What volume would 4.32x1023 atoms of Krypton gas occupy at STP?​

What Volume Would 4.32x1023 Atoms Of Krypton Gas Occupy At STP?

Answers

Answer 1
Me no ingles, lo siento, necesito el punto

Related Questions

ASAP PLEASE!!!B. Complete the drawing for the sample reaction below to show the law of conservation of
mass, when XY is produced.
+
->

ASAP PLEASE!!!B. Complete the drawing for the sample reaction below to show the law of conservation ofmass,

Answers

The complete reaction, according to the law of conservation of mass is:

XX + YY → 2XY

The Law of Conservation is a fundamental principle in chemistry and physics. It states that in a closed system, mass cannot be created or destroyed during a chemical reaction or a physical change. The total mass of the substances involved before the reaction or change must equal the total mass of the substances after the reaction or change.

This principle is based on the understanding that atoms are not created or destroyed, but they can combine or separate to form different substances.

Learn more about the law of mass conservation, here:

https://brainly.com/question/28711001

#SPJ1

Can anyone help me understand how to calculate the moles of H+ and OH-?

Can anyone help me understand how to calculate the moles of H+ and OH-?

Answers

To calculate the moles of H+ and OH-, you need to know the concentration of the solution in terms of its pH or pOH value.

How to calculate the moles

When you get the pH of the solution, you can use this formula to calculate the concentration of H+ ions: [H+] = 10^(-pH)

Also, if you know the pOH of the solution, you can use this formula to calculate the concentration of OH- ions: [OH-] = 10^(-pOH)

Having determined the concentration of H+ and OH- ions, the molarity formula can be used to calculate the number of moles of each ion as follows: moles = concentration (in mol/L) x volume (in L)

Learn more about moles calculation here:

https://brainly.com/question/14357742

#SPJ1

How many electrons are in the 6p subshell of Rn?

Answers

In the electrical arrangement, the 6p subshell of the radon element contains 6 electrons.

What is electronic configuration of radon?Radon is the 86th element in the periodic table, with the symbol 'Rn'. Radon is a type of noble gas. Radon contains a total of eighty-six electrons. These electrons are grouped in accordance with the laws of several orbits.The p-orbital can hold up to six electrons. As a result, the following six electrons enter the 2p orbital. The second orbit is now completely filled. As a result, the remaining electrons will go into the third orbit.As a result, the entire electron configuration of radon is 1s^2 2s^2 2p^6 3s^2 3p^6 3d^10 4s^2 4p^6 4d^10 4f^14 5s^2 5p^6 5d^10 6s^2 6p^6.

For more information on electronic configuration kindly visit to

https://brainly.com/question/29757010

#SPJ1

-Convert 6.02 x 1020 formula units of MgCl₂ to mol of MgCl₂:​

Answers

6.02 x \(10^{20\) formula units of MgCl₂ is equal to 0.1 moles of MgCl₂.

To convert formula units of MgCl₂ to moles of MgCl₂, we need to use Avogadro's number, which relates the number of formula units to the number of moles.

Avogadro's number (NA) is approximately 6.022 x 10^23 formula units per mole.

Given that we have 6.02 x 10^20 formula units of MgCl₂, we can set up a conversion factor to convert to moles:

(6.02 x 10^20 formula units MgCl₂) * (1 mol MgCl₂ / (6.022 x 10^23 formula units MgCl₂))

The formula units of MgCl₂ cancel out, and we are left with moles of MgCl₂:

(6.02 x 10^20) * (1 mol / 6.022 x 10^23) = 0.1 mol

Therefore, 6.02 x 10^20 formula units of MgCl₂ is equal to 0.1 moles of MgCl₂.

It's important to note that this conversion assumes that each formula unit of MgCl₂ represents one mole of MgCl₂. This is based on the stoichiometry of the compound, where there is one mole of MgCl₂ for every one formula unit.

Additionally, this conversion is valid for any substance, not just MgCl₂, as long as you know the value of Avogadro's number and the number of formula units or particles you have.

