Answer:
what is the molarity of a solution that contains 3.4 moles of NaCL in 2.2 L of solution ?
Explanation:
when an atom gains an electron it becomes a cation true or false
Answer: False
Explanation: Gaining an electron which has a negative charge results in an overall negative charge, thus making this an anion, and the answer, false.
Answer:false
Explanation:it becomes a anion
If the base is also monoprotic, then at the endpoint the number of _________of acid equals the number of _______ of base.
Since the base is also monoprotic, the number of moles of acid equals the number of moles of base.
Monoprotic acid and baseA monoprotic acid is an acid that contains only one proton that can react with a base while a monoprotic base can only react with only one proton. Examples of a monoprotic acid include; HCl, HNO3, etc. Examples of a monoprotic base are KOH and NaOH.
If the base is also monoprotic, then at end point, the number of moles of acid is equal to the umber of moles of base.
Learn more about acids and bases: https://brainly.com/question/10468518
In 5-7 sentences, identify and explain Newton's three laws of motion.
Use the "RAP" method to answer this short-answer question:
Restate the question.
Answer the question.
Prove your answer citing textual evidence from the course.
Don't forget to use complete sentences and proofread your answer.
Newton's laws of motion are stated and explained below:
First law - an object remains in its state of motion in a straight line unless acted upon by an external force. This explains why moving objects are reluctant to stop and objects are rest are reluctant to move.
Second law - the change in the momentum of a body is directly proportional to the applied force and takes place in the direction of the applied force. This explains why acceleration increases with force.
Third law - action and reaction are equal and opposite.
This means that every force has a balancing force acting in the opposite direction
What are Newton's laws of motion?Newton's laws of motion are the laws that describe the observed phenomena of objects in motion.
The laws of motion are useful in determining the various features of motion in a straight line such as velocity, acceleration, impulse, and momentum.
Learn more about Newton's laws of motion at: https://brainly.com/question/28171613
#SPJ1
what ocurrrs when the vapor pressure of a liquid is equal to the external atmospheric pressure
Answer:
The change from a liquid phase to a gaseous phase.
so the answer would be it changed to a gaseous phase
---------------
This is what occurs when the vapor pressure of the liquid is equal to the atmospheric pressure exerted on the liquid.
Determine what elements are denoted by the following electron configurations:
6) 1s²2s²2p 3s²3p4
7) 1s²2s²2p 3s²3p64s²3d¹04p65s¹
8) [Xe] 6s²4f¹2
9) [Xe] 6s4f45d10
10) [Ne]3s²3p4
The arrangement of an atom's or molecule's electrons in atomic or molecular orbitals is known as the electron configuration in atomic physics and quantum chemistry.
What is electron configurations?
One orbital can house a maximum of two electrons, and there are four different types of orbitals (s, p, d, and f). More electrons can be held in the p, d, and f orbitals since they contain various sublevels. Each element's position on the periodic table determines the specific electron configuration of that element. The arrangement of an atom's or molecule's electrons in atomic or molecular orbitals is known as the electron configuration in atomic physics and quantum chemistry.
A standardized notation is used for expressing electron configurations, in which the energy level and type of orbital are written first, followed by the number of electrons in the orbital, which is expressed in superscript. For instance, carbon's (atomic number: 6) electronic configuration is 1s22s22p2.
Hence. The elements are denoted by the electron configurations are,
1) Beryllium
2) Boron
3) Magnesium
4) Silicon
5) Phosphorus
6) Calcium
7) Nickel
8) Krypton
9) Bromine
10) Strontium
The complete question is,
Determine the elements denoted by the following electron configurations.
To learn more about electron configurations refer to:
https://brainly.com/question/26084288
#SPJ13
Which of the following pairs of solutions produces a precipitate when combined?
