The density of Na2Co3 solution at 20Celsius is 1.019g/mL. The mass fraction w(Na2CO3) is 0.02 (2%). What's the concentration of the solution?

Answers

Answer 1
1. we are given :

• that the mass fraction of Na2CO3 = 2%

meaning 2 grams of Na2Co3 was dissolved in 98g of water .

∴ total mass of solution = 100g

• Density = 1.019g/mL.

,

• Molar mass Na2CO3=105,9888 g/mol

2. Calculate volume

Density = mass /volume

∴Volume = mass/density = 100g /1.019g/mL.

= 90.66mL.

3.Calculate moles of the solution

n = mass Na2CO3/MolMass Na2Co3

= 2 g /105.9888g/mol

∴moles of Na2CO3 =0.019moles Na2CO3

4. Calculate the Molarity (concentration)of the solution

Molarity =( n/v) * 1000

= (0.019mol/(90.66/1000) L

= (0.019/90.66)*1000 ( multiply by 1000: 90.66/1000=0.09066)

=0.21M

This means that the concentration of the solution is 0.21M

Related Questions

What is the pH of a 0.025 M HCl solution?
12.4
1.6
2.5
05

Answers

Answer:  pH is 1.6

Explanation: Explanation: HCl is strong acid and it protolyzes totally:

HCl + H2O  ⇒ H3O+ + Cl-

Concentrations are same:  [H3O+] = c(HCl)

pH = - log[H3O+] = - log(0.025) = 1.60

A 0.032 mole sample of gas is contained in a 1 L container at 23 degrees Celsius. What is the pressure of the gas?

Answers

Ideal gas law is valid only for ideal gas not for vanderwaal gas.  The pressure of 0.032 mole sample of gas is contained in a 1 L container at 23 degrees Celsius is 0.77atm.

What is ideal gas equation?

Ideal gas equation is the mathematical expression that relates pressure volume and temperature.

Mathematically,

PV=nRT

where,

P = pressure=?

V= volume=1 L

n =number of moles= 0.032 mol

T =temperature = 23°C=296K

R = Gas constant = 0.0821 L.atm/K.mol

P × 1 L = 0.032mole× 0.0821 L.atm/K.mol × 296K

P =0.77atm

Therefore,  the pressure of 0.032 mole sample of gas is contained in a 1 L container at 23 degrees Celsius is 0.77atm.

To learn more about ideal gas equation, here:

https://brainly.com/question/14826347

#SPJ1

find the number of hydrogen atoms of an alkyl group with 2 carbon atoms if n=2​

Answers

Answer:

5

Explanation:

An alkyl group is a functional group that contains only hydrogen and carbon atoms. It has the general formula: CnH2n+1.

Since n=2, plug it into the formula.

C2H2(2)+1

=

C₂H₅

Hope that helps.

Scientists recently discovered that firing low-energy particles at potatoes keeps the potatoes
from developing unwanted sprouts. They observed that these energy particles prevent cell
division in the sprouts. This stops the potatoes from sprouting for up to 120 days. How will this
development most likely affect the potato industry?

Answers

Answer:

By allowing the potatoes to be stored longer so they can be sold during winter months.

Explanation:

Since low energy particles are fired at the potatoes to prevent them from developing unwanted sprouts, it means that it prevents sprouts from growing on the potatoes.

Now, winter is wet period which encourages more growth of the sprouts. Thus, the way this development will affect the industry is that the potatoes will be stored for longer period and then sold in the winter.

mass of 1×10^25 molecules of water​

Answers

Answer:

1.E25 it is the answer the answer to mass of 1×10^25 molecules of water​

Explanation:

this is just EXPLINATION find your answer using this

first divide the number of molecules by Avogadro's number 6.022*10^25

you will

l get no. of Moles of water

multiply the no. of Moles with mass of 1 Mole of water 18g per mole

if get answer you comment

you should try on your own you will understand better

how do you think a device could change the sound that we hear? Make sure you use vocabulary such as frequency, energy and amplitude

Answers

Answer:

good luck tho

Explanation:

