What is the coefficient in this expression?5 minus 4.7 minus 2 x + StartFraction 5 over 8 EndFractionNegative 4.7Negative 2StartFraction 5 over 8 EndFraction5

Answers

Answer 1

Answer:

-2

Step-by-step explanation:

i did the test


Related Questions

necesito ayuda porfaa

necesito ayuda porfaa

Answers

From the equation, the value of m is 4

How to determine the value of m?

The given parameter is

0.m1+ 0.m2 + 0.m3 = 11/14

Simplify this to have

m1 / 99 + m2 / 99 + m3 / 99 = 11/14

Simplify the equation further

( m1 + m2 + m3 ) / 99 = 11/14

⇒( m1 + m2 + m3 ) = 126

By multiplication we have

( 10 * m + 1 ) + ( 10 * m + 2 ) + ( 10 * m + ) = 126

Simplify to get

30 * m + 6 = 126

30 * m = 120

m = 4

Therefore the value of m is 4

Learn about subject formula on https://brainly.com/question/29064960

#SPJ1

Translated question:

Please help, given that 0.m1 +0.m2 +0.m3 = 14/11, Find the value of m

find the difference for 60-30

Answers

Answer:

30

Step-by-step explanation:

Answer:

30

Step-by-step explanation:

60-30

6-3 = 3

0-0 = 0

60 - 30 = 30

How does SAS work in math?

Answers

In mathematics, SAS stands for 'Side-Angle-Side' which is a criterion used to determine congruence (equality in size and shape) between two triangles.

The SAS criterion states that if two triangles have two sides that are proportional in length

and the included angles between those sides are congruent, then the two triangles are congruent.

To understand how SAS works,

Side,

This refers to a specific side of a triangle.

In the SAS criterion, we compare the lengths of the sides of two triangles to determine if they are proportional.

Angle

This refers to a specific angle within a triangle.

In the SAS criterion, compare the angles formed by the corresponding sides of the two triangles to determine if they are congruent.

Side-Angle-Side

This combination of a side, an angle, and another side is what we compare between two triangles.

If the two triangles have the same proportions for the corresponding sides and the same measures for the included angles,

they are considered congruent.

To illustrate this, let's consider an example

Suppose we have two triangles, triangle ABC and triangle DEF.

If side AB is proportional in length to side DE, angle BAC is congruent to angle EDF, and side BC is proportional in length to side EF,

then conclude that triangle ABC is congruent to triangle DEF using the SAS criterion.

By applying the SAS criterion,

mathematicians can determine whether two triangles are congruent without relying on other criteria such as Side-Side-Side (SSS),

Angle-Angle-Side (AAS), or Side-Angle-Angle (SAA).

Congruence is a fundamental concept in geometry and plays a significant role in various geometric proofs and constructions.

learn more about SAS here

brainly.com/question/30108160

#SPJ4

Evaluate the expression 33.15/n n=1.5

Answers

Answer:

22.1

Step-by-step explanation:

33.15/n

33.15/1.5

= 22.1

A lake near the Arctic Circle is covered by a thick sheet of ice during the cold winter months. When spring arrives, the warm air gradually melts the ice, causing its thickness to decrease at a rate of 0.2 meters per week. After 7 weeks, the sheet is only 2.4 meters thick.
Let y represent the ice sheet's thickness (in meters) after x weeks.

Complete the equation for the relationship between the thickness and number of weeks.
y=_____

Answers

The equation for the relationship between the thickness and number of weeks is y = 3.8 - 0.2x

How to write equation?

Ice lost per week = 0.2 metersIce remaining after 7 weeks = 2.4 metersNumber of weeks = xRelationship between the thickness and number of weeks = y

Ice lost at 7 weeks = 7(0.2) = 1.4 meters

Total thickness of ice before loss = Ice remaining after 7 weeks + Ice lost at 7 weeks

= 2.4 + 1.4

= 3.8 meters

The equation:

y = Total thickness of ice before loss - (Ice lost per week × Number of weeks)

= 3.8 - (0.2 × x)

y = 3.8 - 0.2x

Learn more about equation:

https://brainly.com/question/8284719

#SPJ1

A bee flies at 10 feet per second directly to a flowerbed from its hive. The bee stays at the flowerbed for 20 ​minutes, and then flies directly back to the hive at 8 feet per second. It is away from the hive for a total of 22 minutes.
a. What equation can you use to find the distance of the flowerbed from the​ hive?
b. How far is the flowerbed from the​ hive?

