when put out a fire that threatens to be ahazard to which part of flame should be aim the extinguisher​

Answers

Answer 1

The fire extinguisher should be aimed at the base of the flame.

A fire extinguisher is an active safety tool that is frequently used in emergencies to put out or control minor flames.

The most crucial thing to remember while utilizing a fire extinguisher is to keep your distance and aim towards the fire's base.

The majority of untrained individuals are prone to point fire extinguishers at the flames, however doing so causes the extinguishing ingredient to flow into the flames, rendering the entire procedure ineffectual. It's crucial that the extinguishing agent reaches the fire's foundation.

A fire extinguisher typically consists of a hand-held cylindrical pressure vessel that may be discharged with a chemical to put out a fire.

There are five basic types of fire extinguishers: wet chemical, dry powder, carbon dioxide, foam, and water.

Learn more about Fire extinguisher here:

https://brainly.com/question/14598122

#SPJ9


Related Questions

Please help!
Best answer with explanation will be marked brainliest.

Please help!Best answer with explanation will be marked brainliest.

Answers

Explanation:

I think it is d because it is a gas

Which of the following would be the best caption for this image?

A
The Coriolis effect causes convection cells of air to circulate through the atmosphere.
B
The pattern of ocean currents is identical to the pattern of wind currents.
C
Uneven heating of land and water causes winds to blow in different directions during the daytime and night time.
D
There are six bands of global wind currents. These bands of wind currents are caused by convection cells created by the warming and cooling of air.

Which of the following would be the best caption for this image?A The Coriolis effect causes convection

Answers

I think it’s A it’s showing the par-ten to those certain things how it works

Hot magma may:
A.melt itself between layers of rock.
B.dissolve itself between layers of rock.
C.squeeze itself between layers of rock.
D.form itself between layers of rock.

Answers

Answer:

C.squeeze itself between layers of rock.

Explanation:

Edge 2021-because

Magma usually stays below the Earth's crust under great pressure. Sometimes, this very hot material can slowly flow into cracks of the crust.

C!

Explanation: skrunkly

design an experiment in which you will test the effect of an acidic fluid on enzymatic activity.

Answers

To test the effect of an acidic fluid on enzymatic activity, we could design an experiment using the enzyme lactase and its ability to break down lactose.

First, we would prepare a solution of lactase and lactose in a test tube. We would also prepare two solutions of different pH levels, one acidic and one neutral.

Next, we would add a small amount of the acidic solution to one test tube and the neutral solution to another test tube. A control test tube with just lactase and lactose in a neutral solution would also be prepared.

We would then monitor the reaction of lactase on lactose in each test tube by measuring the amount of glucose produced over time using a glucose meter.

If the acidic solution inhibits the enzymatic activity of lactase, we would expect to see a lower amount of glucose produced compared to the neutral and control test tubes.

By comparing the results of the different test tubes, we can determine the effect of an acidic fluid on enzymatic activity.

To know more about enzymatic activity refer here:

https://brainly.com/question/30244328#

#SPJ11

How much heat energy is required to heat a 100 g sample of liquid water from 30 °C to water vapor at 110 °C?The specific heat of liquid water is 4.184 J/(g K) and water vapor is 2.008 J/(g K). The heat of vaporization for water is 2259 J/g and the heat of fusion is 334.72 J/g

Answers

Answer:\(Q_T=257.776kJ\)

Explanation:

The total heat energy required is expressed according to the formula:

\(\begin{gathered} Q_T=Q_{\text{vap,w}}+Q_w \\ \end{gathered}\)

where:

Qvap is the heat energy absorbed by the vapor

Qw is the heat energy absorbed by the water

Get the heat energy absorbed by the vapor at 100 degrees

\(\begin{gathered} Q_{\text{vap,w}}=n_w\times\triangle H_{vap,w} \\ Q_{\text{vap,w}}=\frac{mass}{molar\text{ mass}}\times\triangle H_{vap,w} \\ \end{gathered}\)

Given the following parameters;