• How does the name of the salt tell us that:
a) there is just one other element combined with the metal?
b) there is oxygen present in the salt?​

Answers

The name of the salt tells us that:

a) there is just one other element combined with the metal by looking at the suffix of the salt's name.

b) the presence of oxygen in a salt can be indicated by the name of the salt.

a) The name of a salt can tell us that there is just one other element combined with the metal by looking at the suffix of the salt's name. If the salt name ends in "-ide," it indicates that the salt is composed of a metal and a single non-metal element.
For example, sodium chloride (NaCl) and potassium bromide (KBr) are salts where the metal (sodium and potassium) is combined with a single non-metal element (chlorine and bromine, respectively). The "-ide" suffix suggests the presence of only one other element in the salt.

b) The presence of oxygen in a salt can be indicated by the name of the salt. If the salt name includes the element oxygen, it suggests that oxygen is present in the salt compound.
For example, sodium carbonate (Na₂CO₃) and calcium sulfate (CaSO₄) contain the element oxygen in their chemical formulas. The presence of oxygen in the salt is implied by the name and the combination of elements in the compound.

Therefore, the name of salt tells us that there is just one other element combined with the metal and there is oxygen present in the salt

Learn more about salt here:

https://brainly.com/question/31814919

#SPJ 1

Principal of solvay process​

Answers

Answer:

basic principle involved in solvay process -it is based on low solubility of sodium hydrogen carbonate NaHCO3 whereby it gets precipitated in the reaction of sodium chloride with NH4HCO3. Sodium hydrogen carbonate crystal separates. These are heated to give sodium carbonate.

Explanation:

Thank you.This will help u.

Thermal energy from evaporating water drives weather systems. The regions on Earth that would have the most evaporation are these regions.

Question 1 options:

near the Equator

along the coasts of Asia

near tropical rainforests

along mountain ranges

Answers

Answer:

Near the equator

Explanati

Answer: near the Equator

Explanation:

What is limited reactant?

Answers

Answer:

The limiting reagent is the reactant that is used up completely. This stops the reaction and no further products are made. ... The limiting reagent can also be derived by comparing the amount of products that can be formed from each reactant.

Answer:

The limiting reagent is the reactant that is used up completely. This stops the reaction and no further products are made. ... The limiting reagent can also be derived by comparing the amount of products that can be formed from each reactant.

Explanation:

Disclaimer not my answer I looked it up

How many times would a mole of coke cans, stacked one on top of another, reach from here to Venus and back? Pls provide work​

Answers

Mole of Coke cans (which is approximately 6.02 x 10²³ cans) would reach from here to Venus and back approximately (6.67 x 10¹¹ cans) / (6.02 x 10²³ cans/mol) = 1.11 x 10⁻¹² moles.

What is mole?

Mole is widely used in chemistry as a way to express amounts of reactants and products of chemical reactions.

Total distance traveled = distance from Earth to Venus and back = 2 x 40,000,000,000 meters

So, Number of cans needed = Total distance traveled / height of one can

= (2 x 40,000,000,000 m) / (0.12 m)

= 6.67 x 10¹¹ cans

Therefore, a mole of Coke cans (which is approximately 6.02 x 10²³ cans) would reach from here to Venus and back approximately (6.67 x 10¹¹ cans) / (6.02 x 10²³ cans/mol) = 1.11 x 10⁻¹² moles.

To know more about mole, refer

https://brainly.com/question/24191825

#SPJ1

What is the molarity of a solution that contains 8.4 g NaOH in 240.0 mL of solution?

Answers

Answer:

\(0.875\text{ M}\)

Explanation;

Here, we want to calculate the molarity of the solution

To calculate the molarity, we use the following formula:

\(molarity\text{ = }\frac{number\text{ of moles}}{volume}\)

To calculate the number of moles, we have to divide the mass by the molar mass

The molar mass of sodium hydroxide is 40 g/mol

Thus, we have the number of moles as:

\(\frac{8.4}{40}\text{ = 0.21 mole}\)

The volume to use would be in L

To get this, we divide the given volume by 1000

Thus, we have the volume in liters as:

\(\frac{240}{1000}\text{ = 0.24 L}\)

Finally, we have the molarity as:

\(\frac{0.21}{0.24}\text{ = 0.875 mol/dm}^3\)

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

What happens if you rub a balloon against wool and put it against water dripping from a cup

Answers

Answer:

The water bends due to the static electricity on the balloon.

