its b
i did the quiz and got it right it is b
Answer:
b
Explanation:
took test on edge
When 0.695 g of an unknown gas are held in an otherwise-empty 293-mL container, the pressure is 807.4 mmHg at 22°C. What is the molecular mass of the gas?
____g/mol
The molecular mass of the gas is 54 g/mol.
The Ideal gas law is the equation of state of a hypothetical ideal gas. It is a good approximation to the behaviour of many gases under many conditions, although it has several limitations. The ideal gas equation can be written as
PV = nRT
where,
P = Pressure
V = Volume
T = Temperature
n = number of moles
In this equation, number of moles can be replaced by mass divided by molecular mass.
Given,
Mass = 0.695g
Volume = 293ml = 0.293L
Pressure = 807.4mmHg = 807.4/760 atm
Temperature = 22⁰C = 22 +273 = 295K
PV = nRT
(807.4 × 0.293) ÷ 760 = (0.695 × 8.314 × 295) ÷ M
M = (0.695 × 0.0821× 295 ×760) ÷ (807.4 × 0.293)
M= 54 g/ mol
Learn more about Ideal gas Law, here:
https://brainly.com/question/28257995
#SPJ1
SOMEONE PLEASE HELP! WILL GIVE BRAINLIEST!
Answer:
1 At 0C° KNO3 is least soluble
2 Approximately 65 grams
3 About 30 grams
4 yes it increases at the same rate can be explained by straight line graph
Explanation:
If you want to determine the actual salicylate concentration for a sample that gives a greater absorption than the highest concentration standard (as described in Question (3)), you need to dilute the sample. If you dilute it by mixing 0.25 mL of sample with 0.75 mL of water and then find that this mixture has a salicylate concentration of 0.45 mg/mL, what is the concentration of the unknown sample
Answer: The concentration of unknown sample is 1.8 mg/ml
Explanation:
According to the dilution law,
\(M_1V_1=M_2V_2\)
where,
\(M_1\) = concentration of stock solution = ?
\(V_1\) = volume of stock solution = 0.25 ml
\(M_1\) = concentration of diluted solution = 0.45 mg/ml
\(V_1\) = volume of diluted solution = (0.25+0.75) ml = 1.00 ml
Putting in the values we get:
\(M_1\times 0.25=0.45\times 1.00\)
\(M_1=1.8mg/ml\)
Therefore, concentration of unknown sample is 1.8 mg/ml
Describe how your response in the previous question explain the decrease in the temperature measured during the evaporation process
Answer:
See explanation
Explanation:
Evaporation is an endothermic process. In an endothermic process, heat is absorbed from the surrounding. This causes the system to feel cool.
Since evaporation is endothermic and heat is absorbed from the surrounding, the system will feel cool and the temperature of the system decreases accordingly.
Hence, during evaporation, the temperature of the system decreases.
Molecules inside a liquid _____.
Answer:
Answer. A liquid is made up of tiny vibrating particles of matter, such as atoms, held together by intermolecular bonds. Water is, by far, the most common liquid on Earth. Like a gas, a liquid is able to flow and take the shape of a container
Answer:
Move because that are boncing off the sides of the containers and into each other
Bobota
Level 1
Q2
What is the ability of a substance to
burn or ignite, causing fire or combustion?
DANGER
A. Chemical stability
B Reactivity
C Flammability
D. Conductivity
Answer:
chemical stability
Explanation:
g goodnight
Sound waves can travel across outer space true or false
Answer:
False
Explanation:
sounds waves can't travel so far
A sample of a certain lead compound contains 12.92 g of lead for 2 g of oxygen. A second sample has mass of 34.27 g and contains 14.39 g of oxygen. Are the two compound the same
The two chemical compounds are not the same, because their ratio is not equal. In both samples the composition of lead and oxygen is different.
What is a chemical compound?A chemical compound is a substance made of numerous similar molecules (or molecular entities) joined by chemical bonds and comprising atoms from various chemical elements. Therefore, a molecule made up of only one type of atom is not a compound. Chemical reactions, which may entail interactions with other molecules, can change a compound into a distinct substance. Atomic bonds may be broken or new ones created during this process.
