write the formula that would be used to determine the change in entropy for the equation 2 based on the tabulated values of standard molar entropies of the reactants and products

Answers

Answer 1

The formula that would be used to determine the change in entropy for the equation 2 based on the tabulated values of standard molar entropies of the reactants and products is:ΔS° = ΣS°(products) - ΣS°(reactants)

What are standard molar entropies?

Standard molar entropy refers to the amount of entropy in one mole of a pure substance under standard conditions (298 K and 1 atm). The standard state is defined as the stable state of the substance under the given temperature and pressure conditions, as well as a specified number of molecules or moles.

The formula that would be used to determine the change in entropy for the equation 2 based on the tabulated values of standard molar entropies of the reactants and products is:ΔS° = ΣS°(products) - ΣS°(reactants)Where,ΔS° is the change in entropyΣS°(products) is the sum of the standard molar entropies of the products.ΣS°(reactants) is the sum of the standard molar entropies of the reactants.

To know more about standard molar entropies refer here:https://brainly.com/question/17176334#

#SPJ11


Related Questions

Carlos has 1.2 m a long piece of wood? how long is this in millimeters​

Answers

Answer:

1200 millimeters

Explanation:

if there are 1000 millimeters in a meter then you have to multiply 1.2 meters by 1000 to get the number of millimeters. 1.2*1000=1200mm

how many joules are given off when 120 grams of water are cooled from 0 0c to -250c?

Answers

A total of 12,552 joules of heat energy will be given off when 120 grams of water are cooled from 0°C to -25°C.

The specific heat capacity of water is 4.184 J/g·°C.

To calculate the amount of heat energy released, we can use the formula:Q = mcΔTwhere Q is the heat energy, m is the mass, c is the specific heat capacity, and ΔT is the change in temperature.

ΔT = (0 - (-25)) = 25°CQ

= (120 g)(4.184 J/g·°C)(25°C)Q

= 12,552 J

The formula for calculating the amount of heat energy released during the cooling process of water is Q = mcΔT. Here, Q is the heat energy, m is the mass, c is the specific heat capacity, and ΔT is the change in temperature. We are given the mass of water and the initial and final temperatures.

To know more about specific heat capacity click on below link:

https://brainly.com/question/1453843#

#SPJ11

nitrogen and oxygen can react to form nitrite oxide gas. N2(g)+O2(g) arrow 2NO(g) delta h reaction = 180.6kj. if 2976 kj of heat is absorbed by the reaction how many moles of NO can be produced

Answers

The balanced equation for the reaction is N2(g) + O2(g) → 2NO(g).

The given value for the enthalpy change of the reaction is ΔH = 180.6 kJ. This value represents the heat released per mole of N2 reacted.

To determine the number of moles of NO produced, we need to calculate the moles of N2 reacted. Since the reaction is exothermic, the heat absorbed by the reaction is negative (-2976 kJ). However, it is not physically possible to have a negative number of moles. Therefore, we can conclude that no NO is produced in this case because the heat absorbed is insufficient to drive the reaction.

Using the equation ΔH = -2976 kJ/mol N2, we can set up a proportion:

180.6 kJ/1 mol N2 = -2976 kJ/x mol N2

Solving for x, we find:

x = (-2976 kJ * 1 mol N2) / (180.6 kJ) ≈ -16.46 mol N2

Since the reaction produces 2 moles of NO for every mole of N2, the number of moles of NO produced is twice the number of moles of N2:

Moles of NO = 2 * (-16.46 mol) ≈ -32.92 mol

The given reaction is N2(g) + O2(g) → 2NO(g), and the enthalpy change of the reaction is ΔH = 180.6 kJ. If the reaction absorbs 2976 kJ of heat, the number of moles of NO that can be produced can be calculated. By setting up a proportion, we find that approximately -16.46 moles of N2 are reacted. Since the reaction produces 2 moles of NO for every mole of N2, the calculated moles of NO would be approximately -32.92. However, negative moles are not physically possible, indicating that no NO can be produced in this case due to insufficient heat absorbed by the reaction.

