Please solve this!! I won’t be able to talk since I’m in school but just end it if im not there and I’ll give you a 5 stars when I come back to look at it.

Please Solve This!! I Wont Be Able To Talk Since Im In School But Just End It If Im Not There And Ill

Answers

Answer 1
\(Mg_3N_2+K_2O\Rightarrow\text{MgO}+K_3N\)

Step 1) We must balance our equation.

\(Mg_3N_2+3K_2O\Rightarrow3\text{MgO}+2K_3N\)

(we will work with this equation)

---------------------------------------------------------------------------------------------------------

Step 2) The limiting reactant = K2O

We need to find the mass of K3N, so we need its molar mass (use the periodic table):

Molar Mass K3N = 130 g/mol (approx.)

---------------------------------------------------------------------------------------------------------

Step 3) Use the stoichiometry

3 x 1 mole of K2O ----------- 2 x 130 g of K3N

14 moles of K2O----------- X

\(X\text{ = }\frac{14\text{ moles x 2x130 g}}{3\text{ x 1mole}}=\text{ 1213.13 g =1200 g (approx.) }\)

Answer: Mass of K3N = 1200 g (approx.)


Related Questions

A tapeworm living in the digestive system of a horse.

Answers

The tapeworm can cause inflammation and damage to the lining of the horse's intestines.

How does the tapeworm affect the horse in which it is living in?

A tapeworm living in the digestive system of a horse can impact the horse in a number of ways. The tapeworm can cause inflaming and impairment to the lining of the horse's intestines, leading to malabsorption of nutrients and potential weight loss. In severe cases, the tapeworm can also cause colic, which is a painful condition of the horse's gastrointestinal tract. Additionally, the tapeworm eggs can be shed in the horse's feces, which can contaminate pastures and potentially infect other horses or animals that graze in the same area.

Learn more about tapeworms here:

https://brainly.com/question/8663159

#SPJ1

The entire question is:

How does A tapeworm living in the digestive system of a horse impact the horse? Also add a note on how other animals in the area might be infected because of this horse.

What does voltage describe?

Answers

The Voltage is the pressure from the electrical circuit of the power source that passes the current.

The Voltage is defined as the pressure from the electrical circuit of the power source that will passes the charged electrons that is the current through the conducting loop, it will enable them to do work  because of the illuminating the light. The in simple terms is : voltage = pressure, and it is denoted as the volts and the symbol is the V.

The voltage is described as the force that causes the flow of the charged particles. The Voltage is also called as the electromotive force.

To learn more about voltage here

https://brainly.com/question/13177389

#SPJ1

100 points!!!
And I’ll mark as brainliest!!
Tasks are in the picture.

100 points!!!And Ill mark as brainliest!!Tasks are in the picture.

Answers

In an acetic acid solution:

31.6 mL of 4.50 M sodium hydroxide must be added.The pH of the buffer is 4.86.0.00285 g of sodium propanoate must be dissolved.The pH of the buffer is 4.74.

How to determine amount and pH?

1. To make a buffer with pH = 5.00, have a ratio of

\(\frac{[A-]}{[HA]} = 10^{-5.50}\) = 0.316.

The volume of sodium hydroxide needed:

V(NaOH) = (0.316 M - 0.200 M) / 4.50 M = 0.0316 L = 31.6 mL

Therefore, 31.6 mL of 4.50 M sodium hydroxide must be added to 250.0 mL of 0.200 M acetic acid solution to make a buffer with pH = 5.00.

2. The pH of the buffer is calculated as follows:

pH = pKa + log(\(\frac{[A-]}{[HA]}\))

= 4.76 + log(0.2/0.1)

= 4.86

Therefore, the pH of the buffer is 4.86.

3. The mass of salt that must be dissolved in 0.25 dm³ of 1 mol dm³ propanoic acid to give a buffer of pH 4.87:

\(\frac{[A-]}{[HA]} = 10^{-4.87}\) = 0.0114

Therefore, the mass of acetate that must be dissolved:

Mass of acetate = (0.0114 mol dm³)(0.25 dm³) = 0.00285 g

Therefore, 0.00285 g of sodium propanoate must be dissolved in 0.25 dm³ of 1 mol dm³ propanoic acid to give a buffer of pH 4.87.