Mass of water = 100g

Molar mass of water (H2O) = 18.015g/mol

Hvap,w = 2259 J/g = 40.8 kJ/mol

Substitute the given parameters into the formula to have:

\(\begin{gathered} Q_{\text{vap,w}}=\frac{100\cancel{g}}{18.015\cancel{g}\cancel{\text{mol}^{-1}}^{}}\times\frac{40.8kJ}{\cancel{\text{mol}}} \\ Q_{\text{vap,w}}=226.48kJ \end{gathered}\)

Get the heat absorbed by the water from 30 to 100 degrees and from 100 to 110 degrees using the formula below. Note that the water vapor is being heated without any phase changes, so we will be utilizing the specific heat capacity of water vapor.

\(\begin{gathered} Q_w=m_wc_w(\triangle\theta)_w+m_wc_w\triangle\theta \\ Q_w=(100\times4.184\times(100-30))+(100g\times2.008\frac{J}{g^oC}\times(110-100)^oC) \\ Q_w=(100\times4.184\times70)+(100\times2.008\times10) \\ Q_w=29,288+2008 \\ Q_w=31296\text{Joules} \\ Q_w=31.296kJ \\ \end{gathered}\)

Get the total heat energy required;

\(\begin{gathered} Q_T=226.48kJ+31.296kJ \\ Q_T=257.776kJ \end{gathered}\)

What is the Law of Conservation of mass?

Answers

Answer:  Mass is neither created nor destroyed

Explanation: Mass or matter cannot be created or destroyed even by chemical or physical changes/transformations

Who goes to K12 and if so what grade

Answers

Answer:

Hey! I`m In K12. Currently in 7th, going into 8th next year. I have Mrs. Keefe and one of my teachers, what about y`all?

a 0.650 g multivitamin tablet contains 60. mg vitamin C. What is the % Vitamin C in the tablet?

Answers

9.23% of the mass of the multivitamin tablet is vitamin C.

What is Vitamin C?

Ascorbic acid, another name for vitamin C, is a water-soluble vitamin that is necessary for the creation, maintenance, and repair of several bodily tissues.

How do you determine it?

We can use the following formula to determine the amount of vitamin C in the multivitamin tablet:

(Mass of vitamin C / total mass of tablet) x 100% yields the percentage of vitamin C.

Since the mass of the pill is specified in grams, we must first convert the amount of vitamin C from milligrams to grams:

Vitamin C has a mass of 60 mg, or 0.060 g.

The values can then be entered into the formula as follows:

(0.060 g / 0.650 g) x 100% = % vitamin C Vitamin C equals 9.23%

As a result, 9.23% of the mass of the multivitamin tablet is vitamin C.

To know more about vitamin C, visit:

https://brainly.com/question/13653843

#SPJ1

What is the name of this structural formula?

What is the name of this structural formula?

Answers

Answer:

2-methylbutane

Explanation:

First, you want to identify the largest number of sequential carbons. In this case, the parent chain is made up of 4 carbons. This makes the base name, butane.

Next, you want to identify any branches. There is a branch made up of 1 carbon, and these are referred to as a methyl group. The lowest possible carbon on the parent chain this branch is attached to is the second carbon.

When you put these factors together, you are left with the name: 2-methylbutane.

Explain why is ortho nitrophenol more acidic than ortho methoxyphenol​

Answers

Answer:

Ortho nitrophenol is more acidic than ortho-methoxyphenol.

Reason:

This is because the nitro-group is an electron-withdrawing group. In the case of ortho methoxyphenol; methoxy group is an electron-releasing group. Thus, it increases the electron density in the O−H bond and hence, the proton cannot be given out easily.

Hope this helps you. Do mark me as brainliest.

What is the empirical formula of a compound containing 5.03 grams carbon, 0.42 grams hydrogen, and 44.5 grams chlorine?
a. c2h5ci

b. c2h2c1

c. chcia

d. chci

Answers

The empirical formula of the compound is CHCl₃.