O NH4Cl and AgNO3
O Na₂SO4 and KCI
O Fe(NO)3 and KCI
O KOH and NH4CI
Answer:
Answer is NH4Cl and AgNO3
Explanation:
:)
please help asap !! i don’t know if that’s the right answer
Answer:
b, c and d (last three options)
Explanation:
It can't be the first one because:
On the left hand side there is one of everything and then on the right, ther is one zinc, two chloride and 2 hydrogen atoms. It is unbalanced
Second one:
there are 8 carbons on both sides, 20 hydrogens on both sides and 26 oxygen on both sides. It is balanced
Third
1 copper on both sides, 2 hydrogens on both sides and 1 oxygen on both sides. It is balanced
Fourth
4 silver on both sides and 2 oxygens on both sides
According to Reference Table I, which reaction has a heat of reaction equal
to -283 kJ/mole at 25°C and I atmosphere?
A) C(s) + O2(g) + CO2(g)
B) CO(g) + O2(g) + CO2(g)
C) N2 +102 + NH3(g)
D) 20 + 3H2 → CzH6
Three letters of dna nucleotides make up a word called a.
A codon is made up of three nucleotides of DNA and represents a single amino acid that will be added to a growing polypeptide chain during protein synthesis.
Three letters of DNA nucleotides make up a word called a codon. DNA nucleotides are molecules that contain three components: a sugar molecule, a phosphate group, and a nitrogen-containing base. The nucleotides in DNA are adenine (A), cytosine (C), guanine (G), and thymine (T).These nucleotides are arranged in a specific sequence to form genes. Each gene contains the instructions for the synthesis of a specific protein. The process of protein synthesis begins with transcription, during which a segment of DNA is copied into messenger RNA (mRNA). The mRNA molecule contains a sequence of codons that specify the sequence of amino acids in the protein.In summary, a codon is a sequence of three nucleotides in DNA that codes for a specific amino acid. A gene is a sequence of nucleotides in DNA that contains the instructions for making a protein. During protein synthesis, the codons in mRNA specify the sequence of amino acids that will be added to a growing polypeptide chain.
To know more about nucleotides visit :
https://brainly.com/question/16308848
#SPJ11
a piece of metal weighing 137.6 g is placed in a graduated cylinder containing 235.2 ml of water. the combined volume of solid and liquid is 260.3 ml. what is the density in grams per milliliter, of the metal? (
The density in grams per milliliter, of the metal is 5.49 g/ml
The mass of a material per unit volume is known as density.. It is often represented by the symbol ρ (rho) and is defined by the equation:
ρ \(= \frac{m}{V}\), where m represents mass and V represents volume.. Density can also be expressed as a specific gravity (SG), which is a relative measure of density compared to the density of water. The equation for specific gravity is SG = ρ/ρH₂O, where ρH₂O is the density of water.The density of the metal can be calculated using the equation:
Density = \(\frac{Mass }{ Volume}\)
Mass = \(137.6 g\)
Volume = \(260.3 ml - 235.2 ml = 25.1 ml\)
Density = \(\frac{137.6 g }{ 25.1 ml}\)
Density =\(5.49 g/ml\)
Therefore , the density in grams per milliliter, of the metal is \(5.49 g/ml\)
learn more about Density Refer:brainly.com/question/29775886
#SPJ4
Oxygen gas is prepared in the laboratory through the catalytic decomposition of hydrogen peroxide. Define a catalyst
Answer:
Catalyst:
Explanation:
A catalyst is a substance that increases the rate of a chemical reaction without itself undergoing any permanent chemical change.
enough of a monoprotic acid is dissolved in water to produce a 1.51 m solution. the ph of the resulting solution is 2.85 . calculate the ka for the acid.
Answer:
Ka = 1.32 x 10^-6
Explanation:
First we should find the [H+].
pH = -log[H+], so [H+] = 10^-pH = 10^-2.85 = 0.00141 M
Then we can set up the equilibrium value
Which will be Ka = [A-][H+]/[HA], we can assume A- = H+
The final concentration of Acid will be initial - H+ as all H+ is formed from this acid.
Ka = [0.00141][0.00141]/[1.51-0.00141] = 1.32 x 10^-6
What happens to the atomic mass of the elements moving from left to right within a period?
A. The atomic mass stays the same within a period.
B. The atomic mass fluctuates throughout the period.
C. The atomic mass decreases.
D. The atomic mass increases.
Answer:
The atomic mass increases.
Explanation:
Define decomposers????