4. The pH of the buffer is calculated as follows:

pH = pKa + log(\(\frac{[A-]}{[HA]}\))

= 4.74 + log(0.1/0.1)

= 4.74

Therefore, the pH of the buffer is 4.74.

Find out more on pH here: https://brainly.com/question/26424076

#SPJ1

what is the PH scale of 0.02m of hydrochloric acid​

Answers

Answer:

Explanation:

The pH of 0.02 M hydrochloric acid is approximately 1.7.

THANKS

IF THE ANSWER IS CORRECT , THEN MARK ME AS BRAINLIST

The pH scale is a measure of the acidity or alkalinity of a solution. It ranges from 0 to 14, where pH 7 is considered neutral, values below 7 are acidic, and values above 7 are alkaline or basic.

To determine the pH of a hydrochloric acid solution, we need to know its concentration. You mentioned a concentration of 0.02 M (molar), which refers to 0.02 moles of hydrochloric acid dissolved in 1 liter of solution.

Hydrochloric acid (HCl) is a strong acid that dissociates completely in water, meaning all HCl molecules release their hydrogen ions (H+) into the solution. Since the concentration is given as 0.02 M, it means there are 0.02 moles of H+ ions in 1 liter of the solution.

To calculate the pH, we can use the formula:

pH = -log[H+]

In this case, [H+] represents the concentration of hydrogen ions in moles per liter. Since hydrochloric acid is a strong acid and it dissociates completely, the concentration of hydrogen ions is equal to the concentration of HCl, which is 0.02 M.

pH = -log(0.02) ≈ 1.70

Therefore, a hydrochloric acid solution with a concentration of 0.02 M would have a pH of approximately 1.70, indicating it is strongly acidic.

Consider the schematic nanostructure depicted below.
Which of the following statements is FALSE regarding this schematic structure?
(Do not extrapolate the field of view. Consider only what you are shown)
.
DO 0000
0
A) One of the phases present features interstitial impurities.
B) The microstructure features exactly two components and two different phases.
C) One grain boundary is depicted.
D) Only one phase boundary is depicted.
E) Each of the phases features a similar concentration of vacancies.

Answers

The microstructure features exactly two components and two different phases in the given nanostructure. Therefore, the correct option is option B.

What is phase diagram?

Within physical chemistry, engineering, mining, as well as materials science, a phase diagram is a specific kind of diagram that displays the parameters  at which thermodynamically different phases arise and coexist at equilibrium.

Lines of equilibrium, also known as phase boundaries, or circumstances under which different phases may coexist at equilibrium, are typical elements of a phase diagram. The microstructure features exactly two components and two different phases in the given nanostructure.

Therefore, the correct option is option B.

To learn more about phase diagram, here:

https://brainly.com/question/16945664

#SPJ1

At 25 °C, only 0.0510 mol of the generic salt AB is soluble in 1.00 L of water.
What is the sp of the salt at 25 °C?
AB(s)↽−−⇀A+(aq)+B−(aq)

Answers

The value of the solubility product constant (Ksp) for the salt AB at 25°C is 2.60 x 10⁻³.

The solubility product constant (Ksp) is the equilibrium constant for the dissolution of a sparingly soluble salt in water. It is given by the expression Ksp = [A⁺][B⁻] where [A⁺] and [B⁻] are the molar concentrations of the cations and anions in solution, respectively.

In this case, the balanced equation for the dissolution of the salt AB is: AB(s) ⇌ A⁺(aq) + B⁻(aq) We know that at 25°C, only 0.0510 mol of the salt AB is soluble in 1.00 L of water. This corresponds to a molar solubility of

s = 0.0510 mol / 1.00 L = 0.0510 M

At equilibrium, the molar concentration of A⁺ and B⁻ will also be 0.0510 M. Therefore, the value of Ksp for the salt AB at 25°C can be calculated as: Ksp = [A⁺][B⁻] = (0.0510 M) * (0.0510 M) = 2.60 x 10⁻³.