What are the calculations?sample 1 = mass of lead / mass of oxygen = 12.92g/2g = 6.46 .
sample 2 = mass of lead/ mass of oxygen = 34.27 - 14.39/14.39 = 1.38 .
so, the ratios are not the same.
Hence, the two chemical compounds are not the same, because their ratio is not equal. In both samples the composition of lead and oxygen is different.
To know more about Chemical compounds, check out:
https://brainly.com/question/26487468
#SPJ1
143°C =
—
О-130 к
OOK
o143 К
416 К
Answer:
143°C = 416K
Select the correct answer.
Which unit is used for measuring atomic mass?
A atomic mole
B. grams/mole
C. grams
D. atomic mass unit
E. atomic mass weight
Answer:
D
Explanation:
The unit used to measure atomic mass is the atomic mass unit (amu). A single amu is equivalent to 1/12 the mass of an atom from the carbon-12 isotopIsotopes with different numbers of protons and neutrons will have an actual mass slightly different from the atomic mass calculated in atomic mass units.
At a maximum, an f-orbital can hold_____ electrons, a d-orbital can hold_____ electrons, a p-orbital can hold ________ electrons and an s-orbital can hold ________ electrons.
An clement X has 2 electrons in K shell, 8 electrons in L shell and 5 electrons in i Size of X ion is greater than that of X atom though both contain the same protons. Give reason. ii) Write down the formula of one of the compounds of X where X is in -3 oxidation.
Answer:
i) The size of X ion is greater than that of X atom even though both contain the same number of protons because the ion has fewer electrons compared to the atom. When an atom forms an anion (negative ion), it gains electrons, which causes increased electron-electron repulsion. This repulsion causes the electron cloud to expand, and as a result, the ion becomes larger than the neutral atom.
In the case of element X, when it forms an ion with a -3 charge, it will gain 3 more electrons, increasing the total number of electrons to 18. This will cause the size of the X ion to be larger than the neutral X atom.
ii) To determine the compound of X in the -3 oxidation state, we first need to determine the element's identity. We know that X has 15 electrons in total (2 in the K shell, 8 in the L shell, and 5 in the M shell). Therefore, X has an atomic number of 15, which corresponds to phosphorus (P).
Since phosphorus is in the -3 oxidation state, it gains 3 electrons and becomes P^3-. To form a compound, we need a cation that can balance the negative charge. A common example is aluminum (Al), which has a +3 charge (Al^3+). When phosphorus and aluminum combine, they form the compound aluminum phosphide with the formula AlP.
Sodium reacts with oxygen to produce sodium oxide.
4Na(s)+O2(g)→2Na2O(s)
How many grams of Na2O are produced when 32.2 g of Na reacts?
Answer:
32.2 g of Na will produce 43.4 g of Na2O.
Explanation:
The balanced chemical equation for the reaction between sodium and oxygen shows that 4 moles of sodium react with 1 mole of oxygen to produce 2 moles of sodium oxide:
4Na(s) + O2(g) → 2Na2O(s)
To solve this problem, we can use the following steps:
Step 1: Convert the mass of Na given in the problem to moles using the molar mass of Na.
molar mass of Na = 23 g/mol
moles of Na = mass of Na / molar mass of Na
moles of Na = 32.2 g / 23 g/mol
moles of Na = 1.4 mol
Step 2: Use the mole ratio from the balanced chemical equation to determine the moles of Na2O produced.
From the balanced chemical equation, we can see that 4 moles of Na react to produce 2 moles of Na2O.
moles of Na2O = (moles of Na / 4) x 2
moles of Na2O = (1.4 mol / 4) x 2
moles of Na2O = 0.7 mol
Step 3: Convert the moles of Na2O to grams using the molar mass of Na2O.
molar mass of Na2O = 62 g/mol
mass of Na2O = moles of Na2O x molar mass of Na2O
mass of Na2O = 0.7 mol x 62 g/mol
mass of Na2O = 43.4 g
Therefore, 32.2 g of Na will produce 43.4 g of Na2O.
Question 5 of 20:
Select the best answer for the question.
5. When considering gravity acceleration and the force of acceleration, what must be true?
O A. The direction of acceleration must be perpendicular to the direction of the force.
