Answer:
See explanation
Explanation:
The reaction is shown in the image attached. This reaction occurs by a carbocation (ionic) mechanism.
The lone pair on the nitrogen atom attacks the carbocation leading to the formation of the product as shown in the image attached.
Since the reaction occurs in a 1:1 ratio, two moles of reactants yields two moles of product.
In an ionic compound, the size of the ions affects the internuclear distance (the distance between the centers of adjacent ions), which affects lattice energy (a measure of the attractive force holding those ions together). Based on ion sizes, arrange these compounds by their expected lattice energy. Note that many sources define lattice energies as negative values. Please arrange by magnitude and ignore the sign.
Compunds: RbCl ,RbBr ,Rbl ,RbF
Answer:
The correct answer will be " RbF > RbCl > RbBr > Rbl".
Explanation:
The size of the given ions will be:
RbCl:
⇒ 689kJ/mol
RbBr:
⇒ 660kJ/mol
Rbl:
⇒ 630kJ/mol
RbF:
⇒ 785kJ/mol
Now according to the size, the arrangement will be:
⇒ (785kJ/mol) > (689kJ/mol) > (660kJ/mol) >(630kJ/mol)
⇒ RbF > RbCl > RbBr > Rbl
The bond among all opposite charging ions seems to be strongest whenever the ions were indeed small.
which compound is an electrolyte ? 1) butene 2) propane
Answer:
1.)
Explanation:
Can tell the answer pls
Explanation: where the article????
Complete and balance the reaction for the reduction of silver ions by nitrite under basic conditions.
Ag+(aq)+NO−2(aq)⟶Ag(s)+NO−3(aq)
To see the total number of atoms of an element we need to multiply stoichiometry of that element to the number that is written on the foot of that element. Thus the balanced equation is
NaNO₂(aq)+AgNO₃(s)→NaNO₃(aq)+AgNO₂(s)
What is Balanced equation?Balanced equation is the one in which the total number of atoms of a species on reactant side is equal to the total number of atoms on product side
The unbalanced equation is
NaNO₂(aq)+AgNO₃(s)→NaNO₃(aq)+AgNO₂(s)
Sodium atoms on reactant and product side is 1
Silver atoms on reactant and product side is 1
Nitrogen atoms on reactant side and product side is 2
Oxygen atom on reactant side and product side is 5
Thus the balanced reaction is
NaNO₂(aq)+AgNO₃(s)→NaNO₃(aq)+AgNO₂(s)
Learn more about the balanced equation, here:
https://brainly.com/question/7181548
#SPJ1
URGENT:
(I’ll give first person brainlyist)
What type of elements typically become positively charged ions?
Answer:
The elements that are commonly positive ions are metals. But there are a few gases that can become positively charged by losing electrons.
Typically, when metals and non-metals interact, the metals' electrons are transferred to the non-metals. In contrast to non-metals, which form negatively charged ions, metals form positively charged ions.
The non-metal picks up electrons and gets negatively charged, whereas the metal loses electrons and gets positively charged. Cations and anions are the names given to positively and negatively charged ions, respectively.
Metals are the elements that lose electrons to generate positively charged ions (cations) in all chemical processes, with the exception of hydrogen. Metals are electropositive elements as a result.
To know more about metals, visit;
https://brainly.com/question/29766835
#SPJ6
Why your body needs energy even when you’re not moving
Answer:
Basal metabolic rate (BMR) – even at rest, the body needs energy (kilojoules) to keep all its systems functioning correctly (such as breathing, keeping the heart beating to circulate blood, growing and repairing cells and adjusting hormone levels).
Two asteroids are 75,000 m apart one has a mass of 8 x 10^7 N what is the mass of the other asteroid
The mass of the asteroid is C. 1.2 x \(10^{12}\) Kg
To find the mass of the other asteroid, we can rearrange the equation for the gravitational force between two objects:
F = (G * m1 * m2) / \(r^{2}\)
where F is the force of gravity, G is the gravitational constant, m1 and m2 are the masses of the two asteroids, and r is the distance between them.
Given that the distance between the asteroids is 75000 m, the force of gravity between them is 1.14 N, and one asteroid has a mass of 8 x \(10^{7}\) kg, we can substitute these values into the equation and solve for the mass of the other asteroid (m2):
1.14 N = (6.67430 × \(10^{-11}\) N \(m^{2}\)/\(Kg^{2}\) * 8 x \(10^{7}\) kg * \(m2\)) / \((75000 m)^{2}\)
Simplifying and solving the equation, we find that the mass of the other asteroid (m2) is approximately 1.2 x \(10^{12}\) kg. Therefore, Option C is correct.
