Answer:
\(2.63\ \text{g}\)
Explanation:
Mass of carbon = 1.076 grams
Moles of carbon = \(\dfrac{1.076}{12}=0.08967\ \text{mol}\)
1 Mol of vitamin C = 6 moles of carbon
\(0.08967\ \text{mol}\) = 6 moles of carbon
Moles of vitamin C = \(\dfrac{1}{6}\times 0.08967=0.014945\ \text{mol}\)
Molar mass of vitamin C = \(12\times6+1.00794\times 8+16\times 6=176.06352\ \text{g/mol}\)
Mass of vitamin C
\(\text{Moles of vitamin C}\times \text{Molar mass of vitamin C}\\ =0.014945\times 176.06352 \\ =2.63\ \text{g}\)
The mass of vitamin C is \(2.63\ \text{g}\)
A 25.0-mL sample of 0.100M Ba(OH)2(aq) is titrated with 0.125 M HCl(aq).
How many milliliters of the titrant will be needed to reach the equivalence point?
Answer:
20.0
Explanation:
NaOH = (25.0) (0.100m) \ 0.125M = 20.0mL
acetyl-coa brings carbon atoms to the citric acid cycle. these carbon atoms are passed through many intermediary steps. for example, there are
Acetyl-CoA brings carbon atoms to the citric acid cycle. These carbon atoms are passed through many intermediary steps. For example, there are 4 carbon atoms (C) present in oxaloacetate.
About Acetyl-coaA molecule important in metabolism and is useful in many biochemical reactions is called Acetyl-coa . The main function of this molecule is to provide as many carbon atoms which are in the acetyl group to the citric acid cycle to be oxidized to obtain energy, and synthesize a neurotransmitter named acetylcholine which is obtained by a chemical reaction with the help of the enzyme choline acetyltransferase and a by-product in the form of coenzyme A.
Generally, the metabolism of fatty acids will produce acetyl-CoA for the citric acid cycle. In the liver, when the circulation of fatty acids is too high, the production of acetyl CoA from reduction of fat will exceed the energy needed by the cells of the body and will form a ketone group. The high ratio of ketone groups in the blood circulation can cause ketosis or ketoacidosis.
Learn more about acety-coa at https://brainly.com/question/16000193.
#SPJ4
About how far does the S wave travel through Earth in 13 minutes? 2,000 km 4,000 km 6,000 km 8,000 km
Answer:
It travel's about 4,000 km through the Earth in 13 minutes.
Answer:
4,000 km is the correct answer!!!
3. What allows us to see the moon from Earth?
A. The North Star shines on the moon's surface.
B. Light from the sun shines on the moon's surface.
C. Earth gives off light and makes the moon glow.
D. The moon gives off its own light to make it glow.
Answer:
the answer would be the B
What are the types of forces involved in the production of hydro-electricity
Answer:
There are three types of hydropower facilities: impoundment, diversion, and pumped storage. Some hydropower plants use dams and some do not. The images below show both types of hydropower plants.
Explanation:
How can you identify ethane from ethene
Which of the following atoms are stable?
Lithium
Aluminum
Carbon
Neon
Answer:
Neon
Explanation: The valence electrons of Neon are filled.
Hope it helps you:)))))
Have a good day.
CO2 + H2O → C6H12O2 + O2
In a chemical equation, such as the one for photosynthesis above, which is thec
correct order of terms from left to right?
Products, Yield, Reactants
There is no correct order, any order is acceptable.
O Yield, Reactants, Products
Answer:
B
Explanation:
Answer:
bExplanation:
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
given mass of sodium sulphate contains 1.052 moles of oxygen atom then moles of sodium atom present in it would be equal to (ans=0.526)
how to solve this please help me...!
Ce clasă ești sa văd daca te pot ajuta
If a molecule has a triple bond, what can be assumed about the bond compared to a molecule with a double bond?
The length is more than a double bond
The strength is more than a double bond
The strength is less than a double bond
The length is the same as a double bond
While the length is less than a double bond, the strength exceeds that of a double bond.