Answers

Using the equation we know that the flowerbed is 2250 feet away from the hive.

What are equations?

A mathematical assertion that has an "equal to" symbol between two expressions with equal values is known as an equation.

As in 3x + 5 Equals 15, for instance.

So, let's say the flowerbed is feet away from the hive.

The bee travels directly from its hive at a speed of 20 feet per second to a flowerbed before returning at a speed of 12 feet per second.

Time = distance/speed

Therefore, the bee needed x/20 seconds to get to the flowerbed and x/12 seconds to fly back to the hive.

The bee spends a total of 20 minutes, or 2060 seconds, or 1200 seconds away from the hive. I

t spends 15 minutes, or 1560 seconds, at the flowerbed.

Consequently, the equation will be:

x/20 + x/12 + 900 = 1200

3x + 5x/60 = 300

8x = 60 * 300

8x = 18000

x =  18000/8

x = 22550


Therefore, using the equation we know that the flowerbed is 2250 feet away from the hive.

Know more about equations here:

https://brainly.com/question/28937794

#SPJ1

Complete question:
A bee flies at 10 feet per second directly to a flowerbed from its hive. The bee stays at the flowerbed for 20 ​minutes, and then flies directly back to the hive at 8 feet per second. It is away from the hive for a total of 22 minutes.

What equation can you use to find the distance of the flowerbed from the​ hive?

What is the value of k?​

What is the value of k?

Answers

Answer:

10°

Step-by-step explanation:

According remote interior angles, 4k + 5 + 6k + 10 = 115.

10k + 15 = 115

10k = 100

k = 10

Hope this helps :)

Have a nice day!

Answer:

k = 10°

Step-by-step explanation:

      According to the exterior angle theorem, the exterior angle will be equal to the two opposite inside angles added together. It will look like the following, and we solve for k from there.

115° = (4k + 5)° + (6k + 10)°

115° = 4k° + 5° + 6k° + 10°

115° = 6k° + 4k° + 10°  + 5°

115° = 10k° + 15°

100° = 10k°

10° = k

k = 10°

(PLS HURRY!) On​ Melissa's 6th​ birthday, she gets a ​2000$ CD that earns ​6% ​interest, compounded. If the CD matures on her 14th ​birthday, how much money will be​ available?

(PLS HURRY!) On Melissa's 6th birthday, she gets a 2000$ CD that earns 6% interest, compounded. If the

Answers

Using compound interest formula when the CD matures on Melissa's 14th birthday, there will be $3187.69 available.

What is Compound Interest?

The interest that is calculated using both the principal and the interest that has accrued during the previous period is called compound interest. It differs from simple interest in that the principal is not taken into account when determining the interest for the subsequent period with simple interest. Compound interest is commonly abbreviated C.I. in mathematics.

Use the formula for compound interest to calculate the amount of money that will be available when the CD matures -

\(A = P(1 + r/n)^(nt)\)

Where A is the amount of money available when the CD matures, P is the initial principal, r is the interest rate, n is the number of times the interest is compounded per year, and t is the time in years.

In this case, the initial principal is $2000, the interest rate is 6%, and the CD will be held for 8 years (from Melissa's 6th to 14th birthday).

It is not given how many times per year the interest is compounded, so assume it is compounded annually.

Using these values in the formula -

\(A = $2000(1 + 0.06/1)^(1*8)A = $2000(1.06)^8A = $3187.69\)

Therefore, the value is obtained as $3187.69.

To learn more about compound interest from the given link

brainly.com/question/28020457

#SPJ1

Evaluate cos 150° without using a calculator.Ο Α.√32B. 2O C. -1/2OD. -32

Evaluate cos 150 without using a calculator. .32B. 2O C. -1/2OD. -32

Answers

Answer:

Explanation:

Note that:

\(\begin{gathered} cos(A+B)=cosAcosB-sinAsinB \\ cos(150^0)=cos(90+60) \end{gathered}\)

Applying the addition formula given above to cos 150:

\(\begin{gathered} cos(150)=cos(90)cos(60)-sin(90)sin(60) \\ \\ cos(150)=0(\frac{1}{2})-1(\frac{\sqrt{3}}{2}) \\ \\ cos(150)=0-\frac{\sqrt{3}}{2} \\ \\ cos \end{gathered}\)

Help pls

Two digits of the 6-digit number X = 345 * 8* are missing. Fill in the missing digits
so that the number obtained is the smallest possible number that is divisible by 45.
Find X.

