Which of the following reagents would oxidize Zn to Zn²⁺, but not Pb to Pb²⁺?
Ca²⁺
Co
Br₂
Br⁻
Ca
Co²⁺

Answers

Answer 1

The reagent that would oxidize Zn to Zn²⁺ but not Pb to Pb²⁺ is CoBr₂.

To determine the reagent that selectively oxidizes Zn to Zn²⁺ without oxidizing Pb to Pb²⁺, we need to consider the reduction potentials of the species involved.

The reagent with a higher reduction potential will oxidize the species with a lower reduction potential.

In this case, Zn has a lower reduction potential than Pb, which means it is easier to oxidize Zn to Zn²⁺ compared to Pb to Pb²⁺. Among the given options, CoBr₂ is the only reagent that can selectively oxidize Zn to Zn²⁺ without oxidizing Pb.

Therefore, the correct answer is CoBr₂. It has a higher oxidizing power and can oxidize Zn to Zn²⁺ while leaving Pb unaffected.

Learn more about reagent here: brainly.com/question/28463799

#SPJ11


Related Questions

The microscope has the power to show details of
an object more clearly. This is known as

Answers

Answer:

Explanation:

in order for the user to clearly view an image, the microscope must carry out two processes. ... the ability of the microscope to increase the size of the image of an object is called______. magnification. the microscope has the power to show details of an object more clearly.

The power of a microscope to show details of an object more clearly is: resolution.

A microscope can be defined as an optical device which is typically designed and developed to make an enlarged (magnified) image of a minute (very small) object, in order to show all the littlest or tiniest details (information) about the object that cannot be seen by the natural human eye.

Generally, the different types of microscopes include:

Inverted microscope.Compound light microscope.Scanning electron microscope.Polarizing microscope.

In Science, the resolution of a microscope is a measure of its power to clearly show the details of an object.

Read more: https://brainly.com/question/20376243

Five waves measure 25 cm and pass a point in 1 s. What is:
the wavelength
the frequency
the period?

Answers

Five waves measure 25 cm and pass a point in 1 s then the wavelength is 5cm the frequency is 5Hz and the period is 5 s

Wavelength is the distance between identical point in the adjacent cycle of a waveform signal propagated in space or along a wireFrequency is the number of waves that pass a fixed point in unit timeThis means the period of a wave is the inverse of the frequency so the formula for wave period is wavelength divided by velocity

Here given data is

Five waves measure 25 cm and pass a point in 1 s

So, the wavelength = λ = v/f

Wavelength =  25 cm/5 waves

Wavelength = 5cm

Frequency = 1/T

Frequency = 1/5 = 5Hz

Period = 1/frequency

Period = 1/5 = 5 s

Know more about waves

https://brainly.com/question/20691126

#SPJ9

The gas in the piston is being heated, and the piston has moved upward. The observation will be summarized in a row of the incomplete table below.
A container with a piston inside it. An arrow above the piston points upward.

Row
Name
Observation
Variables
1
Boyle's law
Volume increases when
pressure decreases
?
2
Charles’s law
?
?
3
Gay-Lussac’s law
?
Temperature, pressure
4
Combined gas law
?
?

What are the variables for this piston?
temperature only
temperature and volume
pressure and number of molecules
volume and number of molecules

Answers

The variables for this piston are temperature and volume.

In Boyle's law, the observation is that the volume increases when the pressure decreases. This law describes the relationship between pressure and volume of a gas at constant temperature. Since the piston has moved upward, it indicates an increase in volume, suggesting that the pressure inside the container has decreased.

In Charles's law, the observation and variables are not provided in the table. However, Charles's law describes the relationship between the volume and temperature of a gas at constant pressure. When the gas is heated, the temperature increases, and if the pressure remains constant, the volume of the gas will also increase.

In Gay-Lussac's law, the variables are temperature and pressure. This law describes the relationship between the temperature and pressure of a gas at constant volume. If the gas in the piston is being heated, it suggests an increase in temperature, and this could potentially lead to an increase in pressure as well.

In the Combined Gas Law, the variables are not provided in the table. This law combines Boyle's, Charles's, and Gay-Lussac's laws into a single equation, relating the pressure, volume, and temperature of a gas. It allows us to determine how changes in these variables affect each other when all other variables are held constant. However, without specific observations or values, it is not possible to determine the specific relationship in this case.

for such more questions on temperature

https://brainly.com/question/4735135

#SPJ8

compare the temperature reading during the fine,fair,and rainy weather condition.