O B. The direction of the force and the direction of acceleration must be opposite of each other.
OC. The direction of the force and the direction of acceleration must be the same as each other.
O D. The mass of the body must be the same as the acceleration of the body.
Mark for review (Will be highlighted on the review page)
<< Previous Question
Next Question >>
What is the volume of an object with the mass of 7.9 grams in the density of 2.28g/ml.
Answer:
3.7mL is the volume of the object
Explanation:
To convert the mass of any object to volume we must use density that is defined as the ratio between mass of the object and the space that is occupying. For an object that weighs 7.9g and the density is 2.28g/mL, the volume is:
7.9g * (1mL / 2.28mL) =
3.7mL is the volume of the objectWhat is the best way to measure the pH of a natural solution while out in a forest?
The best way to measure the pH of a natural solution while out in a forest is to use a portable pH meter or pH test strips specifically designed for field use. These instruments provide accurate and reliable pH measurements and are convenient for outdoor applications.
1. Prepare the necessary equipment: Before heading out to the forest, gather the required tools. You will need a portable pH meter or pH test strips, as well as the necessary reagents or calibration solutions if using a pH meter.
2. Collect the sample: Locate the natural solution you want to measure the pH of, such as a stream, pond, or soil. Use a clean container to collect a representative sample of the solution.
3. Calibrate the pH meter (if applicable): If you are using a portable pH meter, it is essential to calibrate it before taking measurements. Follow the manufacturer's instructions to calibrate the meter using the provided calibration solutions.
4. Conduct the measurement: For pH meters, immerse the electrode into the collected sample. Allow some time for the reading to stabilize, and then record the pH value indicated on the meter's display.
5. Using pH test strips: If you are using pH test strips, dip the strip into the collected sample for the recommended amount of time. Remove the strip and compare the color change with the provided color chart. Determine the corresponding pH value from the chart.
6. Repeat for accuracy: To ensure reliability, repeat the measurement process at least once and compare the results. This step helps confirm the accuracy of your measurements.
7. Record and analyze the data: Note down the pH values obtained and any relevant observations. Analyze the data as needed for your research or monitoring purposes.
By following these steps and using the appropriate equipment, you can effectively measure the pH of a natural solution while in a forest setting.
For more such questions on measurements, click on:
https://brainly.com/question/28391278
#SPJ8
When fossil fuels are burned, they emit carbon dioxide into the atmosphere. After centuries of large amounts of carbon dioxide accumulating in the atmosphere, the earth's temperature increases by 1°C.
What is the connection between increasing carbon dioxide and increasing temperature?
The connection between increasing carbon dioxide and increasing temperature is: carbon dioxide absorbs heat from the sun and traps it in earth's atmosphere. Since the heat cannot escape, it causes the earth's temperature to increase which is the first option.
When carbon dioxide (CO₂) and other greenhouse gases are present in the atmosphere, they act as a natural blanket, allowing sunlight (solar radiation) to pass through and reach the Earth's surface. Some of this solar radiation is absorbed by the Earth's surface, while the rest is reflected back towards space as heat (infrared radiation). However, greenhouse gases like carbon dioxide have the property of absorbing and re-emitting infrared radiation.
Learn more about fossil fuel here
https://brainly.com/question/2029072
#SPJ1
9. A brand of gasohol (gasoline containing alcohol)
contains 10.% ethanol by volume. How many
milliliters (mL) of ethanol are in a 0.750-gallon
sample of the gasohol? (1 gall = 3.785 L)
(A) 283.875 mL
(B) 280 mL
(C) 0.284 mL
(D) 2.8 x 10-4 mL
283.875 mL of ethanol are in a 0.750gallon sample of the gasohol. Therefore, the correct option is option A.
What is ethanol?Ethanol, sometimes known as ethyl alcohol, is a chemical liquid having the formula C2H5OH. Its primary application is as a solvent. To comprehend the chemical composition of ethanol, you must first grasp what alkenes are.
Alkenes are carbon and hydrogen molecules containing at at least one double bond between two carbons. Ethene is an example of an alkene.
1 gall = 3.785 L
0.750gallon =?