For more such questions on MgCl₂ visit:

https://brainly.com/question/26311875

#SPJ8

A liquid ester used to flavour food is believed to be impure. What would be the best way of testing its purity?​

Answers

Answer:

Filter it

Explanation:

Will give out brainiest for best answer giving 15 pts

Will give out brainiest for best answer giving 15 pts

Answers

I think that the answer is 8

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

What product is released into Earth's atmosphere through the combustion offossil fuels?O A. Carbon dioxideOB. HydrocarbonO C. OxygenO D. Methane

Answers

Explanation:

When fossil fuel (coal, natural gas, and oil) burns or solid waste, trees, and other biological substances products, CO2 (carbon dioxide) is released and enters the atmosphere.

Answer: A. Carbon dioxide

g The boiling of water is a Question 4 options: chemical and physical damage chemical change because a gas (steam) is given off chemical change because heat is needed for the process to occur physical change because the water merely disappears physical change because the gaseous water is chemically the same as the liquid

Answers

Answer:

physical change because the gaseous water is chemically the same as the liquid

Explanation:

Matter can be defined as anything that has mass and occupies space. Any physical object that is found on earth is typically composed of matter. Matter are known to be made up of atoms and as a result has the property of existing in states.

Generally, matter exists in three (3) distinct or classical phases and these are; solid, liquid and gas.

A physical change can be defined as a type of change that only affects the physical form of a chemical substance (matter) without having any effect on its chemical properties. Thus, a physical change would only affect the physical appearance and properties of a chemical substance (matter) but not its chemical properties.

This ultimately implies that, a physical change result in a change of matter from one form or phase (liquid, solid or gas) to another without a corresponding change in chemical composition.

Hence, the boiling of water is considered to be a physical change because the gaseous water is chemically the same as the liquid i.e there isn't any changes in chemical composition of water when boiling.

50 points
Which elemental family receives electrons in an ionic bond?
Responses

noble gases

metals

halogens

nonmetals

Answers

Answer:    es no metales

Explanation:

a) At 40 °C, what the saturated solubility level of KCl (aq)? (1 mark)

b) If 40 g of KCl is added to 100 g of water at 90 °C, would the solution be saturated? Explain. (2 marks)

c) Describe two ways in which saturation can be achieved if only 40 g of KCl is added to 100 g of water at 90 ° (3 marks)

a) At 40 C, what the saturated solubility level of KCl (aq)? (1 mark)b) If 40 g of KCl is added to 100

Answers

a) The saturated solubility level of KCl (aq) at 40°C is 35.7 g/100 mL of water.

b) No, the solution would not be saturated at 90°C. At this temperature, the solubility of KCl in water is higher than at 40°C. Therefore, more KCl can dissolve in 100 g of water at 90°C than at 40°C. To determine if the solution is saturated, we need to compare the amount of KCl that actually dissolved in the water to the maximum amount of KCl that can dissolve in the water at that temperature. If the amount of KCl that dissolved is less than the maximum amount, then the solution is unsaturated. If the amount of KCl that dissolved is equal to the maximum amount, then the solution is saturated. If the amount of KCl that dissolved is greater than the maximum amount, then the solution is supersaturated.

c) Two ways in which saturation can be achieved if only 40 g of KCl is added to 100 g of water at 90°C are:

i) Heating the solution to a higher temperature: As the temperature of the solution is increased, the solubility of KCl in water also increases. Therefore, by heating the solution to a higher temperature than 90°C, more KCl can be dissolved in the water until the solution becomes saturated.

ii) Allowing the solution to cool slowly: If the solutionis heated to a temperature higher than 90°C and then allowed to cool slowly, the solubility of KCl in water decreases as the temperature decreases. This means that as the solution cools, KCl will begin to precipitate out of the solution until the solution becomes saturated. Alternatively, if the solution is left undisturbed at 90°C and allowed to cool slowly, KCl will begin to precipitate out of the solution as it reaches its saturation point.