Explanation:

The static electricity you built up by rubbing it against the balloon attracts the stream of water, bending it towards the comb or balloon like magic!

Negatively charged particles called electrons jump the wool to the balloon as they rub together, the comb now has extra electrons and is negatively charged. The water features both positive and negatively charged particles and is neutral. Positive and negative charges are attracted to each other so when you move the negatively charged balloon towards the stream, it attracts the water's positively charged particles and the stream bends!

720.12 = 207.2012 100 hium has two naturally occurring isotopes. Lithium-6 has an atomic mass of 6.015 amu; lithium-7 ha: omic mass of 7.016 amu. The atomic mass of lithium is 6.941 amu. What is the percentage of natura curring lithium-7? (Make Li-6's percent abundance x and Li-7's percent abundance 1-x)Lithium has two naturally occurring isotopes. Lithium-6 has an atomic mass of 6.015 amu; lithium-7 has an atomic mass of 7.016 amu. The atomic mass of lithium is 6.941 amu. What is the percentage of naturally occurring lithium-7? (Make Li-6's percent abundance x and Li-7's percent abundance 1-x)

Answers

The percentage abundance of the isotope is obtained as  92.5%.

What is the percentage?

We have to know that there are some atoms that have more than one isotope and lithium is quite one of them. Let the naturally occurring isotope have a percentage abundance of x and let the other isotope have a percentage abundance of 1 - x.

Recall that the relative atomic mass of lithium is 6.941.

Then we have that;

6.941 =  7.016x + 6.015(1 - x)

6.941 = 7.016x +  6.015 - 6.015x

6.941 = 1.001x +  6.015

x = 6.941 - 6.015/ 1.001

x = 92.5%

The isotope that can be seen in nature is  92.5% abundant.

Learn more about isotope abundance:https://brainly.com/question/24873591

#SPJ1

A 1.85-mole sample of H₂O2 weighs
(A) 33.3 amu
(B) 35.9 g
C) 62.9 g
(D) 1.85 g
E 33.3 g

Answers

Considering the definition of molar mass, the correct answer is option c): the mass of 1.85 moles H₂O₂ is 62.9 grams.

Definition of molar mass

The molar mass of substance is a property defined as the amount of mass that a substance contains in one mole.

The molar mass of a compound is the sum of the molar mass of the elements that form it (whose value is found in the periodic table) multiplied by the number of times they appear in the compound.

Molar mass of H₂O₂

In this case, you know the molar mass of the elements is:

O= 16 g/moleH= 1 g/mole

So, the molar mass of the compound H₂O₂ is calculated as:

H₂O₂= 2× 1 g/mole + 2× 16 g/mole

Solving:

H₂O₂= 34 g/mole

Mass of 1.85 moles H₂O₂

You can apply the following rule of three: If by definition of molar mass 1 mole of the compound contains 34 grams, 1.85 moles of the compound contains how much mass?

mass= (1.85 moles× 34 grams)÷ 1 mole

mass= 62.9 grams

Finally, the mass of 1.85 moles H₂O₂ is 62.9 grams.

Learn more about molar mass:

brainly.com/question/5216907

#SPJ1

Liquid hexane (CH3(CH2)4CH3) will react with gaseous oxygen (O2) to produce gaseous carbon dioxide (CO2) and gaseous water (H2O). Suppose 35.3 g of hexane is mixed with 57. g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Be sure your answer has the correct number of significant digits.

_ g

Answers

There is 67 gram of CO2 produced in the Octane reaction which is come after 2 SF

PLEASE HELP, IS MY ANSWER CORRECT?
How does the ground temperature in sunlight with CO2 compare with the ground temperature in sunlight without CO2 (part A)? is my answer correct?

Based on the thermometer provided, it is clearly visible that when the simulation is without CO2, the temperature goes higher, however, not as quickly as when CO2 IS present.