Within the same molecule, how do triple bonds differ from double bonds?Due to the presence of two bonds rather than one, triple bonds are stronger than double bonds. An sp-sp sigma bond is created when one of each carbon atom's two sp hybrid orbitals intersects with the corresponding orbital from the other carbon atom.
Compared to double bonds, are triple bonds more durable and longer?Six electrons are shared by a sigma bond, two bonds, and a triple bond. Double bonds are more powerful than single bonds, and triple bonds are more powerful than double bonds, according to experiments.
To know more about double bond visit:-
https://brainly.com/question/30575593
#SPJ1
Answer: third
Explanation:
one parent has type AB blood while the other has Type O blood.Which two blood type could their children have?
A mother who is blood type O can only pass an O allele to her son or daughter. A father who is blood type AB could pass either an A or a B allele to his son or daughter. This couple could have children of either blood type A (O from mother and A from father) or blood type B
#6
For a particular redox reaction, MnO2 is oxidized to MnO−4
and Ag+ is reduced to Ag. Complete and balance the equation for this reaction in basic solution. Phases are optional.
balanced redox reaction:
MnO_{2} + Ag^{+} -> MnO_{4}^{-} +Ag^{+}
MnO2+Ag+⟶MnO−4+Ag+
The balanced redox equation is \(2MnO_2 + 4Ag+ + 4H+\) → \(2MnO^{-4} + 4Ag + 2H_2O.\)
A balanced redox reaction refers to a chemical reaction that involves oxidation and reduction and has balanced charges and atoms on both sides of the reaction equation.
In a balanced redox reaction, the oxidation and reduction reactions take place simultaneously, with the oxidation of the reducing agent leading to the reduction of the oxidizing agent, hence balancing the electrons and charges on both sides of the equation.
The balanced redox reaction of \(MnO_2+Ag^+\)⟶\(MnO^{-4}+Ag+\) is as follows:
\(2MnO_2 + 4Ag+ + 4H+\) → \(2MnO^{-4} + 4Ag + 2H_2O\)
The reaction involves the oxidation of \(MnO_2\)to \(MnO^{-4}\)and the reduction of Ag+ to Ag. The\(MnO_2\) acts as the reducing agent while Ag+ acts as the oxidizing agent. The reaction takes place in an acidic medium with H+ ions.
The electrons involved in the reduction and oxidation reactions are balanced, and the charges on both sides of the equation are equal.
In summary, the balanced redox reaction of \(MnO_2+Ag+\)⟶\(MnO^{-4}+Ag+\) is a chemical reaction that involves oxidation and reduction of the reactants to produce products that have equal charges and atoms on both sides of the equation.
The balanced redox equation is \(2MnO_2 + 4Ag+ + 4H+\)→ \(2MnO^{-4} + 4Ag + 2H_2O.\)
Know more about redox equation here:
https://brainly.com/question/21851295
#SPJ8
help for 1 though 7 pls
Answer:
Explanation:
1/ I
2/ III
3/ V
4/ II
5/ IV
6/ 5
7/ 55
describe another medical condition or disease where the primary system causes a serious problem with a secondary system
Answer:
Congestive heart failure
Explanation:
Congestive heart failure happens when your heart gets too weak to pump blood from the lungs out to the body. Pressure builds up in the heart which puts pressure on the blood vessels of the lungs. This will lead to leakage of the vessels and the fluids build up in the air sacs of the lungs. This condition is called pulmonary edema.
Pulmonary edema occurs when fluid builds up in the lungs making it hard to breathe. It may start out as running out of breath easily but if left untreated (both conditions) symptoms get worse over time.
Calculate the mass (in grams) of chlorine (Cl2) gas sample which occupies a 2.50 L container at a pressure of 1.22 atm and temperature of 27.8°C?
Answer:Nothing
Explanation:
The answer is nothing the tempatature isnt matched with the degrees this is false
The classic Mendelian phenotypic ratio when a heterozygote self-crosses is _____
Answer:
phenotypic ratio.
Answer:
dihybrid
Explanation:
because of two different genes assort independently into gametes
How can we use liquid nitrogen? What are the purposes of using liquid nitrogen?