Batrachotoxin, C31H42N2O6 , an active component of South American arrow poison, is so toxic that 0.05μg can kill a person.

Answers

In 0.05μg, there are  \(6.9 * 10^{15} molecules\)  of batrachotoxin.

To calculate the number of molecules of batrachotoxin, we first need to calculate the molar mass of the molecule. This can be done by adding up the atomic masses of the elements in the compound. The elements in batrachotoxin are carbon (C), hydrogen (H), nitrogen (N), and oxygen (O). The atomic masses of these elements are 12 g/mol for C, 1 g/mol for H, 14 g/mol for N, and 16 g/mol for O. Therefore, the molar mass of batrachotoxin is:

Molar mass = 12 g/mol C + 1 g/mol H + 14 g/mol N + 16 g/mol O

Molar mass = 43 g/mol

We then need to calculate the mass of 0.05 μg of batrachotoxin. This can be done by converting 0.05 μg to grams. To do this, we divide 0.05 μg by 1,000,000. This gives us:

\(\frac{0.05\mu g }{ 1,000,000 }= 0.00000005 g\)

Now we can calculate the number of molecules of batrachotoxin in 0.05 μg by dividing the mass in grams by the molar mass:

Number of molecules =\(\frac{ 0.00000005 g }{ 43 g/mol}\)

Number of molecules = \(1.16 * 10^{-8} mol\)

Finally, we can calculate the number of molecules by multiplying the number of moles by Avogadro's number:

Number of molecules =\(\frac{1.16 * 10^{-8 }mol * 6.022 * 10^{23 }molecules}{mol}\)

Number of molecules = \(6.9 * 10^{15} molecules\)

Therefore, there are  \(6.9 * 10^{15} molecules\)  of batrachotoxin in 0.05 μg.

learn more about molecules Refer:brainly.com/question/19556990

#SPJ1

complete question:Batrachotoxin, C31H42N2O6 an active component of South American arrow poison, is so toxic that 0.05μg can kill a person.

How many molecules is this? Express your answer as an integer

can u identify a chemical equation for the saponification of olive oil as per your experiment?
I​

Answers

yes you can identify it depending on the experiment made

Help please guys anybody

Help please guys anybody

Answers

Given what we know about the forces that act upon objects, we can confirm that an object to which balanced forces are applied will not be in motion.

What are balanced and unbalanced forces?A balanced force is when an object is not in motion due to all forces being matched. This means that for every force, there is an opposite force of the same magnitude that nullifies it. When one of these forces increases and overtakes its opposite, we gain motion. When this happens, the forces are now unbalanced.

Therefore, we can confirm that since the forces that are acting on the object are balanced, meaning that each force is matched by an opposite force of the same magnitude, the object will not move. For this object to move, the forces would have to become unbalanced by increasing the magnitude of one.

To learn more about the laws of motions visit:

https://brainly.com/question/2437899?referrer=searchResults

The reaction A + 2B + C → Products has a rate law of Rate = k[A]²[B]. By what factor would the reaction rate change if [C] is tripled?

Answers

The rate of reaction would change by a factor of 1  if [C] is tripled.

What is the rate law?

We know that the rate law is a relationship that shows the connection that exists between the reactants and the products in a given reaction. Now we know that species that appear in the rate law are the species who actually participate in the reaction. If there is any specie that does not participate in the rate determining step of the reaction then it does not in any way appear in the rate determining step of the reaction.

We have the reaction equation as;  A + 2B + C → Products

The we have the rate law for the reaction as;  Rate = k[A]²[B]

We can see that C dos not appear in the rate law thus the formation of the product is independent of the concentration of C.

Thus, the rate of reaction would change by a factor of 1  if [C] is tripled.

Learn more about rate of reaction:https://brainly.com/question/8592296

#SPJ1

Consider the following reaction:

2CH4(g)⇌C2H2(g)+3H2(g)

The reaction of CH4 is carried out at some temperature with an initial concentration of [CH4]=0.092M. At equilibrium, the concentration of H2 is 0.014 M.