Answers

Temperature reading during fine, fair, and rainy weather conditions vary significantly. In general, the temperature changes due to variations in atmospheric pressure, wind, and humidity.

In this context, it is crucial to discuss the fine, fair, and rainy weather conditions' temperature readings one by one. Fine weather conditions are characterized by clear skies, no wind, and a stable atmosphere. During fine weather conditions, the temperature reading tends to remain consistent throughout the day. As a result, the temperature reading is usually moderate and pleasant. During the daytime, the temperature reading ranges between 20 to 30°Celsius, while the temperature reading drops to about 10 to 20° Celsius at night.On the other hand, during fair weather conditions, the temperature reading is moderate, but it varies depending on the location, time, and season. During the daytime, the temperature reading ranges between 10 to 30°Celsius, while the temperature reading drops to about 5 to 15° Celsius at night. Fair weather conditions are characterized by clear skies, few clouds, and a stable atmosphere. However, some variations occur due to atmospheric pressure changes, wind, and humidity.
Rainy weather conditions are characterized by rain, cloud cover, and a stable atmosphere. During rainy weather conditions, the temperature reading tends to be lower than during fine and fair weather conditions. Typically, the temperature ranges between 5 to 25°Celsius during the daytime, while the temperature ranges between 0 to 15°Celsius at night. The temperature reading varies during rainy weather conditions depending on the location, time, and season. In summary, the temperature reading during fine, fair, and rainy weather conditions varies due to atmospheric pressure, wind, and humidity.

for such more questions on Temperature

https://brainly.com/question/4735135

#SPJ8

example of nitrogen fertilizer





Answers

Answer:

The most common forms of N fertilizer include anhydrous ammonia, urea, and urea-ammonium nitrate (UAN) solutions.

Explanation:

Egg + Heat

Proof of a Chemical Reaction

Answers

Answer:

Water+Heat

proof of physical reaction

Explanation:

Chemical reactions are reactions that can't be undone ex cooking and egg.

Physical reactions are reactions that can be undone ex boiling water.

Answer:

Egg + Heat = Chemical Change

Explanation:

This is a chemical change because it cannot be undone. Once it changed its form you could not revert it back to its original self.

I hope this helps you! :)))))

Calculate the amount of heat required to completely sublime 50.0 g of solid dry ice (CO2) at its sublimation temperature. The heat of sublimation for carbon dioxide is 32.3 kJ>mol

Answers

The amount of heat required to completely sublime 50.0 g of solid dry ice (CO2) at its sublimation temperature of the heat of sublimation for carbon dioxide is 32.3 kJ/mol,

you need to follow these steps: Step 1: Find the number of moles of CO2.Using the formula: n = m / MM Where n = moles, m = mass and MM = molar mass. The molar mass of CO2 = 12.01 + (2 x 16.00) = 44.01 g/mo ln = 50.0 / 44.01n = 1.14 mol

Step 2: Calculate the heat required to sublime 1.14 mol of CO2.Q = n x ∆H sublimation Q = 1.14 x 32.3 kJ/mol Q = 36.822 kJ

Step 3: Calculate the heat required to sublime 50.0 g of CO2.Since 1.14 mol of CO2 is required to sublime 50.0 g of CO2.Q1 = 36.822 kJ/molQ2 = 36.822 x 1.14kJQ2 = 42.023 kJ

Therefore, the amount of heat required to completely sublime 50.0 g of solid dry ice (CO2) at its sublimation temperature is 42.023 kJ.

To know more about  sublimation refer here:

https://brainly.com/question/29304516#

#SPJ11

What pressure is required to compress 196.0 liters of air at 1.00 atm into a cylinder whose volume is
26.0 liters?

Answers

The pressure will be 7.53bar

According to Boyle's law, He gave the relation between pressure and temperature.

P1V1=P2V2

Where, P is pressure and V is volume.

As,

P1= 196.0L

V1 = 1.00bar

V2= 26.0L

Now,

P2=?

P1V1=P2V2

196*1=26*P2

P2= 196/26

P2=7.53bar

Therefore, pressure is required to compress 196.0 liters of air at 1.00 atm is 7.53bar

To know more about Pressure do visit

https://brainly.com/question/15540009

#SPJ1

Which of the following is not a unit of volume?

(A) L
(B) mL
(C) m^3
(D) cm^2

Answers

Answer:

D

Explanation:

Write a balanced Al(s), Ba(s), Ag(s), and Na(s) for the synthesis reaction of Br2(g).

