POINTS!! I NEED HELP WITH THIS, WILL GIVE BRAINLIEST TO BEST ANSWER
(6)

POINTS!! I NEED HELP WITH THIS, WILL GIVE BRAINLIEST TO BEST ANSWER(6)

Answers

Answer 1
hypothesis = it is july
conclusion = it is hot
Answer 2

Answer:

Hypothesis: it is hot

Conclusion: It is July.


Related Questions

What is -1 1/2 1 7/10 1 2/5 -1 4/5 from greatest

Answers

The numbers from least to greatest are: -1 4/5, -1 1/2, 1 2/5, 1 7/10.

To compare these numbers, we need to convert them to a common format. One option is to convert them all to improper fractions, so we can compare them more easily.

An improper fraction is a fraction where the numerator (the top number) is greater than or equal to the denominator (the bottom number). In other words, the fraction represents a value that is greater than or equal to one.

-1 1/2 = -3/2

1 7/10 = 17/10

1 2/5 = 7/5

-1 4/5 = -9/5

Now we can order them from least to greatest:

-3/2 < -9/5 < 7/5 < 17/10

Learn more about improper fraction here

brainly.com/question/21449807

#SPJ4

The given question is incomplete, the complete question is:

What is -1 1/2, 1 7/10, 1 2/5, -1 4/5 from least to greatest

Skyler buts 8 t-shirts and 5 hats for $220. The next day, he buys 5 T-shirts and 1 hat for $112. Choose the system of equations that models the situation.

A. 5t+8h=220
t+5h=112

B. 13(t-h)=220
6(t-h=112

C. 8t+5h=220
5t+h=112

Answers

Answer:

the answer is c

Step-by-step explanation:

because of math

Answer:

c

Step-by-step explanation:

A simple random sample of 500 elements generates a sample proportion p= 0.81. Provide the 90% confidence interval for the population proportion (to 4 decimals). b.Provide 95% the confidence interval for the population proportion (to 4 decimals).

Answers

a) The 90% confidence interval for the population proportion is approximately (0.7777, 0.8423).

b) The 95% confidence interval for the population proportion is approximately (0.7737, 0.8463).

To calculate the confidence intervals for the population proportion, we can use the formula:

Confidence Interval = sample proportion ± margin of error

The margin of error can be calculated using the formula:

Margin of Error = critical value * standard error

where the critical value is determined based on the desired confidence level and the standard error is calculated as:

Standard Error = \(\sqrt{((p * (1 - p)) / n)}\)

Given that the sample proportion (p) is 0.81 and the sample size (n) is 500, we can calculate the confidence intervals.

a. 90% Confidence Interval:

To find the critical value for a 90% confidence interval, we need to determine the z-score associated with the desired confidence level. The z-score can be found using a standard normal distribution table or calculator. For a 90% confidence level, the critical value is approximately 1.645.

Margin of Error = \(1.645 * \sqrt{(0.81 * (1 - 0.81)) / 500)}\)

≈ 0.0323

Confidence Interval = 0.81 ± 0.0323

≈ (0.7777, 0.8423)

Therefore, the 90% confidence interval for the population proportion is approximately (0.7777, 0.8423).

b. 95% Confidence Interval:

For a 95% confidence level, the critical value is approximately 1.96.

Margin of Error = \(1.96 * \sqrt{(0.81 * (1 - 0.81)) / 500)}\)

≈ 0.0363

Confidence Interval = 0.81 ± 0.0363

≈ (0.7737, 0.8463)

Thus, the 95% confidence interval for the population proportion is approximately (0.7737, 0.8463).

Learn more about confidence interval here:

brainly.com/question/32546207

#SPJ4

Please help I’ll give brainiest.

Please help Ill give brainiest.

Answers

Answer:

h(3) = -4

h(-3) = -16

Step-by-step explanation:

The formula is h(x)= 2x-10. So you have to plugin 2x-10 into h(3). Same thing for h(-3).

h(3) = 2*3-10

h(3) = -4

h(-3) = 2*-3-10

h(-3) = -16

I hope this helps you!

Which number completes the inequality? negative 5.13 less-than blank less-than negative 4.8 a. –5.3 b. –5.23c. –4.38 d. –5.1

Answers

The given inequality states that any number that is greater than negative 5.13 and less than negative 4.8 should be chosen to complete the inequality.