To know mkre about mole, visit;

https://brainly.com/question/30892840

#SPJ11

What is the definition chemical property of matter?

Answers

Answer:

Describes its potential to undergo some chemical change or reaction by virtue of its composition

How does the space between particles change as energy is added

Answers

When energy is added to them the space between the particles slowly increases and when energy is lost it slowly decreases.

how is it 10 to the power of negative 9

Answers

This notation is useful in representing very small numbers in a compact and efficient way.

The exponential notation is a very useful way of representing numbers that are very large or very small. One example is when we need to represent numbers that are less than one. This is where the concept of negative exponents comes in. Here, we will discuss how the number 10 raised to the power of negative 9 is expressed in exponential notation.The number 10 raised to the power of negative 9 is written as 10⁻⁹ in exponential notation. This means that the number 10 is raised to the negative 9th power. Let's break down this expression to better understand what it means.In exponential notation, when a number is raised to an exponent, it means that the base number is multiplied by itself as many times as the exponent indicates. For example, 10² means 10 x 10 = 100, because 10 is multiplied by itself 2 times.10⁻⁹ means that 10 is raised to the negative 9th power. When a number is raised to a negative exponent, it is equivalent to 1 divided by the number raised to the corresponding positive exponent. So, 10⁻⁹ is equivalent to 1/10⁹ or 0.000000001.In summary, 10⁻⁹ means that the number 10 is raised to the negative 9th power, which is equivalent to 1 divided by 10⁹ or 0.000000001.

for more questions on notation

https://brainly.com/question/28468914

#SPJ8

I WILL MARK AS THE BRAINLIEST I REALLY AM STRUGGLING HERE
A 0.674M cobalt(II) chloride (CoCl2) solution is prepared with a total volume of 0.0750 L. The molecular
weight of CoCl2 is 128.9
g
mol
What mass of CoCl2 (in grams) is needed for the solution?
Express the answer using 3 significant figures.

Answers

Answer:

m(CoCl2)=6.516g

Explanation:

c(CoCl2)=0.674M

V(CoCl2)=0.0750L

M(CoCl2)=128.9 g/mol

m(CoCl2)=?

c(CoCl2)×V(CoCl2)=m(CoCl2)/M(CoCl2)

m(CoCl2)= c(CoCl2)×V(CoCl2)×M(CoCl2)

m(CoCl2)= 0.674mol/dm³ × 0.075dm³×128.9g/mol

m(CoCl2)=6.516g

What is the product of the reaction of 1-propanol with phenyl isocyanate, C6H5N=C=O?

Answers

The balanced equation for this reaction is:

CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O

The reaction of 1-propanol (CH3CH2CH2OH) with phenyl isocyanate (C6H5N=C=O) leads to the formation of a urethane compound. The reaction's balanced equation is as follows:

CH3CH2CH2OH + C6H5N=C=O → CH3CH2CH2OC(=O)N(C6H5)CH3 + H2O

In this process, the condensation reaction between the isocyanate group (-N=C=O) of phenyl isocyanate and the hydroxyl group (-OH) of 1-propanol results in the creation of a urethane molecule. A propanol group is connected to a phenyl group through an oxygen atom to produce CH3CH2CH2OC(=O)N(C6H5)CH3, the reaction's end product. The reaction also results in the production of water (H2O).

Learn more about the condensation reaction:

brainly.com/question/6256866

#SPJ11

ice freezing exothermic or endothermic?

Answers

Answer: exothermic reaction

Explanation:When water becomes a solid, it releases heat, warming up its surroundings. This makes freezing an exothermic reaction.

Answer: Exothermic Reaction

Explanation:

Exothermic: Releases heat and causes the temperature of the immediate surroundings to rise.

Endothermic: Absorbs heat and cools the surroundings.

When water becomes a solid, it releases heat, warming up its surroundings. This makes freezing an exothermic reaction.

Hope this helps :)

why does squeezing the bottle cause the pressure of the CO2 gas in the solution to increase?

