen) is oxidized.
What is oxidation state?Oxidation state of an element is a number that is assigned to an element in a molecule that represents the number of electron gained or lost during the formation of that molecule or compound.
The balanced equation is given as
2Ag + H\(_2\)S → Ag\(_2\)S + H\(_2\)
The oxidation state of Ag (silver) on reactant side is O. The oxidation state of Ag in Ag\(_2\)S is -1. So, oxidation is reduced that is Ag (silver) is reduced.
The oxidation state of H (hydrogen) on reactant side in H\(_2\)S is -1. The oxidation state of H (hydrogen) in H\(_2\) is 0. So, oxidation is decreased that is H (hydrogen) is oxidized.
Therefore, the correct option is option B that is Ag (silver) is reduced and H (hydrogen) is oxidized.
To learn more about Oxidation state, here:
https://brainly.com/question/11313964
#SPJ2
Solve the equation by first using the Quadratic Formula and then by factoring.
x2 – 14x + 48 = 0
The new hybrid car can get 51.5 km/gal. It has a top speed of 40000.00 cm/min and is 4m long. How fast can the car go in m/hr?
Answer:
The anawer of this question is 0.024 m/h
Explanation:
Other explanations of the question are additional.
Benny wonders why when he presses his finger against a map nothing
happens to the map. However, if he presses a thumbtack into the map using
the same force, the tack will probably poke a hole in the map. This is what his friends said was the reason:
Heather: I think it’s because the tack is made of metal.
Steve: I think it’s because your finger has more surface area.
Ashia: I think it’s because your finger is warm.
With whom do you agree most?
Explain
The pressure exerted on a surface by an object increases as the surface area of contact decreases.
Explanation:
Pressure measures the amount of force exerted per a given area of an object. From this definition, the surface area of the object and force applied, affects the pressure applied.
As Benny presses his finger against a map, nothing happens to the map because the force applied is affected by the increased surface area of his finger. However as he presses a thumbtack into the map using the same force the tack will probably poke a hole in the map because the small( decreased) surface area of the sharp point of the thumbtack produces a much larger pressure on the map than the area of Benny finger. I hope this helps, thanks!
What is the noble gas arrangements
The noble gases are the most stable elements in nature. They rarely react with other elements since they are already stable. Why? Because they have 8 electrons in their outer shell (except from Helium that has 2), They have the maximum amount of valence electrons that their outer shell can hold.
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Which Sphere does condensation occur.
Answer:
The atmosphere, I believe.
Explanation:
select the two statements that are true about the atom and quantum chemistry. select the two statements that are true about the atom and quantum chemistry. the pauli exclusion principle requires that only two electrons occupy a given orbitals with opposite spins. electrons have wave properties atoms emit em radiation only at discrete, well-defined frequencies infrared radiation corresponds to higher energy than visible wavelengths.
Only two electrons must occupy an orbital with opposite spins in order for the Pauli exclusion principle to hold true. Atoms only produce discrete EM radiation, but electrons have wave characteristics.
According to the Pauli exclusion principle of quantum physics, fermions—two or more identical half-integer spin particles—cannot all be present in a quantum system's quantum system at the same time and wave characteristics. Austrian physicist Wolfgang Pauli first proposed this idea for electrons in 1925, and with the help of his spin-statistics theorem from 1940, he expanded it to include all fermions.
It can be said that in the case of electrons in atoms, two electrons of a poly-electron atom cannot have the same values of the four quantum numbers: n, the main quantum number; l, the azimuthal quantum number; ml, the magnetic quantum number; and ms, the spin quantum number.
Learn more about Characteristics here:
https://brainly.com/question/3454051
#SPJ4
Which type of element Is not likely to react chemically with other elements to form a compound?
Answer:noble gases
Explanation:
I need help I don’t understand this is hitting
Reagents that are entirely consumed by a chemical reaction are known as limiting reagents.
Thus, They are additionally known as limiting reactants or limiting agents. A predetermined quantity of reactants are necessary for the reaction to be completed, according to the stoichiometry of chemical reactions.
In the aforementioned reaction, 2 moles of ammonia are created when 3 moles of hydrogen gas react with 1 mole of nitrogen gas.
In most cases, this reactant dictates when the reaction will end. The reaction stoichiometry can be used to determine the precise quantity of reactant that will be required to react with another element. The limiting agent is determined by the mole ratio rather than the mass of the reactants.
Thus, Reagents that are entirely consumed by a chemical reaction are known as limiting reagents.