Find the equilibrium constant at this temperature.

Answers

The equilibrium constant at this temperature is Kc= 4.17 x 10⁻⁶.

What is equilibrium?

Since the equilibrium constant depends on the equilibrium concentration of both the reactants and the products of the chemical reaction.

Balanced reaction equation

2CH₄(g)⇌C₂H₂(g)+3H₂(g)

The initial concentration of the CH₄ = 0.093 M

The equilibrium concentration of the H = 0.017 M

Equilibrium constant = ?

Let's make the ice table

2CH₄(g) ⇌ C₂H₂(g) + 3H₂(g)

0.093 M 0 0

-2x +x +3x

0.093-2x x 0.017 M

3x = 0.017 M

Therefore, x =0.017 M /3 = 0.00567 M

Therefore, the equilibrium concentration of CH₄ =

0.093 M – 2x = 0.093 M – (2 x 0.00567 M) = 0.0817 M

Equilibrium concentration of the C₂H₄ = x = 0.00567 M

Let's write the equilibrium constant expression

Kc= [C₂H₄[H2]³/[CH₄]²

Let's put the values in the formula

Kc= [0.00567][0.017]³/[0.0817]²

Kc= 4.17 x 10⁻⁶

Therefore, the equilibrium constant is 4.17 x 10⁻⁶.

To learn more about equilibrium constant, refer to the link:

https://brainly.com/question/12971169

#SPJ9

What is the relationship between pressure and temperature?
PLEASEEE HELPPP!!!!!

Answers

Answer:

i forgot

Explanation:

Answer:The pressure of a given amount of gas is directly proportional to its absolute temperature, provided that the volume does not change (Amontons's law). The volume of a given gas sample is directly proportional to its absolute temperature at constant pressure (Charles's law).

Explanation:

brainliest?

Which compound contains only nonpolar covalent bonds?
O 02
0 CO2
O H20
O NO3

Answers

Answer:

A o2

Explanation:

edge 2020

The compound contains only nonpolar covalent bond is oxygen. Therefore, option A is correct.

What is non polar covalent bond ?

When the electrons are shared equally between the two atoms there is the formation of non polar covalent bond. By equal sharing of electron non polar covalent bond are produced.

The oxygen atoms have neutral charge. The oxygen molecule in the has two nonpolar bonds present in their structure. The two oxygen nuclei have an equal force of attraction between them for their four shared electrons.

The oxygen molecule is nonpolar because the electrons are equally divided between the two oxygen atoms. Two oxygen molecule share equal number of electrons. These materials split electrons in the same way as carbon and hydrogen atoms shared, therefore non polar covalent bond formed.

Thus, option A is correct.

To learn more about the non polar covalent bond, follow the link;

https://brainly.com/question/10777799

#SPJ2

What two things interact to affect development of color in some instances?

Answers

Answer:The colour and distribution of the organism's biochromes

Explanation:

The colour and distribution of the organism's biochromes (pigments), particularly the relative location of differently coloured areas; the shape, posture, position, and movement of the organism; and the quality and quantity of light striking the organism

HELPPP PLEASEE w/ all

HELPPP PLEASEE w/ all

Answers

The covalent bond is present in the compound C₃H₈. The reactant C is 3, product C is 6, reactant H is 8, product H is 10, Reactant O is 2, product O is 9.

What is covalent bond ?

Atoms share electron pair between them in covalent bonds. H-H or C-H are examples of nonpolar covalent bonds between atoms with similar or identical electronegativity, whereas polar covalent bonds are formed when unequal electronegativity is shared between atoms (e.g., H–O).

What is reactant ?

Raw materials known as reactants combine to create products. When the right factors, such as temperature, time, or pressure, come into play, the chemical bonds between the reactants are broken, allowing the atoms to form new bonds that lead to various combinations.

Therefore, covalent bond is present in the compound C₃H₈. The reactant C is 3, product C is 6, reactant H is 8, product H is 10, Reactant O is 2, product O is 9.