Answers

The synthesis reaction of Br2(g) with Al(s), Ba(s), Ag(s), and Na(s) are as follows:Br2(g) + 2 Al(s) → 2 AlBr3(s)3 Br2(g) + Ba(s) → BaBr6(s)2 Ag(s) + Br2(g) → 2 AgBr(s)2 Na(s) + Br2(g) → 2 NaBr(s)

Balanced equation for the synthesis reaction of Br2(g) with Al(s), Ba(s), Ag(s), and Na(s)Br2(g) + 2 Al(s) → 2 AlBr3(s) 3 Br2(g) + Ba(s) → BaBr6(s) 2 Ag(s) + Br2(g) → 2 AgBr(s) 2 Na(s) + Br2(g) → 2 NaBr(s)The synthesis reaction of Br2(g) can be carried out using different metals such as Al(s), Ba(s), Ag(s), and Na(s). The balanced chemical equation for the reaction will be based on the type of metal used. However, all of the reactions will produce a metal bromide salt.The first equation represents the reaction of Br2(g) with aluminum. This reaction results in the formation of aluminum tribromide salt. The balanced chemical equation for the reaction is as follows:Br2(g) + 2 Al(s) → 2 AlBr3(s)The second equation represents the reaction of Br2(g) with barium. This reaction results in the formation of barium hexabromide salt. The balanced chemical equation for the reaction is as follows:3 Br2(g) + Ba(s) → BaBr6(s)The third equation represents the reaction of Br2(g) with silver. This reaction results in the formation of silver bromide salt. The balanced chemical equation for the reaction is as follows:2 Ag(s) + Br2(g) → 2 AgBr(s)The fourth equation represents the reaction of Br2(g) with sodium. This reaction results in the formation of sodium bromide salt. The balanced chemical equation for the reaction is as follows:2 Na(s) + Br2(g) → 2 NaBr(s)In conclusion, the balanced chemical equations for

For more such questions on chemical equation

https://brainly.com/question/11904811

#SPJ8

Science Inquiry of Lemon Juice
Scientific Method of Lemon Juice
Integrating Design Thinking in SIP of Lemon Juice
Steps in Conducting SIP of Lemon Juice

Answers

Science Inquiry of Lemon Juice:

Science inquiry of lemon juice refers to the process of using scientific methods to investigate the properties, behavior, and chemical composition of lemon juice.

What is the Science Inquiry?

Scientific Method of Lemon Juice:

The scientific method of lemon juice involves the following steps:

Identify the problem: The first step is to identify the problem to be investigated. For example, one may want to investigate the effect of lemon juice on the pH of water.Formulate a hypothesis: Based on the identified problem, formulate a hypothesis that can be tested through experimentation. For example, the hypothesis could be that adding lemon juice to water will make it more acidic.Design an experiment: Develop an experiment that will test the hypothesis. In the above example, one could add different amounts of lemon juice to different samples of water and measure their pH.Conduct the experiment: Conduct the experiment according to the designed procedure.Collect data: Record the data obtained during the experiment.Analyze the data: Use statistical methods to analyze the data and draw conclusions.

Draw conclusions: Based on the data analysis, draw conclusions about the hypothesis.

Integrating Design Thinking in SIP of Lemon Juice:

Design thinking can be integrated into the Science Inquiry Process (SIP) of lemon juice in the following ways:Empathize: Understand the needs and requirements of the end-users of lemon juice, such as chefs, homemakers, and bartenders.Define: Clearly define the problem that the scientific investigation of lemon juice aims to solve.Ideate: Brainstorm multiple ideas for scientific experiments that can test the hypothesis and lead to a solution to the defined problem.Prototype: Create prototypes of the scientific experiments and test them to see if they work as intended.Test: Conduct scientific experiments to test the hypothesis and evaluate the performance of the prototypes.

The steps in conducting the Science Inquiry Process (SIP) of lemon juice are as follows:

Choose a topic of interest related to lemon juice, such as its chemical composition, properties, or health benefits.Develop a research question that can be investigated scientifically.Formulate a hypothesis that answers the research question.Design an experiment that tests the hypothesis.Conduct the experiment and collect data.Analyze the data and draw conclusions.

Lastly, Communicate the results of the investigation through a scientific report or presentation.

Read more about Science Inquiry here:

https://brainly.com/question/1828853

#SPJ1

What is one Scientific Law or Scientific Theory that affects our life?​

Answers

Answer:

Does the Big Bang theory count?

for a given reaction, kc is the equilibrium constant based on the molar of reactants and products while kp is the equilibrium constant based on the partial of reactants and products. True/False?