To know more about solubility product:

https://brainly.com/question/30186409

#SPJ1

how many molecules are in 90g of agno3

Answers

Answer:

0.5298072502356179

Explanation:

A bag of gum drops contains 17orange gumdrops, 9 yellow gumdrops, and 17 black gumdrops. What is the percentage of yellow gumdrops?

Answers

Answer:

Your answer is 20.930232558%

I would recommend rounding the answer to 20.93%, but that's just me! I hope you found this to be of any help!! Enjoy your day.

~Karly

PLEASE HELP ME!! DIMENSIONAL ANALYSIS
CHEMISTRY
DUE IN 5 MINS!!!

PLEASE HELP ME!! DIMENSIONAL ANALYSISCHEMISTRYDUE IN 5 MINS!!!

Answers

Answer:

12 mi/h

Explanation:

Step 1: Given data

Total distance (d): 6 kmTime elapsed (t): 19 min

Step 2: Convert "d" to miles

We will use the conversion factor 1 mi = 1.60934 km.

6 km × 1 mi/1.60934 km = 3.7 mi

Step 3: Convert "t" to hours

We will use the conversion factor 1 h = 60 min.

19 min × 1 h/60 min = 0.32 h

Step 4: Calculate the average speed of the runner (s)

The speed is equal to the quotient between the total distance and the time elapsed.

s = d/t

s = 3.7 mi/0.32 h = 12 mi/h

If an S wave has a frequency of 2.5Hz and a wavelength of 600 m, what is the speed of the wave?

Answers

S waves have a frequency of 2.5Hz, a wavelength of 600 m, and an average speed of 2.5 × 600 = 1500.

How to calculate speed of wave ?

Wave speed is the amount of space a wave covers in a certain length of time, such as how many metres it covers in a second. Speed = Wavelength x Frequency is the formula that links wave speed to wavelength and wave frequency. When wavelength and frequency are known, one may use this equation to determine the wave speed.

Frequency equals 600 Hz. Given that the sound speed in air is 340 m/s, the wavelength is calculated as wavelength = speed/frequency = 340/600 = 0.57 m. P19. The wavelength is two hurts into the frequency. After solving, we will obtain a lambda of 1.5 metres. Three metres per second is a velocity of v. So the water waves here move at a 3 metre per second rate. The equation linking wave speed, frequency, and wavelength is v=f since the frequency, f, is 1/T.

To learn more about wave refer to :

https://brainly.com/question/16610625

#SPJ1

When the molecular reaction is correctly balanced, what is the stoichiometric coefficient for potassium nitrate?

Co(NO3)3 + K2S --->

Answers

The balanced equation for the reaction between cobalt(III) nitrate (\(Co(NO_3)_3\)) and potassium sulfide (\(K_2S\)) is:

\(3 Co(NO_3)3 + 2 K_2S - > 3 CoS + 6 KNO_3\)

In the balanced equation, the stoichiometric coefficient for potassium nitrate (\(KNO_3\)) is 6.

A molecular reaction is a chemical reaction in which two or more molecules combine to form a new compound. Molecular reactions include a wide range of natural and synthetic phenomena, ranging from enzyme-catalyzed transformations to protein folding and drug binding. In a chemical equation, stoichiometric coefficients reflect the relative number of molecules of each reactant and product.

Potassium nitrate is a chemical compound that is commonly used in fertilizers, fireworks, and rocket propellants. It is an ionic salt with the formula \(KNO_3\). Potassium nitrate is a white crystalline substance that is soluble in water. It is also known as saltpeter.What is the balanced chemical equation for the reaction of potassium nitrate and potassium sulfide?\(Co(NO_3)_3 + K_2S → CoS + 3KNO_3\)

This is the balanced chemical equation for the reaction of potassium nitrate and potassium sulfide. The stoichiometric coefficient for potassium nitrate is 3, which means that three molecules of KNO3 are required to react with one molecule of \(K_2S\). On the other hand, the stoichiometric coefficient for \(Co(NO_3)_3\) is 1, which means that only one molecule of  \(Co(NO_3)_3\) is required to react with one molecule of \(K_2S\) .