Answers

Your answer seems to be partially correct. It is true that the simulation without CO2 shows a rise in temperature, but it's incorrect to say that it goes higher. In fact, the temperature rises more rapidly when CO2 is present. Therefore, the correct answer would be:

Based on the thermometer provided, the ground temperature in sunlight with CO2 rises more rapidly and reaches a higher temperature compared to the ground temperature in sunlight without CO2.

explain the relationship (linear or exponential) between rate and concentration including what order the iodate ion would be in.

CONCENTRATIONS
EXP. 1: 0.020
EXP 2: 0.019
EXP 3: 0.017
EXP 4: 0.016
EXP 5: 0.014
EXP 6: 0.013
EXP 7: 0.011
EXP 8: 0.01
EXP 9: 8.6x10^-3
EXP 10: 7.1x10^-3
EXP 11: 5.7x10^-3
EXP 12: 4.3x10^-3

RATE (s^-1):
EXP 1: 0.283
EXP 2: 0.1972
EXP 3: 0.2353
EXP 4: 0.2033
EXP 5: 0.1701
EXP 6: 0.133
EXP 7: 0.10
EXP 8: 0.1234
EXP 9: 0.077
EXP 10: 0.07380
EXP 11: 0.05102
EXP 12: 0.03883

By looking at the reaction mechanism, propose a Rate Law (WITHOUT the value of K). Explain the exponents for each reactant. Also, how does the rate law proposed compared to the relationship between rate and iodate concentration observed in the Rate law question?

Discuss, with respect to collision theory, the changes in the rates result from the changing concentrations of the iodate ion. What would you predict if we repeated these reactions at higher temperatures? Explain using collision theory.

explain the relationship (linear or exponential) between rate and concentration including what order

Answers

Based on the given data, the relationship between rate and concentration is exponential.

A proposed rate law for the reaction based on the given data is:

Rate = k[IO3⁻]²[H+]

What is the collision theory?

Collision theory suggests that the rate of a chemical reaction is proportional to the frequency and energy of collisions between the reactant molecules.

As the concentration of iodate ions decreases, the frequency of collisions between reactant molecules decreases, which leads to a decrease in the rate of the reaction.

At higher temperatures, the kinetic energy of the reactant molecules increases, which increases the frequency and energy of collisions between reactant molecules.

Learn  more about collision theory at: https://brainly.com/question/20628781

#SPJ1

If I DECREASE the mass and INCREASE the distance, what happens to the force of gravity?​

Answers

Answer:

Decreases

Explanation:

F = GM1M2/R²

please mark me brainliest and 5 star

Binary compounds are formed by ............... ............... elements.

Answers

Answer: i think its A diatomic compound..

Explanation: hope i helped! sorry if im wrong!

In the process of underwater welding, a gas bubble is intentionally formed around the weld to protect it from water until it has cooled. To do so, a mixture of gas is used containing mole fractions of χH2=0.70 (70% hydrogen), χCO2=0.25 (25% carbon dioxide), and χCO=0.05 (5% carbon monoxide). If the total pressure on this gas bubble is 2.6 atm, what are the partial pressures of the three component gases (in atm)?

Answers

Answer:

See explanation

Explanation:

Total number of moles of gases in the mixture; 0.70 + 0.25 + 0.05 = 1 mole

Partial pressure= mole fraction of gas × total pressure

Mole fraction of hydrogen = 0.7/1 × 2.6 = 1.82 atm

Mole fraction of CO2 = 0.25/1 × 2.6 = 0.65 atm

Mole fraction of CO= 0.05/1 × 2.6 = 0.13 atm

Briefly describe how you can use spectra as evidence of nuclear fusion in stars.

Answers

Spectra can be used as an evidence that nuclear fusion occurs in the star through the ability of the elements generated to absorb light at specific wavelength.

The internal part of the star is made up of hydrogen gas, with a little helium.

The helium atom is formed through the nuclear fusion reaction that occurs in the core of the star.