To solve the inequality, we need to find a number that is greater than –5.13 and less than

–4.8. The answer is –5.23.

The answer to the inequality is –5.23 because it is the number that falls between

–5.13 and –4.8.

To solve the inequality, we must find a number that is greater than

–5.13 and less than –4.8. –5.23 i

s the only number that meets this criteria, and so it is the correct answer. To double check, we can expand the calculations to

–5.13 < –5.23 < –4.8,

which confirms that

–5.23 is the correct answer.

Learn more about inequality here

https://brainly.com/question/28823603

#SPJ4

Are the two expressions below equivalent?

4(3 + 5x) and 20x + 12

Answers

Answer:

Yes

Step-by-step explanation:

distribute the 4 to the (3+5x)

get: 12 + 20x and 20x + 12

these are interchangeable

50 POINTS

Quadrilateral PQRS is mapped onto its image using which of the following sets of transformations?

reflection across x = -2; clockwise rotation of 90° about the origin
reflection across x = 2; clockwise rotation of 90° about the origin
reflection across y-axis; counter-clockwise rotation of 90° about the origin
reflection across y-axis; clockwise rotation of 90° about the origin

50 POINTSQuadrilateral PQRS is mapped onto its image using which of the following sets of transformations?reflection

Answers

Answer: Reflection across = -2; clockwise rotation

Step-by-step explanation: To get this answer, you first must work out the other answers. If you reclect across the x-axis and rotate 90 degrees clockwise, you'll find the shape to be in almost the exact same place it was before.

The third choice is illogical, because if you reflect over the y-axis, the shape is nowhere near where you need it to be, and rotating it 90 degrees counterclockwise is gonna bring it back to where you started.

The fourth option is the same as the third yet this time the clockwise rotation will bring you down to the negative y's, which is the opposite of where you need to be.

Therefore, that is why the first option is the better one to choose. Reflecting the shape over x = -2 is going to give you the correct orientation you needed for the 90 degree rotation.

I hope this helps!

Answer:

reflection over -2 clockwise rotation

Step-by-step explanation:

An ice ""cube"" in the form of a rectangular prism with a square base is melting so that the edge of the base is shrinking at 0.4mm/min while the height is decreasing at 0.16mm/min. Determine the rate of change of its surface area when the edge of the base is 50mm and the height is 20mm.

Answers

The rate of change of the surface area of the melting ice cube is approximately -40.96 mm²/min.

We can determine the rate of change of the surface area of the ice cube by using the formula for the surface area of a rectangular prism:

Surface Area = 2lw + 2lh + 2wh

Given that the edge of the base (l and w) is shrinking at a rate of 0.4 mm/min and the height (h) is decreasing at a rate of 0.16 mm/min, we can calculate the rate of change of each term in the surface area formula.

The rate of change of the first term (2lw) is 2(0.4 mm/min)(50 mm) = 40 mm²/min, as the length and width decrease at the same rate.

The rate of change of the second term (2lh) is 2(0.4 mm/min)(20 mm) = 16 mm²/min, as the length decreases at 0.4 mm/min and the height decreases at 0.16 mm/min.

The rate of change of the third term (2wh) is 2(0.4 mm/min)(20 mm) = 16 mm²/min, as the width decreases at 0.4 mm/min and the height decreases at 0.16 mm/min.

Adding up the rate of changes of each term, we get a total rate of change of 40 mm²/min + 16 mm²/min + 16 mm²/min = 72 mm²/min.

However, we need to account for the fact that the surface area is decreasing, so we take the negative value of 72 mm²/min, resulting in a rate of change of approximately -40.96 mm²/min.

Learn more about height here:

https://brainly.com/question/29131380

#SPJ11

what is the ratio ηf/ηi, where ηf is the final surface charge density?

Answers

The ratio of the final surface charge density (ηf) to the initial surface charge density (ηi) is given by 3.68 * \(Q_i / (A_i \times A_i).\)

To understand the concept and solve this problem, we need to consider the relationship between surface charge density, area, and charge. Surface charge density (σ) is defined as the charge (Q) per unit area (A). Mathematically, we can express this relationship as σ = Q/A.