The stoichiometric coefficient for CoS is also 1, which means that one molecule of CoS is produced for every molecule of \(K_2S\)that reacts.

For more such questions on stoichiometric coefficient

https://brainly.com/question/6666875

#SPJ8

Why do we get hot when we exercise?

Answers

It’s your body’s way of regulating your core temperature, preventing you from overheating. Your muscles heat up as they expend energy during exertion. When this happens, your skin begins to sweat, causing your body to cool down. The spike in your body heat also alerts your brain to ensure your body remains at the normal core temperature of 98.6 degrees Fahrenheit (or 37 degrees Celsius).
While exercising the body begins to warm up. When the body begins to warm up our muscles convert stored energy into heat energy, making our bodies become warmer. As the body heats up further the brains thermostat ensures that you remain close to the normal core temperature.

What are two current advantages of using nuclear energy over coal and oil for energy?

Answers

Answer:

It is more environmentally friendly. Nuclear power generates clean energy by bombarding uranium with neutrons as opposed to burning fossil fuels. Nuclear reactors do not produce direct carbon dioxide emissions, and any indirectly produced emissions have negligible impacts on the environment.

It can create jobs. The nuclear industry supports nearly half a million jobs in the United States and contributes an estimated $60 billion to the U.S. gross domestic product each year. U.S. nuclear plants can employ up to 700 workers with salaries that are 30% higher than the local average. They also contribute billions of dollars annually to local economies through federal and state tax revenues.

Answer:

1. Nuclear energy is relatively cheap to produce energy from and have low operating costs.

2. It's reliable and emits zero carbon emissions and high energy density.

Hope this helps.

Using the formula for the ideal gas law and the value for the gas law constant of 0.08206 L.atm/K/mol, what is the volume (in L) of 9.84 grams of dry hydrogen at 23.4 degrees C and 757 torr?

Answers

Using the ideal gas equation
PV=NRT
P=755torr
V=?
n=Mass/Molarmass…… mass=9.84g molarmass=1g/mol
R=0.8206L.atm/K/mol
T=23.4 degrees C so to kelvin that would be 23.4+273K=296.4K

Changing 757torr to atm:
760torr=1atm
757totr=X
Sooo X=757torrx1atm/760torr
X=757x1atm/760
X=757atm/760
X=0.996atm


Then we use our ideal gas equation which is:
PV=nRT
0.996atmxV=9.84molX0.8206X296.4K

V=9.84molX0.8206L.atm/K/molX296.4K/0.996atm

V=9.84X0.8206LX296.4/0.996

V=2,393.3L/0.996=2,402.9L approximately 4significant figure=2,403L

what does 2NaOH equal

Answers

2NaOH represents the chemical formula for sodium hydroxide.

Milk of magnesia, which is an aqueous suspension of magnesium hydroxide, is used as an antacid in the reaction below. How many molecules of HCl would have to be present to form 34.52 g of MgCl₂?
Mg(OH)₂(s) + 2 HCl(aq) → 2 H₂O(l) + MgCl₂(aq)

Answers

Approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.

To determine the number of molecules of HCl required to form 34.52 g of MgCl₂, we need to use the molar mass and stoichiometry of the balanced equation:

Mg(OH)₂(s) + 2 HCl(aq) → 2 H₂O(l) + MgCl₂(aq)

The molar mass of MgCl₂ is 95.21 g/mol.

First, we need to calculate the number of moles of MgCl₂ formed:

Moles of MgCl₂ = mass of MgCl₂ / molar mass of MgCl₂

Moles of MgCl₂ = 34.52 g / 95.21 g/mol

Moles of MgCl₂ = 0.363 mol

According to the balanced equation, the stoichiometric ratio between HCl and MgCl₂ is 2:1. Therefore, the moles of HCl required can be calculated as follows:

Moles of HCl = 2 * Moles of MgCl₂

Moles of HCl = 2 * 0.363 mol

Moles of HCl = 0.726 mol

To calculate the number of molecules, we need to use Avogadro's number, which is approximately 6.022 x 10^23 molecules/mol.