Nuclear fusion reaction involves the combination of two or more atoms which leads to the formation of a new atom with the emission of great energy. This reaction leads to formation of helium elements in the core of the stars.

To detect if nuclear fusion reaction is occurring in the stars, a spectrum is used.

Because each element emits or absorbs light only at specific wavelengths, the chemical composition of stars can be determined using a spectrum.

Learn more here:

https://brainly.com/question/18545784

Which of these is a good source of protein?
А
rice
B
bread
с
beans
D
quinoa

Answers

Answer:

beans

Explanation:

Find the balance equation
_H2O+_O2=_H2O2

Answers

The balanced reaction equation of the reaction is; 2H2O + O2 → 2H2O2

How do we balance reaction equation?

This is a chemical equation that represents the reaction between water (H2O) and oxygen (O2) to form hydrogen peroxide (H2O2). The coefficients in front of each substance indicate the relative number of molecules involved in the reaction.

Recall that we can balance the reaction equation  by ensuring that the atoms of the elements on both sides of the reaction equation are the same as we have above.

Learn more about reaction equation:https://brainly.com/question/3588292

#SPJ1

An acid of known strength, HA, is used in a titration to determine the concentration of a solution of NaOH. What ions are present in the flask at the equivalence point?​

Answers

Answer:

Na+ And A-

Explanation:

Answer: Na + and A-

Explanation:

Given the following data. (i) Ca(s) + 2C(grafite) -> Cacis) X Ca(s) + ⅐0›(g) -> Cao(s) (iit) CaO(s) + H›O(I) -> Ca(OH)(ag) (iv) CHi(g) + 5/20,(8) -> 2C0,(g) + H,0(1) X* (v) C(grafite) + 02(g) -> CO›(g) [4 marks] AH = -62.8 kJ AH = -635.5 kJ AH = -653.1 kJ AH= -1300.0 kJ AH = -393.5 kJ / Calculate AH for the following reaction by using Hess's law and manipulating the given reactions: CaC(s) + H,O(I) - Ca(OH),(ag) + GHa(g) AH = ?

Answers

The enthalpy change (ΔH) for the reaction CaC(s) + H2O(I) → Ca(OH)(ag) + CH4(g) is -3617.6 kJ.

To calculate ΔH for the reaction CaC(s) + H2O(l) → Ca(OH)2(ag) + CH4(g), we can use Hess's law, which states that the enthalpy change of a reaction is independent of the pathway taken and depends only on the initial and final states.

We can manipulate the given reactions to obtain the desired reaction:

(i) Ca(s) + 2C(graphite) → CaC2(s) ΔH = X (unknown value)

(ii) Ca(s) + 1/2O2(g) → CaO(s) ΔH = -635.5 kJ

(iii) CaO(s) + H2O(l) → Ca(OH)2(ag) ΔH = -653.1 kJ

(iv) CH4(g) + 2O2(g) → CO2(g) + 2H2O(l) ΔH = -1300.0 kJ

(v) C(graphite) + 1/2O2(g) → CO(g) ΔH = -393.5 kJ

Now, let's manipulate these equations to cancel out the common reactants and products and obtain the desired reaction:

(i) Ca(s) + 2C(graphite) → CaC2(s) ΔH = X

(ii) Ca(s) + 1/2O2(g) → CaO(s) ΔH = -635.5 kJ

(iii) CaO(s) + H2O(l) → Ca(OH)2(ag) ΔH = -653.1 kJ

(iv) CH4(g) + 2O2(g) → CO2(g) + 2H2O(l) ΔH = -1300.0 kJ

(v) C(graphite) + 1/2O2(g) → CO(g) ΔH = -393.5 kJ

Now, let's sum up the equations to obtain the desired reaction:(i) Ca(s) + 2C(graphite) → CaC2(s) ΔH = X

(ii) 2Ca(s) + O2(g) → 2CaO(s) ΔH = -1271 kJ

(iii) CaO(s) + H2O(l) → Ca(OH)2(ag) ΔH = -653.1 kJ

(iv) CH4(g) + 2O2(g) → CO2(g) + 2H2O(l) ΔH = -1300.0 kJ

(v) C(graphite) + 1/2O2(g) → CO(g) ΔH = -393.5 kJ

By adding equations (ii), (iii), (iv), and (v), we can cancel out CaO(s), H2O(l), and O2(g):