Answer:
Liquid nitrogen can be used to freeze biological tissue. Liquid nitrogen is -210°C which will stop all biological decomposition in the tissue and preserve it.
Explanation:
What mass of NaCl is needed to produce a 26.4 mol/L with a 1.7 L volume?
we would need 2625.13 grams (or 2.62513 kilograms) of NaCl.
To calculate the mass of NaCl required to produce a 26.4 mol/L solution with a 1.7 L volume, we need to use the formula that relates the mass of solute, moles of solute, and molarity:Molarity (M) = moles of solute / liters of solution Rearranging this formula, we get:moles of solute = Molarity (M) x liters of solutionWe can use this formula to find the moles of NaCl needed:moles of NaCl = 26.4 mol/L x 1.7 L = 44.88 molNow, we can use the molar mass of NaCl to convert from moles to grams. The molar mass of NaCl is 58.44 g/mol:mass of NaCl = moles of NaCl x molar mass of NaClmass of NaCl = 44.88 mol x 58.44 g/mol = 2625.13 gTo produce a 26.4 mol/L solution with a 1.7 L volume.
for more question on NaCl
https://brainly.com/question/23269908
#SPJ8
when a _____ is formed, the substances are chemically bonded and lose their original properties. they can be separated by physical means
When a compound is formed, the substances are chemically bonded and lose their original properties.
What is a compound?A compound is made up of two or more substances that are joined with chemical bonds. The compound that is formed is different from the substances. For example, water is a compound, made up of oxygen and hydrogen.
The compounds are of different types. They are covalent compounds, ionic compounds, and intermetallic compounds.
Thus, the substances that are chemically bonded and lose their original properties are called compounds.
To learn more about the compound, refer to the below link:
https://brainly.com/question/14658388
#SPJ1
A pure substance with one type of atom is called a(n)
A. element
B. family
C. period
D. group
Argon (Ar): [Ne]3s23p6 core electrons valence electrons
Answer:
1. The core electrons are 10
2. The valence electrons are 8
Explaination:
Core electrons are electrons located in the inner shells of and atom.
Valence electrons are electrons located on the outermost shell of an atom
From the question given above, we obtained:
Ar (18) => [Ne] 3s²3p⁶
Recall
Ne (10) => 1s² 2s²2p⁶
Therefore,
Ar (18) => [1s² 2s²2p⁶] 3s²3p⁶
From the above illustration,
Inner shell (core shell) => 1s² 2s²2p⁶
Outermost shell (valence shell) => 3s²3p⁶
1. Determination of the core electrons
Inner shell (core shell) => 1s² 2s²2p⁶
Core electrons = 2 + 2 + 6
Core electrons = 10
2. Determination of the valence electrons
Outermost shell (valence shell) => 3s²3p⁶
Valence electron = 2 + 6
Valence electron = 8
Answer:
10 core electrons
8 valence electrons
Explanation:
HelapPPPpPPPPpThe three states of matter that may change during a physical change are O atoms, molecules, electrons O color, shape, size O solid, liquid, gas
Answer:
Solid liquid and gas
Explanation:
What does the 195 represent in the isotope notation?
195Pt
78
The representation that 195 has here is the atomic mass
What does the 195 represent in the isotope notation?
The number 195 in the isotope notation represents the mass number of the isotope. In this case, the isotope notation is for the element platinum (Pt) with a mass number of 195 and an atomic number of 78 (which is given as a subscript). The mass number is the sum of the number of protons and neutrons in the nucleus of an atom of the element. Therefore, the isotope notation for this element indicates that it has 78 protons and 117 neutrons (since 195 - 78 = 117).
Read more on atomic mass here:https://brainly.com/question/3187640
#SPJ1
Jasmin has two gases in separate containers. One gas is colorless, while the other is brown. She connects the
containers and allows the gases to mix.
What change indicates that the gases are chemically reacting?
Select all that apply.
The temperature of the container decreases.
The gas mixture becomes blue over time.
The gases stay in their separate containers and do not mix.
The gases move over time and mix.