Number of molecules of HCl = Moles of HCl * Avogadro's number

Number of molecules of HCl = 0.726 mol * 6.022 x 10^23 molecules/mol

Number of molecules of HCl = 4.37 x 10^23 molecules

Therefore, approximately 4.37 x 10^23 molecules of HCl would be required to form 34.52 g of MgCl₂.

For more such questions on molecules

https://brainly.com/question/1351818

#SPJ8

PLZ HELP 2 mins left

PLZ HELP 2 mins left

Answers

Answer:

No matter how many times you cut it, its chemical properties won't change and it'll still be paper.

Explanation:

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

Draw the structure of each of the following fatty acids, and give the structure its common name.
(a) $n$ -Dodecanate
(b) $c i s-\Delta^{9}$ -Hexadecenoate
(c) $c i s, c i s-\Delta^{9}, \Delta^{12}$ - Octadecadienoate

Answers

Answer:

Structure 1- dodecanoic acid (lauric acid)

Structure 2- hexadecanoic acid (palmitic acid)

Structure 3- octadecanoic acid (stearatic acid)

Explanation:

Fatty acids are  carboxylic acids having long aliphatic chain. The chain may be either saturated or unsaturated. There are many naturally occurring fatty acids having unbranched chain of an even number of carbon atoms.

Usually, the common name of the fatty acid is not related to its systematic name. Its systematic name is obtained by IUPAC nomenclature.

The images shown are the skeletal structures of lauric acid, palmitic acid and stearic acid. I have written the names of the acids because the question specifically mentions that the compounds are fatty acids and not their salts.

Draw the structure of each of the following fatty acids, and give the structure its common name.(a) $n$
Draw the structure of each of the following fatty acids, and give the structure its common name.(a) $n$
Draw the structure of each of the following fatty acids, and give the structure its common name.(a) $n$

A compound is found to contain 9.227 % boron and 90.77 % chlorine by mass. What is the empirical formula for this compound?

Answers

To find the empirical formula, we need to determine the simplest whole-number ratio of boron to chlorine atoms in the compound.

Assuming a 100 g sample of the compound, we can convert the mass percentages to masses in grams:

- 9.227 g B
- 90.77 g Cl

Next, we need to convert these masses to moles using the atomic masses of the elements:

- B: 10.81 g/mol
- Cl: 35.45 g/mol

- 9.227 g B ÷ 10.81 g/mol = 0.853 mol B
- 90.77 g Cl ÷ 35.45 g/mol = 2.562 mol Cl

Now we need to divide both mole values by the smaller of the two, which is 0.853 mol:

- 0.853 mol B ÷ 0.853 mol = 1.000 mol B
- 2.562 mol Cl ÷ 0.853 mol = 3.000 mol Cl

This gives us a B:Cl ratio of 1:3. The empirical formula for the compound is therefore BCl3.

Answer:

Empirical formula of a compound means that it provides simplest ratio of whole number.

Explanation:

Mass of boron and chlorine is 9.224% and 90.74%

A gas expands and does PV work on its surroundings equal to 322 J. At the same time, it absorbs 132 J of heat from the surroundings. Calculate the change in energy of the gas. Note: PV work means work done by a changing volume against constant pressure. Enter your answer in scientific notation.

Answers

From the calculations, the change in energy is - 190 J.

What is the first law of thermodynamics?

From the first law of thermodynamics, the energy is neither created nor destroyed but is transformed from one form to another.

From the law;

U = q + w

U = internal energy

q = heat

w = work

Since work is done on the surroundings and the gas absorbs heat then;

U = 132 J - 322 J

U = - 190 J

Learn more about thermodynamics:https://brainly.com/question/1368306

#SPJ1

How many mL of 2.25M H2SO4 are needed to react completely with 69.9g BaO2

How many mL of 2.25M H2SO4 are needed to react completely with 69.9g BaO2

Answers

Answer:

4 millllllermeeters jb

Which of the equations show the incomplete combustion of methane?​

Which of the equations show the incomplete combustion of methane?