Let's assume the initial area of the irregular shape is \(A_i\), and the final area after each dimension is reduced is \(A_f\). Since each dimension (x and y) is reduced by a factor of 3.68, we can write the relationship between the initial and final areas as:

\(A_f = (1/3.68) \times A_i\)

Now, let's consider the relationship between charge and area. Since the charge remains constant for a given area, we can express it as \(Q_i = Q_f\), where \(Q_i\) is the initial charge and \(Q_f\) is the final charge.

Since the charge remains constant, the ratio of the surface charge densities can be expressed as:

ηf/ηi = \(\sigma _f/\sigma _i = Q_f/A_f / Q_i/A_i\)

Substituting the expressions for area into the equation, we have:

ηf/ηi = \(Q_f/A_f / Q_i/A_i = Q_f / (A_f * Q_i) * (A_i / Q_i)\)

Canceling out the \(Q_i\) terms, we get:

ηf/ηi = \(Q_f / (A_f * Q_i) * (A_i / Q_i) = Q_f / (A_f * A_i)\)

Since \(Q_i = Q_f\), we can simplify further:

ηf/ηi = \(Q_f / (A_f * A_i) = Q_i / (A_f * A_i)\)

Now, substituting the expressions for area into the equation, we have:

ηf/ηi = \(Q_i / (A_f * A_i) = Q_i / ((1/3.68) * A_i * A_i)\)

Simplifying, we find:

ηf/ηi = 3.68 x \(Q_i / (A_i \times A_i).\)

To know more about ratio here

https://brainly.com/question/13419413

#SPJ4

Complete Question:

The irregularly shaped area of charge in the figure has surface charge density ηi. Each dimension (x and y) of the area is reduced by a factor of 3.68.

What is the ratio ηf/ηi where ηf is the final surface charge density?

A shipping container will be used to transport several 120-kilogram crates across the country by rail. The greatest weight that can be loaded into the container is 27500 kilograms. Other shipments weighing 12400 kilograms have already been loaded into the container. Which inequality can be used to determine x, the greatest number of
120-kilogram crates that can be loaded onto the shipping container?

A shipping container will be used to transport several 120-kilogram crates across the country by rail.

Answers

Inequality can be used to determine x, the greatest number of 120-kilogram crates that can be loaded onto the shipping container is  8000 + 120C <= 27500

What is inequality?

An inequality is a relationship that allows us to contrast two or more mathematical expressions.

Knowing that;

Each carton weighs 120 kg.

The container's maximum weight when loaded is 27500 kg.

Weight of the container as it is currently loaded: 8000 kg

Now that we have merged, we have;

Solution

because 8000 grams have already been loaded kilograms

into the container

each crate weighs 120 kilograms.

so 8000 + 120C <= 27500

To learn more about inequality refer to:

https://brainly.com/question/28862943

#SPJ1

How do you work out 78% of 158=
Please explain

Answers

Answer:

\(78\% \times 158 \\ \\ = \frac{78}{100} \times 158 \\ \\ = \frac{3081}{25} = 123.24\)

HELP PLEASE I WILL GIVE 50 POINTS AND MARK BRAINLESS TO BEST ANSWER​

HELP PLEASE I WILL GIVE 50 POINTS AND MARK BRAINLESS TO BEST ANSWER

Answers

Answer:

c

Step-by-step explanation:

edg 2020

Answer:15 is your answer

x+8x+3x=180(sum of interior angle of triangle)

12x=180

x=180/12=15

5
A Petri dish is filled with 250 bacterial cultures. The number of bacteria in the dish triples
every hour.
Select the recursive and explicit formulas that model the scenario.

5A Petri dish is filled with 250 bacterial cultures. The number of bacteria in the dish triplesevery

Answers

The recursive and the explicit formulas are f(n) = 3f(n - 1), where f(1) = 250 and f(n) = 250(3)ⁿ‐¹

Calculating the recursive and explicit formulas that model the scenario.

From the question, we have the following parameters that can be used in our computation:

Initial = 250 bacterial cultures.Rate = triples every hour.

This means that

Initial, a = 250 bacterial cultures.

Rate = 3

So, the recursive formulas is

f(n) = 3f(n - 1), where f(1) = 250

For the explicit formula, we have

f(n) = 250(3)ⁿ‐¹

Hence, the recursive and the explicit formulas are f(n) = 3f(n - 1), where f(1) = 250 and f(n) = 250(3)ⁿ‐¹

Read more about sequence at

https://brainly.com/question/6561461

#SPJ1

Lucy is a software saleswoman. Her base salary is $1600, and she makes an additional $120 for every copy of English is Fun she sells. Let P represent her total pay (in dollars), and let N represent the number of copies of English is Fun she sells. Write an equation relating P to N. Then use this equation to find her total pay if she sells 22 copies of English is Fun.