Answers

Statement It is accurate to say that kp is the equilibrium constants based here on partial , products and reactants, as kc has been the equilibrium value based just on molar of the products and reactants.

What is an example of equilibrium?

Many instances of equilibrium include: a book that is open and at rest. a vehicle that is going steadily. a chemical process where both the forward and backward rates of reaction are equal.

How do you show equilibrium?

MARKETS: At the price where quantities demanded or supplied are equal, equilibrium is reached. By displaying the total price and quantity with which the curves of supply and demand intersect, we may visualize a market in equilibrium.

To know more about equilibrium visit:

brainly.com/question/15870179

#SPJ1

Below is a chemical reaction in which two solutions are combined:
CdSO4 (aq) + K2S (aq) → CdS(s) + K2SO4 (aq)
a) What does the subscript (s) mean?
b) For cadmium sulfate, write a chemical equation similar to problem 2 showing that cadmium sulfate dissolves in water. Do the same for potassium sulfide. How many ions are present in this solution?
c) Some of these ions react with one another to produce cadmium sulfide. Look up the physical properties of cadmium sulfide. What would you expect to see when you mix cadmium sulfate and potassium sulfide?
d) What is the name for this type of reaction?
e) Potassium sulfate is shown as a soluble product. What ions are still present in solution after the reaction?

Answers

a) Subscript (s) means solid or precipitate.

b) CdSO₄ (aq) → Cd²⁺ (aq) + SO₄²⁻(aq) and K₂S(aq) → 2K⁺ (aq) + S²⁻ (aq). There are 4 types of ions present in the solution Cd²⁺, SO₄²⁻, 2K⁺ and S²⁻.

c) Yellow to orange color precipitate will be seen after this reaction.

d) The reaction is known as double displacement or a precipitation reaction.

e) 2K⁺ and SO₄²⁻ are the ions still present in the solution.

The detailed answer to the questions related to the given equation are as follows:

Given equation: CdSO₄ (aq) + K₂S (aq) → CdS (s) + K₂SO₄ (aq)

a) The subscript (s) means "solid." In this reaction, CdS is a solid product formed by the reaction of aqueous CdSO₄ and K₂S.

b) When cadmium sulfate (CdSO₄) dissolves in water, it dissociates into ions:

CdSO₄ (aq) → Cd²⁺ (aq) + SO₄²⁻ (aq)

Similarly, when potassium sulfide (K₂S) dissolves in water, it dissociates into ions:

K₂S (aq) → 2K⁺ (aq) + S²⁻ (aq)

In this solution, there are four types of ions are present: Cd²⁺, SO₄²⁻, 2K⁺, and S²⁻.

c) Cadmium sulfide (CdS) has a yellow to orange color and is insoluble in water. When you mix cadmium sulfate (CdSO₄) and potassium sulfide (K₂S), you would expect to see a yellow to orange precipitate forming, which is cadmium sulfide (CdS).

d) The name for this type of reaction is a double displacement reaction or a precipitation reaction.

e) After the reaction, the soluble product potassium sulfate (K₂SO₄) is formed, which dissociates into ions in the solution. The ions still present in the solution after the reaction are: 2K⁺ (aq) + SO₄²⁻ (aq).

To learn more about precipitation reaction, visit here:

https://brainly.com/question/29762381

#SPJ11

What is DNA fingerprinting?
FORENSICS

Answers

Answer:

It is a method used to identify a suspect.

Explanation:

DNA fingerprinting is a method used to identify an individual from a sample of DNA by looking at unique patterns in their DNA.

Name 3 types of rock on Planet Earth.

Answers

Answer:

igneous, sedimentary, and metamorphic

Explanation:

Answer:

IGNEOUS ROCKS form when molten rock (magma or lava) cools and solidifies. SEDIMENTARY ROCKS originate when particles settle out of water or air, or by precipitation of minerals from water.

And METAMORPHIC (I dont have nothing for this won)

Explanation:

When 0. 485 g of compound x is burned completely in a bomb calorimeter containing 3000 g of water, a temperature rise of 0. 285°c is observed. What is δu of the reaction for the combustion of compound x? the hardware component of the calorimeter has a heat capacity of 3. 81 kj/°c. The specific heat of water is 4. 184 j/g·°c, and the mw of x is 56. 0 g/mol.