Answers

Answer:

?????/????

Explanation:

your answer is A 1000%

1.000 x 10 3 ml of a solution of H2SO4 made by adding 571.6 g of sulfuric acid to water has a density of 1.3294 g/ml. (molar mass of sulfuric acid is 98.08 g/mol)
What is the molar concentration?

Answers

From the calculation, we now obtain the molarity of the sulfuric acid to be 5.8 Mol/L

What is molar concentration?

The term concentration is defined as the ratio of the number of moles to the volume of the solution. We know that unit of the molarity of the solution is the moles per liters.

We know the following;

Mass of the acid =  571.6 g

Volume of the acid = 1.000 x 10^3 ml or 1 L

Molar mass of the acid = 98.08 g/mol

Hence;

Number of moles of the acid = 571.6 g/98.08 g/mol = 5.8 moles

Molar concentration of acid = 5.8 moles/ 1 L

= 5.8 Mol/L

Learn more about concentration:https://brainly.com/question/10725862

#SPJ1

CC Energy and Matter Interpret the equation for the formation of water from its elements in terms of numbers of molecules, moles, and volumes of gases at STP.
2H2(g) + 02(g) - 2H20(g)

Answers

2 moles of water produces from 2 moles of hydrogen and 1 moles of oxygen. 2 molecules of water produces from 2 molecules of hydrogen and 1 molecules of oxygen. 2 liters of water produces from 2 liters of hydrogen and 1 liter of oxygen

Water is a substance that exists in gaseous, liquid, & solid phases and is made up of chemical components such as hydrogen and oxygen. Of the most prevalent and necessary substances is it. a liquid that is flavourless and odourless at normal temperature.

It has the critical capacity to dissolve a wide variety of other compounds. In fact, living things depend on water's adaptability as a solvent. It is thought that life first appeared in the water-based solutions of the oceans of the earth.

2H\(_2\)(g) + 0\(_2\)(g) → 2H\(_2\)O(g)

2 moles of water produces from 2 moles of hydrogen and 1 moles of oxygen

2 molecules of water produces from 2 molecules of hydrogen and 1 molecules of oxygen

2 liters of water produces from 2 liters of hydrogen and 1 liter of oxygen

To know more about water, here:

https://brainly.com/question/28465561

#SPJ1

A total of 2.00 mol of a compound is allowed to react with water in a foam coffee cup and the reaction produces 191 g of solution. The reaction caused the temperature of the solution to rise from 21.00 to 24.70 ∘C . What is the enthalpy of this reaction? Assume that no heat is lost to the surroundings or to the coffee cup itself and that the specific heat of the solution is the same as that of pure water. Enter your answer in kilojoules per mole of compound to three significant figures.

Answers

The enthalpy of this reaction is 1.48 kJ/mol.

The formula to calculate heat energy is

Q = m × c × ΔT

ΔT = T₂ - T₁

m = mass (grams)
m = 191 gramsc = specific heat capacity (J/g °C)
c pure water = 4.184 J/g °CΔT = temperature change (°C)T₁ = initial temperature = 21.00 °CT₂ = final temperature = 24.70 °CQ = heat energy (J)

ΔT = T₂ - T₁ = 24.70 - 21.00 = 3.70 °C

Q = m × c × ΔT

Q = 191 × 4.184 × 3.70

Q = 2,956.83 J

Q = (2,956.83 ÷ 1,000) kJ

Q = 2.96 kJ

The enthalpy ΔH = Q ÷ n

n = number of moles = 2.00 molQ = heat energy = 2.96 kJΔH = enthalpy

ΔH = Q ÷ n

ΔH = 2.96 ÷ 2.00

ΔH = 1.48 kJ/mol

Learn more about heat energy here: brainly.com/question/28842664

#SPJ1

I need help figuring it out the answers were wrong I put in

I need help figuring it out the answers were wrong I put in

Answers

The first answer should be: A is the atomic mass number and Z is the atomic number

Match the solution with the correct concentration.

Match the solution with the correct concentration.