Learn more about covalent bond from the given link.

https://brainly.com/question/3447218

#SPJ1

Potassium, a metal with one electron in the outermost shell, will react with how many chlorine atoms

Answers

Answer:

7 chlorine atoms

Explanation:

K=2.8.8.1

Cl=2.8.7

pottasium will give chlorine its I valence electron to form ions as follows

K=(2.8.8)+

Cl=(2.8.8)-

It will react with 1 chlorine atom.

Whilst one atom loses an electron to every other atom it results in the formation of?

An ionic bond is shaped by using the whole transfer of some electrons from one atom to every other. The atom losing one or more electrons becomes a cation—an undoubtedly charged ion. The atom gaining one or more electrons will become an anion—a negatively charged ion.

What number of bonds can chlorine form?

In those compounds carbon, nitrogen, oxygen, and chlorine atoms have four, three, and one bonds, respectively. The hydrogen atom and the halogen atoms form the most effective covalent bond to different atoms in maximum stable neutral compounds.

Learn more about chlorine atom here: https://brainly.com/question/25310059

#SPJ2

What is Versatile nature of Carbon?​

Answers

Answer:

The versatile nature of carbon is due to the presence of two types of properties to carbon. - The two properties which will give the name versatile to carbon are tetravalency and catenation. ... - The carbon has a property to form long chain compounds due to its catenation property.

Hope it helps

TC

GN

SD

The versatile nature of Carbon allows it to form long chains of compound with other elements in a process known as concatenation.

What is carbon?

Carbon is a chemical element with the symbol C and atomic number 6.

Carbon has four valance electrons that allows it form covalent bond. The covalent nature of carbon allows it to form long chains with other elements.

The ability of carbon to form long chains is known as concatenation.

Thus, the versatile nature of Carbon allows it to form long chains of compound with other elements in a process known as concatenation.

Learn more about concatenation of carbon here: https://brainly.com/question/12350620

2 NaClO3→ 2 NaCl + 3 O2

How many moles of O2 are produced when 40g of NaCl are formed?

Answers

Answer:

75.6

Explanation:

draw structure of 4-ethyl-2,2,7trimethyloctane? ​

Answers

An ethyl group is an alkyl substituent produced from ethane in chemistry (C2H6). It has the chemical formula -CH2CH3 and is frequently shortened to Et.

What is meant by chemical structure?When determining the chemical structure of a target molecule or other solid, chemists must also characterize the molecular geometry and, if possible and required, the electronic structure.When determining the chemical structure of a target molecule or other solid, chemists must also characterize the molecular geometry and, if possible and required, the electronic structure.Shell structures, frame structures, and solid structures are the three fundamental forms of structures.Examples of load-bearing constructions include salt domes, anthills, beaver dams, buildings, airplanes, and skeletons. The infrastructure of human society is made up of buildings and non-building structures that are the outcome of construction.

Draw structure of 4-ethyl-2,2,7trimethyloctane:

An ethyl group is an alkyl substituent produced from ethane in chemistry (C2H6). It has the chemical formula -CH2CH3 and is frequently shortened to Et.

To learn more about ethyl, refer to:

https://brainly.com/question/16187602

#SPJ9

draw structure of 4-ethyl-2,2,7trimethyloctane?
draw structure of 4-ethyl-2,2,7trimethyloctane?

The composition of a compound is 28.73% K, 1.48% H, 22.76% P, and 47.03% O. The molar mass of the
compound is 136.1 g/mol.
I

Answers

The compound has an empirical formula of \(K_2H_2P_2O_8\) and a molecular formula of \(K_2HPO_4\).