Help pls Two digits of the 6-digit number X = 345 * 8* are missing. Fill in the missing digitsso that

Answers

The smallest possible number that is divisible by 45 when the blanked place of the number is filled is 345285.

What is the divisible rule of 9 and 5?

The divisible rule of 9 and 5 are:

Divisible rule of 9- When the addition of all number is divisible by 9, then that number also divisible by 9.Divisible rule of 5- When a number has a digit 0 or 5 in the last of it, then that number also divisible by 5.

Two digits of the 6-digit number are missing.

\(X = 345 * 8*\)

The smallest possible number from this is divisible by 45. The factors of 45 are 9 and 5.

\(45=9\times5\)

Thus, the 6-digit number which is divisible by 45, must be divisible by 9 and 5.  

To be divisible with 5, the number has 0 or 5 in last. So the numbers can be,

\(X = 345 * 85\\X=345 * 80\)

For first number, when the blank is filled with number 2 to make sum 9 and for second the blank number should be 7. Thus, the numbers,

\(X = 345 285\\X=3457 80\)

Thus, the smallest possible number that is divisible by 45 when the blanked place of the number is filled is 345285.

Learn more about the smallest common factor here;

https://brainly.com/question/16054958

#SPJ1

Kiley found $8.75 in nickels and quarters in the cabinet above the washing machine. Let x represent the number of nickels
she found and y represent the number of quarters. Which equation written in standard form represents the amount of
money she found, and what does its y-intercept represent?
O The equation in standard form is 0.05x + 0.25y = 8.75; the y-intercept represents that if she found 0 nickels, she must
have found 175 quarters.
The equation in standard form is 0.05x + 0.25y = 8.75; the y-intercept represents that if she found 0 nickels, she must
have found 35 quarters.
The equation in standard form is x + 5y =175; the y-intercept represents that if she found 0 nickels, she must have found
175 quarters.
The equation in standard form is x + 5y =175; the y-intercept represents that if she found 0 nickels, she must have found
35 quarters.

Answers

Answer:

0.05x+0.25y=8.75; the y intercept represents that if she found 0 nickels she must have found 35 quarters.

Step-by-step explanation:

1. Solve for y:

0.25y= 8.75-0.05x (subtract 0.05x on both sides)

y= (8.75-0.05x)/0.25 (divide by 0.25 on both sides)

2. Since the y intercept can be found when x equals 0, plug in 0 for x into the equation.

y=(8.75-0.05(0))/0.25

y= 8.75/0.25

y=35

PLEASE help
Allen mixes 1 cup of water that is 150°F and 1 cup of cold chicken broth that is 50°F. The end temperature of the mixture would be about___________
. Chris combines 2 cups of soup that is 50°F with 1 cup of water that is 150°F. The end temperature of the mixture would be ______

Answers

Answer:

1) 100 degrees F

2) 50 degrees F

Step-by-step explanation:

its just simple subtraction

Tell whether the angles are complementary or supplementary. Then find the value of x.

Tell whether the angles are complementary or supplementary. Then find the value of x.

Answers

Answer:

The angles are supplementary.

x = 31

Step-by-step explanation:

The way the two angles lay together and make a straight line shows that they are supplementary. Supplementary means that they add up to 180°

Use this idea to write an equation.

2x + 3x + 25 = 180

combine like terms

5x + 25 = 180

subtract 25

5x = 155

divide by 5

x = 31

Answer:

x = 31

Step-by-step explanation:

(3x + 25) and 2x are a linear pair and are supplementary, that is

3x + 25 + 2x = 180

5x + 25 = 180 ( subtract 25 from both sides )

5x = 155 ( divide both sides by 5 )

x = 31

Which of the following are solutions to the equation y= - 1/2 x + 3 . —->

Which of the following are solutions to the equation y= - 1/2 x + 3 . ->

Answers

Answer:2,2

Step-by-step explanation:

!35 POINTS! Find the total surface area of the following prism! ​

!35 POINTS! Find the total surface area of the following prism!

Answers

Total surface area is 152 cm

Answer:

152

Step-by-step explanation:

Why is this still worth 18 points?
because if you math 12+273 it = 8281 or something free point thank

the ratio of peter's age to richard's age is $5:8.$ the ratio of john's age to peter's age is $7:12.$ none of the three are over $100$ years old. what is the sum of their ages?