The question was incomplete. find the full content below:
Two asteroids are 75000 m apart one has a mass of 8 x \(10^{7}\) kg if the force of gravity between them is 1.14 what is the mass of the asteroid
A. 3.4 x \(10^{11}\) kg
B. 8.3 x \(10^{12}\) kg
C. 1.2 x \(10^{12}\) kg
D. 1.2 x \(10^{10}\) kg
Know more about gravitational force here:
https://brainly.com/question/72250
#SPJ8
The reaction between ethylene and hydrogen bromide to form ethyl bromide is carried out in a continuous reactor. The product stream is analyzed and found to contain 51.7 mol% C2H5Br and 13.3 mol% HBr. The feed to the reactor contains only ethylene and hydrogen bromide. Calculate the fractional conversion of the limiting reactant and the percentage by which the other reactant is in excess. If the molar flow rate of the feed stream is 285 mol/s, what is the extent of reaction
Answer:
Fractional conversion=0.760
Percentage by which the other reactant is in excess=16.56%
extent = 56.23 mol/s
Explanation:
CHECK THE ATT FOR DETAILED EXPLANATION
where do you need to orient your eye level to make accurate reading of the meniscus
Electron affinity is the likelihood of an atom to accept an electron
O A. True
O B. False
If 4.44 mol of C,H₁2 reacts with excess O₂, how many moles of CO₂ will be produced by the following combustion reaction?
C₂H2 +80₂6H₂O +5C0₂
moles of CO₂:
mol
A combustion reaction is a type of chemical reaction that involves the rapid combination of fuel (typically a hydrocarbon) with oxygen, resulting in the release of energy in the form of heat and light.
Combustion reactions are often characterized by the presence of a flame and the production of carbon dioxide (CO₂) and water (H₂O) as products.
In the given balanced combustion reaction:
C₂H₂ + 5O₂ → 4H₂O + 2CO₂
The stoichiometric ratio indicates that 1 mole of C₂H₂ reacts with 2 moles of CO₂ produced. Therefore, if 4.44 moles of C₂H₂ react, we can calculate the moles of CO₂ produced using the ratio:
Moles of CO₂ = (4.44 mol C₂H₂) × (2 mol CO₂ / 1 mol C₂H₂)
Moles of CO₂ = 8.88 mol
Therefore, 8.88 moles of CO₂ will be produced in the combustion reaction.
For more details regarding combustion reaction, visit:
https://brainly.com/question/14335621
#SPJ1
what is the independent and dependent variable in mosa’s experiment.Please help me thank you
Answer:
independent = sugar dependant = kid's hyper
Explanation:
the independent is the part that doesn't change while the dependent is the one that changes because of the independent. the amount of sugar doesn't change but how much sugar the kid get' s affects thw kid's hyper level. hope this helps, i didn't see the full question so make sure you double check what it is asking. the part about what the independent and dependant is correct so use that to make sure this is correct for your question.
To what temperature must a balloon, initially at 9°C and 4.00 L, be heated in order to have a volume of 6.00 L?
The balloon must be heated to a temperature of 150 °C in order to have a volume of 6.00 L.
How are volume and temperature of gases related?The volume of a gas is directly proportional to the temperature of the gas.
According to Charles' law: V1/T1 / = V2/T2
V1 =4.0 L
T1 = 9°C = (273. + 9) K = 282 K
V2 = 6.0 L
T2 = ?
T2 = V2×T1/V1
T2 = 6 × 282 / 4 = 423 K
423.2 K = 423 -273 = 150 °C
Therefore, the balloon must be heated to a temperature of 150 °C in order to have a volume of 6.00 L.
Leran more about gas Charles'law at: https://brainly.com/question/888898
#SPJ1
Using the thermodynamic information in the ALEKS Data tab, calculate the standard reaction entropy of the following chemical reaction: Round your answer to zero decimal places. N2 O2 yields NO2
Answer:
-122 J/K
Explanation:
Let's consider the following balanced reaction.
N₂(g) + 2 O₂(g) ⇒ 2 NO₂(g)
We can calculate the standard reaction entropy (ΔS°) using the following expression.
ΔS° = Σ ηp × Sf°p - Σ ηr × Sf°r
where,
η: stoichiometric coefficients of products and reactantsSf°r: entropies of formation of products and reactantsΔS° = 2 mol × 240.06 J/K.mol - 1 mol × 191.61 J/K.mol - 2 mol × 205.14 J/K.mol
ΔS° = -121.77 J/K ≈ -122 J/K
Using the balanced equation CaC₂(ş) + 2 H₂O(1) --> C₂H₂(g) + Ca(OH)₂(aq) how many moles of Ca(OH)2 would be produced if 3.5 moles of H₂O are consumed?