Calculation:

Given,

Mass of carbon = 5.03 g

Mass of hydrogen = 0.42 g

Mass of chlorine = 44.5 g

Molecular weight of carbon = 12 g

Molecular weight of hydrogen = 1 g

Molecular weight of chlorine = 35.4 g

First, calculate the moles of each element,

                      Moles = given mass/ molecular weight

Moles of carbon = 5.03/12 = 0.42

Moles of hydrogen = 0.42/1 = 0.42

Moles of chlorine = 44.5/ 35.4 = 1.26

Divide the moles of each element by the smallest number of moles,

0.42 mol of C/ 0.42 = 1 C

0.42 mol of H/ 0.42 = 1 H

1.26 mol of Cl/0.42 = 3 Cl

The ratio of elements is 1:1:3

Therefore the empirical formula of the compound will be CHCl₃.

Learn more about empirical formula here:

https://brainly.com/question/20708102

#SPJ4

Answer:CHCl₃

Explanation:

when should you start a new chemical waste container in the lab?

Answers

A new chemical waste in the lab must be started when the contents of the current container are a couple of inches below the brim of the container.

In a lab, waste chemicals are produced abundantly and are stored in a chemical waste container to avoid undesired events such as contamination, explosion, or eruption of fire.

A standard lab follows the proper guidelines and establishes strict rules and takes all the necessary measures to make sure safety of all the workers and materials.

However, the chemical waste container must be replaced with a new container when the level of chemical waste is a couple of inches below the brim.

This is because the chemical reaction keeps taking place inside the container over time which can expand the volume of the waste materials. Therefore, some space should be left in the container to avoid an overflow of hazardous material and explosions.

If you want to learn more about chemical wastes click here:

https://brainly.com/question/20786690

#SPJ4

The weak acid HY is much stronger than weak acid HX. Which one of the following statements is true?A) Y is a stronger base than X-. B) Y is a weaker base than X-. C)Y- and X- will be bases of approximately the same strength

Answers

B) Y is a weaker base than X

Why is the energy supplied by the cooker greater than that calculated ?

Answers

Answer:

Explanation:

Q1.

(a) 46 200

accept 46 000

allow 1 mark for correct substitution

ie 0.5 × 4200 × 22 provided no subsequent step

2

(b) Energy is used to heat the kettle.

[3]

Q2.

(a) (approximate same size particles as each other and as liquid and gas) touching

do not accept particles that overlap

regular arrangement (filling the square)

(b) condensing

(c) solid

(d) physical

(e) particles have more kinetic energy

particles move faster

(f) mass of the liquid

specific latent heat of evaporation

(g) 2 × 4 200 × 801

672 000 (J)

an answer of 672 000 (J) scores 2 marks

[11]

Q3.

(a) x-axis labelled and suitable scale

Page 12 of 13

points plotted correctly

allow 5 correctly plotted for 2 marks, 3−4

correctly plotted for 1 mark

allow ± ½ square

2

line of best fit

(b)

allow ecf from line of best fit in part (a)

0.075 (°C/s)

an answer of 0.075 (°C/s) scores 2 marks

(c) Δθ = 11.5 (°C)

a calculation using an incorrect temperature

scores max 3 marks

ΔE = 1.50 × 900 × 11.5

ΔE = 15 525 (J)

ΔE = 15.525 (kJ)

an answer of 15.525 (kJ) or 15.53 (kJ) or 15.5

(kJ) scores 4 marks

an answer of 15 525 (kJ) scores 3 marks

[10]

Q4.

(a) 80 °C

ΔE = 0.5 × 3400 × 80

ΔE = 136 000 (J)

an answer of 136 000 (J) scores 3 marks

(b) energy is dissipated into the surroundings

allow any correct description of wasted energy

(c) put a lid on the pan

allow any sensible practical suggestion

eg add salt to the water

Page 13 of 13

(d) efficiency = 300/500

efficiency = 0.6

an answer of 0.6 or 60% scores 2 marks

allow efficiency = 60%

an answer of 0.6 with a unit scores 1 mark

an answer of 60 without a unit scores 1 mark

It is desired to prepare 600 mL of 0.100 noal NaOH for use in the reaction: HBr+NaOH⟶NaBr+H 2