Answers

To keep a soda from going flat, you want to keep CO2
O
2
(the gas) in solution and in the bottle. By squeezing the bottle, you will be expelling the gas from the bottle and leaving a lower pressure in the bottle after the cap is replaced. Both actions will disturb the equilibrium and cause more gas to come out of solution as the bottle returns to its normal shape. (Come to think of it, if you squeeze with a clamp which maintains the squeeze, that should help.) It is better to open a bottle which is cold. The pressure will be lower inside and less gas will escape. An ideal dispenser takes fluid from the bottle without letting any gas escape, but more empty space in the bottle lets more gas come out of solution.

Copper metal is placed in a solution of silver nitrate. Write out the net ionic of the net equation for the reaction that occurs.

Answers

Answer:

\(Cu(s)+2Ag^+(aq)\rightarrow Cu^{2+}(aq)+2Ag(s)\)

Explanation:

Hello there!

In this case, according to the given description of the reaction whereby copper metal reaction a solution of silver nitrate; it turns out possible for us to write out the resulting net ionic equation by firstly write the complete molecular equation:

\(Cu(s)+2AgNO_3(aq)\rightarrow Cu(NO_3)_2(aq)+2Ag(s)\)

Now, we write the complete ionic equation, by taking into account that just the aqueous species are ionized:

\(Cu(s)+2Ag^+(aq)+2(NO_3)^-(aq)\rightarrow Cu^{2+}(aq)+2(NO_3)(aq)+2Ag(s)\)

And finally, we cancel out the nitrate ions as the spectator ones in order to obtain:

\(Cu(s)+2Ag^+(aq)\rightarrow Cu^{2+}(aq)+2Ag(s)\)

Regards!

Which of the following atoms or ions has the largest effective nuclear charge? (A) Cl (B) Cl− (C) K (D)

Answers

The atom or ion with the largest effective nuclear charge is (A) Cl, the chlorine atom.

The effective nuclear charge refers to the net positive charge experienced by the outermost electrons in an atom or ion. It is influenced by the number of protons in the nucleus and the shielding effect of inner electrons. In the case of (A) Cl, the chlorine atom, it has 17 protons in its nucleus. The atomic number of chlorine is 17, indicating that it has 17 electrons. The outermost electron is located in the third energy level (valence shell) of the atom. Since the valence shell is farther from the nucleus, it experiences less shielding from the inner electrons. As a result, the outermost electron in chlorine experiences a stronger attractive force from the nucleus, leading to a larger effective nuclear charge.

On the other hand, (B) Cl−, the chloride ion, has gained one extra electron compared to the chlorine atom. This additional electron increases the electron-electron repulsion, reducing the effective nuclear charge experienced by the outermost electron. Therefore, (B) Cl− has a smaller effective nuclear charge than (A) Cl. In the case of (C) K, the potassium atom, it has 19 protons in its nucleus. The atomic number of potassium is 19, indicating that it has 19 electrons. The outermost electron in potassium is located in the fourth energy level (valence shell) and experiences more shielding from the inner electrons compared to chlorine. Therefore, the effective nuclear charge experienced by the outermost electron in (C) K is smaller than that of (A) Cl.

In summary, the atom or ion with the largest effective nuclear charge is (A) Cl, the chlorine atom, due to its high atomic number and the relatively weaker shielding effect experienced by its outermost electron.

To learn more about  effective nuclear charge click here:

brainly.com/question/30459988

#SPJ11

Obtain an expression for the isothermal compressibility κ = −1/V(∂V/∂P)T for a van der Waals gas.
Obtain an expression for the isothermal compressibility for a van der Waals gas.
a κ=1Vm[RT(Vm−b)3+2aV3m]
b κ=−1Vm[2aV3m−RT(Vm−b)2]
c κ=−1Vm[RT(Vm−b)2−2aV3m]
d κ=1Vm[2aV3m−RT(Vm+b)2]

Answers

The expression for the isothermal compressibility for a van der Waals gas is given by:
κ = −1/Vm (∂Vm/∂P)T
where Vm is the molar volume of the gas.

