The step in Michaelis-Menten kinetics that determines the overall rate is the formation and breakdown of the enzyme substrate complex (ES complex).
This step is characterized by a rapid equilibrium between the ES complex and the free enzyme and substrate. The rate of formation of the ES complex is proportional to the concentration of both the enzyme and the substrate, whereas the rate of breakdown of the ES complex is proportional to the concentration of the ES complex. The overall rate is determined by the rate of formation of the ES complex, as this is the rate-limiting step in the reaction. Enzyme are biological catalysts that speed up chemical reactions in living organisms. They are proteins made up of chains of amino acids, and their unique three-dimensional shape allows them to bind to specific molecules, called substrates, and facilitate chemical reactions. Enzymes play crucial roles in metabolism, digestion, and other cellular processes, and their activity can be regulated by factors such as pH, temperature, and inhibitors. Deficiencies or abnormalities in enzyme function can lead to various diseases and disorders.
Learn more about Enzyme here:
https://brainly.com/question/11952570
#SPJ11
What is the molarity of a solution made by dissolving 8.60 g of a solid with a
molar mass of 21.50 g/mol in 280.0 mL of solution.
Answer:
1.43 M
Explanation:
We'll begin by calculating the number of mole of the solid. This can be obtained as follow:
Mass of solid = 8.60 g
Molar mass of solid = 21.50 g/mol
Mole of solid =?
Mole = mass / molar mass
Mole of solid = 8.60 / 21.50
Mole of solid = 0.4 mole
Next, we shall convert 280 mL to litre (L). This can be obtained as follow:
1000 mL = 1 L
Therefore,
280 mL = 280 mL × 1 L / 1000 mL
280 mL = 0.28 L
Thus, 280 mL is equivalent to 0.28 L.
Finally, we shall determine the molarity of the solution. This can be obtained as illustrated below:
Mole of solid = 0.4 mole
Volume = 0.28 L
Molarity =?
Molarity = mole / Volume
Molarity = 0.4 / 0.28
Molarity = 1.43 M
Thus, the molarity of the solution is 1.43 M.
which is the correct order from lowest to highest field for the chemical shift
The correct order from lowest to highest field for the chemical shift is: Deshielded < Shielded < Highly Shielded
The chemical shift is a measure of the magnetic field experienced by a nucleus in a molecule. It depends on the electron density around the nucleus and the external magnetic field.
Shielding occurs when the electrons around the nucleus create a magnetic field that opposes the external magnetic field, leading to a lower chemical shift. Deshielding occurs when the electrons around the nucleus create a magnetic field that reinforces the external magnetic field, leading to a higher chemical shift.
Highly shielded nuclei are those that experience the strongest shielding effect, leading to the lowest chemical shift.
The correct order from lowest to highest field for the chemical shift is Deshielded < Shielded < Highly Shielded.
For more information on chemical shift kindly visit to
https://brainly.com/question/30630744
#SPJ11
Which term includes the other four? (atoms, molecules, electrons, elements, protons)
Answer:
molecules
Explanation:
8. Why do we see water droplets on the outer surface of a glass containing ice cold water?
9. Convert the following temperature to the CELCIUS scale (a) 25K (b) 373K.
10. How will you show that air has maximum compressibility?
Answer:
8. We see water droplets on the outer surface of a glass containing ice cold water because condensation is happening! This happens when warm water vapour from the surroundings come into contact with a cool surface (in this case the cool glass) and loses heat and condenses, forming water droplets on the surface of the glass.
9 a) -248.15 celcius
b) 99.85 celcius
10. by using 2 syringes, one filled with water and one filled with air. when you compress it, you will find that the one with water barely compresses and the one filled with air should be able to be compressed quite a bit. and to the extent that the syringe is unable to be pushed down further, that is the maximum compressibility of air.
Carbon cycle – What are the main reservoirs
of the carbon cycle? Where do the inorganic and organic carbon
cycles interact? What are the major differences and similarities
between the inorganic and organic carbon?
The main reservoirs of the carbon cycle are the atmosphere, oceans, land (including vegetation and soils), and fossil fuels. In these reservoirs, carbon exists in both inorganic and organic forms.