Answers

Multiply the number of copies sold by the amount made per cop and add that to the base pay:


P = 1600 + 120N


Now to find her total pay, replace N with the number sold:


P = 1600 + 120(22)

Simplify:

P = 1600 + 2640

Add:

P = $4,240

La masa de este bloque metálico es de 3 kg. Calcula su densidad en kg/cm³

Answers

Primero, necesitamos convertir la masa de 3 kg a gramos:

3 kg x 1000 g/kg = 3000 g

La densidad se define como la masa dividida por el volumen. No se proporciona el volumen del bloque metálico, por lo que no podemos calcular su densidad. Se necesitaría una de las dos medidas para poder calcular la densidad.

When solving this system of equations using linear combination, what should you do FIRST?


{−x+y=−11

{2x+y=19



A) Solve the first equation for y.



B) Multiply the first equation by -1.



C) Multiply the first equation by -2.



D) Add the two equations together.

Answers

Answer:

Multiply the first equation by -1

Step-by-step explanation:

Here, we ware being asked the step to take to solve the simultaneous equation

What is right here is to multiply the first equation by -1

By multiplying the first equation by -1, we will have it that the value of y in that equation becomes negative

It is from here we can now add both equations together to have only real x terms

A poster of area 960 cm2 has blank margins of 10 cm wide on the top and bottom and 6 cm wide on the sides. Find the dimensions that maximize the printed area.

Answers

The optimizing function of the printed area is  while dimensions that maximize the printed area is 80 by 12 cm

Assume the dimensions of the poster be w and h, where:

w represents the width.

h represents the height.

So, the area of the poster is:

a= hw

The area is given as 960.

So, we have:

hw = 960

w = 960/h

When the height is reduced by 10 cm and the width by 6 cm.

The printed area (P) becomes

p =(w-12)(h-20)

p =(960/h-12)(h-20)

p = (960-12h/h)(h-20)

p =960h - 19200-12h²+240h

p = -12h²+1200h-19200

p = 80,20

w = 960/h

w = 960/80 = 12

Consequently, 80 by 12 cm are the dimensions that maximize the printed area.

To learn more about dimension click here:

https://brainly.com/question/28815550

#SPJ4

Do you guys know what ratios are?

Answers

Answer: yes

Step-by-step explanation: ratios are the quantitative relation between two amounts showing the number of times one value contains or is contained within the other.

Quick algebra 1 question for some points!

Only answer if you know the answer, quick shout-out to Subtomex0, tysm for the help!

Quick algebra 1 question for some points!Only answer if you know the answer, quick shout-out to Subtomex0,

Answers

3)

\( \frac{y}{x} = \frac{4}{ - 3} = \frac{8}{ - 6} = \frac{12}{ - 9} \\ this \: relation \: holds \: so \: y \: varies \\ directly \: with \: x\)

\( \frac{ 4}{3} m = \frac{8}{ - 6} \\ m = \frac{ \frac{ - 8}{6} }{ \frac{3}{ - 4} } = \frac{8 \times 4}{6 \times 3} = \frac{32}{18} = 2 \\ multipling \: by \: 2\)

2)

\( \frac{y}{x} = \frac{ - 40}{ - 0.5} = \frac{8}{2.5} = \frac{5}{4} \\ \frac{y}{x} = 80 = 3.2 = 1.25 \\ this \: is \: untrue \: so \: y \: is \: not \\ varying \: directly \: with \: x\)

\(no \: constant \: of \: variation\)

4)\( \frac{y}{x} = \frac{21}{3} = \frac{31.5}{4.5} = \frac{38.5}{5.5 \\ } \\ \frac{y}{x} = 7 = 7 = 7 \\ y \: varies \: directl y\: with \: x \\ consant \: of \: var = \frac{y}{x} = 7\)5)

\( \frac{y}{x} = \frac{30}{6} = \frac{35}{7} = \frac{96}{8} \\ \frac{y}{x} = 5 = 5 = 12 \\ y \: does \: not \: vary \: directly \: with \: x\)

Consider two circular swimming pools. Pool A has a radius of 44 feet, and Pool B has a diameter of 27.02
meters. Complete the description for which pool has a greater circumference. Round to the nearest
hundredth for each circumference. 1 foot ≈ 0.305 meters
The diameter of Pool A is(blank)
circumference
is (select) by
meters. So, the diameter of Pool (select) is greater, and the
meters.