Answer:
Decomposers are used to break down substances. In chemistry, this is the breaking down of organic molecules into simpilar compounds that are able to be sused
A compound has an empirical formula of CH20. What is its molecular formula, if its molar mass is 360 g/mol?
a. C6H12O6
b. C12H24O12
Answer:
a
Explanation:
A actual molecule of glucose contains six carbon atoms, twelve hydrogen atoms, and six oxygen atoms.
Answer:
B.
Explanation:
Simon has collected three samples from the coral reef where he observes marine life. He must determine whether
each one is a pure substance or a mixture.
Appearance
When heated
Sample A
Sample B
Sample C
Sample A is a
Clear liquid
Clear, blue
liquid
Opaque, whitish
liquid
Evaporates completely at
70°C
Boils at 90°C, leaving blue
crystals behind
Boils at 100°C, leaving
white crystals behind
Sample B is a
When left over time
Appearance does not change
Appearance does not change
Dust appears to settle to the
bottom
and Sample C is a
Dona
From the collected three samples from the coral reef we can conclude that:
SAMPLE A - pure substance.
SAMPLE B - homogeneous mixture.
SAMPLE C - heterogeneous mixture.
Pure substances and mixtures are the two broad categories into which matter can be divided.
A sort of matter known as a pure substance has qualities that are constant throughout the sample and a stable composition that makes it the same everywhere (meaning that there is only one set of properties such as melting point, color, boiling point, etc. throughout the matter).
A mixture is said to be homogenous if its composition is constant throughout. Because the dissolved salt is evenly distributed throughout the whole salt water sample, the salt water described above is homogenous.
A combination is said to be heterogeneous if its composition is not constant throughout. Vegetable soup is a complex concoction. Each mouthful of soup will have differing percentages of the various veggies and other ingredients.
To learn more about mixtures visit the link:
https://brainly.com/question/24898889?referrer=searchResults
#SPJ9
What is the mass of 3.5 moles of silicon? (to the nearest tenth)
Answer: 112.2 g
Explanation:
The atomic mass of silicon is 32.065 g/mol, so 3.5 moles have a mass of (3.5)(32.065) grams, or about 112.2 g
EASY!!!!! ILL MARK BRAINLIEST!!!!!!!!
why does measured current differ from calculated current
Answer:
No component is perfect. All have tolerances that can vary. If you construct a simple circuit where a 10 volt power supply feeds a 10 ohm resistor, you would expect to measure a current of one ampere. BUT - the wiring has some resistance too. This adds perhaps 0.1 ohms to the circuit. The resistor has a +-5% tolerance. If it is 5% high, it may measure 10.5 ohms. That's a total circuit resistance of 10.6 ohms. The power supply may have a tolerance of +-1%. Suppose it's 1% low. That's an output of 9.9 volts in real life. So you have 9.9 volts dropped across 10.6 ohms. you will measure closer to 0.934 amps instead of 1.000 amps. To make matters worse, most electronic components have a temperature coefficient, that is, their values change with different temperatures. You may get a completely different reading tomorrow if the temperature is different! Finally, with current measurements in particular, you are inserting the ammeter in series with the circuit under test. Ammeters have some inherent resistance too, so by putting the ammeter in the circuit, you are changing the very current you are trying to measure (a little)! Oh yeah, the ammeter has a tolerance too. Its reading may be off a little even if everything else is perfect. Sometimes you have to wonder how we get a decent reading at all. Fortunately the errors are usually fairly small, and not all tolerances are off in the same direction or off the maximum amount. They tend to cancel each other out somewhat. BUT - in rare circumstances everything CAN happen like I said, and the error can be huge.
Explanation:
2. Calculate the number of moles of propane you have in 5.78 x1024 molecules of propane = CH
Answer:
Molar mass of C3H8 = C 3 (12.01 g/mol) = 36.03 (g/mol)
H 8 (1.008 g/mol) = 8.064 (g/mol)
44.09 (g/mol)
74.6 g propane x 1 mole propane x 6.022 x 10
23
molecules
44.09 g propane 1 mole propane
= 1.02 x 10
24 molecules propane
Explanation:
What does a subscript indicate in a chemical formula?