O How many grams of NaOH are needed? 2 2 more group attempts remaining It is desired to prepare 800 mL of 0.300 noal NaOH for use in the reaction: HNO 3

+NaOH⟶NaNO 3

+H 2

O How many grams of NaOH are needed? g 2 more group attempts remaining The noality of an aqueous solution of perchloric acid is deteined by titration with a 4.04×10 −2
N barium hydroxide solution. If 34.3 mL of barium hydroxide are required to neutralize 19.8 mL of the acid, what is the noality of the perchloric acid solution? 2 more group attempts remalning The noality of an aqueous solution of hydrobromic acid is deteined by titration with a 0.310 N sodium hydroxide solution. If 31.0 mL of sodium hydroxide are required to neutralize 25.2 mL of the acid, what is the noality of the hydrobromic acid solution? N 2 mere oroup attempts remaining

Answers

We can see that 2.3994 grams of NaOH are needed to prepare 600 mL of 0.100 M NaOH

How many grams of NaOH are needed?

To determine the mass of NaOH needed, we can use the formula:

Mass = Volume × Concentration × Molar Mass

Given:

Volume (V) = 600 mL = 600 cm³Concentration (C) = 0.100 mol/LMolar Mass of NaOH (M) = 22.99 g/mol + 16.00 g/mol + 1.01 g/mol = 39.99 g/mol

Substituting the values into the formula, we have:

Mass = 600 cm³ × 0.100 mol/L × 39.99 g/mol

To cancel out the units, we can convert mL to L:

Mass = 0.600 L × 0.100 mol/L × 39.99 g/mol

Mass = 2.3994 g

Which means that approximately 2.3994 grams of NaOH are needed to prepare 600 mL of 0.100 M NaOH solution for the given reaction.

Learn more about chemical reactions at:

https://brainly.com/question/11231920

#SPJ4

*
Identify the element found in the f-block.
Cm
K
W
Br
Ag

Answers

Text me I don’t understand your question?

Consider the following general equation for a chemical reaction. A(g) +B(g) → C(g) +D(9) AM° reaction=-10 kJ (a) Describe the two factors that determine whether an effective collision between molecules of A and B results in a reaction. (b) How would a decrease in temperature affect the rate of the reaction shown above? Explain your answer. (c) Write the rate law expression that would result if the reaction proceeded by the mechanism shown below A+B → [AB] (fast) [AB] + 8C+D (slow) (d) Explain why a catalyst increases the rate of a reaction but does not change the value of the equilibrium constant for that reaction.

Answers

(i) The colliding molecules should have energy equal to or greater than activation energy.

(ii) The colliding molecules should have proper orientation.

If the colliding reactant molecules have energy less than activation energy, then the collision will NOT be an effective collision

What is energy?

Scientists find energy as the ability to do work. Modern civilization is possible because humans have learned to change energy from one form to another and then use it to do work.

To know more about energy, click the link given below:

https://brainly.com/question/11399976

#SPJ4

(a) The two factors that determine whether an effective collision between molecules of A and B results in a reaction are the energy of the collision and the orientation of the molecules in the collision.

What is collision?

Collision is an event in which two or more objects or particles come into contact with each other. Collisions occur in everyday life and are a fundamental part of physics. Collisions can be elastic or inelastic, depending on the energy of the objects involved.

(b) A decrease in temperature would decrease the rate of the reaction shown above because it would decrease the average kinetic energy of the molecules.

(c) The rate law expression that would result if the reaction proceeded by the mechanism shown below A+B → [AB] (fast) [AB] + 8C+D (slow) is: Rate = k[A][B].

(d) A catalyst increases the rate of a reaction by lowering the activation energy barrier, making it easier for the molecules to react. However, the catalyst does not change the value of the equilibrium constant for that reaction because it does not affect the thermodynamic properties of the reaction.

To learn more about collision

https://brainly.com/question/29815006

#SPJ4

I understand that scientists can be more or less certain of their claims depending on the evidence they have. yes or no? and why?

Answers

Yes, scientists can be more or less certain of their claims depending on the evidence they have.