Answers

The sum of Peter, Richard, and John's ages is 191.

We know that the ratio of Peter's age to Richard's age is = 5/8 --(i)

The ratio of John's age to Peter's age is = 7/12 --(ii)

Similarly, the ratio of John's age to Richard's age is = (5*7)/(8*12)= 35/96 -(iii)

Using the value of (i),(ii),(iii), we get -

Age of Peter = (5*12)/(8*12) = 60/96

= 60 years of age

Age of John = (7*5)/(12*5) = 35/60

=35 years of age

From the value of (iii), since no one is over 100 years of age, the age of Richard= 96 years of age

Hence the sum of their ages is = 96+35+60

= 191

Therefore, we know that the sum of their ages is 191.

Learn to know more about Ratios at

https://brainly.com/question/13419413?referrer=searchResults

#SPJ4

A car travels 30 km in 5.5 hours and 400 km in 5.5 hours find the average speed of the car during the entire journey

Answers

Answer:

This is your answer

A car travels 30 km in 5.5 hours and 400 km in 5.5 hours find the average speed of the car during the

Answer:  39.09 km per hour average

Step-by-step explanation:

add total distance and divide by total time

(30+400)/(5.5+5.5)

430/11=39.0909

right triangle abc is shown. triangle a b c is shown. angle a c b is a right angle and angle c b a is 50 degrees. the length of a c is 3 meters, the length of c b is a, and the length of hypotenuse a b is c. which equation can be used to solve for c? sin(50o)

Answers

The equation that can be used to solve for c in the given right triangle is the sine function: c = (3 meters) / sin(50°).

In the given right triangle ABC, we are given that angle ACB is a right angle (90°) and angle CBA is 50°. We also know the length of side AC, which is 3 meters. The length of side CB is denoted by "a," and the length of the hypotenuse AB is denoted by "c." To solve for c, we can use the trigonometric function sine (sin). In a right triangle, the sine of an acute angle is defined as the ratio of the length of the side opposite the angle to the length of the hypotenuse. In this case, we can use the sine of angle CBA (50°) to find the ratio between side CB (a) and the hypotenuse AB (c).

The equation c = (3 meters) / sin(50°) represents this relationship. By dividing the length of side AC (3 meters) by the sine of angle CBA (50°), we can find the length of the hypotenuse AB (c) in meters. Using the given equation, we can calculate the value of c by evaluating the sine of 50° (approximately 0.766) and dividing 3 meters by this value. The resulting value will give us the length of the hypotenuse AB, completing the solution for the right triangle.

To learn more about sine function click here;

brainly.com/question/32247762

#SPJ11

H= 51.34
Please work out the volume of this.

H= 51.34Please work out the volume of this.

Answers

The volume of the prism is

70 cm³

How to find the volume of the prism

The volume of the prism is solved by the formula

= area of triangle * depth

Area of the triangle

= 1/2 base * height

base = p = cos 51.34 * √41 = 4

height = q = sin 51.34 * √41 = 5

= 1/2 * 4 * 5

= 10

volume of the prism

= area of triangle * depth

= 10 * 7

= 70 cm³

Learn more about volume of prism at

https://brainly.com/question/23766958

#SPJ1

3. Find the first derivative for each of the following: A. y = 3x² 3x2 + 5x + 10 B.y = 100200x + 7x C. y = In (9x4)

Answers

A) First derivative for y = 3x² + 5x + 10 is dy/dx = 6x + 5; B) First derivative of for, y = 100200x + 7x is dy/dx = 100207 ; C) First derivative for y = In (9x4) is dy/dx = 4 / (3x).

A. y = 3x² + 5x + 10:

First derivative of the given equation, y = 3x² + 5x + 10 is as follows:

dy/dx = d/dx (3x²) + d/dx (5x) + d/dx (10)dy/dx

= 6x + 5

Since there are no exponents in 5x, the derivative of 5x is simply 5.

Similarly, since 10 is a constant, the derivative of 10 is zero.

B. y = 100200x + 7x:

First derivative of the given equation, y = 100200x + 7x is as follows:

dy/dx = d/dx (100200x) + d/dx (7x)dy/dx

= 100200 + 7

= 100207

C. y = In (9x4):

The given equation is, y = In (9x4).

