what is the percent ionization of nitrous acid in a solution that is m in nitrous acid (hno2) and m in potassium nitrite (kno2)? the acid dissociation constant of nitrous acid is 4.50 x 10-4 0.39

Answers

Answer 1

The percent ionization of nitrous acid (HNO2) in the given solution is 4.10%.

This can be calculated using the acid dissociation constant (Ka) and the initial concentration of the acid.

The equilibrium expression for the ionization of nitrous acid is as:

HNO2 + H2O ⇌ H3O+ + NO2-

The equilibrium constant expression for this reaction is:

Ka = [H3O+][NO2-] / [HNO2]

where [H3O+] and [NO2-] are the concentrations of the hydronium ion and nitrite ion, respectively, at equilibrium, and [HNO2] is the initial concentration of nitrous acid.

Since the initial concentration of nitrous acid is given as 0.39 M, we can assume that the concentrations of H3O+ and NO2- at equilibrium are equal and can be represented by x. Therefore, we can write:

Ka = x^2 / (0.39 - x)

where x is the concentration of H3O+ and NO2- at equilibrium.

Solving for x, we get:

x = 0.016 M

Therefore, the percent ionization of nitrous acid is:

% ionization = (x / [HNO2]) x 100

% ionization = (0.016 / 0.39) x 100

% ionization = 4.10%

So, the percent ionization of nitrous acid in the given solution is 4.10%.

To know more about percent of ionization, refer here:

https://brainly.com/question/17055219

#SPJ11


Related Questions

3.0 mol Na reacts with 1.4 mol
F2 according to the equation below:
2Na+ F₂ → 2NaF

How many moles of NaF form
from 3.0 mol Na?

Answers

The number of moles of NaF that will be produced from 3moles of Na is 3 moles.

How to calculate number of moles?

Stoichiometry is the study and calculation of quantitative (measurable) relationships of the reactants and products in chemical reactions (chemical equations).

According to this question, sodium reacts with fluorine as follows:

2Na+ F₂ → 2NaF

Based on the above equation, 2 moles of Na will produce 2 moles of NaF

This means that 3 moles of Na will produce 3 moles of NaF.

Learn more about stoichiometry at: https://brainly.com/question/9743981

#SPJ1

1. Choose the letter that represents the activation energy. -
2. How much energy is needed to start the reaction. -
3. What is the change in energy? -
4. Is it an endothermic reaction or exothermic reaction? -

1. Choose the letter that represents the activation energy. -2. How much energy is needed to start the

Answers

The letter that represents the activation energy is (B).

The energy needed to start the reaction is the activation energy.

The change in energy is the difference between the energy of the products and the energy of the reactants.

We cannot determine whether the reaction is endothermic or exothermic from the given diagram.

The diagram shows the energy profile of a chemical reaction, which includes the energy of the reactants, the energy of the products, and the activation energy required to initiate the reaction. The activation energy is the minimum amount of energy required for the reactants to form products.

The activation energy is represented by letter (B) in the diagram, which is the energy difference between the reactants and the highest point on the energy profile. This energy barrier must be overcome for the reaction to proceed.

The change in energy is the difference between the energy of the products and the energy of the reactants. If the energy of the products is higher than the energy of the reactants, the change in energy is positive, indicating an endothermic reaction.

If the energy of the products is lower than the energy of the reactants, the change in energy is negative, indicating an exothermic reaction. However, we cannot determine the type of reaction based solely on the energy profile diagram provided, as it does not show the energy of the products.

To know more about the Activation energy, here

https://brainly.com/question/11334504

#SPJ1

What is the balanced equation for the reaction that takes place when a solution of sodium sulfate is mixed with strontium chloride?

Answers

The balanced  chemical equation for the reaction that takes place when a solution of sodium sulfate is mixed with strontium chloride is

Na2SO4 + SrCl2 → 2Nacl + SrSO4

Balanced chemical equation explained.

Balanced chemical equation is a chemical reaction in which the number of atoms and moles of the reactant side is the same as the product. This means the reactant side has equal number of atoms and moles with the product.

The balanced equation for the reaction that takes place when a solution of sodium sulfate is mixed with strontium chloride is

Na2SO4 + SrCl2 → 2Nacl + SrSO4

In this reaction, sodium sulfate with strontium chloride to form sodium chloride and strontium sulfate. The coefficients in the balanced equation indicate the stoichiometric ratios of the reactants and the products, ensuring that the same number of atoms of each element is present on both sides of the equation.

Learn more about balanced chemical equation below.

https://brainly.com/question/11904811

#SPJ1

Hypothesis: If you can measure the pH of a range of acids and bases using a universal pH indicator, then you can use those values to calibrate a cabbage pH indicator. To determine the pH of a solution using a pH indicator paper, you need a .

Answers

To determine the pH of a solution using a pH indicator paper, you need a color chart or a color scale that corresponds to different pH values.

This color chart or scale is used to compare the color of the pH indicator paper after it has been immersed in the solution. The pH indicator paper is impregnated with a universal pH indicator, which is a chemical compound that changes color depending on the acidity or alkalinity of the solution.

The indicator undergoes a chemical reaction with the hydrogen ions (H+) or hydroxide ions (OH-) present in the solution, resulting in a color change.

By comparing the color of the pH indicator paper with the color chart or scale, you can determine the approximate pH of the solution. The color chart usually provides a range of colors corresponding to different pH values, allowing you to match the observed color to the nearest pH value.

In the hypothesis mentioned, the aim is to calibrate a cabbage pH indicator using the pH values obtained from a universal pH indicator. Therefore, in addition to the pH indicator paper and color chart, you would also need a range of solutions with known pH values to establish a calibration curve specific to the cabbage pH indicator.

In summary, to determine the pH of a solution using a pH indicator paper, you need a color chart or scale that correlates the observed color of the pH indicator paper with different pH values. This chart or scale serves as a reference for interpreting the color change and determining the pH of the solution.

Know more about   hypothesis  here:

https://brainly.com/question/31293943

#SPJ8

Answer: COLOR KEY

Explanation: CS

What were some of the causes of the Amu Darya and Syr Darya rivers being ruined?

urban sewer drainage
tannery dumping
tourism
drying up
agricultural chemicals

Answers

Answer:

drying up

agricultural chemicals

Explanation:

 why don't we ever see solid or liquid oxygen on earth?

Answers

Please mark me brainiest!

The reason why you don’t see solid or liquid oxygen is because oxygen is a natural occurring gas. Gas can not be solid or liquid because there is too much energy to have volume/shape. That’s why you see oxygen tanks, as the tank keeps the gas contained and that is why you can’t see it in the air outside or in something like H20 (water).

Hope this helps :)

Just don’t open the link in the other answer. It’s a scam...

Which of the following is the best choice for presenting the percent
composition of calcium carbonate (CaCO3)?
O A. Circle graph
O B. Line graph
O C. Data table
O D. Bar graph

Answers

Bar graph !!!!!!!!!!!!!!!

Which process produces the energy that is used in photosynthesis?
O A. Nuclear fusion
B. Chemical reactions
C. Nuclear fission
D. Nuclear decay

Which process produces the energy that is used in photosynthesis?O A. Nuclear fusionB. Chemical reactionsC.

Answers

Answer: Nuclear fusion

Explanation:

The process that produces the energy that is used in photosynthesis is nuclear fusion. option A is correct.

Photosynthesis is the process by which light energy is converted into chemical energy in the form of sugars. This chemical energy is produced as a result of nuclear fusion reaction .

Photosynthesis takes place in chloroplasts of plants, which are found in the mesophyll of  leaves. Inside the chloroplast, is the thylakoids, where the chlorophyll absorbs the various hues of light and nuclear fusion reaction takes place  to create energy .

Using light energy, oxygen is produced as a byproduct while carbon dioxide and water are converted to glucose .

To know more about  photosynthesis here

brainly.com/question/1388366

#SPJ2

in the prep of methyl benzoate what is the purpose of a) washing the organic layer w sodium bicarbonate, b) washing it w/ saturated nacl, and c) treating it w/ cacl pellets

Answers

In the preparation of methyl benzoate, the following steps  a) washing the organic layer with sodium bicarbonate, b) washing it saturated NaCll, and c) treating it CaCl₂ pellets  serve specific purposes:


a) Washing the organic layer with sodium bicarbonate: This step helps neutralize any remaining acidic impurities (such as unreacted benzoic acid) in the organic layer. Sodium bicarbonate reacts with the acids to form water-soluble salts, which can be separated from the organic layer.

b) Washing with saturated NaCl: This step aims to remove any remaining water from the organic layer. The addition of saturated NaCl increases the ionic strength, making the water layer more polar, and thus promoting the separation of water from the organic layer.

c) Treating with CaCl₂ pellets: Calcium chloride is a desiccant, meaning it can absorb moisture from its surroundings. Treating the organic layer with CaCl₂ pellets helps to further remove any trace amounts of water, resulting in a drier, more purified methyl benzoate product.

Learn more about methyl benzoate here:

https://brainly.com/question/10213530

#SPJ11

What does it mean when you ask your dad whats he going to do with the chikens and hes says feed them some fried chiken?

Answers

Answer:

It means your dad is making those chickens cannibal's.......

Explanation:

Answer:

Hes gonna cook those chickens.....

Balance the following chemical equation: \text{Mg} Mg M, g, plus \text{O}_2 \rightarrowO 2 ​ →O, start subscript, 2, end subscript, right arrow \text{MgO}MgO

Answers

The balanced chemical equation is: Mg + 2O2 -> MgO

To balance the chemical equation:

Mg + O2 -> MgO

We need to ensure that the number of atoms of each element is the same on both sides of the equation.

Let's start by balancing the magnesium (Mg) atoms. There is one Mg atom on the left side, so we place a coefficient of 1 in front of MgO on the right side.

Mg + O2 -> 1MgO

Next, let's balance the oxygen (O) atoms. On the left side, we have two oxygen atoms from O2. To have the same number of oxygen atoms on the right side, we need to place a coefficient of 2 in front of O2.

Mg + 2O2 -> 1MgO

Now the equation is balanced with one magnesium atom, two oxygen atoms, and two oxygen atoms on both sides. The balanced chemical equation is:

Mg + 2O2 -> MgO

This equation represents the reaction between magnesium and oxygen to form magnesium oxide.

learn more about chemical equation here

https://brainly.com/question/28792948

#SPJ11

The quantity of refrigerant in a system is less critical when the system has a(n).

Answers

The quantity of refrigerant in a system is less critical when the system has increased operating pressures.

A low coolant level can cause the engine to overheat. This can cause the compressor not to start or the circuit breaker to trip prematurely. If left unchecked, the engine will eventually burn out and completely stall. Refrigerants with a low critical temperature have a large decrease in cooling performance.

The critical temperature of the refrigerant should be higher than the condensing temperature to obtain greater heat transfer at a constant temperature. When the air conditioner runs low on refrigerant, it loses its ability to transfer heat from within. This means that the air that's being blown into your AC coil isn't cooling properly, so your vents will start circulating warm air throughout your home.

Learn more about Refrigerant here:-https://brainly.com/question/26395073

#SPJ9

7. What is the weather of a certain area over a long period of time?
(10 Points)
climate zone
element
climate
O moisture

Answers

Answer:

Climate

Explanation:

Which circuit hook-up design will have the brightest light bulb?A - 1 battery 1 bulb, B - 2 batteries 1 bulb, C - 3 batteries one bulb, D 2 batteries the bulb is on the other end, E 1 battery and 1 bulb on the other end

Question 5 options:

A


B


C


D


E

Heres another for you guys!

Which circuit hook-up design will have the brightest light bulb?A - 1 battery 1 bulb, B - 2 batteries

Answers

Answer:

I believe it is E because the battery has a wire, a power source(the battery), and a bulb connected together thus making a full series circuit. Furthermore, the more batteries they are to a series circuit, the more dimmer the light bulbs will be.

Which term describes the phase change that occurs when intermolecular forces (attractions) completely overcome kinetic energy (motion) and the material has little to no motion?

Answers

Explanation:

If the kinetic energy is less than the attractive forces, a liquid or solid will form.

The average kinetic energy of the particles in a solid is very less almost negligible this is because they have high attractive forces between their molecules as they are tightly packed in regular lattices and are vibrating about their mean positions.

Therefore, freezing of a liquid or the sublimation of a gas results in the formation of a solid. These two phase changes result in the overcoming of K.E completely.

Answer:

freezing

Explanation:

Why are heat and alcohol used to disinfect medical equipment? 02 Why is milk given to someone who accidentally ingests a heavy metal ion such as silver or mercury?

Answers

The use of heat and alcohol to disinfect medical equipment is because both heat and alcohol are effective at killing microorganisms and bacteria.

Heat can be used to sterilize equipment by exposing it to high temperatures for a certain period of time, while alcohol, specifically ethanol and isopropyl alcohol, can be used to disinfect surfaces by denaturing the proteins and dissolving the lipid membranes of microorganisms.

Milk is not given to someone who accidentally ingests a heavy metal ion such as silver or mercury. Ingestion of heavy metal ions like silver or mercury can cause serious health problems and requires prompt medical attention. Milk is not an effective treatment for heavy metal poisoning, and chelating agents or other specific treatments are used for removing heavy metals from the body.

Learn more about chelating agents here:

https://brainly.com/question/1217155

#SPJ4

How much heat is absorbed by the melting of 1.5 mol of ice?

Answers

The melting of 1.5 mol of ice releases 9.015 kJ of heat.

If ice melts, does heat get absorbed?

Ice melts by absorbing heat, but the temperature doesn't change since the extra heat is expended in releasing the force that holds the ice particles together. Latent heat of fusion is the name given to this energy, which is thought to be concealed within ice.

6.01 kJ/mol is the molar heat of fusion of ice.

Hence, Q = n  Hfus can be used to calculate the amount of heat absorbed by the melting of 1.5 mol of ice.

Q = 1.5 moles times 6.01 kJ/mol

Q = 9.015 kJ

To know more about heat visit:-

https://brainly.com/question/30603212

#SPJ1

Which of the following statements is true concerning a 0.1 M solution of Na2S and a 0.1 M solution of NaHS? For H2S, Ka1 = 1.0 × 10–7 and Ka2 = 1.3 × 10–13.
The sodium sulfide solution is the more basic.
Both the solutions are acidic.
The sodium hydrogen sulfide solution is the more basic.
Both solutions have the same pH.
Both solutions are neutral.

Answers

The statement which is true concerning a 0.1 M solution of Na2S and a 0.1 M solution of NaHS is that the sodium sulfide solution is the more basic.Both Na2S and NaHS are salts of H2S.

The hydrolysis reactions for these two salts are given below:Na2S + 2H2O → 2NaOH + H2SNaHS + H2O → NaOH + H2SAs for the Ka1 and Ka2 values, H2S is a weak acid and, thus, only partially dissociates into H+ and HS- ions.  the sodium sulfide solution is the more basic. Hence,The sodium sulfide solution is the more basic.

When Na2S is dissolved in water, the hydrolysis reaction can be given by Na2S + H2O → 2Na+ + OH- + HS- which shows that Na2S will produce two hydroxide ions for every sulfide ion produced.The same can be said for NaHS. When NaHS is dissolved in water, the hydrolysis reaction can be given by NaHS + H2O → Na+ + OH- + HSO- which shows that NaHS will produce one hydroxide ion for every hydrosulfide ion produced.Thus, Na2S will have a higher pH than NaHS because it has a higher concentration of hydroxide ions.

To know more about sodium sulfide visit:

https://brainly.com/question/4301673

#SPJ11

The center of a root is called the _____.

epidermis
xylem
vascular cylinder
phloem
PLZ HELP

Answers

Answer:

The right answer is xylem

Explanation:

The molecular mass of glucose is 180 g. to make a 1m solution of glucose, you should _______.

Answers

The molecular mass of glucose is 180 g. To make 1 M solution of glucose , you should dissolve 1 mole of glucose in 1 litre of water.

The molecular mass of glucose is 180.16 g/mole, therefore 1 mole is 180.16 grams.

So, to make a 1 M solution, you should take 1 mole = 180.16 g of glucose and make up to 1 litre.

Working glucose solution is prepared by diluting the stock solution.

It can also be said that 1 M glucose solution is  -

                       1 M glucose solution = 180 g / 1000 m L

                                                          = 0.18.

So, it is 0.18 % w/v.  

Glucose solution is a mixture of glucose and water. It is used to treat low blood sugar and the water loss without the electrolyte loss. Glucose solution is an isosmotic solution. If it is in large amount, it produces hypertonic effects on the system.

To learn more about glucose solution,

brainly.com/question/18011483

#SPJ4

what is the ph of 0.779 m ethylammonium chloride, c2h5nh3cl. the kb of ethylamine, c2h5nh2, is 4.3 x 10-4.

Answers

The pH of 0.779 M ethylammonium chloride (C2H5NH3Cl) is 10.08. What is ethylammonium chloride? Ethylammonium chloride is a chloride salt that is formed from the reaction between ethylamine and hydrochloric acid.

Ethylamine (C2H5NH2) is the primary component in the synthesis of ethylammonium chloride. When ethylamine is added to hydrochloric acid, a white solid is formed that has the chemical composition C2H5NH3Cl.How to find pH of ethylammonium chloride?The Kb value for ethylamine is given as 4.3 x 10^-4.

The reaction for ethylamine is:C2H5NH2(aq) + H2O(l) ⇌ C2H5NH3+(aq) + OH-(aq)We can assume that ethylammonium chloride is completely ionized. So, we can write:C2H5NH3Cl → C2H5NH3+ + Cl-The hydrolysis of the ethylammonium ion is given by the following equation: C2H5NH3+ (aq) + H2O(l) ⇌ C2H5NH2(aq) + H3O+(aq)Therefore, Kb = [C2H5NH2][H3O+]/[C2H5NH3+]Let's assume x is the H3O+ ion concentration. Then [C2H5NH2] = [H3O+] and [C2H5NH3+] = 0.779 - x.Substituting these values in the above equation, we get the equation: 4.3 x 10^-4 = x^2 / (0.779 - x)By solving the above equation, we can get x, which is the H3O+ ion concentration. Once we get x, we can calculate the pH of the solution, which is given by the equation:pH = - log [H3O+]Finally, by substituting the value of [H3O+] we get the pH of the solution. PH of the solution is 10.08.

learn more about ph of ethylammonium chloride at: brainly.com/question/31096747

#SPJ11

In order for a substance to be considered a mineral, it must a. be a solid, liquid, or gas. b. be abundant in the crust. c. have atoms arranged in a random, non-repeating pattern. d. contain carbon.

Answers

Answer: i think its (b) be abundant in the crust

Explanation:

16. What part of the atom does radioactivity involve?
O Outer energy shells
Nucleus
O Entire atom
Inner energy shells

Answers

Answer:

inner energy shells are involved in radioactive activity

Answer: I think its NUCLEUS

Explanation: Good luck yall

Which of the following reactions is correctly balanced?
3 Ca + 1 N2 → Ca3N2
O 2 P2 + 3 H2 → 2 PH3
O 2 HgBr → 1 Hg + 1 Br2
O 2 Sr + 102 — 1 sro

Answers

I believe it is 3 CA + 1 N2 -> Ca3N2; I cannot tell whether the O(s) in front of the next three are supposed to be oxygens, if so then yes definitely the first line is correctly balanced.

why is an acid-base extraction being performed rather than a simple solid-liquid or liquid-liquid extraction? what are the acid and the base solutions used for, and why are they both necessary in the procedure?

Answers

Acid-base extraction is performed rather than a simple solid-liquid or liquid-liquid extraction because it allows for the separation of compounds based on their acidity or basicity.

The acid and base solutions are used to react with the compounds in the mixture, causing them to become either more acidic or more basic. This allows for the compounds to be separated into different layers based on their solubility in the acid or base solution.

The acid solution is typically a dilute solution of a strong acid, such as hydrochloric acid or sulfuric acid, and is used to react with basic compounds in the mixture. The base solution is typically a dilute solution of a strong base, such as sodium hydroxide or potassium hydroxide, and is used to react with acidic compounds in the mixture.

Both the acid and base solutions are necessary in the procedure because they allow for the separation of compounds based on their acidity or basicity. Without both solutions, the compounds would not be able to be separated into different layers based on their solubility in the acid or base solution.

Learn more about acid-base extraction here:

https://brainly.com/question/29334954#

#SPJ11

tan delta 0 = (k * tan(KR) - K * tan(kR))/(K + k * tan(kR) * tan(KR)) Using the same equation (1), calculate the phase shift for a Helium atom scattered off a Sodium atom (He+Na) at an incident energy E = 5K Kelvins).

Answers

The phase shift for a Helium atoms scattered off a Sodium atom (He+Na) at an incident energy E = 5K Kelvins is calculated using the equation tan delta 0 = (k * tan(KR) - K * tan(kR))/(K + k * tan(kR) * tan(KR)).

To calculate the phase shift for the scattering of a Helium atom off a Sodium atom, we use the equation tan delta 0 = (k * tan(KR) - K * tan(kR))/(K + k * tan(kR) * tan(KR)), where tan delta 0 represents the phase shift, K and k are constants, R is the scattering radius, and E is the incident energy. In this case, the incident energy E is given as 5K Kelvins.

The equation relates the phase shift to the scattering parameters and energy. The term k * tan(KR) represents the phase shift due to the scattering of the incident wave, while the term K * tan(kR) represents the phase shift due to the scattered wave. The numerator of the equation calculates the difference between these two phase shifts, while the denominator involves their combination.

By substituting the given values and solving the equation, we can determine the phase shift for the He+Na scattering at an incident energy of 5K Kelvins. Further calculations involving the constants K and k, as well as the scattering radius R, might be necessary to obtain a precise numerical value.

Learn more about Helium atoms

brainly.com/question/10897530

#SPJ11

PLS HELP ME, use the periodic table to write the electron configuration of selenium

PLS HELP ME, use the periodic table to write the electron configuration of selenium

Answers

Answer:

[Ar] 3d10 4s2 4p4

Explanation:

1s2 2s2 2p6 3s2 3p6 3d10 4s2 4p4

If it takes 15.0 mL of 0.40 M NaOH to neutralize 5.0 mL of HCI, what is the molar concentration of the HCI solution?

Answers

The molar concentration of the HCl solution is 1.2 M.


The balanced chemical equation for the reaction between HCl and NaOH is:

HCl (aq) + NaOH (aq) → NaCl (aq) + H₂O (l)

From the equation, we can see that one mole of HCl reacts with one mole of NaOH.

Given that 15.0 mL of 0.40 M NaOH is required to neutralize 5.0 mL of HCl, we can use the following equation to calculate the concentration of HCl:

moles of NaOH = concentration of NaOH x volume of NaOH (in liters)

moles of HCl = moles of NaOH (since they react in a 1:1 ratio)

concentration of HCl = moles of HCl / volume of HCl (in liters)

Converting the volumes to liters:

Volume of NaOH = 15.0 mL = 0.015 L

Volume of HCl = 5.0 mL = 0.005 L

Substituting the values:

moles of NaOH = 0.40 M x 0.015 L = 0.006 moles

moles of HCl = 0.006 moles (since they react in a 1:1 ratio)

concentration of HCl = 0.006 moles / 0.005 L = 1.2 M

As a result, the HCl solution has a molar concentration of 1.2 M.

To know more about the Concentration, here

https://brainly.com/question/17137921

#SPJ1

if poison expires is it more poisonous or less poisonous?

Answers

Depending on the toxin, yes. Many things, including proteins, will surely be denatured or degraded and finally turn harmless if we adopt the colloquial definition of the word and include toxins and poisons.

For instance, ricin, botulinum, tetrodotoxin, etc. They are rather delicate, so I'm hoping this toxin has the lowest shelf life.

For a poison, "not up to quality" might indicate anything. It might be more harmful or less toxic. It might be more toxic than before, which would make it less effective against the intended target but extremely harmful to other species. It only indicates that a single chemical may have begun to breakdown, and the final result of that deterioration may be something entirely else.

Small organic molecules make up a lot of other toxins. These include nerve agents like nicotine, sarin, and VX, all of which are capable of being broken down through air oxidation, UV exposure, hydrolysis, and other processes. Numerous nerve agents have a shelf life of several years, and studies have been done to extend their use in weapons.

Lead, mercury, and cadmium are just a few examples of metals that are hazardous because they are toxic not only in their elemental forms but also as inorganic and organic compounds. Although the toxicity of the various forms can varies substantially (see, for example, methylmercury and elemental mercury), the majority of them are nevertheless at least harmful.

These can persist for a very long period since the reactions that can happen under usual circumstances might not be safe, such as a sizable piece of cinnabar left on a desk even throughout the course of a geological time scale. any substantial modification to ensure safety.

To learn more about poison from given link

https://brainly.com/question/21019313

#SPJ4

when temperature increase gas decrease or increase support u r answer with daily life example​

Answers

Answer:

increase

Explanation:

dont known reason burr answer is correct

Answer:

When temperature increases ,gas increases ,because of the rise in temperature evaporation will take place.

Explanation:

When you boil water to make coffee/tea the kettle/boiler releases the evaporation caused by the rise in temperature.

Other Questions
Which expression is equivalent to [tex]8/x^6[/tex]? Assume x> 0 El tomate, la papa, el maz y son originarios de amrica. Wilma is looking for facts about social media for her research project. What fact should she use for her project? a Communicating with social media is hard b Social media is a great way to communicate. c Social media is fun and easy to use. d The minimum age for some social media sites is 13. please help me and i will give you 5 stars True or False? exporting has an advantage compared to other types of international involvement, because it is usually easier to drop or change arrangements as the firm's needs change. F(x)=3x2-3x+1Find f(-2) What transportation improvement made travel on land routes easier in the 1800s?O bridgesO paved roadsO automobilesO horse-drawn carriages Which of the following are examples of presidential democracies in Latin America?(10pts A Cuba and Mexico B Cuba and Brazil C Brazil and Mexico D Cuba, Brazil, and Mexico simplify the expression below suppose a popular fm radio station broadcasts radio waves with a frequency of 104 mhz . calculate the wavelength of these radio waves. , a type of repartnering, is an intimate relationship between unmarried individuals who live in separate homes but identify themselves as a committed couple. group of answer choices living apart together separation remarriage cohabitation about what proportion of those on welfare have three or more children In the diagram below if bulb 2 blew out what would happen to the VOLTAGE? (its not decreases thats why its highlighted) What does Raman spectroscopy use to identify substances? 1. Encontramos dos factores que influyen en los seres vivos como las bacterias y la cianoficeas. Es el llado factor: a. Biotico b. Abiotico c. Ecosistema d. Mutualismo what is the main idea of this passage?The recording industry has gone too far in its fight against file-sharers in that Copyright Management Systems (CMS), used to enforce Copyright Management Information (CMI), can impinge on users ``fair use of digital information. According to U.S. Code, Title 17, chapter 1, section 107, copying of copyrighted information is allowed for purposes such as criticism, comment, news reporting, teaching (including multiple copies for classroom use), scholarship, or research. Many proposed systems of copyright management, such as creating hardware with anti-copying devices already installed, can impinge on this fair use allotment in copyright law by preventing professionals with legitimate defense from exercising proper usages. It can also prevent the copying of non-copyrighted material by the average user. If a person wishes to make a copy of a noncopyrighted CD, so as to have a copy at home and one in the car, a copyright management system would prevent him or her from this fair use act. Dr. Martin Luther King Jr. was arrested and put in jail 29 different times for acts of civil disobedience. How do you think MLK Jr. used being arrested as a strategy towards reaching his Civil Rights Movement goals? A 25.00 mL sample of the ammonia solutionwas accurately diluted to 250.0 mL. A 25.00mLaliquot of the diluted ammonia solution wasplaced in a conical flask. Indicator was then addedand the solution was titrated with 0.208 molL-1hydrochloric acid. The indicator changed colourpermanently when 19.64 mL of the acid had beenadded. Calculate the concentration of ammonia inthe original solution. List and fully explain each component/element of a crime whichmust be proven before a defendant can be convicted of a crime. procaine hydrochloride (mw = 272.77 g/mol) is used as a local anesthetic. calculate the molarity of a 4.952 m solution which has a density of 1.065 g/ml. enter m to 3 decimal place. could you please help me out with a question . Exercise A.