The inorganic carbon cycle involves the exchange of carbon dioxide (CO2) between the atmosphere and oceans through processes like photosynthesis and respiration.
Organic carbon, on the other hand, is found in living organisms, dead organic matter, and soil organic matter. It is cycled through processes such as decomposition and consumption by organisms. The interactions between the inorganic and organic carbon cycles occur primarily in the biosphere, where photosynthesis converts inorganic carbon into organic carbon compounds. While inorganic carbon is primarily in the form of CO2, organic carbon is present in complex organic molecules. Both forms of carbon play crucial roles in energy transfer, nutrient cycling, and climate regulation.
Learn more about Carbon Cycle
brainly.com/question/13729951
#SPJ11
7. True or false. Where air masses collide, weather changes
Answer:true
Explanation:
if a sample of 4.50 moles of hydrogen gas was reacted with excess nitrogen, how many moles of ammonia gas would be produced?
Answer: 3.00
Explanation: got the answer from my teachers notes
According to stoichiometry, if a sample of 4.50 moles of hydrogen gas was reacted with excess nitrogen, 3 moles of ammonia gas would be produced.
What is stoichiometry?Stoichiometry is the determination of proportions of elements or compounds in a chemical reaction. The related relations are based on law of conservation of mass and law of combining weights and volumes.
Stoichiometry is used in quantitative analysis for measuring concentrations of substances present in the sample.It is useful in balancing chemical reactions.In the given reaction 3 moles hydrogen gives 2 moles ammonia, thus, 4.5 moles of hydrogen will give, 4.5×2/3=3 moles.
Thus, if a sample of 4.50 moles of hydrogen gas was reacted with excess nitrogen, 3 moles of ammonia gas would be produced.
Learn more about stoichiometry,here:
https://brainly.com/question/9743981
#SPJ6
When the offspring has a new genetic variation that a government neither of us parents it is called
(a) can a hydrogen atom in the ground state absorb a photon of energy less than 13.6 ev?
Yes, a hydrogen atom in the ground state can absorb a photon of energy less than 13.6 ev.
The wavelength of the matter waves that make up an electron orbit around a nucleus is the same as the radius of the orbit. Any fractional number would not fit the circle of the electron orbit, but a whole number of wavelengths might. Atomic excitations, in which the electrons take in a photon to enter a higher energy state, are another process that an atom goes through. As a result, electrons' wavelength can shift, which also causes the electron's orbit to alter. The relationship between an electron's energy and wavelength is inverse. An electron in the ground state can therefore absorb a photon with energy equal to the energy difference between the ground state energy and excited state energy during atomic excitation.
know more about atoms here
https://brainly.com/question/13654549#
#SPJ4
A 34.0 g metal cylinder is dropped into a graduated cylinder. If the water level increases from 22.3 mL to 25.3mL, what is the density of the cylinder?
Answer:
The answer is
11.33 g/mLExplanation:
The density of a substance can be found by using the formula
\(density = \frac{mass}{volume} \\ \)
From the question
mass of metal = 34 g
volume of metal = final volume of water - initial volume of water
volume = 25.3 - 22.3 = 3.0 mL
The density is
\(density = \frac{34}{3} \\ = 11.33333...\)
We have the final answer as
11.33 g/mLHope this helps you
Design a synthesis of diphenylmethanol from starting materials containing 6 carbons or fewer and only C, H, and/or O in their structure.
Diphenylmethanol may be synthesized by a Grignard reaction between phenylmagnesium bromide and benzaldehyde as the staring material.
A Grignard reagent is an organometallic compound that is formed by reacting an alkyl or aryl halide with magnesium metal in anhydrous ether or THF (tetrahydrofuran) solvent.
To synthesize diphenylmethanol from a Grignard reaction between phenylmagnesium bromide and benzaldehyde, the following steps can be followed:
1. Start with benzaldehyde (\(\rm C_6H_5CHO\)) as the starting material.
2. React benzaldehyde with an excess of phenylmagnesium bromide \(\rm (C_6H_5MgBr)\) in anhydrous ether or THF (tetrahydrofuran) as a solvent. This will form the Grignard reagent, phenylmagnesium bromide \(\rm (C_6H_5MgBr)\).