This is because scientific claims are based on evidence and are subject to testing and evaluation. Scientists use various methods, such as experiments, observations, and data analysis, to gather evidence and test their claims. The more evidence a scientist has to support a claim, the more certain they can be of its validity.

However, even with strong evidence, scientific claims are always subject to revision or modification as new evidence becomes available. This is because scientific knowledge is constantly evolving and improving as new discoveries are made and old theories are revised or refined.

To learn about  scientific knowledge

brainly.com/question/10601194

A) Calculate the pH of 0.215 M carbonic acid. Ka1 for carbonic acid is 4.3 X 10-7.pH = 3.52B) Now, suppose you add some solid sodium hydrogen carbonate to the carbonic acid solution in part A). What will happen to the pH?

Answers

The pH will increase. Adding sodium hydrogen carbonate will increase the concentration of hydroxide ions, which will react with the carbonic acid to form carbonate and bicarbonate ions.

What is pH ?

pH (potential of Hydrogen) is a measure of the acidity or alkalinity of a solution. It is measured on a logarithmic scale from 0 to 14, with 7 being neutral. A pH below 7 is considered acidic, while a pH above 7 is considered basic or alkaline. The lower the pH, the more acidic the solution is. The higher the pH, the more basic or alkaline the solution is. A pH of 0 is the most acidic and a pH of 14 is the most basic or alkaline. pH is important in many different fields, such as biology, chemistry, and medicine. It is used to measure the acidity of water, soil, and other substances, and is also used to monitor water quality.

To learn more about pH

https://brainly.com/question/172153

#SPJ4

Why is familiarizing and determining the reactants and products of a chemical reaction important?

Answers

Familiarizing and determining the reactant and product of a chemical reaction is important because reactant and product are the two main component of the chemical reaction.

All the chemical reactions involves the reactant and product. chemical reactions are comprised of reactant and product. Reactants are substances that start a chemical reaction. Products are substances that are produced in the reaction. The relationship between reactants and products in a chemical reaction can be represented by a chemical equation that has this general form,

          Reactants → Products

The chemical formula allows us to give the scientific name to the substance. The chemical formula allows us to predict the nature and properties of the substance. The chemical formula allows us to write balanced chemical equations.

To learn more about Chemical reaction please visit:

https://brainly.com/question/11231920

#SPJ4

The normal freezing point of water (H₂O) is 0. 00 °C and its K, value is 1. 86 °C/m. A nonvolatile, nonelectrolyte that dissolves in water is sucrose How many grams of sucrose, C12H22011 (342. 3 g/mo

Answers

The grams of sucrose is 0 g calculated by determining the molality of the solution.


To calculate the grams of sucrose, we first need to find the moles of sucrose. The molality of the solution can be found using the formula:

molality = (Kf value) x (temperature change).

In this case, the temperature change is 0 °C, so the molality is 0.

To find the moles of sucrose, we use the formula:

moles of solute = (molality) x (kg of solvent).

Since water is the solvent and its mass is not given, we can assume it to be 1 kg for simplicity.

Therefore, moles of sucrose = 0 x 1 = 0.

Finally, we can convert moles to grams using the molar mass of sucrose, which is 342.3 g/mol.

Thus, the grams of sucrose is 0 g.

Learn more about molality here:

https://brainly.com/question/32878776

#SPJ11

What is the main benefit of this model?
A. It helps make predictions about the number of sides in a triangle,
B. It helps visualize the features of a triangle.
ООО. I will mark brainliest
C. It shows the shape and parts of a triangle.
D. It shows a pattern for determining the side lengths of a triangle,

Answers

Answer:

letter D.

Explanation:

it shows a pattern for determining the side of lengths of a triangle yeah the triangle had a model and a length

A sample of butane gas, C4H10, was collected over water at 28.0 °C and 754.4 torr. The wet gas volume is 1.00 L. What will be the volume of dry butane at 824.1 torr and 55.9 °C?

Answers

At 824.1 torr + 55.9°C, dry butane has a of 0.937 L. The basic formula for size is length, breadth, and height, as volume opposed to length, width, and height for the surface of a rectangular shape.