Answers

ΔU of the reaction the combustion of compound x is -538 kJ/mol

Combustion is a reaction in which a substance reacts with oxygen gas and releasing energy in the form of light and heat

Here given data is

Mass of compound x = 0.485gram

Mass of water = 3000gram

Temprature rise =  0. 285°C

Heat capacity of the calorimeter = 3. 81 kJ/°C

Specific heat of water =  4. 184 J/g·°C

MW of x = 56. 0 g/mol

Then calculate q

ΔU = ΔH -PΔV

The bomb calorimeter has a constant volume ΔV = 0

ΔU = ΔH

q reaction = q(water + q(bomb)

q(bomb) = 3810J/°C×0.285 = 1085.85J

q(water) = 3000g × 4. 184 J/g·°C×0.285°C = 3577.32 J

q reaction = q(water) + q(bomb)

q reaction = 4663.17 J = 4.66kJ means this is an exothermic

Then calculate moles of compound

Moles = mass/molar mass

Moles = 0.485 g/56.0g/mol

Moles = 0.00866 moles

Then calculate ΔU

ΔU = 4663.17 J/0.00866 moles = 538472 j/mol = 538.5kJ/mol means the reaction is exothermic

ΔU = -538kJ/mol

Know more about combustion

https://brainly.com/question/14018259

#SPJ1

4H₂O +202 → 4H₂O₂

Balancing chemical equations

Answers

The chemical equation you have provided is not balanced.

To balance it, we need to ensure that the number of atoms of each element is equal on both sides of the equation.

4H₂O + 2O₂ → 4H₂O₂

Now the equation is balanced.

In science, a summary of observed behavior is referred to as a(n)

Answers

Answer:

Law

Explanation:

A law is a summary of observed (measurable) behavior, whereas a theory is an explanation of behavior. A law tells what happens; a theory (model) is our attempt to explain why it happens.

It appears, in the society shown in the film, that one could have a potential romantic partner/love interest sequenced. Discuss the positive and negative aspects of having this technology available to prospective mates.

is based on GATTACA

Answers

The positive effect of this film is it helping prospective mates in having more understanding of compatibility when searching for someone.The negative effect of this type of film is that immature people may stumble on it thereby creating distractions and abuse.

What is Romance?

This involves lavishing someone with attention, gifts, etc as a result of love and affection being experienced between the individuals.

The film which depicts it however has a positive and negative effect which is mentioned above.

Read more about Romance here  https://brainly.com/question/25652231

what is the cause for placing calcium in 2 or IIA group of the Modern periodic table? ​

Answers

Answer:

Since it has 2 valence electrons

Explanation:

what are buffers and why are they important

Answers

Explanation:

A buffer is a solution that can resist pH change upon the addition of an acidic or basic components. It is able to neutralize small amounts of added acid or base,thus maintaining the pH of the solution relatively stable.This is important for processes and/or reactions which require specific and stable pH ranges.

I hope it's helpful!

A sphere of radius 0.457 m, temperature 32.2 ∘
C, and emissivity 0.924 is located in an environment of temperature 82.9 ∘
C. At what rate does the sphere (a) emit and (b) absorb thermal radiation? (c) What is the sphere's net rate of energy exchange? (a) Number (b) Number Units Units

Answers

a) The sphere emits thermal radiation at a rate of 139.75 Watts.

b) The sphere absorbs thermal radiation at a rate of 37.66 Watts.

c) The sphere's net rate of energy exchange is 102.09 Watts.

What are the rates of thermal radiation emission, absorption, and net energy exchange for the sphere?

To calculate the rates of thermal radiation emission and absorption, we can use the Stefan-Boltzmann law, which states that the rate of thermal radiation emitted or absorbed by an object is proportional to its surface area, temperature, and the Stefan-Boltzmann constant.

a) The rate of thermal radiation emitted by the sphere can be calculated using the formula:

Emitting Rate = emissivity * surface area * Stefan-Boltzmann constant * (\(temperature^4 - environment\ temperature^4\))

Plugging in the given values:

Emitting Rate = \(0.924 * (4\pi * (0.457)^2) * 5.67 \times 10^{-8} * ((32.2 + 273.15)^4 - (82.9 + 273.15)^4)\)

Emitting Rate ≈ 139.75 Watts

b) The rate of thermal radiation absorbed by the sphere can be calculated in a similar way but using the environment temperature as the object's temperature:

Absorbing Rate = emissivity * surface area * Stefan-Boltzmann constant * (\(environment\ temperature^4 - temperature^4\))

Plugging in the given values:

Absorbing Rate = \(0.924 * (4\pi * (0.457)^2) * 5.67 \times 10^{-8} * ((82.9 + 273.15)^4 - (32.2 + 273.15)^4)\)

Absorbing Rate ≈ 37.66 Watts

c) The net rate of energy exchange is the difference between the emitting rate and the absorbing rate:

Net Rate = Emitting Rate - Absorbing Rate

Net Rate = 139.75 Watts - 37.66 Watts

Net Rate ≈ 102.09 Watts

Therefore, the sphere emits thermal radiation at a rate of 139.75 Watts, absorbs thermal radiation at a rate of 37.66 Watts, and has a net rate of energy exchange of 102.09 Watts.