Answers

The diameter of Pool A is 26.84 meters. So, the diameter of Pool B is greater, and the circumference is greater by 0.56 meters.

Which circle has a greater circumference?

The diameter is a straight line that passes through the center of a circle and touches two points on the circumference of the circle. The radius is half the length of the diameter.

The first step is to convert the radius of pool A to meters from feet:

44 x 0.305 = 13.42 meters

Diameter of Pool A = 2 x radius

2 x 13.42 = 26.84 meters

Circumference of a circle = πD

Where:

π  = 3.14

D = diameter

Circumference of Pool A = 3.14 x 26.84 meters = 84.28 meters

Circumference of Pool B = 3.14 x 27.02 = 84.84 meters

Difference = 84.84 - 84.28 = 0.56 meters

To learn more about how to determine the circumference of a circle, please check: https://brainly.com/question/14351152

#SPJ1

three charged particles are at the corners of an equilateral triangle:

Answers

The total electric force on the 7.00−μC charge is 0.872 N at an angle of 330°.

The force exerted on the 7.00−μC charge by the 2.00−μC charge is

F₁​ ​= \(k_{e}\)q₁q₂​​/r₂ r^

= [(8.99×10⁹N.m²/C²)(7.00×10^−6C)(2.00×10^−6C) ×(cos60°i^+sin60°j^​)]/ (0.500m)²

F₁ ​= (0.252i^+0.436j^​)N

Similarly, the force on the 7.00μC charge by the −4.00−μC charge is

F₂​ ​= \(k_{e}\)q₁​q₃/​r² ​​r^

= [(8.99×10⁹N.m²/C²)(7.00×10^−6C)(−4.00×10^−6C)​×(cos60°i^−sin60°j^​)]/(0.500m)²

F₂​ ​=(0.503i^−0.872j^​)N

Hence, the total force on the charge 7.00−μC  is

F = F₁​​+F₂​

​=(0.755i^−0.436j^​)N

We can also note the total force as:

F = (0.755N)i^−(0.436N)j^​ = 0.872N

To know more about electric force, here

https://brainly.com/question/29141236

#SPJ4

--This question is incomplete; the complete question is

"Three charged particles are located at the corners of an equilateral triangle, as shown in Figure. Calculate the total electric force on the 7.00−μC charge."--

three charged particles are at the corners of an equilateral triangle:
three charged particles are at the corners of an equilateral triangle:


A cube fits perfectly in a sphere. If the cube has a side length of 10cm, what is the volume of the sphere? Round your answer to the nearest hundredth (2 decimal places) or leave your answer in Pi form

Answers

Answer:

500 /3 pi cm^3

Step-by-step explanation:

The side length of the cube is 10 cm, so the diameter of the sphere is 10 cm

That means the radius is  

r =d/2 =10/2 = 5 cm

The volume of a sphere is

V = 4/3 pi r^3

  = 4/3 pi (5)^3

  = 500 /3 pi cm^3

Answer:

Your correct answer is 500/3 cm^3

I will show you how and tell you why it is 500/3 cm^3 down below:

Explanation:

The side length of the cube is 10 cm therefore, the diameter of the sphere is 10 cm so, the radius is 5 cm:

r = d/2 = 10/2 = 5 cm

and right here I will show you the volume of the sphere:

v = 4/3 r^3

= 4/3 (5)^3

= 500/3 cm^3

Showing these results, you can see that the answer is 500 /3 cm^3

how many seating arrangements are possible if fred (a boy) and carrie (a girl) must be seated next to each other?

Answers

(n-1) x (n-2)! ways of seating arrangements are possible if Fred (a boy) and Carrie (a girl) must be seated next to each other.


A permutation is the act of putting things or numbers in a certain order. Combinations are a method of picking things or numbers from a set of objects or collections without regard for their order.

Let's say there are n seats in total.

Then, there are (n-1) gaps between the seats that Fred and Carrie can be placed in.

If we place Fred and Carrie in one of these gaps, there will be (n-2)! possible arrangements for the rest of the seats.