3. After the addition of phenylmagnesium bromide, add water or dilute acid (such as hydrochloric acid) to the reaction mixture to hydrolyze the Grignard reagent. This will lead to the formation of diphenylmethanol.
4. Isolate and purify diphenylmethanol through techniques such as extraction, distillation, or recrystallization.
Therefore, overall reaction for the synthesis of diphenylmethanol using benzaldehyde as the staring material:
\(\rm Benzaldehyde + Phenylmagnesium bromide \rightarrow Diphenylmethanol\)
Learn more about Grignard reagent here:
https://brainly.com/question/31845163
#SPJ4
Which is not a physical state of matter?
A. Solid
B. Liquid
C. Plasma
D. Gas
Answer: Plasma
Explanation:
Answer: Plasma
Explanation:
1. Give the structural formula for the following molecules
2,3-dimethyl heptane
2,3-dimethylheptane is an organic compound with the chemical formula C9H20. It belongs to the class of hydrocarbons known as alkanes, specifically heptanes.
The compound is a branched alkane, meaning it has a chain of seven carbon atoms with two methyl groups (CH3) attached to the carbon atoms at positions 2 and 3. The molecular structure of 2,3-dimethylheptane can be represented as follows: CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH3 In this structure, the two methyl groups are attached to the second and third carbon atoms in the heptane chain. The compound is a colorless liquid at room temperature and is primarily used as a solvent or as a component in gasoline blends. It has a relatively high octane rating, which makes it desirable for use in gasoline to improve its overall performance and reduce engine knocking.
Learn more about dimethylheptane here:
https://brainly.com/question/31481603
#SPJ11
which process helps guarantee that a species continues to involve over hundreds of years?
A. growth
B. nutrition
C. reproduction
Answer:
C. reproduction
Explanation:
Calculate the amount of heat released when one bottle (250 g) of ethanol is cooled from 45°C to 40°C. The specific heat of ethanol is 2.45 J/g°C
2054 J
-1533 J
-3063 J
4063 J
Answer:
C) -3063J
Explanation:
multiply m, c, and change in T
Using the rules for significant figures, what do you get when you multiply 67.6 by 1.2?
Answer:
The answer should have as many significant figures as the lowest number used in the multiplication, which is 1.2 .
Explain whether changing the ratio of baking soda and vinegar changes the amount of carbon dioxide produced. Include the evidence you used to reach your conclusion.
On changing the ratio of baking soda and vinegar changes the amount of carbon dioxide produced is true, because each species will depends on both reactants.
What is chemical reaction?Chemical reaction between baking soda and vinegar is shown below in the attached image in which the formation of carbon dioxide, water and sodium acetate takes place. So the formation of carbon dioxide depends on the baking soda and baking soda reacts with vinegar to form sodium acetate so change in the ratio will changes the amount of carbon dioxide.
Hence on changing the ratio of reactants and vinegar changes the amount of carbon dioxide.
To know more about chemical reactions, visit the below link:
https://brainly.com/question/26018275
Due at 8:20 am and it’s currently 2:20 am! Please help me. Do NOT send links, it’s irritating and it is a waste of time. Thank you!
Balance the following equation, then solve for the heat of the combustion reaction (ΔH rxn) of glucose:
C6H12 (g) + O2 (g)-> CO2 (g) + H2O (g)
Answer:
1,9,6,6
Explanation:
i have a good idea of the answer i just need confirmation! Thanks!