Answer:
1.75 moles
Explanation:
According to CaC₂(s) + 2 H₂O(l) --> C₂H₂(g) + Ca(OH)₂(aq)
2 moles of H20 will produce 1 mole of Ca(OH)2
therefore 3.5 moles of H2O will produce 3.5 x (1/2) = 1.75 moles of Ca(OH)2
Mechanical Energy
At what point on the rollercoaster is
the kinetic energy the highest?
A. point A
B. point B
C. point C
D. cannot be determined
with the information provided.
Answer:
Point C
Explanation:
Remember that kinetic energy is energy a object has when it's in motion so the higher the speed, the higher the kinetic energy is. In this case we have a roller coaster, as the roller coaster goes up the tracks it's kinetic energy is low because it slows down as it climbs to the top of the hill. Then as it sits on top of the hill it's kinetic energy is little to none before it goes down the hill because the roller coaster isn't in motion. As when the roller coaster goes down the hill it's speed increases meaning the kinetic energy increases which means option C or "point C" is your answer.
Hope this helps.
The activation energy for a reaction is the energy difference between what two components of a reaction?
ANSWER
Reactant and intermediate
EXPLANATION
Activation energy is the minimum energy required to activate a chemical reaction
Activated energy is the difference between the reactants and the intermediate
Therefore, the correct answer is option Dm
Drag the tiles to the correct boxes to complete the pairs. Not all tiles will be used.
Match each SI unit to the quantity it measures.
The SI unit to the quantity it measures are:
mass - kilogram, gramtemperature - kelvintime - second, nanosecondelectric current - ampereWhat is SI unit used for?Mass: The mass of an object is a measure of its amount of matter. The SI unit of mass is the kilogram (kg) or gram (g).
Temperature: Temperature is a measure of the average kinetic energy of the particles in a substance. The SI unit of temperature is the kelvin (K).
Time: Time is a measure of the interval between two events. The SI unit of time is the second (s).
Electric current: Electric current is a measure of the flow of electric charge. The SI unit of electric current is the ampere (A).
Find out more on SI unit here: https://brainly.com/question/16393390
#SPJ1
Complete question:
Drag the tiles to the correct boxes to complete the pairs. Not all tiles will be used.
Match each SI unit to the quantity it measures.
What state
of matter
exists in
area B?
A. gas
B. liquid
C. solid
Pressure
(atm)
61
6543210
0
50 100 150 200
Temperature (°C)
Considering the phase diagram, the state of matter that exists in area B is gas.
The correct option is A.
What is a phase diagram?A phase diagram is a graphical representation that shows the conditions of temperature and pressure at which different phases or states of a substance exist.
The axes of a phase diagram typically represent temperature (usually on the horizontal axis) and pressure (usually on the vertical axis). The diagram is divided into regions that correspond to different phases, and the lines separating these regions represent phase boundaries.
The point where three phase boundaries meet is known as the triple point, which represents the temperature and pressure at which all three phases can coexist in equilibrium.
Learn more about phase diagrams at: https://brainly.com/question/28097253
#SPJ1
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
What is the molarity of solution if 42.1 grams of KOH is dissolved in 3.0 L of solution?
Answer:
the molarity of the solution is 0.25 M.
Explanation:
To calculate the molarity of a solution, we need to know the amount of solute in moles and the volume of the solution in liters.
The first step is to calculate the amount of KOH in moles using its molar mass. The molar mass of KOH is the sum of the atomic weights of potassium (39.1 g/mol), oxygen (16.0 g/mol), and hydrogen (1.0 g/mol):
Molar mass of KOH = 39.1 g/mol + 16.0 g/mol + 1.0 g/mol = 56.1 g/mol
The amount of KOH in moles is:
moles of KOH = mass of KOH / molar mass of KOH
moles of KOH = 42.1 g / 56.1 g/mol
moles of KOH = 0.750 moles
Now that we know the amount of KOH in moles, we can calculate the molarity of the solution:
Molarity = moles of solute / liters of solution
Molarity = 0.750 moles / 3.0 L
Molarity = 0.25 M
Therefore, the molarity of the solution is 0.25 M.
Answer: 9.23 moles of solute
Explanation: It's a hard explanation so you can just have the answer.
Fill in the molecular description; explain what happens when heat is added and removed, make sure to state the change in kinetic energy; and describe any real-world implications or applications for each molecular state.
The mobility of atoms and molecules is increased when energy is added (heating), raising the temperature. By removing energy (cooling), atoms and molecules slow down and the temperature drops as a result.
What is molecular state ?A molecular orbital is a one electron wave function, which is what is meant by the term "molecular level." The molecular levels and orbitals are related (HOMO, LUMO etc).
Methods based on molecular mechanics are frequently used to calculate the precise structures and energy of molecules.