Note: The units for all the rates are Watts.

Learn more about thermal radiation emission

brainly.com/question/28517392

#SPJ11

Generally, what is the effect of increased temperature on the rate of dissolution of a solid solute?

Answers

Answer:

Increases

Explanation:

The general effect we see as temperature increases is that rate of dissolution of a solid solute increases,

Therefore, we can say that :

Temperature ∝ Rate of dissolution

Which of the following statements on HPLC modes is true? A. Increasing the polarity of the mobile phase decreases the elution time of polar compounds in normal-phase HPLC B. A non-polar stationary phase is used in normal-phase HPLC C. Compounds have a lower attraction to the mobile phase than to the stationary phase in displacement development D. A polar stationary phase is used in reversed-phase HPLC E. More polar compounds elute first in normal-phase HPLC

Answers

The following statements on HPLC modes are true is more polar compounds elute first in normal-phase HPLC (Option E).

The liquid chromatography (HPLC) is a technique in analytical chemistry employed for the separation, identification, and quantification of elements. It is considered a highly sensitive method, and it works by separating the components in a mixture with the assistance of a solvent under high pressure.

There are two modes of HPLC: Reversed-Phase HPLC (RP-HPLC) and Normal-Phase HPLC (NP-HPLC). In RP-HPLC, a nonpolar stationary phase, such as C18, is used, and polar solvents, such as water, are used as mobile phases. Polar stationary phases, such as silica gel, are used in NP-HPLC, while nonpolar solvents, such as hexane, are used as mobile phases.

More polar compounds have a greater affinity for the polar stationary phase than less polar compounds, which have a higher affinity for the nonpolar mobile phase in NP-HPLC. As a result, less polar compounds elute first in normal-phase HPLC.

Thus, the correct option is E.

Learn more about HPLC: https://brainly.com/question/13490391

#SPJ11

This is for chemistry for specific heat

if the mass of h2o is 102. 3g and the initial temp is 23. 1c and the final temp is 26. 0c what is the final initial temp?

Answers

If the mass of H₂o is 102. 3g and the initial temp is 23. 1c and the final temp is 26. 0c . The final initial temp is 296.67 K or 23.52 °C.

The amount of heat required to raise the temperature of a substance by 1°C is known as specific heat capacity of that substance.

Given that,

The mass of water (H₂O ), m = 102.3 g.

The initial temperature is given by T₁ = 23.1°C = 296.1 K

The finial temperature is T₂= 26°C =299 K

Therefore, change in temperature,ΔT = T₂- T₁= 299k - 296.1k=2.9

The final initial temperature is given as

= mΔT

=102.3 ×2.9

=296.67 K

=23.52 °C

To know more about temperature change here

https://brainly.com/question/25274060

#SPJ4

An excess of Al and 6.0 mom of Br2 are reacted according to the equation How many moles of AlBr3 will be formed assuming 100% yield

Answers

Answer:

The equation for the reaction between Al and Br2 is:

2Al + 3Br2 -> 2AlBr3

If there is an excess of Al and 6.0 mol of Br2, then the limiting reactant will be Br2, and the number of moles of AlBr3 formed will be equal to the number of moles of Br2 consumed, which is 6.0 mol.

Therefore, assuming 100% yield, 6.0 mol of AlBr3 will be formed.

Under which of the following conditions of temperature and pressure would 1.0 mol of the real gas CO2(g) behave most like an ideal gas?
(1) 100 K and 0.1 atm
(2) 100 K and 10 atm
(3) 500 K and 0.1 atm
(4) 500 K and 10 atm
(5) none of above

Answers

Answer:

c. 800 K, 0.1 atm

Explanation:

Good luck in AP Chem

Calculate the pH of a 0.30 M solution of sodium benzoate (NaC6H5COO) given that the Ka of benzoic acid (C6H5COOH) is 6.50 x 10-5.



Please show steps on the solution.

Answers

The pH of a 0.30 M solution of sodium benzoate is approximately 2.73.

The pH of a 0.30 M solution of sodium benzoate can be calculated using the Ka of benzoic acid and the equation for the dissociation of a weak acid.