ANSWER
7 moles of MgO was produced during the reaction
EXPLNATION
Given that;
The number of moles of oxygen is 3.5 moles
Follow the steps below to find the number of moles of MgO
Step 1; Write a balanced equation of the reaction
\(\text{ 2Mg + O}_2\text{ }\rightarrow\text{ 2MgO}\)In the equation above 2 moles Mg react with 1 mole oxygen to produce 2 moles MgO
Step 2; Find the number of moles of MgO using a stoichiometry ratio
Let x represents the number of moles of MgO
\(\begin{gathered} \text{ 1 mole O}_2\text{ }\rightarrow\text{ 2 moles MgO} \\ \text{ 3.5 moles O}_2\text{ }\rightarrow\text{ x moles MgO} \\ \text{ Cross multiply} \\ \text{ 1 mole O}_2\times\text{ x moles MgO = 2 moles MgO }\times\text{ 3.5moles O}_2 \\ \text{ Isolate x} \\ \text{ x moles MgO = }\frac{2\text{ moles MgO}\times3.5moles\cancel{O_2}}{1mole\cancel{O_2}} \\ \\ \text{ x moles MgO = 2 }\times\text{ 3.5} \\ \text{ x moles of MgO = 7 moles} \end{gathered}\)Therefore, 7 moles of MgO was produced during the reaction
The isomerization of cyclopropane to propene is a first-order reaction with a rate constant of 9.2/s. If an initial sample of cyclopropane has a concentration of 6.00 M, what will the cyclopropane concentration be after 1.00 s?
The number of moles of the cyclopropane that remains after 1.00 s is 6.1 * 10^-4 M.
What is is the concentration?By the use of the equation of the first order reaction, we can be able to find out the concentration at a given time.
The equation of the first order reaction can be written as;
ln[A] = ln[Ao] - kt
[A] = Concentration at time t
[Ao] = Initial concentration
k = rate constant
t = time
Then;
[A] = e^ln[Ao] - kt
[A] = e^ln6.00 - (9.2 * 1)
[A] = 6.1 * 10^-4 M
The amount of the cyclopropane left is 6.1 * 10^-4 M.
Learn more about first order reaction :https://brainly.com/question/12446045
#SPJ1
What gas law states that volume and pressure are inversely proportional, while directly proportional to temperature when moles are held constant
Combined gas law states that when the number of moles of an ideal gas are held constant, the volume and pressure of the gas are inversely proportional while being directly proportional to temperature.
Under combined gas law, the three (3) main gas laws are combined together and these include:
Boyle's law.Charles' law.Gay-Lussac's law.Mathematically, the combined gas law is given by the formula:
\(\frac{PV}{T} =k\\\\\frac{P_1V_1}{T_1} = \frac{P_2V_2}{T_2}\)
Where:
P is the pressure of a gas.T is the temperature of a gas.V is the volume of a gas.Read more: https://brainly.com/question/21280037
For this investigation, you used commercial juices. The juices are known to contain appreciable amounts of Vitamin C (Ascorbic acid). The vitamin C in the juice sample will react with the NaOH used in This means the volume of NaOH used in the neutralization reaction is higher than what it should have been making it appear like there are more moles of citric acid present. Therefore, the calculated concentration of the citric acid in the juice samples will be overestimated compared to the actual concentration in the commercial juices.
The calculated concentration of citric acid in the juice samples will be overestimated due to the interference of Vitamin C.
Vitamin C, also known as ascorbic acid, is present in significant amounts in commercial juices. When NaOH is added to the juice sample to neutralize the citric acid, it reacts with the vitamin C as well, causing the volume of NaOH used to be higher than it should be.
This results in an overestimation of the concentration of citric acid in the sample. The reaction between vitamin C and NaOH is:
C6H8O6 + 2NaOH → Na2C6H6O6 + 2H2O
The NaOH reacts with both citric acid and vitamin C in the sample, which leads to an inaccurate measurement of the actual concentration of citric acid present in the juice. Therefore, it is essential to consider this interference while analyzing the results of the experiment.
For more questions like Concentration click the link below:
https://brainly.com/question/10725862
#SPJ11
4Fe + 3O2 —-> 2Fe2O3
How many grams of iron(Fe) and oxygen gas(O2) reacted to form 65.6 grams of Fe2O3
46.03 grams of iron and 19.75 grams of oxygen gas reacted to form 65.6 grams of Fe2O3.
What is Moles?
In chemistry, a mole is a unit of measurement that represents a certain amount of a substance. One mole of any substance is equal to 6.022* \(10^{23}\) particles (atoms, ions, etc.), which is known as Avogadro's number. The number of moles of a substance is determined by dividing the mass of the substance by its molar mass, which is the mass of one mole of the substance.