The technique makes use of the core ideas of vibrational spectroscopy and the notion that bonds have natural lengths and angles, and that molecules will select geometries that can best achieve these natural values.
Thus, All the electrons in the molecule combine to form the wave function known as molecular states.
To learn more about the molecular state, follow the link;
https://brainly.com/question/15013597
#SPJ1
Water boils at 100 degrees Celsius. What is the boiling point for water on the Kelvin scale? K = °C + 273 and °C = K - 273
Answer:
the answer is 373
Explanation:
K=°C + 273
K=100+273=373
Suppose certain sample takes 100 min for 750 mL water to percolate into the
soil. Calculate the rate of percolation of water.
The rate of percolation of water into the soil will be 0.125 mL per second
Percolation rateThe rate of percolation of water into the soil is determined by the volume of water that enters the soil per unit of time under specific conditions.
In this case, 750 mL of water percolated in 100 minutes.
100 minutes = 100 x 60 = 6,000 seconds
Percolation rate = 750/6000 = 0.125 mL per second
More on percolation rate can be found here: https://brainly.com/question/16882186
#SPJ1
Which statement accurately describes a type of potential energy found in a container full of a chemical substance in liquid form?
A) The rotation of the particles in one place where potential energy is stored.
B) The vibration of the atoms in molecules is one place where potential energy is stored.
C) The bonds between atoms are one place where potential energy is stored.
D) The speed of the particles is one place where potential energy is stored
Answer:
The bonds between atoms are one place where potential energy is stored.
How many grams of sodium chloride are dissolved in 375 ml of a 0.90% saline solution?
Answer:
337.5 g NaCl
Explanation:
.90% saline solution = 90g saline (NaCl)/100mL water (H2O)
1. Use 375 mL to find mass
375 mL × (90 g NaCl/100 mL) = 337.5 g NaCl in 375 mL .9% saline solution
The amount of sodium chloride dissolved in 375 ml of a 0.90% saline solution is 337.5 g.
What is the concentration of the solution?The concentration can be calculated when we have the molecular formula and its molecular weight. The concentration of the solution is calculated as the weight of a solute divided by the volume of the solution.
The weight/volume percentage of the solution is determined in the following way.
W/v (%) = weight of the solute/Volume of the Solution ( in mL)
Given, the concentration of the saline solution = 0.90 %
0.90 % saline solution means 90 g of NaCl is dissolved in 100 ml of water.
Given, the volume of solution = 375 ml
100 ml of saline solution containing NaCl = 90 g
Then 375 ml of saline solution containing NaCl = 90 ×375/100 = 337.5 g
Therefore, the amount of NaCl is equal to 337.5 g.
Learn more about molar concentration, here:
brainly.com/question/21841645
#SPJ2
What happens to the amount of solution when we add food colour to it?
Answer:
We need more? What else is in the question? This is unanswerable.
Explanation:
What do chemists study?
A. The properties of matter and how matter changes
B. How matter and energy interact
C. Mathematical principles
D. Living things
SUBMIT
A. The properties of matter and how matter changes.
Answer: A. the properties of matter and how matter changes
Explanation:
just got it right
i need help what is s-1/3=7/9???? please help guys and thank you
Answer:
10/9
Explanation:
First, let's convert 1/3 and 7/9 so that the have the same denominator. To do this let's find the least common multiple of 3 and 9.
List the multiples of 3 and 9:
3: 3, 9
9: 9
They have a least common multiple of 9
We need to convert 1/3 so it has a denominator of 9:
1/3*3/3 (we can multiply it by 3/3 because any number over itself is 1) = 3/9
s-3/9=7/9
Add 3/9 to both sides to isolate s
s=10/9
except for speed, your nervous system is most similar to
A-A metro bus that makes many stops along its route
B-an air trip where you take multiple planes to get to your destination
C-A cruise ship that makes a circular route back home to port
D-a race car speeding down a track, making pit stops occasionally
Your nervous system is most similar to a cruise ship (option C).
The nervous system is a complex network in the body in charge of:
Automatic responses and movements.Voluntary movements.Responses to the world.This system works due to the action of structures such as:
The brain.The spinal cord.The nerves.Moreover, the nervous system works through the following steps:
A stimulus is received, for example, you accidentally touch a hot surface.This is taken by the nerves to the brain.The brain processes the information and sends a response, for example, to move the hand away from the hot surface.Based on this, the system resembles a cruise ship because signals go from the senses to the brain and then back again similar to a cruise going away and then back to the port.
Learn more about brain in: https://brainly.com/question/5361122
Answer:
THIS IS THE CORRECT ANSWER
an air trip where you take multiple planes to get to your destination.
Explanation:
I did the other answer and I got it wrong so this is the correct answer