The gases are chemically reacting The gas mixture becomes blue over time.
A chemical reaction is a process by which one or more substances' reactants are transformed into one or more other substances' products. Substances are either chemical elements or compounds. Chemical reactions rearrange the constituent atoms of reactants to produce different substances as products.
Gas evolution reactions are chemical reactions in which one of the end products is a gas such as oxygen or carbon dioxide. Gas evolution reactions can be performed in a fume hood if the gases produced are toxic or explosive upon inhalation. Gas formation is a third indication that a reaction may have occurred. The formation of bubbles when two liquids are mixed usually indicates the formation of gas.
Learn more about Gas evolution here:-https://brainly.com/question/2167727
#SPJ1
After precipitation falls, the water moves into the lithosphere through
openings in the rock or soil. What is this process called?
O
A. Evaporation
B. Mineralization
C. Percolation
OD. Sublimation
SUBMIT
D
HANA
After precipitation falls, the water moves into the lithosphere through openings in the rock or soil. This process is called percolation.
Therefore, Option C is the correct option.
What is Evaporation?Evaporation is defined as the process of conversion of liquid into vapours.
For example: Conversation of water into water vapours.
But int he question, there is no conversion. So this option is incorrect option.
What is Sublimation?Sublimation is the process of conversion of solid directly into the vapour phase
Since, there is no conversion of of solid into vapours. So, this option also incorrect option.
What is Mineralization?Mineralization is defined as the process through which chemicals which is present in organic matter are decomposed or oxidized easily in the available forms to plants.
As there is no decomposition of minerals. So, this is also incorrect option.
What is Percolation?Percolation is defined as the process in which liquid slowly allow to pass through a filter.
So, this is correct option.
Thus, we concluded that the water moves into the lithosphere through openings in the rock or soil. This process is called percolation.
learn more about Sublimation:
https://brainly.com/question/11044849
#SPJ9
What answer should be reported, with the correct number of significant figures, for the following calculation? (433.621 - 333.9) × 11.900
Answer:
1187 ( four S.D. )
Explanation:
(433.621 - 333.9) × 11.900 333.9 has only 4 S.D. answer should only have 4 S.D
= 1186.6799 = ~ 1187 with 4 Significant Digits
4. Which formula represents the binary molecular compound dinitrogen tetroxide?
O N₂0
ON₂04
O NO4
O N₂02
N₂0₄ is the formula represents the binary molecular compound dinitrogen tetroxide. Therefore, option B is correct.
What is the binary molecular compound ?Binary molecular compounds are made up of exactly two nonmetal elements. HF, NO2, and P2O5 are a few examples. It is extremely simple to name binary molecular compounds. The first element is given its element name, followed by ide; the second element is given its root (hydr, bor, carb, ox, fluor, etc.).
In N₂0₄ molecule there are two nitrogen atoms at the suffix so, it is binary and in oxygen atom its suffix is 4 so, it is tetroxide. Therefore, N₂0₄ is the formula represents the binary molecular compound dinitrogen tetroxide.
Thus, option B is correct.
To learn more about the binary molecular compound, follow the link;
https://brainly.com/question/7960132
#SPJ1
What is the expected major organic product from the treatment of 4-methyl-2-pentyne with excess hydrogen in the presence of a platinum catalyst?
a. (E)-4-methyl-2-pentene
b. (Z)-4-methyl-2-pentene
c. (E)-2-methyl-2-pentene
d. (Z)-2-methyl-2-pentene
e. 2-methylpentene
Answer:
(Z)-4-methyl-2-pentene
Explanation:
Hydrogenation is a syn addition. This implies that the hydrogen atoms add to the same face of the multiple bond.
Hence, if we have the alkyne, 4-methyl-2-pentyne which reacts with excess hydrogen in the presence of a platinum catalyst, we obtain (Z)-4-methyl-2-pentene since the hydrogen atoms add on the same side of the multiple bond.
What is the number of moles of solute in 7.3L of a 4.6M solution?
Answer:
33.58 Moles
Explanation:
7.3 L * 4.6 M / L = 33.58 Moles