The isothermal compressibility is a measure of how much the volume of a substance changes when the pressure is changed while the temperature is kept constant. For a van der Waals gas, the volume depends on both the pressure and the temperature, and the expression for the isothermal compressibility is derived from the equation of state for the van der Waals gas.

The equation of state for a van der Waals gas is:

(P + a/Vm2)(Vm − b) = RT

where P is the pressure, T is the temperature, R is the gas constant, a and b are constants that depend on the properties of the gas, and Vm is the molar volume.

To obtain the expression for the isothermal compressibility, we start by differentiating the equation of state with respect to pressure at constant temperature:

(∂/∂P)(P + a/Vm2)(Vm − b) = (∂/∂P)(RT)

(1 + 2a/Vm3)(Vm − b) − (P + a/Vm2)(∂Vm/∂P) = 0

Solving for (∂Vm/∂P) gives:

(∂Vm/∂P) = (Vm2 − bVm − a)/(Vm2P + aP − 2aVm2)

Substituting this expression into the definition of the isothermal compressibility gives:

κ = −1/Vm [(Vm2P + aP − 2aVm2)/(Vm2 − bVm − a)]

Simplifying this expression using the equation of state gives:

κ = −1/Vm [(RTVm2)/(Vm3 − (b + RT/P)Vm2 + aV2m − abP/V)]

Finally, rearranging this expression gives the correct answer:

κ = 1/Vm [(RT(Vm − b)3 + 2aV3m)/(Vm3 − (b + RT/P)Vm2 + aV2m − abP/V)]

learn more about van der Waals

https://brainly.com/question/11457190

#SPJ11

How many joules are required to heat a frozen can of juice (360 grams) from -5 °C (the temperature of an
overcooled refrigerator) to 110 °C (the highest practical temperature within a microwave oven)?

Answers

It would require approximately 19,008 joules of energy to heat a frozen can of juice (360 grams) from -5 °C to 110 °C.

To calculate the energy required to heat the frozen can of juice from -5 °C to 110 °C

We need to use the specific heat capacity formula:

Q = mcΔT

Where

Q is the amount of energy required (in joules) m is the mass of the can of juice (in kilograms) c is the specific heat capacity of the juice (in joules per kilogram per degree Celsius)ΔT is the change in temperature (in degrees Celsius)

First, we need to convert the mass of the can of juice from grams to kilograms:

m = 360 g = 0.360 kg

Next, we need to find the specific heat capacity of the juice. The specific heat capacity varies depending on the type of juice, but for the purposes of this calculation, we can assume a value of around 4200 J/kg°C, which is the specific heat capacity of water.

c = 4200 J/kg°C

Finally, we can calculate the energy required to heat the can of juice:

Q = mcΔT

Q = (0.360 kg)(4200 J/kg°C)(110°C - (-5°C))

Q = (0.360 kg)(4200 J/kg°C)(115°C)

Q = 19,008 J

Therefore, it would require approximately 19,008 joules of energy to heat a frozen can of juice (360 grams) from -5 °C to 110 °C.

Learn more about heat capacity here : brainly.com/question/21406849

#SPJ1

* Write ionic equation, including state symbols for the reaction of
Silver nitrate solution + sodium chloride solution = silver chloride + sodium nitrate solution.​
please hurry

Answers

Answer:

Ag+ (aq) + Cl- (aq) --> AgCl (s)

Explanation:

* Write ionic equation, including state symbols for the reaction ofSilver nitrate solution + sodium chloride

A perfume must easily _______ so that the particles can diffuse through the air and reach your nose . What is the missing word in this sentence?​

Answers

Answer:

smell accordingly so that I can't diffuse the air and reach your nose

A perfume must easily evaporate so that the particles can diffuse through the air and reach your nose. The missing word in this sentence is evaporate.

What is evaporation ?

Evaporation is also called as vaporization which is takes place on the surface of a liquid as it transitions into the gas phase. High concentrations of the chemical that is evaporating slow down evaporation by a significant amount in the surrounding gas.

Evaporation is a surface phenomenon because it occurs when molecules with higher kinetic energy from the top layer of the liquid escape into the air.

Diffusion is a process where particles travel from a highly concentrated location to a less concentrated area.