A. The number of atoms of that element in the molecule
B. The number of bonds that element forms in the molecule
C. The position in the molecule that element occupies
D. The atomic number of the element in the molecule
the answer is A: The number of atoms of that element in the molecule
Answer:
The number of atoms of that element in the molecule
Explanation:
Which are signs of Chemical Change (pick all that apply)
Color Change
Gas Formation
Solid Formation
Liquid Formation
Energy Change
might be gas change or colour change
The decay of chlorine in a distribution system follows first-order decay with a rate constant of 0. 380 d-1. If the concentration of chlorine in a well-mixed water storage tank is 1. 50 mg/L at time zero, what will the concentration be three days later? Assume no water flows out of the tank
After three days, the concentration of chlorine in the well-mixed water storage tank will be 0.88 mg/L.
The decay of chlorine in a distribution system follows first-order decay, which means that the rate of decay is proportional to the concentration of chlorine. The rate constant (k) for the decay is 0.380 d-1. If the initial concentration of chlorine in the tank is 1.50 mg/L, the concentration of chlorine after t days can be calculated using the first-order decay equation:
C(t) = C(0) × \(e^{-kt}\)
Where C(0) is the initial concentration and C(t) is the concentration after t days. To find the concentration of chlorine three days later, we plug in t = 3, C(0) = 1.50, and k = 0.380 into the equation:
C(3) = 1.50 × e^(-0.380 × 3) = 1.50 × e^(-1.14) = 0.88 mg/L
So, after three days, the concentration of chlorine in the well-mixed water storage tank will be 0.88 mg/L.
Learn more about chlorine:
brainly.com/question/14962130
#SPJ4
Describe two physical properties and one chemical property of the materials used for dental braces,
The physical and chemical properties of the dental braces would be listed and explained below.
What are dental braces?Dental braces are the dental devices or tools that are used for correction of abnormally developed tooth.
Wearing of dental braces can help to permanently straighten the teeth.
The physical properties of dental braces include the following:
they have abrasion and abrasion resistancethey have thermal diffusivity and coefficient of thermal expansion.The chemical properties of dental braces is that they are chemically inert leading to its ability to avoid any reaction with the wet (as well as low and high pH) environment of the mouth.
Learn more about dental braces here:
https://brainly.com/question/28348626
#SPJ1
electron affinity and ionization energy do not rigorously adhere effective nuclear charge arguments because:
The capacity of an atom to absorb electrons can be indicated by its electron affinity. An atom gains electrons more readily the lower its first electron affinity. The ability of an atom to gain electrons is weaker the higher the electron affinity. The ionization energy demonstrates an atom's capacity to lose electrons.
What is effective nuclear charge ?
The attractive positive charge of nuclear protons acting on valence electrons is known as effective nuclear charge. Due to the shielding effect, the effective nuclear charge is always smaller than the total amount of protons in a nucleus.
To know about effective nuclear charge from the link
https://brainly.com/question/13647434
#SPJ4
5When copper metal is added to silver nitrate in solution, silver metal and copper(II) nitrate are produced. What mass of silver is produced from 51 g of Cu
When copper metal is added to silver nitrate in a solution, the resulting products are silver metal and copper (II) nitrate. If 51 g of copper is used, we need to determine the mass of silver that will be produced.
To solve this problem, we need to use the balanced chemical equation:
Cu + 2AgNO3 → 2Ag + Cu(NO3)2
From the equation, we can see that one mole of copper reacts with two moles of silver nitrate to produce two moles of silver and one mole of copper (II) nitrate.
Step-by-step solution:
1. Calculate the number of moles of copper used
The molar mass of copper is 63.55 g/mol. To calculate the number of moles, divide the given mass by the molar mass:
n(Cu) = 51 g / 63.55 g/mol = 0.803 mol
2. Use stoichiometry to determine the number of moles of silver produced
According to the balanced equation, one mole of copper reacts with two moles of silver nitrate to produce two moles of silver. Therefore, we can use to determine the number of moles of silver produced:
0.803 mol Cu x (2 mol Ag / 1 mol Cu) = 1.606 mol Ag
3. Calculate the mass of silver produced
To calculate the mass of silver produced, we need to use the molar mass of silver, which is 107.87 g/mol:
mass(Ag) = n(Ag) x M(Ag) = 1.606 mol x 107.87 g/mol = 173.26 g
Therefore, 173.26 g of silver will be produced from 51 g of copper.