The first derivative of this function can be obtained as follows:

dy/dx = 1 / (9x4) * d/dx (9x4)dy/dx

= 1 / (9x4) * 36x3dy/dx

= 4x3 / (3x4)dy/dx

= 4 / (3x)

Therefore, the first derivative of the given function y = In (9x4) is 4 / (3x).

A) First derivative forgiven equation, y = 3x² + 5x + 10 is dy/dx = 6x + 5; B) First derivative for given equation, y = 100200x + 7x is dy/dx = 100207 ; C) First derivative for given equation, y = In (9x4) is dy/dx = 4 / (3x).

To know more about first derivative, refer

https://brainly.com/question/31464785

#SPJ11

Is -4 a real or imaginary number?

Answers

Answer:

Real number

Step-by-step explanation:

Unless it has an i with it then it's an imaginary number but because it doesn't have an i with it it's real

Answer:

real number

Step-by-step explanation:

Hi! -4 is a real number because imaginary numbers are characterized as i= sqrt -1

If you see a number with an i in it, then it is imaginary. In this case, however, we have a real number.

I hope this helps!

What is the area of the figure? pls help !

What is the area of the figure? pls help !

Answers

Hello !

Answer:

\(\boxed{\sf Option\ C \to A=155ft}\)

Step-by-step explanation:

To calculate the area of this figure, we will divide it into three smaller figures as shown in the attached file.

Now that we have three rectangles A, B, and C.

The formula to calculate the area of a rectangle is:

\(\sf A_{rec} = Length\times Width\)

Let's calculate the area of the 3 rectangles using the previous formula :

\(\sf A_A=12\times 5=60ft\)

\(\sf A_B = 7\times5=35ft\)

\(\sf A_C=12\times 5 =60ft\)

Now we can calculate the total area of the figure.

\(\sf A=A_A+A_B+A_C\\A=60+35+60\\\boxed{\sf A=155ft}\)

Have a nice day ;)

What is the area of the figure? pls help !

PLEASE HELP ME ANSWER QUESTION

PLEASE HELP ME ANSWER QUESTION

Answers

This is the correct answer
PLEASE HELP ME ANSWER QUESTION

Lola (from the Loud House) has two coins.
What are the odds of tossing both coins and get head on one and tails on another?

Answers

Answer:

likely (hope this helped!)

Step-by-step explanation:

Hello there! Coco here!UwU UwU UwU UwU UwU UwU!Answer: 50%There are two sides on a coin.So, there are two chances she may get either side.

A recent study reported that 60% of the children in a particular community were overwoight or obese. Suppose a random sample of 200 public school children is taken from this community. Assume the sample was taken in such a way that the conditions for using the Central Limit Theorem are met. We are interested in finding the probability that the proportion of overveightfobese children in the sample will be greater than 0.57. Complete parts (a) and (b) below. a. Before doing any calculations, determine whether this probability is greater than 50% or less than 50%. Why? A. The answer should be less than 50%. because 0.57 is less than the population proportion of 0.60 and because the sampling distribution is approximately Normal. B. The answer should be greater than 50%, because the resulting z-score will be positive and the sampling distribution is approximately Normal. C. The answer should be greater than 50%, because 0.57 is less than the population proportion of 0.60 and because the sampling distribution is approximately Normal. 0. The answer should be less than 50%, because the resulting z-score will be negative and the sampling distribution is approximately Normal.

Answers

The probability that the proportion of overweight or obese children in the sample will be greater than 0.57 is less than 50%.

The first paragraph summarizes the answer, stating that the probability is less than 50% because 0.57 is less than the population proportion of 0.60, and the sampling distribution is approximately normal.

In the second paragraph, we can explain the reasoning behind this conclusion. The Central Limit Theorem states that for a large sample size, the sampling distribution of the sample proportion will be approximately normal, regardless of the shape of the population distribution. In this case, the sample was taken in a way that meets the conditions for using the Central Limit Theorem.

Since the population proportion of overweight or obese children is 0.60, any sample proportion below this value is more likely to occur. Therefore, the probability of obtaining a sample proportion greater than 0.57 would be less than 50%. This is because the resulting z-score, which measures how many standard deviations the sample proportion is away from the population proportion, would be negative.

To summarize, the probability of the proportion of overweight or obese children in the sample being greater than 0.57 is less than 50% because 0.57 is less than the population proportion of 0.60, and the sampling distribution is approximately normal.