The balanced chemical equation is:
4Fe + 3O2 → 2Fe2O3
From the equation, we can see that 4 moles of Fe react with 3 moles of O2 to produce 2 moles of Fe2O3.
To find out how many grams of Fe and O2 reacted to form 65.6 grams of Fe2O3, we first need to calculate the number of moles of Fe2O3 produced:
molar mass of Fe2O3 = 2 x atomic mass of Fe + 3 x atomic mass of O = 2 x 55.845 + 3 x 15.999 = 159.685 g/mol
moles of Fe2O3 = mass of Fe2O3 / molar mass of Fe2O3
moles of Fe2O3 = 65.6 g / 159.685 g/mol
moles of Fe2O3 = 0.411 mol
From the balanced chemical equation, we know that 2 moles of Fe2O3 are produced from 4 moles of Fe and 3 moles of O2. Therefore, the number of moles of Fe and O2 that reacted can be calculated as follows:
moles of Fe = (4/2) x moles of Fe2O3
moles of Fe = 2 x 0.411 mol
moles of Fe = 0.822 mol
moles of O2 = (3/2) x moles of Fe2O3
moles of O2 = 1.5 x 0.411 mol
moles of O2 = 0.617 mol
Finally, we can calculate the mass of Fe and O2 that reacted:
mass of Fe = moles of Fe x atomic mass of Fe
mass of Fe = 0.822 mol x 55.845 g/mol
mass of Fe = 46.03 g
mass of O2 = moles of O2 x molar mass of O2
mass of O2 = 0.617 mol x 32.00 g/mol
mass of O2 = 19.75 g
Learn more about Moles from the given link
https://brainly.com/question/29367909
#SPJ1
what is the molar concentration of a 15.00y weight sodium chloride solution whose density is 1.081 g/ml
The molar concentration of a 15.00y weight sodium chloride solution whose density is 1.081 g/ml is 0.257 M. Molar concentration is defined as the amount of solute present in per unit volume of solution.
We are given, Weight of sodium chloride = 15.00 y. Density of sodium chloride solution = 1.081 g/ml. Molar mass of NaCl = 58.44 g / mol Molar concentration can be calculated as follows, Firstly, we need to find the number of moles of sodium chloride. Number of moles of NaCl = Mass of NaCl / Molar mass of NaCl= 15.00 y / 58.44 g/mol.
The molar concentration of sodium chloride. Concentration = (number of moles of solute)/volume of solution in litres= 0.00636 mol / 0.411 × 10⁻³ L= 0.257 M. Thus, the molar concentration of a 15.00y weight sodium chloride solution whose density is 1.081 g/ml is 0.257 M.
To know more about sodium chloride visit:
https://brainly.com/question/14516846
#SPJ11
(25 POINTS AND BRAINLIEST)What is the volume of 2 mol of chlorine gas at STP?
2.0 L
11.2 L
22.4 L
44.8 L
Answer:
44.8
Explanation:
According to standard temperature and pressure and ideal gas equation , the volume of 2 mole of chlorine gas at STP is 44.8 liters.
What are standard temperature and pressure conditions?Standard temperature and pressure are defined as a standard set of conditions required for experimental measurements which are established to allow comparison between different sets of data.
Standards which are commonly used are those International Union of pure and applied chemistry and national institute of standards and technology.These are not universally accepted standards but are the ones which are commonly used.
Standard conditions of pressure and temperature are necessary to define standard reference conditions used to express volumes of liquids and gases.
These values are important to physicists, chemists ,engineers ,pilots and navigators.On substituting values in ideal gas equation, volume= 2×8.314×273/1=44.8 liters.
Thus, the volume of 2 mole of chlorine gas at STP is 44.8 liters.
Learn more about standard temperature and pressure , here:
https://brainly.com/question/29129606
#SPJ6
Its elemental percentage composition is 83.87% C, 11.99% H, and 4.14% O. It has a molecular weight of 386.64 amu. Calculate its empirical and molecular formulas.
The empirical formula and molecular formula of the compound are both CH₁₈O.