The given compound has a percent composition of K = 28.73%, H = 1.48%, P = 22.76%, and O = 47.03%. Its molar mass is 136.1 g/mol. To determine its molecular formula, we need to find its empirical formula and calculate its molecular formula from its empirical formula.The empirical formula is the smallest whole number ratio of atoms in a compound. It can be determined by converting the percent composition of the elements into their respective moles and dividing each by the smallest number of moles calculated. The moles of K, H, P, and O in 100 g of the compound are: K = 28.73 g x (1 mol/39.1 g) = 0.734 molH = 1.48 g x (1 mol/1.01 g) = 1.46 molP = 22.76 g x (1 mol/30.97 g) = 0.736 molO = 47.03 g x (1 mol/16.00 g) = 2.94 molDividing each by the smallest number of moles gives the following ratios: K = 0.734/0.734 = 1H = 1.46/0.734 = 2P = 0.736/0.734 = 1.002O = 2.94/0.734 = 4. The empirical formula of the compound is \(K_2H_2P_2O_8\). To calculate the molecular formula, we need to determine the factor by which the empirical formula should be multiplied to obtain the molecular formula. This can be done by comparing the molar mass of the empirical formula to the molar mass of the compound.The molar mass of \(K_2H_2P_2O_8\) is: \(M(K_2H_2P_2O_8)\) = (2 x 39.1 g/mol) + (2 x 1.01 g/mol) + (2 x 30.97 g/mol) + (8 x 16.00 g/mol) = 276.2 g/mol. The factor by which the empirical formula should be multiplied is: M(molecular formula)/M(empirical formula) = 136.1 g/mol/276.2 g/mol = 0.4935. The molecular formula is obtained by multiplying the empirical formula by this factor: \(K_2H_2P_2O_8 * 0.4935 = K_2HPO_4\). Therefore, the molecular formula of the compound is \(K_2HPO_4\).The molecular formula of the given compound having a composition of 28.73% K, 1.48% H, 22.76% P, and 47.03% O with a molar mass of 136.1 g/mol is \(K_2HPO_4\). The empirical formula of the compound is \(K_2H_2P_2O_8\). The compound's molecular formula is calculated by determining the factor by which the empirical formula should be multiplied to obtain the molecular formula. The factor is M(molecular formula)/M(empirical formula) = 136.1 g/mol/276.2 g/mol = 0.4935. The molecular formula of the compound is obtained by multiplying the empirical formula by this factor, resulting in the molecular formula \(K_2HPO_4\).

For more questions on empirical formula

https://brainly.com/question/13058832

#SPJ8

The correct question would be as

The composition of a compound is 28.73% K. 1.48% H, 22.76% P, and 47.03% O. The molar mass of the compound is 136.1 g/mol. What is the Molecular Formula of the compound?

\(KH_2PO_4\\KH_3PO_4\\K_2H_4P_20_{12}\\K_2H_3PO_6\)

Which atom would be expected to have a half-filled
3d subshell?

Answers

Answer:

Manganese: Mn

Explanation:

The elestron configuration would show this is 25 electrons

Atomic number : 25

this electron configuration ends in \(3d^{5}\)

half of the d subshell which is 10

Please Help!

Your car has 1.95 gallons of gasoline (octane, d = 0.6916 g/mL), which reacts with oxygen
according to the balanced reaction below. Your car uses the energy produced by this reaction
at a rate of 115 kJ per second while traveling at a speed of 65 miles per hour. Calculate the
distance (in miles) the car can travel using this amount of octane.
2 C8H18(g) + 25 O2(g) -----> 16 CO2(g) + 18 H2O(g) ΔHrxn = -10,900 kJ

Answers

Answer:

38.3 miles

Explanation:

First, we convert 1.95 gallons to mililiters:

1.95 gallons * \(\frac{3.785 L}{1gallon}*\frac{1000mL}{1 L}\)= 7380.75 mL

Then we calculate how many grams of octane are available for the reaction, using its density:

0.6916 g/mL * 7380.75 mL = 5104.53 g C₈H₁₈

Now we convert octane grams into octane moles, using its molar mass:

5104.53 g C₈H₁₈ ÷ 114 g/mol = 44.78 mol C₈H₁₈

Then we calculate how many kJ are produced from the combustion of  44.78 mol C₈H₁₈, if 2 moles produce 10900 kJ:

44.78 mol * 10900 kJ / 2 mol = 244032 kJ

We calculate how many seconds is the car available to keep going, if it spends 115 kJ per second:

244032 kJ * 1 s / 115 kJ = 2122.02 s

We convert seconds to hours:

2122.02 / 3600 = 0.59 hours

Finally we calculate the distance:

65 mi/hour * 0.59 hour = 38.3 mi

At 25 oC , the following liquids have density:

water - 0.9982 g/mL; toluene - 0.8669 g/mL; chloroform - 1.4832 g/mL

What mass would a 10.00-mL sample of each of the liquids?

Answers

Answer:

Water- 9.982 grams

toluene-8.669 grams

chloroform - 14.832 grams

Explanation:

the units of density are listed as g/mL. So for every mL of substance you have, you will have that many grams.

Water- .9982g/mL * 10 mL

As you can see, the units of "mL" cancel each other out, leaving just the gram amount of water.

What is the median reaction of second end point in HCL and NaOH titration

Answers

The median reaction at the second end point in the HCl and NaOH titration is: HCl + NaOH → NaCl + H2O

In a titration between hydrochloric acid (HCl) and sodium hydroxide (NaOH), the reaction involved is the neutralization reaction between an acid and a base. The balanced equation for this reaction is:

HCl + NaOH → NaCl + H2O

In this reaction, one mole of HCl reacts with one mole of NaOH to form one mole of NaCl (sodium chloride) and one mole of water.

During the titration process, the reaction occurs gradually as the base is added to the acid solution.

The first end point of the titration is reached when the moles of HCl and NaOH are stoichiometrically equivalent, meaning they react in a 1:1 ratio. At this point, all the HCl has been neutralized by the NaOH, and no excess of either reagent remains.

However, if the titration is continued beyond the first end point, the reaction between HCl and NaOH can still occur, albeit in a different ratio.

The second end point refers to the point where the moles of NaOH added exceed the stoichiometrically required amount to neutralize the HCl completely. As a result, any excess NaOH added after the second end point reacts with the excess HCl in a 1:1 ratio.

Therefore, the median reaction at the second end point in the HCl and NaOH titration is:

HCl + NaOH → NaCl + H2O

For more such question on  median reaction visit:

https://brainly.com/question/14189499

#SPJ8

Chemistry Lab Determination of the Universal Gas Constant (R)
SHOW ALL WORK

Given:

Initial mass of butane lighter: 54.24g

Final Mass of Butane Lighter: 54.01g

Temperature of water: 23.0°C

Volume of gas collected: 100.0mL

FIND:
Barometric pressure of room: 766.86 mmHg CONVERTED TO atm

Vapor pressure of water at room temperature(PH2O) (IN atm)

FIND:

Mass difference if butane lighter in grams

Moles of Butane gas collected in moles of C4H10

Partial pressure if butane gas in atm

Converted temperature of water in Kelvin

Converted volume of gas collected in Liters

Experimental value of R in Latm/molk

Accepted value of R in Latm/molk

Percent error in experimental value of R in %

CONCLUSION QUESTIONS:

1. List at least 3 factors that either did it could contribute to the percent error

2. Should the value of R go up or down if the gas had not been corrected for the partial pressure of water. Why?

3. How could this experiment be repeated to increase the accuracy, or in other words, decrease the percent error?


NOTE: LET ME KNOW IF YOU WANT A PICTURE OF THE LAB INSTRUCTIONS TO HELP SOLVE

ALSO SHOW ALL WORK PLS

Answers

To solve this problem, I'll need some additional information related to the molar mass of butane (C4H10). Please provide the molar mass of butane so that I can proceed with the calculations.