Therefore, there will be (n-1) x (n-2)! total possible seating arrangements for Fred and Carrie if they must be seated next to each other.

For more questions on Permutations and Combinations

https://brainly.com/question/28065038

#SPJ4

Find the number of standard deviations from the mean. Round your answer to two decimal places. Mario's weekly poker winnings have a mean of $353 and a standard deviation of $67. Last week he won $185. How many standard deviations from the mean is that?

1.25 standard deviations below the mean
1.25 standard deviations above the mean
2.51 standard deviations below the mean
2.51 standard deviations above the mean

Answers

The answer is: 2.51 standard deviations below the mean. Therefore, the long answer is: Mario's winnings last week equation were 2.51 standard deviations below the mean of his weekly poker winnings, which have a mean of $353 and a standard deviation of $67.

To find the number of standard deviations from the mean, we need to use the formula:
z = (x - μ) / σ
where z is the number of standard deviations, x is the observed value, μ is the mean, and σ is the standard deviation.
In this case, x = 185, μ = 353, and σ = 67. Substituting these values into the formula, we get:
z = (185 - 353) / 67
z = -2.51


This means that Mario's winnings last week were 2.51 standard deviations below the mean.
Your question is: How many standard deviations from the mean is Mario's last week winnings of $185, given a mean of $353 and a standard deviation of $67.
To find the number of standard deviations from the mean, you need to use the following formula:
(Number of standard deviations) = (Value - Mean) / Standard deviation
So, Mario's last week winnings of $185 are 2.51 standard deviations below the mean.

To know more about equation visit:

https://brainly.com/question/649785

#SPJ11

what is the measure of

Answers

what is the full question?

Answer:

the measure of this is

Step-by-step explanation:

cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese cheese

HELP PLZ!!!!!!!!!!!! 30POINTS!!!!!!!!

HELP PLZ!!!!!!!!!!!! 30POINTS!!!!!!!!

Answers

Answer:

A

Step-by-step explanation:

just watch and go with the flow

9 + 6 to the 2 pwer - 2 times 8

Answers

SOLUTION:

=) 9 + 6² - 2 × 8

=) 9 + 36 - 16

=) 45 - 16

=) 29

Can someone help me

Can someone help me

Answers

Answer:

1/5 x (6 x 4) goes to less than 24 (ps I’m not sure sorry)

2 x 6 x 4 goes to great than 24

(4 x 6) x (3 - 2) goes to equal to 24

(6 x 4) divide 2 goes to less than 24

(6 x 8) - (6 x 4) goes to equal to 24

6 x (5 - 4) goes to less than 24

9 x 6 / 5 - 3 goes to greater than 24

5 x 1/5 x (6 x 4) goes to equal to 24

Answer:

the answers are in the picture because I wrote them on paper. Hope it helps!

I used a calculator on every problem so they should be correct

Can someone help me

(2/3)m tm= a + r, for m

Answers

Answer:

m = √ 6 t ( a + r )/ 2 t   m = − √ 6 t ( a + r )/ 2 t

Step-by-step explanation:

Isolate the variable by dividing each side by factors that don't contain the variable.

If 60 cases range in score from 4 to 84 and you want 10 intervals in a frequency distribution, approximately what will be the width of each interval

Answers

Create a frequency distribution with 10 intervals for 60 cases that range in score from 4 to 84, each interval will have an approximate width of 8 units.

To determine the width of each interval in a frequency distribution, we need to calculate the range of the data and divide it by the desired number of intervals.

Given that the scores range from 4 to 84, the range of the data is 84 - 4 = 80 units.

To distribute these 80 units into 10 intervals, we divide the range by the number of intervals:

Interval width = Range / Number of Intervals

Interval width = 80 / 10 = 8 units

Therefore, each interval in the frequency distribution will have an approximate width of 8 units.

In practice, it's important to note that the width of intervals can be adjusted slightly depending on the specific requirements or characteristics of the data. It's also worth considering whether the interval width provides an appropriate level of detail and captures the variation in the data effectively.