To learn more about probability click here, brainly.com/question/31828911

#SPJ11

Perform the indicated operation and simplify the result. 9x^(2)-1/12x^(2)-12x divide by 9x^(2)+12x+3/3x^(2)-6x+3 =

Answers

Given expression:  \(\frac{9x^2 - 1}{12x^2 - 12x} \div \frac{9x^2 + 12x + 3}{3x^2 - 6x + 3}\) . We can simplify the given expression by multiplying the numerator and denominator of the first fraction by (3x-1) and then factorise. So, the simplified expression is \($\frac{3(x-1)^2}{4x(3x+1)(x+1)}$\).

In the second fraction, we can factorise the quadratic expression in the numerator.

=  \(\frac{9x^2 - 1}{12x^2 - 12x} \cdot \frac{3x^2 - 6x + 3}{9x^2 + 12x + 3}\)

= \(\frac{(3x-1)(3x+1)}{12x(x-1)} \cdot \frac{3(x^2 - 2x + 1)}{3(3x^2 + 4x + 1)}\)

Simplify the expression.

= \(\frac{(3x-1)(x-1)}{4x(x-1)} \cdot \frac{(x-1)^2}{(3x+1)(x+1)}\)

= \(\frac{3(x-1)}{4x} \cdot \frac{(x-1)}{(3x+1)(x+1)}\)

= \(\frac{3(x-1)^2}{4x(3x+1)(x+1)}\) . Thus, the simplified expression is \($\frac{3(x-1)^2}{4x(3x+1)(x+1)}$\).

For more questions on: factorise

https://brainly.com/question/30587338

#SPJ8  

a collection of nickels, dimes, and quarters consist of 70 coins with a total of $ 8.00 . if there are 2 times as many dimes as quarters, find the number of each type of coins.

Answers

The number of each type of coins are as follows:

q = 15 quarters.

d = 30 dimes.

n = 25 nickels.

How to determine the number of each type of coins?

In order to solve this word problem, we would assign a variables to the unknown numbers and then translate the word problem into algebraic equation as follows:

Let d represent the number of dimes.

Let q represent number of quarters.

Let n represent number of nickels.

Let T represent total number of coins.

Note: 1 quarter is equal to 0.25 dollar, 1 nickel is equal to 0.5 dollar, and 1 dime is equal to 0.1 dollar.

Translating the word problem into an algebraic equation, we have;

Dimes; d = 2q     .....equation 1.

Nickels; (70 - (q + 2q)) = (70 - 3q)     .....equation 2.

Total coins; T = n + d + q

0.5(70 - 3q) + 2q(0.1) + q(0.25) = 8.00

Multiplying all through by 100, we have:

5(70 - 3q) + 2q(10) + q(25) = 800

350 - 15q + 20q + 25q = 800

350 + 30q = 800

30q = 800 - 350

30q = 450

q = 450/30

q = 15 quarters.

For the number of dimes, we have:

Dimes, d = 2q

Dimes, d = 2(15)

Dimes, d = 30 dimes.

For the number of nickels, we have:

Nickels, n = (70 - 3q)

Nickels, n = (70 - 3(15))

Nickels, n = (70 - 45)

Nickels, n = 25 nickels.

Read more on equations here: https://brainly.com/question/1511173

#SPJ1

The altitude of an airplane is decreasing at a rate of 42
feet per minute. What is the change in altitude of the airplane over a period of 20
minutes?

Answers

Answer: -840 feet

Step-by-step explanation: -42 (since the plane is LOSING altitude) x 20 (mins) = current elevation

3) Shay is looking to go camping with her family. Choice A charges a $150
membership fee plus $15 per night. Choice B charges a $75 membership fee
plus $35 per night. Shay wants to know how many nights will the cost be the
same. Which equation should she use to correctly answer the question?
A) 150x+35=35x+75
B) 150+35x=15x+75
C) 150x+15=35+75x
D) 150+15x=75+35x

Answers

Answer:

The answer is B

Step-by-step explanation:

B)150+35x=15x+75

Given the following LP model, which is the correct standard form? Max(Z)=2X1+X2 Restrictions / Constrains 11×1+3×2≥33
8×1+5×2≤40
7×1+10×2≤70
7×1+10×2≤70 X1,X2≥0 Use this problem's information to answer questions 19 to 21. a. Max(Z)=3×1+2X2
11×1+3×2−51≤33
8×1+5×2+52≥40
7×1+10×2+53≥70
b. Max(Z)=3×1+2×2 11×1+3×2+51=33 8×1+5×2−52=40 7×1+10×2−53=70
c. Max(Z)=3×1+2×2 11×1+3×2−51=33 8×1+5×2+52=40 7×1+10×2+53=70
d. Max(Z)=3×1+2×2 11X1+3×2+$1=33 8×1+5×2+52=40 7×1+10×2+53=70