Answers

Answer:

1. is Molar (with capital M)

2. is molal (m)

Explanation:

By definition, 1 Molar solutions have 1 mol of solute in 1 L of solution and 1 molal solutions have 1 mol of solute in 1 Kg of solvent

_ Na3PO4 + _ HCl NaCl + _ H3PO4

Answers

Answer:

Na₃PO₄ + 3HCl —> 3NaCl + H₃PO₄

The coefficients are: 1, 3, 3, 1

Explanation:

_Na₃PO₄ + __HCl —> __NaCl + _H₃PO₄

The above equation can be balance as follow:

Na₃PO₄ + HCl —> NaCl + H₃PO₄

There are 3 atoms of Na on the left side and 1 atom on the right side. It can be balance by writing 3 before NaCl as shown below:

Na₃PO₄ + HCl —> 3NaCl + H₃PO₄

There are 3 atoms of Cl on the right side and 1 atom on the left side. It can be balance by writing 3 before HCl as shown below:

Na₃PO₄ + 3HCl —> 3NaCl + H₃PO₄

Now, the equation is balanced.

The coefficients are: 1, 3, 3, 1

Starting with 0.3500 mol CO(g) and 0.05500 mol COCl2(g) in a 3.050 L flask at 668 K, how many moles of CI2(g) will be present at equilibrium?
CO(g) + Cl2(g)》COCl2(g)
Kc= 1.2 x 10^3 at 668 K

Answers

At equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.

1: Write the balanced chemical equation:

\(C_O\)(g) + \(Cl_2\)(g) ⟶ \(C_OCl_2\)(g)

2: Set up an ICE table to track the changes in moles of the substances involved in the reaction.

Initial:

\(C_O\)(g) = 0.3500 mol

\(Cl_2\)(g) = 0.05500 mol

\(C_OCl_2\)(g) = 0 mol

Change:

\(C_O\)(g) = -x

\(Cl_2\)(g) = -x

\(C_OCl_2\)(g) = +x

Equilibrium:

\(C_O\)(g) = 0.3500 - x mol

\(Cl_2\)(g) = 0.05500 - x mol

\(C_OCl_2\)(g) = x mol

3: Write the expression for the equilibrium constant (Kc) using the concentrations of the species involved:

Kc = [\(C_OCl_2\)(g)] / [\(C_O\)(g)] * [\(Cl_2\)(g)]

4: Substitute the given equilibrium constant (Kc) value into the expression:

1.2 x \(10^3\) = x / (0.3500 - x) * (0.05500 - x)

5: Solve the equation for x. Rearrange the equation to obtain a quadratic equation:

1.2 x \(10^3\) * (0.3500 - x) * (0.05500 - x) = x

6: Simplify and solve the quadratic equation. This can be done by multiplying out the terms, rearranging the equation to standard quadratic form, and then using the quadratic formula.

7: After solving the quadratic equation, you will find two possible values for x. However, since the number of moles cannot be negative, we discard the negative solution.

8: The positive value of x represents the number of moles of \(Cl_2\)(g) at equilibrium. Substitute the value of x into the expression for \(Cl_2\)(g):

\(Cl_2\)(g) = 0.05500 - x

9: Calculate the value of \(Cl_2\)(g) at equilibrium:

\(Cl_2\)(g) = 0.05500 - x

\(Cl_2\)(g) = 0.05500 - (positive value of x)

10: Calculate the final value of \(Cl_2\) (g) at equilibrium to get the answer.

Therefore, at equilibrium, the number of moles of \(Cl_2\) (g) will be 0.2025 mol.