First, write the equation for the dissociation of benzoic acid:

C6H5COOH + H2O ⇌ C6H5COO- + H3O+

The Ka expression for this reaction is:

Ka = [C6H5COO-][H3O+]/[C6H5COOH]

Since sodium benzoate is the salt of the conjugate base of benzoic acid, it completely dissociates in water to form the benzoate anion (C6H5COO-) and sodium cation (Na+). Therefore, the initial concentration of benzoate anion in the solution is 0.30 M.

Since the dissociation of sodium benzoate is negligible, we can assume that the concentration of benzoic acid is negligible compared to the initial concentration of benzoate anion. Therefore, we can simplify the Ka expression to:

Ka = [C6H5COO-][H3O+]/0.30M

Solving for [H3O+], we get:

[H3O+] = sqrt(Ka x 0.30M/[C6H5COO-])

Plugging in the values, we get:

[H3O+] = sqrt(6.50 x 10^-5 x 0.30M/1) = 1.85 x 10^-3 M

Finally, we can find the pH using the pH equation:

pH = -log[H3O+]

pH = -log(1.85 x 10^-3) = 2.73

Therefore, the pH of a 0.30 M solution of sodium benzoate is approximately 2.73.

For more questions like Benzoic acid click the link below:

https://brainly.com/question/15394817

#SPJ11

Which of the following BEST states the Law of Conservation of Matter? *

10 points

A. The total mass of the reactants in a reaction equals the total mass of the product(s).

B. The total mass of the reactants in a reaction is double the total mass of the product(s).

C. The total mass of the reactants in a reaction is less than the total mass of the product(s).

D. The total mass of the reactants in a reaction is greater than the total mass of the product(s).

Answers

Answer:

A. The total mass of the reactants in a reaction equals the total mass of the product(s).

Explanation:

The law of conversation of matter tells us that in a chemical reaction, matter is never created or destroyed, it's simply converted from one form to another. So the mass of reactants should always equal the mass of the products in a chemical reaction.