0.750gallon ×3.785 L / 1 gallon
= 2838.75 ml
10% of 2838.75 ml= 283.875 mL
Therefore, the correct option is option A.
To learn more about ethanol, here:
https://brainly.com/question/13264860
#SPJ9
\({ \red {\sf{Define \: Transportational}}}\)
2+x=19
Find x
Easy!!
2+17=19
#hope that helps
Answer:
To find the answer you may
2+17=19
Explanation:
so that is the answer I'm sorry,to not give all the solutions
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Question 5(Multiple Choice Worth 5 points)
(01.02 LC)
A chemist reported that 100 gallons of a gas were available in a laboratory. Which property of the gas did the chemist report?
O Length
O Mass
O Temperature
O Volume
Answer:
volume
Explanation:
this is because gallon is a unit of volume.
pls give brainliest
The property of the gas that was used by the chemist's report is volume. The correct option is D.
What is volume?
Volume is a scalar quantity that is used to measure the space occupied by a three-dimensional object. In terms of liquid and gas, the volume is measured as the capacity of the container that contains a liquid.
Gas is a state of matter that has no regular shape and no fixed volume. They have the lowest density and their moles are farthest from each other.
Gallon is a unity of volume that is used in the metric system of the United States. There are 100 gallons of gas in the container, the volume of gas is the total number of moles of the gas in a container.
Thus, the correct option is D. Volume.
To learn more about volume, refer to the link:
https://brainly.com/question/356658
#SPJ5
What volume (in mL) of a 0.150 M HNO3 solution will completely react with 35.7 mL of a 0.108 M Na2CO3 solution according to the following balanced chemical equation?
Na2CO3(aq)+2HNO3(aq)→2NaNO3(aq)+CO2(g)+H2O(l)
In the reaction in Part A, what mass (in grams) of carbon dioxide forms?
Answer:
Explanation:
where are the anwser choices
Answer:
First part: volume of HNO3 solution = 51.4 mL
Second part: mass of CO2 = 0.170 g
Explanation:
First part:
Based on the volume and concentration of the Na2CO3 solution, there is 3.86 mmol of Na2CO3 available to react with HNO3 . Considering the stoichiometric relationship, you then calculate the volume of a 0.150 M solution that contains 7.71 mmol of HNO3 .
51.4 mL
Second part:
Since the reactant and product have a stoichiometric relationship that is 1:1, 0.00386 mol of Na2CO3 can react to form 0.00386 mol of CO2 . The molar mass of CO2 (44.01 g/mol ) is then used to convert the moles to the corresponding mass in grams.
0.170 g
electronic configuration [Ne]3s2 3p6
In distillation,separation is achieved by difference in---
Answer:
relative volatility.
mark me brainliestt :))
Answer: in temperature
9M 6N 15N What is the net force.
Net ionic equation for potassium sulfide and magnesium iodide
The net ionic equation for the reaction between potassium sulfide and magnesium iodide is S2- + Mg2+ -> MgS, as the potassium and iodide ions are spectator ions and do not participate in the reaction.
To determine the net ionic equation for the reaction between potassium sulfide (K2S) and magnesium iodide (MgI2), we first need to identify the ions present in each compound and then determine the products formed when they react.
Potassium sulfide (K2S) dissociates into two potassium ions (K+) and one sulfide ion (S2-):
K2S -> 2K+ + S2-
Magnesium iodide (MgI2) dissociates into one magnesium ion (Mg2+) and two iodide ions (I-):
MgI2 -> Mg2+ + 2I-
Now, we need to determine the possible products when these ions combine. Since potassium (K+) has a +1 charge and iodide (I-) has a -1 charge, they can combine to form potassium iodide (KI):
K+ + I- -> KI
Similarly, magnesium (Mg2+) and sulfide (S2-) can combine to form magnesium sulfide (MgS):
Mg2+ + S2- -> MgS
Now, we can write the complete ionic equation by representing all the ions present before and after the reaction:
2K+ + S2- + Mg2+ + 2I- -> 2KI + MgS
To obtain the net ionic equation, we remove the spectator ions, which are the ions that appear on both sides of the equation and do not participate in the actual reaction. In this case, the spectator ions are the potassium ions (K+) and the iodide ions (I-).