Answers

The correct standard form for the given LP model is option C: Max(Z) = 3x1 + 2x2, subject to the constraints 11x1 + 3x2 - 5 <= 33, 8x1 + 5x2 + 5 >= 40, and 7x1 + 10x2 + 5 >= 70, with x1, x2 >= 0. This option aligns with the original objective function and constraints of the LP model.

To convert the LP model into standard form, we need to rewrite the constraints with the variables on the left-hand side and constants on the right-hand side, with inequality signs (<= or >=) consistent throughout. Additionally, we introduce slack or surplus variables to transform any non-standard constraints.

In option C, the constraints are correctly transformed as 11x1 + 3x2 - 5 = 33, 8x1 + 5x2 + 5 >= 40, and 7x1 + 10x2 + 5 >= 70. These constraints are consistent with the original model. The objective function remains the same, Max(Z) = 3x1 + 2x2.

Option A has incorrect signs in the transformed constraints, and option B introduces surplus variables (+5) instead of slack variables (-5), resulting in an incorrect standard form. Option D includes a non-standard term with a dollar sign, which is inconsistent with linear programming conventions.

Therefore, option C is the correct standard form, adhering to the original LP model's objective function and constraints.

Learn more about LP model here : brainly.com/question/33051152

#SPJ11

Other Questions
hellllppppp me plssss No peace no development a product mix is best defined as:a.all products of a particular typeb.product, price, promotion and distributionc.all products offered by a firmd.some of the products sold by one firme.a procuct line What are the supply factors that have led to the growth in fintechs? Briefly describe each factor and its role in the emergence of fintechs. Itinuturing itong paglabas ng pera sa paikot nadaloy ng ekonomiya dahil itinabi ang peranghindi ginagamit na pambili ng produkto,serbisyo, at salik ng produksiyon. write the correct words in each blank using the cues in parentheses to complete each general description. you will not use every word in each word bank. pay attention to word order (adjectives before or after the noun?) and the definite or indefinite article you need. make sure that your adjectives agree in number and gender with the nouns they are modifying and be sure to end each description with a period when needed. there is more than one way to order the words in 15 POINTS PLEASE ANSWERWhat equation can be used to find the following: "9 is 45% of what number" can someone help How would describe the people who settled Plymouth? ANSWER ALL OF THEM NOT PICKINGa. You have a 10 volt parallel circuit, with 2 resistors on it. What is the voltage across the first resistor? Across the second?b. You have the same two resistors on a 10 volt series circuit. Will the voltage going into the second resistor be more, less, or the same as that going into the first resistor? Exact numbers arent needed!c. You have a series circuit with a current of 6 amps and three resistors on it, with resistances of 10 ohms, 5 ohms, and 6 ohms, respectively. What is the voltage of this circuit? Show your calculation. which expression is equivalent to 2n+n-0.65n3n-0.653n - 0.352.65n2.35n symplify this plssss Which equation is a proportion?721928.1134208326=4.9 The points (14,22) and (49,77) form a proportional relationship. Find the slope of the line throughthe points. Then use the slope to graph the line.The slope is The nasal cavity connects to the pharynx through two openings called the a) nasal septa b) nasal conchae c) paranasal sinuses d) external nares Consider theta =239.a. State an angle coterminal to theta. _______b. Sketch theta.c. What is the reference angle? _____ are necessary to plan for facility expansion. Long-range forecasts Intermediate-range forecasts Make-to-order operations Make-to-stock operations 26 . 26 8 | i need help with this 3. You fall and scrap your skin. When you look at your painful scrap it has turned red and avariety of tissue has flaked off, but you are not bleeding. Explain why this has happened usingrelevant skin structure vocabulary. a job has 10 days of processing time left to do before completion, and today is the 5th day of the month. if the job is due on the 15th day of the month, what is its critical ratio? Andre earns $4000 a month at his new job. In order to track his spending and saving, he created a monthly budget. Andre divided his income into five categories and created the following circle graph to represent the budget he created for himself.Circle GraphExplain how to find the dollar amount that represents the part of his monthly budget labeled "Rent".