Learn more about Chemical reaction, refer to the link:
https://brainly.com/question/22817140
#SPJ1
Select the correct electron configuration for Vanadium. (Atomic Number 23)
1s 22s 22p 63s 23p 84s 23d 1
1s 22s 62p 33s 23p 44s 23d 5
1s 22s 22p 63s 23p 64s 23d 3
1s 22s 22p 53s 23p 74s 13d 4
Explanation:
Vanadium is in Period 4 and in the d-block of elements. The highest energy subshell is 4s. (because as electrons fill the 3d subshell, the subshell becomes of lower energy than 4s)
We have 1s²2s²2p⁶3s²3p⁶3d³4s².
Answer:
Vanadium (V) --- d-block element
Location on the periodic table :
4th Period5th GroupAtomic number=23
Atomic mass=51 g/mol
The correct electron configuration for Vanadium is:
V= [Ar]4s²3d³ = 1s² 2s² 2p⁶ 3s² 3p⁶ 4s² 3d³
3. 1s² 2s² 2p⁶ 3s² 3p⁶ 4s² 3d³ is the right answer.
Use Hess’s Law to calculate the enthalpy change for the reaction.
C2H4(g) + H2(g) → C2H6(g) ∆Hrxn = ?
Given:
C2H4(g) + 3O2(g) → 2CO2(g) + 2H2O(l) ∆Hrxn 1 = -1410.9kJ
2C2H6(g) + 7O2(g) → 4CO2(g) + 6H2O(l) ∆Hrxn 2 = -3119.4kJ
2H2(g) + O2(g) → 2H2O(l) ∆Hrxn 3 = -571.6kJ
Answer:
∆Hrxn 1 + ∆Hrxn 3 - ∆Hrxn 2 = ?
-1410.9kJ - 571.6kJ + 3119.4kJ = ?
-2801.1kJ
Bases increase the concentration of hydronium ions by donating hydroxide ions to water molecules.
A. True
B. False
Answer: False
Explanation: the answer is false
It is false that Bases increase the concentration of hydronium ions by donating hydroxide ions to water molecules.
What are bases?Bases are substances that are sour in taste, slippery to torch and when it react with acid form salt and water, then turn blue lithmys paper to red. Bases is the degree of hydroxide ion in a solution.
Therefore, It is false that Bases increase the concentration of hydronium ions by donating hydroxide ions to water molecules.
Learn more about base below.
https://brainly.com/question/22514615
#SPJ2
Question 1-3
A balloon with a volume of 2.50 L is left in a car at 323K. After sitting in the sun, the temperature increases to 398K. What is the volume
of the heated balloon?
Answer:
\( \huge{\boxed{3.08 \: L}} \)
Explanation:
The volume of the heated balloon can be found by using the Charles' law formula which is;
\( \bold{\frac{V_1}{T_1} = \frac{V_2}{T_2}} \\ \)
where
T1 is the initial temperature
T2 is the final temperature
V1 is the initial volume
V2 is the final volume
From the question
T1 = 323K
T2 = 398K
V1 = 2.5 L V2 = ?
\( V_2 = \frac{V_1 \times T_2}{T_1} \\ \)
\( V_2 = \frac{2.5 \times 398}{323} = \frac{995}{323} \\ = 3.0804 \)
We have the final answer as
3.08 Lthe solubility of PbSO4 is 0.048g/Liter. what is the Ksp of PbSO4? (MMPbSO4 = 303.3)
Answer:
Ksp of PbSO4 is 2.5 *10^-8
Explanation:
Given -
Solubility of PbSO4 = 0.048g/Liter
[Pb+2] * [SO42-] = mass/molecular weight of PbSO4
[Pb+2] * [SO42-] = 0.048g/Liter/303.3g/mol = 0.000158 M
Concentration of PbSO4 = moles/volume = 0.000158 M/1L = 0.000158 M
Ksp = [Pb+2] * [SO42-]
ksp = 0.000158 * 0.000158 = 2.5 *10^-8
a gas has an initial volume of 3,480 mL and an initial temperature of - 70.0 C. what must be the temperature of the gas in kelvin if its volume is reduced to 2,450 mL
The temperature of the gas in Kelvin, after its volume is reduced to 2,450 mL, is approximately 143.27 K.
To determine the temperature of the gas in Kelvin after its volume is reduced, we can use the combined gas law, which relates the initial and final conditions of pressure, volume, and temperature for a given amount of gas.
The combined gas law equation is:
(P₁ * V₁) / T₁ = (P₂ * V₂) / T₂
Where P₁ and P₂ are the initial and final pressures, V₁ and V₂ are the initial and final volumes, T₁ is the initial temperature in Kelvin, and T₂ is the final temperature in Kelvin.