To know more about stoichiometry visit
https://brainly.com/question/28780091
#SPJ11
The first ionization energies of the elements ______ as you go from left to right across a period of the periodic table, and ______ as you go from the bottom to the top of a group in the table.
A.) increase, decrease
B.) decrease, increase
C.) decrease, decrease
D.) unpredictable, unpredictable
E.) increase, increase
The correct answer to the question is: A) increase, decrease
The first ionization energies of the elements increase as you go from left to right across a period of the periodic table, and decrease as you go from the bottom to the top of a group in the table.
1. Going from left to right across a period, the atomic number increases, which means there are more protons in the nucleus. This results in a stronger attraction between the positively charged nucleus and the negatively charged electrons. As a result, it becomes harder to remove an electron, requiring more energy, and therefore the first ionization energy increases.
2. Going from the bottom to the top of a group, the atomic size decreases. This is because the number of energy levels or shells decreases, and the electrons are closer to the nucleus. As the distance between the nucleus and the outermost electrons decreases, the attractive force between them increases. Consequently, it becomes easier to remove an electron, requiring less energy, and therefore the first ionization energy decreases.
Therefore, the correct answer to the question is:
A) increase, decrease
To know more about protons, visit:
https://brainly.com/question/12535409
#SPJ11
Give me some questions exam/test questions or hypothetical questions which apply the general formula for alkanes (CnH2n+2) and alkenes (CnH2n)
Explanation:
CnH2n−2
is the formula for ____________.
what is the average speed of a car that travels 870 km in 14.5 hours
Answer:
hjihniok
Explanation:
hi can anyone help me with a gas law device
Explanation:
The Gas Law Apparatus is a high-quality demonstrator of the relationship between pressure, volume and temperature of a gas. The pressure gauge shows how pressure affects volume and vice versa. A digital thermometer displays the temperature.
: Propose a structure for a compound with molecular formula CgH1403 that fits the following spectroscopic data. IR:1820cm, 1760cm1 1H NMR: 1.08 (triplet, 1-6), 1.6δ (sextet, 1-4), 2.20 (triplet, 1-4)
The molecular formula of the compound is given as CgH1403 and the spectroscopic data are given as follows: IR:1820cm, 1760cm1 1H NMR: 1.08 (triplet, 1-6), 1.6δ (sextet, 1-4), 2.20 (triplet, 1-4).The molecular formula suggests the compound to have 14 hydrogen atoms.
The IR spectrum of the compound suggests the presence of a carbonyl group (C=O) around 1760 cm-1 and the N-H bond (O-H is missing from the spectrum) which suggests the presence of carboxylic acid or amide. The 1H NMR spectrum indicates three types of hydrogen atoms: A triplet at 1.08 ppm (J = 7 Hz) with integration of 6 protons. A sextet at 1.6 ppm (J = 7 Hz) with integration of 4 protons. A triplet at 2.20 ppm (J = 7 Hz) with integration of 4 protons.
From the chemical shift of the hydrogen atoms, we can propose that the hydrogen atoms with δ = 1.08 ppm are CH3 groups, the hydrogen atoms with δ = 1.6 ppm are CH2 groups, and the hydrogen atoms with δ = 2.20 ppm are CH groups. From the integration values of the signals, we can deduce the following:- The triplet at 1.08 ppm (J = 7 Hz) with integration of 6 protons indicates that there are two CH3 groups (6 protons in total).- The sextet at 1.6 ppm (J = 7 Hz) with integration of 4 protons indicates that there are two CH2 groups (8 protons in total).- The triplet at 2.20 ppm (J = 7 Hz) with integration of 4 protons indicates that there are two CH groups (8 protons in total).From the above information, we can propose the structure of the compound as follows: CH3-CH(CH3)-CH2-CO-NH-CH2-CH2-CH2-CO-CH-CH3
To know more about carbonyl group visit
https://brainly.com/question/13564853
#SPJ11