Learn more about frequency distribution here:

https://brainly.com/question/30371143

#SPJ11

Other Questions
Use the example above and fill in the missing values.Consider a three-year loan (so we'll assume the numbers 1 through 36) for $5,000 with interest at 10% per year. Usingstandard amortization, the monthly payment is $161.33. In this example, we will not worry about exact or ordinaryinterest because the total Interest to be paid is $808.13.After the fifth month, the borrower decides to prepay the whole loan. Under a stndard amortization plan the borrowerwould have paid $198.28 in cumulative interest. However, using the Rule of 78 a lender would calculate the fraction ofthe total interest based on two series:((n+35)+(n+34)+(n+33)+(n+32)+(n+31))If you add 36, 35, 34, 33, and 32, the sum isIf you sum the numbers from 1 to 36, the sum is{(n)+(n+1)+...+(n+35)}The fraction (the first sum / the total sum) to the nearest tenth =total interest.%. The lender will multiply this fraction by theThe cumulative interest = (the percentage calculated above) x ($808.13) = $The difference between the amount paid under a standard amortization plan and the amount paid under a Rule of 78plan is: $ Can I get help writing an equation in standard form for the parabola Drag each tile to its equivalent measure, rounded to the nearest tenth.Options: 19.8, 10.2, 22.7, 15.4Measure Equivalent4 in. _____ Cm7 kg _____lb6 gal _____L65 ft _____ m using the henderson-hasselbalch equation, calculate the mass of sodium acetate (dry) and volumes of glacial acetic acid (liquid) and dh2o you would need to prepare 50 ml of 0.2 m acetate buffer, ph 4.5. PLZ HELP DUE IN 3 MINUTES!!!! A(n) ______ difference is due to some systematic influence and not due to chance. which strategy is the most effective for a nurse to use to reduce the number of children involved in automobile accidents who were not wearing seat belts? Question 35 (2 points) Listen The following factors are physical complications of obesity during childhood, EXCEPT a) High total cholesterol b) Fatty liver c) Asthma d) Low blood pressure 9. The volume of a triangular prism is 30 cm. Each triangular face has an area of 4 cm. How long is the prism? According to the U.S. Census Bureau, 20.2% of American women aged 25 years or older have a Bachelor's Degree; 16.5% of American women aged 25 years or older have never married; among American women aged 25 years or older who have never married, 22.8% have a Bachelor's Degree; and among American women aged 25 years or older who have a Bachelor's Degree, 18.6% have never married. Required:a. Are the events "have a Bachelor's Degree" and "never married" independent? Explain. b. Suppose an American woman aged 25 years or older is randomly selected, what is the probability she has a Bachelor's Degree and has never married? Interpret this probability. After completing the fraction division 5 divided by five-thirds, Miko used the multiplication shown to check her work. 3 times five-thirds = StartFraction 3 Over 1 EndFraction times five-thirds = StartFraction 15 Over 3 EndFraction or 5 Which is the most accurate description of Mikos work? Miko found the correct quotient and checked her work using multiplication correctly. Miko found the correct quotient but checked her work using multiplication incorrectly. Miko found an incorrect quotient but checked her work using multiplication correctly. Miko found an incorrect quotient and checked her work using multiplication incorrectly. Fill in the missing lettersthes_rus Dex__ousDec__t( I WILL REPORT YOU IF YOU JUST PUT RANDOM WORDS) Limestone can be either a biochemical or a chemical sedimentary rock. Explain how both types of limestone are formed. Make sure to describe the environments in which they were formed. diegetic musicals have non-musician characters often burst into song, seemingly for no reason other than that it's a convention of the form. group of answer choices true false ene, a restaurant manager, is hospitalized after working 15-hour days for several weeks. her anxiety level is severe upon admission. she has not slept well during the past 2 weeks. her psychiatrist has ordered amitriptyline (elavil) 25 mg, to be administered orally, three times daily. rene asks you, her nurse, why she is so drowsy. what is your best response? Need help! Whats x, and what is the equation? Use the given information below to answer the questions. Show ALL your work.The heights of young men follow a Normal distribution with mean 69.3 inches and standard deviation 2.8 inches. The heights of young women follow a Normal distribution with mean 64.5 inches and standard deviation 2.5 inches.LetM = the height of a randomly selected young manW = the height of a randomly selected young woman1. Describe the shape, center, and spread of the distribution of M-W.2. Find the probability that a randomly selected young man is at least 2 inches taller than a randomly selected young woman. plzzzz help me!!!Plz don't steal my points or add a link How does virtue impact the function of government? Bruno's Burgers has a cook to server ratio of 2 to 5. The total number of servers and cooks is 42. How many more servers does Bruno's Burgers employ than cooks?