Given that the initial volume V₁ is 3,480 mL, the initial temperature T₁ is -70.0 °C (which needs to be converted to Kelvin), and the final volume V₂ is 2,450 mL, we can substitute these values into the equation.
To convert -70.0 °C to Kelvin, we add 273.15 to it, resulting in T₁ = 203.15 K.
Now we can solve for T₂:
(T₂ * V₁) / T₁ = V₂
T₂ = (V₂ * T₁) / V₁ = (2,450 mL * 203.15 K) / 3,480 mL
Simplifying the equation, we find:
T₂ ≈ 143.27 K
Therefore, the temperature of the gas in Kelvin, after its volume is reduced to 2,450 mL, is approximately 143.27 K.
For more question on temperature
https://brainly.com/question/4735135
#SPJ8
Why is the first one (A) correct?
Answer: yes it is correct
Explanation: the higher it is the cooler.
Identify the order in which sound travels through the ear
Answer:
Sound waves enter the outer ear and travel through a narrow passageway called the ear canal, which leads to the eardrum. The eardrum vibrates from the incoming sound waves and sends these vibrations to three tiny bones in the middle ear. These bones are called the malleus, incus, and stapes.
Explanation:
i don't know what are you talking about^_^
In which food or drink are the particles most likely moving the fastest? Answers they gave to us: popsicle, cheese, a drink, Coffee. Please help me please i will give you a 5 star.
Answer:
Coffee
Explanation: When a liquid is warm the particles move faster
molar mass of rhodonite mnsio3
The molar mass of rhodonite MnSiO₃ is 131.0 g.
What is the molar mass of a substance?The molar mass of a substance is the mass of 1 mole of that substance.
The molar mass of a compound is obtained from the sum of the product of the number of moles of atoms and the molar masses of the elements in the compound.
The molar mass of rhodonite MnSiO₃ is calculated as follows:
Molar mass of Mn = 55 g
Molar mass of Si = 28 g
Molar mass of O = 16.0 g
Molar mass of MnSiO₃ = 55 + 28 + 16 * 3
Molar mass of MnSiO₃ = 131.0 g
Learn more about molar mass at: https://brainly.com/question/837939
#SPJ1
Use your data, the equation to the right, and the specific heat of water (4.184 J/g C) to compute the specific heat values of each metal. Use a calculator and round to the nearest hundredth place.
The heat capacity for the metals are;
Aluminum - 0.89
Copper - 0.11
Iron - 0.44
Lead - 0.12
What is the specific heat?The specific heat of a substance is denoted by the symbol "C" and is typically measured in units of J/g·°C (joules per gram per degree Celsius) or cal/g·°C (calories per gram per degree Celsius).
The specific h
We have that;
For Aluminum;
c = 4.184 * 39.85 * 4.7/11.98 * 72.9
= 783.6/873.3
= 0.89
For Copper;
c = 4.184 * 12.14 * 1.9/12.14 * 75.4
= 96.5/915.3
= 0.11
For Iron
c = 4.184 * 40.24 * 2.4/12.31 * 75.1
= 404.1/924.5
= 0.44
For Lead
c = 4.184 * 39.65 * 0.7/12.46 * 76.7
c = 116.1/955.68
= 0.12
Learn more about specific heat:https://brainly.com/question/31608647
#SPJ1
A 8952 g of water was completely melted. Calculate the amount of heat absorbed in this
process.
To melt 8952 g of water, 2.986 × 10⁶ J of heat are required.
What is the heat of fusion?The heat of fusion is the heat absorbed by a unit mass of a given solid at its melting point that completely converts the solid to a liquid at the same temperature.
8952 g of water melt, that is, they undergo fusion.
We can calculate the amount of heat absorbed in this process using the following expression.
Q = ΔH°f × m = 333.55 J/g × 8952 g = 2.986 × 10⁶ J
where,
Q is the amount of heat absorbed by water.ΔH°f is the heat of fusion of water.m is the mass of water.To melt 8952 g of water, 2.986 × 10⁶ J of heat are required.
Learn more about fusion here: https://brainly.com/question/2426950
HELP!
Name an instinctive behavior and describe how it is beneficial to the survival of the young animal.
Answer:
Hunting
Explanation:
Things like hunting is instinct to animals and it's it beneficial to the survival of a young predator so it doesn't starve and die
Answer:HuntingExplanation:Things like hunting is instinct to animals and it's it beneficial to the survival of a young predator so it doesn't starve and die
Explanation: