What is the product from the oxidation of CH3CH(CH3)CH(CH3)C(=O)CH3?Group of answer choices3,4-dimethyl-2-butanol3,4-dimethyl-2-butanoic acidno reaction occurs3,4-dimethyl-2-butanal

Answers

Answer 1

The given molecule is a ketone.

Since carbonyl group in ketones is not located in the extremes of the main chain, they need energy to break C-C bonds and be able to oxidize.

In this case it is not specified if the oxidation is carried out applying energy, but anyway, the products of the oxidation of a ketone are esters that are hydrolized to carboxilic acid and alcohol.

It means that the answer is no reactions occurs (this because it is not specified that energy was applied and none of the options are possible products of the reaction).


Related Questions

an ionic bond consist of a gas and metal

Answers

Answer: yes

Explanation:

which statement describes virginia's watershed i need this ASAP pls help

Answers

where are the statements??

B: It has fewer than 10 total watersheds best describes

What is a watershed?

A watershed is the area of land where all of the water that falls in it and drains off of it goes to a common outlet. All the land drains water into rivers that drain into the Chesapeake Bay, where it enters the Atlantic Ocean.

Why is it called a watershed?

The area that drains into a single river is the watershed for that river.

Learn more about Watershed here

https://brainly.com/question/24813719

#SPJ2

I literally don’t know what I’m doing please help

I literally dont know what Im doing please help

Answers

there are 50 mL in the jar

3. What is the pairing arrangement of the nitrogenous bases? _____________ pairs with __________ and ____________ pairs with ___________.

Answers

Answer:

Adenine pairs with thymine and guanine pairs with cytosine


MULTIPLE CHOICE QUESTION
How many grams of Al203 were
decomposed?
287.13
200g
888g
1148.52g

MULTIPLE CHOICE QUESTIONHow many grams of Al203 weredecomposed?287.13200g888g1148.52g

Answers

287.13 grams of Al₂O₃ were decomposed. Therefore, option A is correct.

What is molar mass ?

The term molar mass is defined as the mass in grams of one mole of the compound. A mole of any substance is 6.022 × 10²³ molecules. It is called as Avogadro's number. The molar mass is a bulk property, it is not molecular, property of a substance.

2Al₂O₃ ⇒ 4Al + 3O₂

Thus, 4 mol of Al combine with 3 mol of oxygen to form 2 mol of Al₂O₃.

2 mol of Al corresponds to 2 × 27 = 54g

Thus, the weight of Al used in the reaction is 108 g.

Molar mass of Al₂O₃ is 101.96g/mol.

5.63 moles of Al = 5.63 × 54 / 101.96

= 287.13 grams

Thus, 287.13 grams of Al₂0₃ were decomposed, option A is correct.

To learn more about the molar mass, follow the link;

https://brainly.com/question/12127540

#SPJ1

PLZZ HELP : Which layer extends from below the mantle
to the center of Earth? (Number 2)

PLZZ HELP : Which layer extends from below the mantleto the center of Earth? (Number 2)

Answers

Answer: The CORE extends from the bottom of the mantle to the center of the earth.

Answer:

f; core

Explanation:

the only one that makes sense

How many formula units make up 25.8g of magnesium chloride (MgCl2)? Express the number of formula units numerically.

Answers

Answer:

Explanation:

Kandndkjwnww

324.55 cm - (6104.5 cm²/22.3 cm)

Answers

Answer: 50.806 cm is the correct answer.

Explanation: First divide 6104.5 cm^2 by 22.3 cm.

\(\frac{6104.5cm^2}{22.3cm} = 273.74 cm\)

*Note: When dividing units, subtract the exponents, and when multiplying units simply add the exponents.

Then continue by subtracting 324.55 cm - 273.74 cm.

This should give you an answer of 50.806 cm.

Liquid octane (CH3(CH2)6CH3) will react with gaseous oxygen (O2) to produce gaseous carbon dioxide (CO2) and gaseous water (H2O). Suppose 17. g of octane is mixed with 112. g of oxygen. Calculate the maximum mass of water that could be produced by the chemical reaction. Round your answer to significant digits.

Answers

The maximum mass of water that could be produced by the chemical reaction is 162 g.

The given chemical equation is: 2 C8H18(l) + 25 O2(g) → 16 CO2(g) + 18 H2O(l)In the chemical reaction of liquid octane with gaseous oxygen, the products are gaseous carbon dioxide and gaseous water.According to the balanced chemical equation, 2 moles of C8H18 react with 25 moles of O2 to form 18 moles of H2O.So, 1 mole of C8H18 react with 25/2 = 12.5 moles of O2 to form 9 moles of H2O.The molar mass of C8H18 is 114 g/mol. So, the number of moles in 17 g of C8H18 is:17 g / 114 g/mol = 0.149 molThe molar mass of O2 is 32 g/mol. So, the number of moles in 112 g of O2 is:112 g / 32 g/mol = 3.5 molFrom the balanced chemical equation, 1 mole of C8H18 react with 12.5 moles of O2 to form 9 moles of H2O.So, the number of moles of O2 required to react with 0.149 mol of C8H18 to form H2O is:(12.5 mol / 1 mol) × (0.149 mol / 2 mol) = 0.935 molThe maximum number of moles of H2O that can be produced from 0.149 mol of C8H18 and 0.935 mol of O2 is 9 mol.So, the mass of water produced from 17 g of C8H18 and 112 g of O2 is:9 mol × 18 g/mol = 162 g

for more questions on chemical reaction

https://brainly.com/question/25769000

#SPJ8

Which statement about diluted solutions is false? When a solution is diluted
A. the concentration of the solution decreases.
B. the molarity of the solution decreases.
C. the number of moles of solute remains unchanged.
D. the number of moles of solvent remains unchanged.

Answers

(Since my answer contradicts the other one here, let me reassure you that my answer is correct by stating that I’m currently doing my Ph. D. in Chemistry.)

A diluted solution is one in which the concentration of a dissolved solid (called the solute) is decreases via the addition of excess solvent. This means that A is a true statement.

Since molarity is a measurement of concentration, based on the conclusion for A, B is also a true statement.

For a given solution, excess solvent is added but the amount of solute present isn’t affected. This means that the number of solute moles is constant and the number of solvent moles is not; C is a true statement, whereas D is false.

Hope this helps!

When a solution is diluted, the concentration of solution increases, as first statement is false, the correct option is A.

What is a solution?

A liquid mixture in which the minor component i.e., the solute is uniformly distributed within the major component i.e., the solvent is referred to as a solution.

A dilute solution is one where a small portion of solute is dissolved in the solution. A concentrated solution contains a significant amount of solute.

Thus, the correct option is A.

For more details regarding solution, visit:

https://brainly.com/question/1416865

#SPJ2

the object in question 1 has a mass of 21.535g. what metal is the cylinder most likely made of? why? pls help asap!!

the object in question 1 has a mass of 21.535g. what metal is the cylinder most likely made of? why?

Answers

Answer:

Aluminium

Explanation:

From the question given above, the following data were obtained:

Diameter (d) = 1.25 cm

Height (h) = 6.48 cm

Volume (V) of cylindrical=.?

Mass (m) of cylindrical object = 21.535 g

Density of the cylindrical object =..?

Next, we shall determine the radius of the cylindrical object. This is illustrated below:

Diameter (d) = 1.25 cm

Radius (r) =?

r = d/2

r = 1.25/2

Radius (r) = 0.625 cm

Next, we shall determine the volume of the cylindrical object. This can be obtained as follow:

Height (h) = 6.48 cm

Radius (r) = 0.625 cm

Pi (π) = 3.14

Volume (V) of cylindrical=.?

V = πr²h

V = 3.14 × 0.625² × 6.48

V = 7.948 cm³

Recall:

1 cm³ = 1 mL

Therefore

7.948 cm³ = 7.948 mL

Thus, the volume of the cylindrical object is 7.948 mL

Finally, we shall determine the metal in which the cylindrical object is made up of by calculating the density of the cylindrical object. This can be obtained as follow:

Mass (m) of cylindrical object = 21.535 g

Volume of the cylindrical object = 7.948 mL

Density of cylindrical object =?

Density = mass /volume

Density = 21.535 / 7.948

Density of cylindrical object = 2.7 g/mL

Comparing the density of the cylindrical object (i.e 2.7 g/mL) with those given in the table in the question, the cylindrical object is made of aluminium since they have the same density.

5. What does a positively charged ion indicate in terms of its subatomic particles? Use the
Calcium ion Cat2 as a specific example in your explanation.

Answers

Answer: A positively charged ion means that there are more protons than electrons. For example, the calcium ion has 2 more protons than electrons.

Why do we need Chemistry in Nursing?

Answers

Answer:

We need chemistry in nursing because it deals with various kinds of drugs and the reactions of these drugs on the human body as well as with each other.

Exactly what the person said above me

what does the first ionization energy represent?
A. the energy required to add an electron
B. the energy to remove an energy level of electrons
C. the energy required to remove an electron from an atom
D. the energy given off when an electron is gained

Answers

The first ionization energy represents Option C.  the energy required to remove an electron from an atom.

The ionization energy is defined as the energy required to remove an electron from a gaseous atom or ion to form a cation that carries a charge of +1.Ionization energy is an essential property of an element, and it is determined by the effective nuclear charge (Zeff) and the distance between the valence electrons and the nucleus. The effective nuclear charge is the positive charge that an electron experiences from the nucleus.

The closer the valence electrons are to the nucleus, the greater the effective nuclear charge, making it more challenging to remove an electron from the atom. The ionization energy increases from left to right and from bottom to top across the periodic table. The ionization energy decreases from top to bottom and from right to left across the periodic table. The reason for this trend is the increase in atomic radius and the decrease in effective nuclear charge from top to bottom and from right to left on the periodic table.

Ionization energy plays a significant role in chemical reactions, particularly in redox reactions. The energy required to remove an electron from an atom or ion is equivalent to the energy released when the ion or atom gains an electron. A high ionization energy indicates that the atom is less reactive and more stable since it requires a lot of energy to remove an electron. Therefore the correct option is C

Know more about ionization energy  here:

https://brainly.com/question/20658080

#SPJ8

What is the ph scale including acid and base number ranges

Answers

ph is defined as the potential of h+ concentration.Substances can be diffrentiate as an acid or a base by evaluate where they fall on the pH scale. Some examples of acids include citrus juice and stomach acid. Some familiar of examples of bases include baking soda and lye.Acids are the matters that have a pH below 7, while bases are substances that have a ph rating above 7. This is because the ph scale tells the concentration of free hydrogen ions in a substance. Acids have relatively more hydrogen ions, while bases have relatively  fewer hydrogen ions and more hydroxide ions. In a substance where the number of hydrogen (H+) ions is  equal to  the number of hydroxide (OH-) ions, the ph would be  considered as completely neutral, and equal exactly 7.

To know more about ph visit :

https://brainly.com/question/15289741

#SPJ9

a gas mixture at 20.0 C and 2.0 atm contains 0.40 mol of H2, 0.15 mol of O2, and 0.50 mol of N2. Assuming ideal behavior, what is the partial pressure of hydrogen gar [H2] in the mixture?

Answers

The partial pressure of hydrogen gas in the mixture is:0.53334 atm.


What is partial pressure?
partial pressure. noun. the pressure that a gas would have if it took up the entire volume that the mixture of gases currently occupies.


P total,and the total number of moles in the mixture would be,

n total=nH2+nO2+nN2

This means that you could write

P total.V=ntotal.RT

p total=n total.RT/V

This is equivalent to

p total=[nH2+nO2+nN2].RT/V

therefore,

P total =PH2+PO2+pN2

now, to get the partial pressure of,let's Hydrogen gas

RT/V=Ptotal/nH2+nO2+nN2

therefore

PN2=XN2.p total

similarly,

PO2=XO2.p total

PN2=XN.p total

The total number of moles will be

\(ntotal\) = 0.40+0.15+0.50=1.50 moles.

\(PH2\)=0.40/1.50*2.0 atm =0.5334 atm.

\(PO2\)=0.15/1.50*2.0 atm =0.2 atm.

\(PN2\)=0.50/1.50*2.0 atm =0.66 atm.

Hence, the partial pressure of hydrogen gas in the mixture is:0.53334 atm.


To learn more about the partial pressure of H2 from the given link:
https://brainly.com/question/19813237
#SPJ9

Ok help it’s for homework

Ok help its for homework

Answers

It would be B. The liquid is less dense than water.

Water collecting on the outside of a glass of lemonade on a hot summer day would be an example of


Evaporation


Condensation


Sublimation


Vaporization

Answers

Answer:

Condensation

Explanation:

This is because, The water evaporates and then condenses back into water.

HELP ASAP!!!! PLEASE AND THANK YOU!!!! Aluminum, which has a specific heat capacity of 0.902 J/g◦C and a mass of 20.9 g absorbs 348.0 J of energy. The final temperature (T2) is 100.0◦C. Calculate the initial temperature (T1).

Answers

Answer:

81.54 °C

Explanation:

Use the equation

q = mcΔT

348 = 20.9(0.902)(100-t)

t = 81.54 °C

*note, you don't have to convert these to kelvin since the difference will be the same

a question was asked by a teacher to a student. She gave the student a jumbled word and told him to make words out of it. The jumbled word is gzeysktqix. Now you know what to do. see ya!​

Answers

The jumbled word "gzeysktqix" can be unscrambled to form the word "skyzigtext."

Here are possible words that can be made from this jumbled word:

Sky: Referring to the atmosphere above the Earth.

Zig: Describing a series of sharp turns or angles.

Text: Referring to written or printed words.

Six: The number following five and preceding seven.

It seems that the jumbled word has provided a mix of letters that can be rearranged to form these words. This exercise is likely intended to enhance the student's vocabulary skills, spelling ability, and problem-solving skills. By unscrambling the letters, the student is encouraged to explore different word possibilities and apply their knowledge of language. It also promotes critical thinking and creativity as they find valid words from the given set of letters.

for such more questions on unscrambled

https://brainly.com/question/23994485

#SPJ8

4) What is/are the product(s) of the following acid-base mechanism? (2 points)
CH30 Na
CH3OH
Na e
+ CH3OH
a)
O
+ CH3OH
b)

4) What is/are the product(s) of the following acid-base mechanism? (2 points)CH30 NaCH3OHNa e+ CH3OHa)O+

Answers

The structures represented by A in the image are the products of the acid base reaction shown.

In organic chemistry, an important aspect of study is reaction mechanisms. Reaction mechanisms often involve movement of electrons shown as arrows. We must diligently follow the movement of these arrows in order to get the products of the reaction correctly.

If we follow the arrows in this case, we will discover that the methoxide ion picks up the proton as shown and there is a movement of electrons from the carbon bearing the 0-H group to the adjacent carbon atom. While a double bond is formed between carbon and oxygen.

These electron movements yield the products shown in (a) in the image attached to the question.

Learn more:https://brainly.com/question/14623424

A stock solution of HNO3 is prepared and found to contain 14.2 M of HNO3. If 25.0 mL of the stock solution is diluted to a final volume of 0.500 L, the concentration of the diluted solution is ________ M.

Answers

Answer:

First convert volume given into same unit.

Therefore 1000 mL =1L

1000mL=1L

25.0mL=?

(25.0×1)÷1000=0.025L

but using the equation;M1×V1=M2×V2

M1=14.2M

V1=0.025L

M2=?

V2=0.5L

Therefore;. 14.2×0.025=M2×0.5

M2=(14.2×0.025)÷0.5

M2=0.71M.

A stock solution of HNO3 is prepared and found to contain 14.2 M of HNO3. If 25.0 mL of the stock solution is diluted to a final volume of 0.500 L, the concentration of the diluted solution is 0.71M.

What is the stock solution ?

To make a stock solution, weigh out the proper amount of a pure solid or measure out the proper amount of a pure liquid, put it in the right flask, and then dilute it to the desired volume. Depending on the intended concentration unit, many methods can be used to measure the reagent.

First we convert volume

Then 1000 mL = 1L

1000mL= 1L

25.0mL = ?

( 25.0 × 1 ) / 1000

= 0.025L

by using the equation;

M1 × V1 = M2 × V2

M1 = 14.2M

V1 = 0.025L

M2 = ?

V2 = 0.5L

14.2 × 0.025 = M2 × 0.5

M2 = (14.2 × 0.025 ) ÷ 0.5

M2 = 0.71M.

Thus, A stock solution of HNO3 is prepared and found to contain 14.2 M of HNO3. If 25.0 mL of the stock solution is diluted to a final volume of 0.500 L, the concentration of the diluted solution is 0.71M.

To learn more about stock solution, follow the link;

https://brainly.com/question/17018950

#SPJ5

What does the reproductive system control?

Answers

Sperm and also sex what type of question is that lol

What is the element Ar classified as in the periodic table?
a noble gas
a halogen
a metalloid
a metal

Answers

it is classified as a noble gas

The element Ar classified as noble gas in the periodic table. Therefore, the correct option is option A.

What is noble gas?

The noble gases are a group of chemical elements that share several characteristics. They are all monatomic, odourless, and colourless gases with relatively little chemical reactivity under normal conditions. Oganesson (Og) is a highly radioactive element created synthetically.

Although the IUPAC has included oganesson since "group 18" and "noble gas" have been used interchangeably, oganesson may not be appreciably chemically noble and therefore is projected to deviate from the norm and just be reactive owing to relativistic effects. Its chemistry is still being studied due to the exceptionally short 0.7 ms ½ of its sole known isotope. The element Ar classified as noble gas in the periodic table.

Therefore, the correct option is option A.

To know more about noble gas, here:

https://brainly.com/question/7036466

#SPJ7

Where are most of the state’s wind farms located? Why do you think this is?

Answers

A wind farm can also be located offshore in most of the state.

Why in most of the state wind frames are located in offshore?

Offshore, faster wind speeds allow for substantially greater energy production. The term "offshore wind energy" describes the installation of wind farms inside of bodies of water. To produce electricity, they use the sea winds. These wind farms may employ floating wind turbines or turbines with solid foundations. Also, compared to other renewable technologies, offshore wind is more similar to onshore wind in terms of resource accessibility and technological maturity. Offshore wind farms are starting to blend into the water and coastal environment as a result.

To know more about offshore, refer:-

https://brainly.in/question/51581294

SPJ1

1.0 mole of a gas is enclosed in a 12.3 liter cylinder with a moveable piston at 300 K and 2.0 atm. Half of the gas is removed, leaving 0.50 mole in the cylinder and the system is warmed to 900 K. The cylinder changes volume to maintain constant pressure. What is the volume in the final system?1.0 mole of a gas is enclosed in a 12.3 liter cylinder with a moveable piston at 300 K and 2.0 atm. Half of the gas is removed, leaving 0.50 mole in the cylinder and the system is warmed to 900 K. The cylinder changes volume to maintain constant pressure. What is the volume in the final system?

Answers

The final volume of the system, given that half of the gas is removed, leaving 0.50 mole in the cylinder and the system is warmed to 900 K is 18.45 liters

How do I determine the final volume of the system?

From ideal gas equation, we have

PV = nRT

Rearrange

V / nT = R/ P

R / P = Constant

Thus, we have

V₁ / n₁T₁ = V₂ / n₂T₂

Where

V₁ and V₂ are initial and final volumen₁ and ₂ are initial and final moleT₁ and T₂ are initial and final temperature

With the above formula, we can obtain the final volume of the system as follow:

Initial mole (n₁) = 1 moleInitial volume of gas (V₁) = 12.3 litersInitial temperature (T₁) = 300 KPressure = ConstantFinal mole (n₂) = 0.5 moleFinal temperature (T₂) = 900 KFinal volume (V₂) = ?

V₁ / n₁T₁ = V₂ / n₂T₂

12.3 / (1 × 300) = V₂ / (0.5 × 900)

Cross multiply

1 × 300 × V₂ = 12.3 × 0.5 × 900

300 × V₂ = 5535

Divide both side by 300

V₂ = 5535 / 300

V₂ = 18.45 liters

Thus, the final volume of the system is 18.45 liters

Learn more about volume:

https://brainly.com/question/14560487

#SPJ1

For the given reaction, what volume of CO2 can be produced from 0.90 L of O2 , assuming an excess of CO ? Assume the temperature and pressure remain constant. g

Answers

Answer:

1.8L of CO2.

Explanation:

We'll begin by writing the balanced equation for the reaction. This is illustrated below:

2CO + O2 —> 2CO2

Next we shall determine the volume of O2 that reacted and the volume of CO2 produced from the balanced equation. This is illustrated below:

1 mole of O2 reacted

Recall: 1 mole of any gas occupy 22.4L at stp

Therefore 1 mole of O2 = 22.4L

2 moles of CO2 were produced

2 moles of CO2 = 2 x 22.4 = 44.8L

Summary:

From the balanced equation above,

22.4L of O2 reacted to produce 44.8L of CO2.

Finally, we shall determine the volume of CO2 produced from 0.90L of O2. This can be obtained as follow:

From the balanced equation above,

22.4L of O2 reacted to produce 44.8L of CO2.

Therefore, 0.90L of O2 will react to produce = (0.9 x 44.8)/22.4 = 1.8L of CO2.

Therefore, 1.8L of CO2 were produced.

6. How is a magnet turned into a temporary magnet?
A. It has to contain hydrocarbons
B. It has to be pure iron
C. It has to have opposite magnetic poles
D. It has to have an alloy of iron

Answers

A magnet turned into a temporary magnet is It has to have opposite magnetic poles. Option C.

Temporary magnets are made of soft metals that become magnetized only when exposed to a permanent magnetic field or electric current. When they come into contact with a magnetic field, they become magnetized. Temporary magnets are made of soft metals that retain their magnetism only when in proximity to a permanent magnetic field or electric current.

They are magnetized in the presence of a magnetic field. Clips, iron nails, and other similar items are examples of temporary magnets. The force that a magnet exerts on a particular substance, including other magnets, is called magnetic force. Forces act over distance and include attraction and repulsion. The north and south poles of two magnets attract each other but the two north poles or the two south poles repel each other.

Learn more about Temporary magnets here:-https://brainly.com/question/2288395

#SPJ9

The esterification reaction is a name reaction in organic chemistry, where it is called ____________ esterification. In addition, when the reverse reaction is promoted by using a base, it is called a ____________ reaction.

Answers

Answer:

rank me as brainliest

Explanation:

The esterification reaction is a name reaction in organic chemistry, where it is called Fischer esterification. In addition, when the reverse reaction is promoted by using a base, it is called a saponification reaction.

Answer:

The esterification reaction is a name reaction in organic chemistry, where it is called Fischer esterification. In addition, when the reverse reaction is promoted by using a base, it is called a hydrolysis reaction.

Explanation:

The Fischer esterification is a type of organic reaction that involves the conversion of a carboxylic acid and an alcohol into an ester and water, catalyzed by an acid catalyst. This reaction is named after its discoverer, Emil Fischer, a German chemist who first described the reaction in 1895.

The general equation for Fischer esterification is:

Carboxylic acid + Alcohol → Ester + Water

For example, the reaction between acetic acid and ethanol to form ethyl acetate (a commonly used solvent and flavoring agent) can be represented as follows:

CH3COOH + C2H5OH → CH3COOC2H5 + H2O

The Fischer esterification is an important reaction in organic chemistry because esters are important compounds in a variety of applications, including the food industry (as flavorings and fragrances), the pharmaceutical industry (as intermediates in the synthesis of drugs), and the polymer industry (as monomers).

When the reverse reaction of Fischer esterification is promoted by using a base, it is called a hydrolysis reaction. Hydrolysis is the process of breaking down a compound by adding water. In the case of esters, hydrolysis occurs when the ester bond is broken by the addition of water, yielding a carboxylic acid and an alcohol.

The general equation for hydrolysis of an ester is:

Ester + Water → Carboxylic acid + Alcohol

For example, the hydrolysis of ethyl acetate can be represented as follows:

CH3COOC2H5 + H2O → CH3COOH + C2H5OH

Hydrolysis of esters is an important reaction in organic chemistry because it is a common route for the degradation of esters in nature, as well as in many industrial processes where it is used for the production of carboxylic acids and alcohols.

How many molecules are in 7.62 L of CH4, at 87.5°C and 722 torr

Answers

Answer: There are \(1.469 \times 10^{23}\) molecules present in 7.62 L of \(CH_4\) at \(87.5^{o}C\) and 722 torr.

Explanation:

Given : Volume = 7.62 L

Temperature = \(87.5^{o}C = (87.5 + 273) K = 360.5 K\)

Pressure = 722 torr

1 torr = 0.00131579

Converting torr into atm as follows.

\(722 torr = 722 torr \times \frac{0.00131579 atm}{1 torr}\\= 0.95 atm\)

Therefore, using the ideal gas equation the number of moles are calculated as follows.

PV = nRT

where,

P = pressure

V = volume

n = number of moles

R = gas constant = 0.0821 L atm/mol K

T = temperature

Substitute the values into above formula as follows.