Other Questions
Calcula la diagonal de los siguientes cuadrados, cuyos lados tienen las siguientes medidas en centimetros (dibuja los cuadrados): El lado mide 4 cm What do the dots around this letter represent ? Can you think of any land-based conflicts today, in which one group wants to preserve land while another wants to develop the land for profit? Can someone please name a few causes of the fall of the roman empire in your own words? In a laboratory experiment, a researcher generates antibodies that bind to purified estrogen receptors extracted from cells. The researcher uses the antibodies in an attempt to treat estrogen-dependent cancers but finds that the treatment is ineffective. Explain the ineffectiveness of the antibodies for treating estrogen-dependent cancers. (2 p A drug that stimulates reproduction is introduced into a colony of bacteria. After t minutes, the number of bacteria is given approximately by the following equation. Use the equation to answer parts (A) through (D) N(t)= 1000+48t2-t3 0StS32 (A) When is the rate of growth, N'(t), increasing? Select the correct choice below and, if necessary, fill in the answer box to complete your choice A The rate of growth is increasing on (0,16) OB. The rate of growth is never increasing When is the rate of growth decreasing? Select the correct choice below and, if necessary, fill in the answer box to complete your choice (Type your answer in interval notation. Use a comma to separate answer as needed.) A The rate of growth is decreasing on (16,32) OB. The rate of growth is never decreasing (B) Find the inflection points for the graph of N. Select the correct choice below and, if necessary, fill in the answer box to complete your choice (Type your answer in interval notation. Use a comma to separate answer as needed.) The inflection point(s) is/are at t There are no inflection points A S 15 are at t 16 OB. (C) Sketch the graphs of N and N' on the same coordinate system. Choose the correct graph below 18 18 18 32 32 32 32 (D) What is the maximum rate of growth? The maximum rate of growth at minutes is bacteria per minute Choose the response that correctly determines if the statement is true or false with an argument that can be used to defend your solution. 2. What is the VOLUME of the rectangular prism? Consider the rectangle on the top/bottom as the base.I need Area of Baseheight andVolume Co. purchased Murgatroyd equipment on January 1, 2019, for $950,000, estimating a five-year useful life and $80,000 residual value. In 2019 and 2020, Murgatroyd depreciated the asset using the double-declining-balance method. In 2021, Murgatroyd changed to straight-line depreciation for this equipment. What depreciation would Murgatroyd record for the year 2021 on this equipment? (Do not round your depreciation rate.) a. $ 87,333. b. $104,000. c. $97,333. d. $160,000. Maggie is 14 years old and has not yet matured physically. According to recent research, which of the following will be most likely to occur by the time Maggie reaches tenth grade?o She will be more likely to have an eating disorder than early maturing girls. O She will be more satisfied with her figure than early maturing girls. O She will be less satisfied with her figure than early-maturing girls O She will be more likely to drop out of school than early-maturing girls the speed (or rate) josiah travels to work is inversely proportion to time it takes to get there. if he travels 35 miles per hour it will take him 2.5 hours to get to work. Determine whether the following statement is true or false Ifr=5 centimeters and 0-16, then s=5-16-80 centimeters Choose the correct answer belowA. The statement is false because r is not measured in radians.B. The statement is true.C. The statement is false because s does not equal r.0.D. The statement is false because 0 is not measured in radians F3 40 F4 Where did the Anasazi live? which benefits does efficient supply chain management provide retailers concerning product availability? Describe the limitations of the free body diagrams. Examine the view that the Resource Based View of the firm gives only an inadequate explanation of the performance of modern firms given the importance of firms dependence on other firms in Global Value Chains.750 wordsIf you can help either with written or bullet points with things to include etc. Explain why the demand curve is typically downward sloping and the supply curve is typically upward sloping. What other shapes can the demand and supply curves take? Explain your answer. Usin does anyone have an answer key to this paper? please don't put anything if it is not this exact paper. Name the property illustrated.4 + 3 + 9 = 3 + 4 + 9Yall please answer ASAP What is a superconductor?A. A conductor that operates at room temperatureB. A conductor that allows electricity to flow easilyC. A conductor that conducts electricity faster than common metalsD. A conductor that allows electricity to flow through nonmetal solids