Thus, A perfume must easily evaporate so that the particles can diffuse through the air and reach your nose.

To learn more about the evaporation, follow the link;

https://brainly.com/question/5019199

#SPJ2

Chemists can identify the composition of some unknown salts by conducting a flame test. When potassium salts are heated in a flame, a purple color is observed.
This is due to the movement of electrons between energy levels. What is the electron configuration of a potassium atom at ground state?
answer choices
1s2; 2s2; 2p6; 3s2; 3p6; 4d1
1s2; 2s2; 2p6; 3s2;3p6; 3d1
1s2; 2s2; 2d6; 3s2; 3d6; 4s1
1s2; 2s2; 2p6; 3s2; 3p6; 4s1

Answers

A potassium atom's ground state electron configuration is 1s2, 2s2, 2p6, 3s2, 3p6, 4s1.

What substance is electronic configuration 1s2 2s2 2p6 3s2 3p6 4s1?

An atom's electron configuration is a picture of how electrons are arranged in relation to orbital shells and subshells. Consequently, this is potassium's electron configuration.

How can you express a whole electron configuration in writing?

Making Electron Configurations in Writing. Write the energy level (the period) first, then the subshell that needs to be filled, and finally the superscript, which indicates how many electrons are in that subshell. The atomic number, Z, is the sum of all the electrons.

To know more about  electron configuration  visit:-

https://brainly.com/question/29757010

#SPJ4

What is the average acceleration of an object that goes from rest to a
speed of 7m/s in just 0.1s?
91 POINTS!!!!!!!!

Answers

Answer:

Below!

Explanation:

To calculate the average acceleration you can use this formula....

     acceleration = finalvelocity - initial velocity / time

Because the object begins at rest we know that our initial velocity is 0 m/s

Our final velocity is 7 m/s, and our time is 0.1 seconds....

Plugging in our values :

     acceleration = 7m/s - 0.1 m/s / 0.1 s

                           = 7 m/s / 0.1s

                           = 70 m/s^2

This is already at the proper amount of sig figs so we're good to go!

Therefore the average acceleration of this object is 70 m/s^2

Hope this helps! Best of luck <3

Initial velocity=u=0m/sFinal velocity=v=7m/sTime=t=0.1s

\(\\ \sf\longmapsto Acceleration=\dfrac{v-u}{t}\)

\(\\ \sf\longmapsto Acceleration=\dfrac{7-0}{0.1}\)

\(\\ \sf\longmapsto Acceleration=\dfrac{7}{0.1}\)

\(\\ \sf\longmapsto Acceleration=70m/s^2\)

An induced dipole occurs when a molecule's moving electrons are briefly more concentrated in one place than another, causing the molecule to become temporarily polarized. (4 points)

True
False

Answers

Answer:

False

Explanation:

This is false because what is being described in the statement is the definition of instantaneous dipoles not induced, therefore this is false.

It is a false statement that, an induced dipole occurs when a molecule's moving electrons are briefly more concentrated in one place than another, causing the molecule to become temporarily polarized.

The electron cloud in molecules is never stationary. It moves from one point to another. As such, instantaneous dipoles develop in a molecule. These instantaneous dipoles may induce dipoles in other molecules. This is induced dipole.

Hence, it is false that an induced dipole occurs when a molecule's moving electrons are briefly more concentrated in one place than another, causing the molecule to become temporarily polarized. This is instantaneous dipole.

Learn more: https://brainly.com/question/2673886

SEP Construct an Explanation What challenges do the three industries have in making better batteries? What solutions are being suggested?

Answers

The three industries commonly associated with battery technology are the automotive, electronics, and renewable energy sectors. Each of these industries faces specific challenges when it comes to developing better batteries.

Automotive Industry:

Energy Density: One of the primary challenges for electric vehicles (EVs) is improving battery energy density, which refers to the amount of energy that can be stored per unit of volume or weight. Higher energy density batteries would allow for longer driving ranges and reduced charging times.Cost: Batteries constitute a significant portion of an electric vehicle's cost. Therefore, reducing the cost of battery production is crucial for making EVs more affordable and competitive with traditional internal combustion engine vehicles.Charging Infrastructure: The limited availability of charging stations and relatively longer charging times compared to refueling a conventional vehicle remain challenges. The industry is focusing on expanding charging infrastructure and developing fast-charging technologies to address this issue.