\(PV = nRT\\0.95 atm \times 7.62 L = n \times 0.0821 L atm/mol K \times 360.5 K\\n = \frac{0.95 atm \times 7.62 L}{0.0821 L atm/mol K \times 360.5 K}\\= \frac{7.239}{29.59705}\\= 0.244 mol\)

According to the mole concept, 1 mole of every substance contains \(6.022 \times 10^{23}\) atoms. Hence, number of atoms or molecules present in 0.244 mol are calculated as follows.

\(0.244 mol \times 6.022 \times 10^{23}\\= 1.469 \times 10^{23}\)

Thus, we can conclude that there are \(1.469 \times 10^{23}\) molecules present in 7.62 L of \(CH_4\) at \(87.5^{o}C\) and 722 torr.

Other Questions
The fundamental frequency of a musical note is 330Hz. What is the frequency of the 2nd harmonic? (WILL GIVE BRAINLy) Select the correct answer.The graph shows the percentage of dog breeds affected by elbow dysplasia, which causes dogs to limp. Whats the most likely explanation for the mixed breeds disease incidence?A. It has low diversity in its genes.B. It has high diversity in its genes.C. Its good at saving human lives.D. It doesnt suffer attacks from wild predators.E. It lives comfortably with people. which of the following sections of the united states constitution is most related to the case marbury v. madison (1803) ? Steering Gear for a Riding Lawn Mower/ Garden Tractor The photo depicts the steering gear for a riding lawn mower/garden tractor (where the photo is approximately half of actual size). The center hole mates with the spline of the steering shaft to properly position the gear teeth on the outer sector. The two round holes have been included simply to reduce the weight of the product, and the "stops" on either side of the bottom surface serve to limit the turning radius of the tractor. Dimensions in both tooth positioning and tooth profile, and the surface finish in this area should be sufficient to hold backlash with the mating gear to within .10 mm (0.004 in). Design parameters have specified a minimum tensile strength of 586 MPa (85,000 psi), and a minimum hardness on the gear teeth of Rockwell B 80 (equivalent to about 150 Brinell or zero on the Rockwell C scale- i.e., rather low!). Assume the quantity to be produced is sufficient to justify most manufacturing processes. 1. Briefly discuss the properties and characteristics that this piece must possess to function properly, and discuss the important fabrication requirements. 2. Based on the size, shape, and reasonable precision of the component, identify and describe several fabrication methods that could be used to produce the part. 3. Identify several material families that could be used to meet the specified requirements. 4. Using your answers to Question 3, present material process combinations that would be viable options to produce this item. 5. Which of your combinations in Question 4 do you feel is the "best" solution? Why? 6. For your "best" solution of Question 5 select a specific metal, alloy, or other material, and justify your selection. Use the graph to determine the input value for which f(x) = g(x) is true. 4. You buy a video game and pay for it with a $50 bil. Write an expression that can be used to find out how much change you shoud receive. brass is an alloy created using $80\%$ copper and $20\%$ zinc. if henri's brass trumpet contains $48$ ounces of copper, how many ounces of zinc are in the trumpet? The lengths of the sides of the right triangle above are a, 3, and c. What is a in terms of c? Lainey bought a set of 20 makers for $6 what is the cost of 1 marker? -20:2+(15)=Simplify at the command prompt, type ls -l myscript and press enter. what permissions does the myscript file have? next, type bash myscript at the command prompt and press enter. did the shell script execute? what do the \t and \a escape sequences do? 1 / 3 1 2 / 3pzzzzzzzzzzzzzzz what is the resistance of a parallel circuit with resistance's of 2 ohms, 4 ohms, 6 ohms, and 10 ohms ? In a cookie jar containing 6 chocolate chip cookies, 8 wafer cookies and 10 double chocolate cookies, what is the probability that a person who isn't looking when they get a cookie will get a chocolate chip cookie? 1) One year ago, your firm purchased an option that gives you the right to buy 10 tons of steel for $450,000 today. The current price of steel is $23 per pound. Your firm initially spent $20,000 for the option. Should you exercise your option and purchase the steel for $450,000 Can someone help me with this? solving for X using cos (20 degrees) Please answer both of the questions pleaseeee write a letter to your friend and give two reasons why he should come to your school A grain product that retains its original content of nutrients and fiber is a(n) ____.a. enriched grain productb. refined grain foodc. whole-grain foodd. fortified grain producte. processed food product By the 400 BCE only one, stable oligarchy remained in which city-state