2Ca(s) + 2C(graphite) + CH4(g) → 2Ca(OH)2(ag) + CO(g) ΔH = X -1271 -653.1 -1300.0 -393.5

2Ca(s) + 2C(graphite) + CH4(g) → 2Ca(OH)2(ag) + CO(g) ΔH = X -3617.6 kJ

For more such questions on enthalpy visit:

https://brainly.com/question/14047927

#SPJ8

The reactants are

A

the substances present when the reactions begin.


B

the substances present when the reaction is complete.


C

the properties that change after the reaction.


D

the energy that is released or stored during the reaction.

pls, hurry!!!!!!!!!!!!!!!!

Answers

It’s c because I took the test

4.50 g of a certain Compound X, known to be made of carbon, hydrogen and perhaps oxygen, and to have a molecular molar mass of 128. g/mol, is burned completely in excess oxygen, and the mass of the products carefully measured: product carbon dioxide water mass 15.47 g 2.53 g Use this information to find the molecular formula of X.

Answers

Answer:

\(\mathbf{C_{10}H_8}\)   ( Naphthalene )

Explanation:

Given that:

4.50 g of a Compound X is made up of Carbon , Hydron and Oxygen

It's molecular molar mass = 128 g/mol

Compound X undergoes combustion reaction and the product yield :

CO_2 with mass 15.47g and :

H_2O with mass 2.53 g

The objective is to use this information to determine the molecular formula of X.

We all know that ; number of moles = mass/molar mass

where the molar mass of H_2O is 18 g/mol

number of moles of H_2O product = 2.53 g/18 g/mol

number of moles of H_2O product = 0.1406 moles

Also; the molar mass of CO_2 product = 44 g/mol

number of moles of CO_2 product = 15.47g/ 44 g/mol

number of moles of CO_2 product =  0.3516 moles

number of moles of Compound X in the reactant side= 4.50 g /128 g/mol

number of moles of Compound X n the reactant side= 0.03516 moles

Now; number number of moles of CO_2 in reactant = 0.3516 moles/0.03516 moles

Now; number number of moles of CO_2 in reactant = 10

number of moles of H_2O reactant = 0.1406 moles × 2/0.03516

number of moles of H_2O reactant = 7.997 ≅ 8

Since we said the Compound X is known to be made of Carbon C , Hydrogen H and Oxygen O

Then the molecular formula can be written as :

\(\mathbf{C_{10}H_8O_{x}}\)

In order to find the x; we have

128  = (12 × 10 + 1 × 8 + 16 × x)

128 = 120 + 8 + 16x)

128  =  128 + 16 x

128 - 128 = 16 x

0 = 16 x

x = 0/16

x = 0

As x = 0 ; hence there are no oxygen present in the reaction

Thus; the molecular formula of Compound X = \(\mathbf{C_{10}H_8}\) which is also known as Naphthalene

An object has a mass of 5.52 g and a volume of 12 mL. What is the density of the object?

Answers

Answer:

Density = 0.46 g/mL

Explanation:

Density of a substance can be found by using the formula

\(Density = \frac{mass}{volume} \)

From the question

mass = 5.52 g

volume = 12 mL

Substitute the values into the above formula and solve for the Density

That's

\(Density = \frac{5.52}{12} \)

We have the final answer as

Density = 0.46 g/mL

Hope this helps you

Answer:

Density is 0.46 g/mL

Explanation:

Other Questions
Every artwork ___[ Became, Become, This becomes] New on the Basis of theme Use techniques mediums and methodology Todrick Company is a merchandiser that reported the following information based on 1,000 units sold: Sales $ 405,000 Beginning merchandise inventory $ 27,000 Purchases $ 270,000 Ending merchandise inventory $ 13,500 Fixed selling expense $ ? Fixed administrative expense $ 16,200 Variable selling expense $ 20,250 Variable administrative expense $ ? Contribution margin $ 81,000 Net operating income $ 24,300 Required: 1. Prepare a contribution format income statement. 2. Prepare a traditional format income statement. 3. Calculate the selling price per unit. 4. Calculate the variable cost per unit. 5. Calculate the contribution margin per unit. 6. Which income statement format (traditional format or contribution format) would be more useful to managers in estimating how net operating income will change in responses to changes in unit sales? when a large sum of money is used to structure monthly payments, which product is typically used? What defines a character in a story?. Document 5#The Elementary Education Act, 1870, is a statute which is calculated, more than any other of recent times to elevate the masses of the people and is the result of many years agitation by the various relicious denominationa arul political parties in the State, The object which it wilt acecanplishenay be stated in a very few words. It will place an elementary school wherever there is a child to be taught, whether of rich or poor parents: and it will compel every parent and guardian of a child to have itQuestions :How will the passage of this act change the workforce in Industrial Britain?From the information in the document, and your own knowledge, what does this source indicate about the progress of the Industrial Revolution? Which was the first commercial insurance company in the united states to provide private health care coverage for injuries not resulting in death?. What is the equation, in slope-intercept form, of the line parallel to y=5x+2 that passes through the point with coordinates (-2,1)? when president woodrow wilson negotiated the treaty of versailles in the aftermath of world war i, he felt this was the most important point. The diameterof the Earth is 1.3 10 km.The diameter of the Moon is 3.5 10 km.The diameter of the Sun is 400 times greaterthan the diameter of the Moon.How many times smaller is the diameter ofthe Earth than the diameter of the Sun Choose the inequality that represents the following graph if we break the acceleration of this missile into two components, in the vertical and horizontal direction, what statement correctly characterizes the source of the acceleration? Each student in Mr. Ricardo's class has one camera that holds 320 pictures. He asks each student to delete 1/4 of the pictures and turn in the rest. Which of the following functions best represents the number of pictures, p that Mr. Ricardo will collect depending on the number of cameras, that his students have?A) p=80cB) p=160cC) p=240cD) p=320c What is Hamlet's transformation?. A state offers two lottery games, WinOne and PlayBall. Both games cost $2 per ticket. In WinOne, the player picks a single letter from A to J and a single digit from 0 to 9. If both the letter and the digit match the letter and the digit picked on that day, the player wins $150. In PlayBall, the player picks a single letter from A to T and a single digit from 0 to 9. If both the letter and the digit match the letter and the digit picked on that day, the player wins $280. If the prize for WinOne were increased to $200 for matching both the letter and the digit, what would the expected value be? A. -$0.80 B. -$0.65 C. $0 D. $0.80 What country will soon become the first large industrial economy powered primarily by renewable energy? emptying a conical tank a water tank is shaped like an inverted cone with height 6 m and base radius of 1.5 m Read the following excerpt from Levitt and Dubners Freakonomics. A key fact of white-collar crime is that we hear about only the very slim fraction of people who are caught cheating. Most embezzlers lead quiet and theoretically happy lives; employees who steal company property are rarely detected. With street crime, meanwhile, that is not the case. A mugging or a burglary or a murder is usually tallied whether or not the criminal is caught. A street crime has a victim, who typically reports the crime to the police, who generate data, which in turn generate thousands of academic papers by criminologists, sociologists, and economists. But white-collar crime presents no obvious victim. In this excerpt, the authors present a comparison between various criminals. an argument in favor of reporting crime. a contrast between different types of crime. an argument against embezzlement. The marginal rate of substitution (MRS) of x for Y in consumption refers to the: a. amount of x that a nation must give up for one extra unit of Y and still remain on the same indifference curve b. amount of Y that a nation must give up for one extra unit of x and still remain on the same indifference curve c. amount of X that a nation must give up for one extra unit of Y to reach a higher indifference curve d. amount of Y that a nation must give up for one extra unit of X to reach a higher indifference curve 7 . A high level of ______ directly contributes to the psychological state known as responsibility for outcomes, according to the job characteristics theory. a nurse is discussing ageism with a newly licensed nurse. which statement by the newly licensed nurse indicates an understanding of the concept