To calculate the empirical formula, we need to find the simplest whole number ratio of atoms in the compound.
Step 1: Convert the given percentages to grams.
C: 83.87% of 386.64g = 324.25g
H: 11.99% of 386.64g = 46.37g
O: 4.14% of 386.64g = 16.02g
Step 2: Determine the moles of each element using their molar masses.
C: 324.25g / 12.01g/mol = 27.00 mol
H: 46.37g / 1.01g/mol = 45.92 mol
O: 16.02g / 16.00g/mol = 1.00 mol
Step 3: Divide each mole value by the smallest mole value to get the simplest ratio.
C: 27.00 mol / 1.00 mol = 27
H: 45.92 mol / 1.00 mol = 45.92
O: 1.00 mol / 1.00 mol = 1
The empirical formula is CH₁₈O.
To find the molecular formula, we need to know the molecular weight of the compound.
Step 1: Calculate the empirical formula mass.
C: 12.01 g/mol x 27 = 324.27 g/mol
H: 1.01 g/mol x 45.92 = 46.44 g/mol
O: 16.00 g/mol x 1 = 16.00 g/mol
Empirical formula mass = 324.27 g/mol + 46.44 g/mol + 16.00 g/mol = 386.71 g/mol
Step 2: Divide the molecular weight by the empirical formula mass to find the whole number ratio.
386.64 g/mol ÷ 386.71 g/mol ≈ 1
The molecular formula is also CH₁₈O.
In conclusion, the empirical formula and molecular formula of the compound are both CH₁₈O.
Learn more about empirical formula here:
https://brainly.com/question/32125056
#SPJ11
List down examples of radioactive machines and sources with
their corresponding types of ionizing radiation. Discuss what type
of shielding materials are used.
Examples of radioactive machines and sources include X-ray machines (producing X-rays), nuclear reactors (producing gamma rays and neutrons), and radioactive isotopes (emitting alpha, beta, or gamma radiation). Shielding materials such as lead, concrete, and water are commonly used to protect against ionizing radiation.
Radioactive machines and sources are used in various fields such as medicine, industry, and research. One commonly encountered radioactive machine is the X-ray machine, which produces X-rays.
X-rays are a form of ionizing radiation that can penetrate the body and create images of bones and tissues. X-ray machines are used for diagnostic purposes in medical settings, helping to identify fractures, tumors, and other medical conditions.
Another example is nuclear reactors, which produce both gamma rays and neutrons. Gamma rays are highly penetrating electromagnetic radiation, while neutrons are subatomic particles that can cause ionization upon interaction with matter.
Nuclear reactors are used to generate electricity, conduct scientific research, and produce radioisotopes for medical and industrial applications.
Radioactive isotopes are another source of ionizing radiation. They can emit different types of radiation, including alpha particles, beta particles, and gamma rays. For instance, alpha particles consist of two protons and two neutrons, and they have low penetration power.
Beta particles are high-energy electrons or positrons, while gamma rays are electromagnetic waves with high energy and penetration ability.
To protect against ionizing radiation, various shielding materials are employed. Lead is commonly used due to its high density, which effectively absorbs and attenuates gamma rays and X-rays.
Concrete is another commonly used material, providing sufficient thickness to reduce the penetration of gamma rays. Water is also used as a shielding material, particularly in nuclear reactors, as it can effectively absorb neutrons.
Learn more about Radioactive machines
brainly.com/question/1770619
#SPJ11
2 Aluminum oxidizes according to the following equation: 4A1 + 302 → 2Al2O,
[a] Powdered Al (0.048 myl) is placed into a container containing 0.030 mol O.. What is the limiting reactant?
[b] How many moles of the excess reoctant remaine?
Answer:
Identify the limiting reactant (limiting reagent) in a given chemical reaction.
Calculate how much product will be produced from the limiting reactant.
Calculate how much reactant(s) remains when the reaction is complete.
write the electronic configuration of an Na+ and CL-1
Answer:
Na+ lost one electron: 1s2 2s2 2p6
Cl- gained an electron: 1s2 2s2 2p6 3s2 3p6
Explanation:
Identify what the conjugate acid/base would be. FOR H3PO4?