Thus, the net ionic equation for the reaction between potassium sulfide and magnesium iodide is:
S2- + Mg2+ -> MgS
For more such questions on ionic equation visit:
https://brainly.com/question/25604204
#SPJ8
Sophia wants to grow a new plant from a piece cut from an old plant. She should use
O cytokinins
O gibberellins
O auxins
Answer:
The answer is cytokinins I know for certain
Write a net ionic equation for the following:
hydrogen ions and [Al(OH)4], yielding aluminum hydroxide;
Explanation:
Al(OH)4-(aq) plus 4H plus (aq) and Al3 plus (aq) plus 4H20(I)
The net ionic equation is applied mainly in neutralization reactions, displacing reactions and redox reactions. The net ionic equation can be written as
\(Al(OH)_{4} +4H^{+} \rightarrow Al^{+3}+4H_{2}O\)
What is net ionic equation?The net ionic equation represents a chemical equation of a reaction that give an idea of species that are really participating in the reaction. Net ionic equations can be written for those electrolyte which are strong in water.
The balanced net ionic equation is
\(Al(OH)_{4} +4H^{+} \rightarrow Al^{+3}+4H_{2}O\)
Here aluminum hydroxide is reacting with acid. That is why neutralization reaction is happening over here as water is releasing in this reaction. In net ionic equation, ions get cancelled that appear on both sides of the reaction arrow because they essentially don't participate in the reaction of interest
Thus the net ionic equation is
\(Al(OH)_{4} +4H^{+} \rightarrow Al^{+3}+4H_{2}O\)
To learn more about net ionic equation, here:
https://brainly.com/question/13161506
#SPJ2
Which process absorbs the greatest amount of heat?
a. the cooling of 10 g of liquid water from 100°C to 0°C.
b. the heating of 10 g of liquid water from 0°C to 100°C.
c. the freezing of 10 g of liquid water the melting of 10 g of ice.
d. the condensation of 10 g of gaseous water.
Answer:
b. the heating of 10 g of liquid water from 0°C to 100°C.
Explanation:
Hello,
In this case, we must notice a., c. and d. processes are not actually absorbing heat but releasing it since cooling, freezing and condensation are processes with negative heat sign since matter changes from a state of more energy to a state of less energy. We can prove this by realizing that freezing enthalpy of water is -6.00 kJ/mol, condensation enthalpy of eater is -40.8 kJ/mol and a change of temperature from 100 °C to 0 °C is negative.
In such a way, the only process absorbing heat is b. the heating of 10 g of liquid water from 0°C to 100°C since energy must be added to the system, or absorbed by it in order to attain the heating.
Regards.
The process having the greatest amount of heat is:
b. the heating of 10 g of liquid water from 0°C to 100°C.
Looking at all the options:The options a., c. and d. processes are not actually absorbing heat but releasing it since cooling, freezing and condensation are processes with negative heat sign since matter changes from a state of more energy to a state of less energy.
The freezing enthalpy of water is -6.00 kJ/mol, condensation enthalpy of eater is -40.8 kJ/mol and a change of temperature from 100 °C to 0 °C is negative.
So out of all the options, only process at b is a heating process thus it will absorb greatest amount of heat.
Find more information about Heat here:
brainly.com/question/13439286
What is the purpose of the arrow in a chemical equation?
The arrow in a chemical equation represents the direction of the reaction. It indicates the conversion of reactants into products. The arrow points from the reactant side to the product side, symbolizing the flow of the reaction.
The purpose of the arrow is to visually represent the chemical transformation occurring in the reaction. It shows the relationship between the reactants and products and the direction in which the reaction proceeds. The arrow implies that the reactant molecules are being rearranged and transformed into new substances with different properties.
Chemical equations are used to describe the stoichiometry and balance of reactions. The arrow helps convey this information by illustrating the overall process taking place. It serves as a crucial element in understanding the reaction's composition, reaction conditions, and the substances involved.
Furthermore, the arrow also implies that the reaction can occur in both directions. In reversible reactions, the arrow can be represented as a double-headed arrow, indicating that the reaction can proceed in either direction depending on the conditions.
Know more about reversible reactions here:
https://brainly.com/question/21426719
#SPJ8