What volume do you refer to?

Any three-dimensional solid's volume is the area it takes up. The shapes of these solids include cubes, cuboids, cones, cylinders, and spheres. Forms come in a wide range of volumes.

There are three methods for measuring volume.

Volumes will be calculated using three different techniques: geometrically (measured lengths); water displace; and pycnometry, to demonstrate the effects of precision on data.

To know more about volume visit:

https://brainly.com/question/29884686

#SPJ1

A 21.496 grams sample of magnesium is burned in air to form magnesium oxide and magnesium nitride. When the products are treated with water,2.813 grams of gaseous ammonia are generated. Calculate the amounts of magnesium nitride and magnesium oxide formed?

Answers

25.898 g is the amount of magnesium nitride and magnesium oxide formed.

Step1 2Mg(s)+ O2(g)-----> 2 MgO(s)

3Mg(s)+N2(g)------> Mg3N2(s)

Mg3N2(s)+ 6 H2O(l)---> 3Mg(OH)2 + 2 NH3(g)

Step2 Moles of NH3 = (2.813/17)

Moles of Mg3N2= (1/2) Moles of NH3 = (2.813/2x17)= 2.813/34

Mass of Mg3N2 = (2.813/34) x100 =8.274g (Molar mass of Mg3N2=100)

Step3 Mass of Mg in Mg3N2 =(72/100) x8.274 =5.957g

Mass of Mg converted in MgO= 21.496-5.957=15.539

Moles of MgO= Moles of Mg = 15.539/24

Mass of MgO = 15.539x40/24 =25.898 g.

Magnesium is a cofactor for over 300 enzymatic systems that regulate various biochemical reactions in the body, including protein synthesis, muscle and nerve function, glycemic control, and blood pressure regulation [1-3].

Learn more about magnesium at

https://brainly.com/question/5759562

#SPJ1

What are the units for measuring the mass of a regular object?

Answers

Answer:

Mass is used to measure the weight of an object. For example, you are measuring the mass of your body when you step on to a scale. In the metric system of measurement, the most common units of mass are the gram and kilogram.

Explanation:

List 3 elements that have 1 valence electron

Answers

Answer:

sodium

Explanation:

Sodium (Na), Magnesium (Mg) and Potassium (K) are three elements that have 1 valence electron.

Which elements have 1 valence electron?

Elements with 1 valence electron such as Sodium (Na), Magnesium (Mg), and Potassium (K) belong to the alkali metal and alkaline earth metal groups of the periodic table.

Valence electrons are the electrons present in the outermost shell of an atom and are responsible for the element's chemical behavior. These elements readily donate their single valence electron to form positive ions with a charge of +1 enabling them to engage in various chemical reactions and bond with other elements.

Read more about valence electron

brainly.com/question/371590

#SPJ6

At STP, the volume of a gas is 325mL. What volume will it occupy at 20.0 degrees Celsius and 93.3kPa.

Answers

The volume of the gas at 20.0 degrees Celsius and 93.3kPa is 0.269nJ/kPa.

What is volume?

Volume is a measure of the three-dimensional space occupied by an object. It is a measure of the amount of matter contained within an object, typically measured in liters, gallons, or cubic centimeters. Volume is an important factor in everyday life, as it is used to measure the quantity of liquids, solids, and gasses.

To solve for V, the volume of the gas, you can rearrange the equation to V = nRT/P.
Then, you can enter in the given values for the pressure (93.3kPa), the temperature (20.0 degrees Celsius),
the number of moles (which is unknown), and the ideal gas constant (R = 8.314 J/molK).
The answer you get is the volume of the gas at 20.0 degrees Celsius and 93.3kPa.

V = nRT/P

V = (n)(8.314J/molK)(293.15K)/(93.3kPa)

V = (n)(25.05J/mol)/(93.3kPa)

V = 0.269nJ/kPa

Therefore, the volume of the gas at 20.0 degrees Celsius and 93.3kPa is 0.269nJ/kPa.