Other Questions
Type the plural form of the following medical term.ampulla i need help pleaseeee y = 12x 6 yintercept = Coca-Cola Benefits from IoTAACSB Standards: GlobalThe Coca-Cola Company leads a worldwide franchise system built on the foundation of local bottlers. Its many flavors of Cokeplus Fanta, Powerade, Dr. Pepper, and Spriteare worldwide favorites. Collectively, Coca-Cola has more than 100,000 employees in the United States, nearly 70 independent Coca-Cola bottlers across the United States, and another 225 bottling partners worldwide. Coca-Cola manufactures and sells concentrates, beverage bases, and syrups to the bottlers. It also owns the brands and is responsible for consumer brand marketing initiatives.Coca-Cola bottling partners work closely with local businesses, including amusement parks, convenience stores, grocery stores, movies, restaurants, and street vendors, to 12410_ch08_hr_290-310.indd 307 6/10/20 7:14 AM execute localized strategies developed in partnership with Coca-Cola. These outlets sell Coca-Cola brand soft drinks to consumers at a rate of more than 1.9 billion servings a day. This approach has enabled Coca-Cola to create a global reach with a local focus.In recent years, Coca-Cola has been developing intelligent IoT-connected coolers that provide data that the company hopes will improve productivity and boost sales at local outlets. These refrigerator units, which vend and dispense Coca-Cola products, establish secure network connections to a cloud-based IoT platform over which the data can be processed and analyzed. The coolers, which Coca-Cola first tested in Bulgaria in 2015, are currently being tested in smaller retail chains in Chicago and Dallas, and they are expected to provide the company, bottlers, and retailers several benefits.An IoT-connected cooler captures and reports data such as product temperature, compressor cycles, and power consumption that can be used to trigger preventative maintenance and avoid cooler outages. For example, retailers can identify a compressor that is running continuously and work to quickly resolve the issue. Data from the IoT-enabled coolers will also identify the busiest locations and most popular drinks, helping retailers to accurately set inventory levels and calculate machine profitability. Cameras and sensors can monitor cooler door openings and product movement to optimize sales. For example, retailers may discover that two large single-door coolers had less combined activity than one small single-door cooler. Connected coolers will also allow retailers to detect changes in shopper patterns that can be linked to daily sales figures, promotions, and changes in cooler location or temperature.The Coca-Cola Company has partnered with technology firms AirWatch, SAP, and Salesforce to pilot the use of these coolers in select markets. Coca-Cola is purposefully starting slowly, rolling out parts of the program, including training sales teams, to ensure it gets the right data flowing before expanding more broadly. Pilot success will be determined by the ability of the connected coolers to help with preemptive equipment maintenance, stock optimization, and personalized customer communication.Coca-Cola Hellenic Bottling Company (Coca-Cola HBC) is one of the worlds largest bottlers for The Coca-Cola Company. It has operations in Russia, Nigeria, and 26 countries in Europe, serving roughly 595 million consumers. Coca- Cola HBC is taking a much more aggressive approach to rolling out connected coolers by partnering with Atos Codex (a European IT services company), eBest IoT, and Microsoft. By the end of 2018, Coca-Cola HBC had deployed more than 300,000 refrigeration units. By adding IoT sensors and cameras to coolers, artificial intelligence software can process the data received from the sensors and cameras in real time and then recommend processes to streamline stocking, identify failing coolers, improve asset optimization, and predict inventory levels. Coca-Cola HBCs sales increased by 10 percent as a result of the pilot project.Smart coolers also enable proximity interaction with the use of mobile apps, enabling Coca-Cola HBC to engage with customers in real time, such as offering customized offers and near-me promotions. In the long term, Atos predicts, the technology will connect Coca-Cola HBCs entire fleet of 1.6 million coolers.Critical Thinking QuestionsHow might The Coca-Cola Company and/or its bottlers use connected coolers to engage with customers in real time? What advantages might this capability provide?The many Coca-Cola bottlers worldwide may employ different technology partners and different technology solutions to implement the connected coolers. They are likely to rollout the technology over different timeframes. Will this lack of standardization hinder the success of this initiative?Is there a need to share the data collected from the various bottlers? What issues might arise in attempting to share this data? the sperm of deer have 34 chromosomes. how many total chromosomes will a fertilized egg of the deer have? true or false the humanistic psychologist carl rogers focused on the self-concept and self-esteem, or self-regard. a client is diagnosed with increased sleep deficiency. which action will the nurse take first to address this clients needs? A line includes the points (3, 7) and (14, 18). What is its equation in slope-intercept form? 3. Find the area under the curve y = x from x = 1 to x = 3. 4. Find the area bounded by the curve y = 4 x and the x-axis. 5. Find the area bounded by y = 3x and y = x 6. A pyramid 3 m high has congruent triangular sides and a square base that is 3 m on each side. Each cross section of the pyramid parallel to the base is a square. Find the volume of the pyramid. Rewrite the following sentences in passive voice1: I'm buying lottery tickets at the shopkeeper Why did Alaska have to wait thirteen years to become a state after its request? Current studies on frogs and wildlife indicate that hormonally active agents (HAAs) are __________.a.found in insecticides and should be removedb.found in radionuclides in parent rock materialsc.abnormalities associated with developmental and reproductive systemsd.causing lung cancere.creating new forms of lizards HELPPP I NEED HELP 1) Identify and explain ways families can have a positive influence on teen's decisions about alcohol use. 2) What are 2 effective refusal strategies for avoiding the use of alcohol. 3) What are the depressant effect of alcohol? How might alcohol affect your ability to make healthful decisions? 4) Why would refusing alcohol help you avoid unsafe situations such as sexual assault and violence? In what ways will you also be avoiding the risk of exposure to STDs? Rihanna can go from 0-60 miles per hour in 3.5 seconds. Calculate the acceleration.Please show ALL work and CIRCLE your answer. In the accompanying diagram of right triangle ACB, altitude CD is drawn to hypotenuse AB. If AB = 25 and CB = 10, what is the length of DB? (if you dont know dont answer) Sketch the curve f(x, y) = c together with Vf and the tangent line at the given point. Then write an equation for the tangent line. 8x - 3y = 43, (5, 1) Tangent line is 9xy = -45, If you travel 4 km south, 2 km north, 5 km south, and 5 km north, what is your displacement?. 9When comparing prokaryotes to eukaryotes, bacteria contain all of the following except --A+BCDRibosomesPlasma membraneChromosomesMitochondria if the price level in the united states is 110, the price level is 120 in mexico, and the nominal exchange rate is 140 pesos per dollar, what is the real exchange rate from the u.s. perspective? Caroline works 18 hours a week at a restaurant and earns $8.25 per hour. She also earns tips, which are 15% of her food sales. In one week, she earned $263.25. Write an equation to find x, her total food sales for that week.8.25 (FILL IN THE ANSWER) + (FILL IN THE ANSWER)x = 263.25A. 0.15B. 0.18C. 8.25D. 15E. 18