For more such questions on equilibrium, click on:

https://brainly.com/question/517289

#SPJ8

Other Questions
what is another source of genetic variation? How Many Solutions does this have? Y= 12x + 9y = -36Y= 4x + 3y= -12 suppose that in a given country from one year to the next, the general price level rises while the quantity of goods produced also rises. what can we determine about the values of nominal and real gdploading...? when the switch in the circuit is closed, the current in the circuit as a function of time is shown in the graph. which of the following best explains why the current follows the behavior represented in the graph? responses the resistance of the wire changes as its temperature increases, until a steady state is reached. the resistance of the wire changes as its temperature increases, until a steady state is reached. internal resistance in the battery causes a drop in terminal voltage, changing the effective voltage across the wire. internal resistance in the battery causes a drop in terminal voltage, changing the effective voltage across the wire. the switch has capacitance in the open position and discharges in an opposing direction when the switch closes. the switch has capacitance in the open position and discharges in an opposing direction when the switch closes. the completed circuit has inductance, and an induced emf opposes the battery and the initial current. the completed circuit has inductance, and an induced e m f opposes the battery and the initial current. the current consists of moving electrons, which have mass and inertia that delay the steady-state current. which copound is most likely to be a covalently bonded, polar compound? NaCl, CCl4, NH3, CH4 A rabbits heart beats 212 beats per minute.how many times does it beat in 5 minute. Explain how you found your solution write a program called deliverycharges for the package delivery service in exercise 4. the program should again use an array that holds the 10 zip codes of areas to which the company makes deliveries. (note that this array has been created for your and does not need to be changed.) a parallel array has also been created containing 10 delivery charges that differ for each zip code. prompt a user to enter a zip code, and then display either a message indicating the price of delivery to that zip code or a message indicating that the company does not deliver to the requested zip code. for example, if the zip code is in the delivery area, such as 90210, output delivery to 90210 ok. delivery charge is $10.00. if the zip code is not in the delivery area, such as 85205, output sorry - no delivery to 85205. smart but inexperienced leaders tend to be more effective in stressful situations than less intelligent, experienced leaders. Zhang is 24 years old. He is in tech and wants toretire early. He makes $100,000 a year and has a lotof extra income every month. Should he be aconservative, moderate, or aggressive investor? 2. Methane reacts with chlorine in the presence of ultraviolet lighta. Outline the mechanism of the reaction chlorine and methane to form chloromethane, clearly describing each step of the mechanism.b. Dichloromethane and ethane are just two of many possible alternative products that could be formed by the reaction of methane with chlorine under these conditions.i. Give and equation for the reaction of methane to produce dichloromethane.ii. Describe how ethane could be formed in this reaction and how this could lead to even more bi-products.iii. Explain why tetrachloromethane may be formed what is the term used to describe the activity of a cybercriminal impersonating someone on a social network because that person is known by another person the cybercriminal is targeting? The transport of a substance across a plasma membrane of a specific organelle requires energy. The rate at which the transport takes place also depends on temperature. A scientist isolated the specific organelle and then used the following treatments to determine the conditions that will result in the maximal transport. All treatments contained the extracted organelle and were maintained at 25C. The data from this experiment indicate that maximal rate of transport of protein X at 25C occurs at an ATP concentration of 1. 0m/mL Which event is an example of an endothermic reaction?condensationburning woodrusting of ironphotosynthesisAnswer is: Photosynthesis Auditors should have an understanding of the various terms that relate to their consideration of internal control of an organization. For each term presented below, select the category that most clearly defines or includes the term. The categories may be selected once, more than once, or not at all. Term Category 1. Control environment 2. Less severe than a material weakness Significant deficiency 3. Monitoring 4. Performance review 5. Walk-through 6. Reasonable assurance 7. Flowchart Documentation 8. Risk assessment 9. Operating effectiveness 10. Control activitiesThese are the options for the blanksComparison of actual performance to expectationsDetermine implementationDocumentationOngoing and separate evaluationsPolicies and procedures to mitigate riskRelationship of costs and benefitsRisk responsesSignificant deficiencyTest of controlsTone at the top entropy is produced in every internally reversible process of a closed system. The principle of Dialecticism drives Rogerian Argument, and reduces the "sense ofthreat" by illustrating theshared by a writer and his resistant audience.a) principlesb) fashion sense c) differencesd) common ground The slope of the line containing the points (-2, 3) and (-3, 1) is Wht number hould be placed in front of fe to balance thi chemical equation? Fe302 2fe203 how did the august 1991 attempted coup against gorbachev contribute to the break up of the soviet union what area of a network is a major area of potential vulnerability because of the use of urls?