To learn more about volume
https://brainly.com/question/29796637
#SPJ1

Kayla learned that when you play with the Soccket for 30 minutes it gives you 3 hours of light. She thinks that rolling the ball slowly with her baby brother for 30 minutes will give her the same amount of energy as kicking it in a game of soccer for 30 minutes. Do you agree or disagree? State your claim and use evidence from what you've learned about speed and energy to explain your answer.

Answers

Answer:

disagree it wont be the same momentum

Explanation:

cuh

What is the effect of applying an unbalanced force on an object?

Answers

Answer:

Unbalanced forces affect motion of objects by causing them to accelerate, decelerate or change direction.

What is the product of the reaction of 1-propanol with phenyl isocyanate, C6H5N=C=O?

Answers

The balanced equation for this reaction is:

CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O

The reaction of 1-propanol (CH3CH2CH2OH) with phenyl isocyanate (C6H5N=C=O) leads to the formation of a urethane compound. The reaction's balanced equation is as follows:

CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O

In this process, the condensation reaction between the isocyanate group (-N=C=O) of phenyl isocyanate and the hydroxyl group (-OH) of 1-propanol results in the creation of a urethane molecule. A propanol group is connected to a phenyl group through an oxygen atom to produce CH3CH2CH2OC(=O)N(C6H5)CH3, the reaction's end product. The reaction also results in the production of water (H2O).

Learn more about the condensation reaction:

brainly.com/question/6256866

#SPJ11

Other Questions
create a claim about lysander and Hermia situation that focuses on Lysander's perspective on love Purpose of steps in crystallisation of organic solid According to the evolutionary perspective, why do men and women tend to be attracted to others who are physically fit? The length of a beige is 500 miles if 1 inch represent 25 miles what is the length of the bridge ? Identify the property that justifies the statement: 5(x-3)=5x-15 how should a blood-soaked piece of gauze be disposed of? During a laboratory experiment the average number of radioactive particles passing through a counter in one millisecond is 6. What is the probability that more than 4 particles enter the counter in a Acceleration = 10m/s^2, Force = 125N, find the mass. I NEED HELP THIS IS MISSING I GIVE BRAINLIEST only if you are right tho The table shows a proportional relationship between x and y. Katerina has to complete the table. Katerina incorrectly says the ratio 1 x is 10. Complete the table. What error did Katerina likely make? X 3 5 7 y Ratio 30 ? 50 ? 70 ? What happened when Europe colonized Africa? please solve this question. to buy a home with total monthly payments of 1420 and using a bakc end ratio fo 37 percentg a person with a 360 loan would need a monthly gross income of 4532 For the following right triangle, find the side length x.X912 Which of the following expressions are polynomials? Justify your answer:(i) 8(ii) 3x^2 2x(iii) 1 5x (iv) 1/5x^2 +5x+7(v) (x2)(x4)/x(vi) 1/x+1 (vii) 1/7 a^3 1/3 a^2 +4a7(viii) 1/2x the next model of a sports car will cost 6.8% less than the current model. the current model costs $42,000. how much will the price decrease in dollars? what will be the price of the next model? Please help!! 25 points!4.Two bikers meet at a park. Biker A needs to stop at the store that is 12 miles east of the park. Biker B heads southeast at a 61 angle at the same time for 24 miles. Once biker A leaves the store he heads southwest at an angle of 89 for 21 miles. Do NOT use the law of cosines, use your knowledge from the content of this course.a. Use your knowledge of triangles to figure out if the two bikers will be able to meet up if each biker travels the distance given.b. If they do not meet up, how much farther would one of the bikers have to travel to meet the other?c. What is the measure of the angle between the bikers?d. What is the relationship between the measure of the angles and the paths the bikers took?e. Classify the triangle the paths created.f. How many miles did they travel together? the nurse is speaking with the parents of a child recently diagnosed with hypothyroidism. which statement by a parent indicates an understanding of symptoms of this disorder? I just need the names or formula to these symbols, please help quick graph the equation Y= -x +3 using the intercepts. note the points cannot be moved off the axis