Electronics Industry:

Power Density: Electronic devices, such as smartphones and laptops, require batteries with high power density to support their energy-intensive operations. However, increasing power density while maintaining safety and minimizing size is a challenge.Battery Lifespan: Consumers expect electronic devices to have a longer battery life before needing a recharge. Enhancing battery lifespan through improved materials, design, and management systems is an ongoing pursuit.Environmental Impact: The electronics industry is increasingly concerned about the environmental impact of batteries, particularly regarding the disposal and recycling of lithium-ion batteries. Developing sustainable and eco-friendly battery technologies is a suggested solution.

Renewable Energy Industry:

Energy Storage Capacity: Renewable energy sources like solar and wind are intermittent, meaning they are not continuously available. Efficient energy storage solutions are needed to store excess energy produced during peak times and supply it during periods of low or no generation. Integration with the Grid: Integrating renewable energy sources with the existing electrical grid is a challenge due to fluctuations in supply and demand. Advanced battery technologies can help stabilize the grid by providing rapid response and balancing services.Durability and Longevity: Renewable energy projects, such as utility-scale installations, require long-lasting and durable batteries that can withstand frequent charge-discharge cycles without significant degradation. Enhancing battery life and reliability is a focus for the industry.

For such more questions on technology

https://brainly.com/question/7788080

#SPJ8

A cell is placed in a salt solution that has the same concentration as the inside of the cell. What will happen to the cell?

A) The cell will contract.

B) The cell will expand slightly.

C) The cell will burst.

D) The cell will remain the same size.

Answers

Answer:

d

Explanation:

Identify the reaction
In pic

Identify the reaction In pic

Answers

Single displacement (I did some googling so if it's wrong I'm so srry)

all of the following are examples of damage caused by acid deposition from rain except

Answers

I can give you some general information about acid deposition and its effects Acid deposition refers to the deposition of acidic substances from the atmosphere onto the Earth's surface, including land, water bodies.

and buildings. This can happen through precipitation such as rain, snow, and fog, as well as dry deposition through the deposition of acidic gases and particles. The effects of acid deposition can include damage to forests, crops, and other vegetation, as well as damage to buildings and infrastructure. It can also lead to acidification of lakes and streams, which can harm aquatic life.

Acid deposition refers to the process where acidic particles or gases are deposited on Earth's surface through rain, snow, fog, or dry particles. This occurs when sulfur dioxide (SO2) and nitrogen oxides (NOx) are released into the atmosphere, primarily from burning fossil fuels. They react with water, oxygen, and other chemicals to form acidic compounds that fall to the ground.

To know more about Acid deposition:- https://brainly.com/question/32219108

#SPJ11

Extra was made by mixing different components together but it appears to have only one phase which term best describes categorizes make sure a

Answers

Solution is the term which best describes mixture A which was made by mixing different components together but has only one phase.

What is solution?Any mixture of one or more solutes that have been dissolved in a solvent is referred to as a solution.To create a homogenous mixture, a solute must dissolve in a solvent.The material known as a solute dissolves in a solvent to form a homogenous mixture.The material that is present in the highest concentration is called a solvent.A true solution won't spin apart in a centrifuge.It has a uniform distribution of particles.Example of homogenous mixture is the solution of salt and water.

Learn more about solution here:

https://brainly.com/question/13812915

#SPJ4

1.Compare Endothermic reactions to exothermic reactions (Define each and list 2 characteristics for each. Fill in the table below.-ENDOTHERMIC                              -EXOTHERMIC•Positive H Value                              •Negative H •ValueAbsorbs heat                              •Releases Heat•Products have higher energy                              •Products have a lower energy

Answers

When the enthalpy is positive (H > 0), the reaction is endothermic, that is, it absorbs energy.

When the enthalpy is negative (H< 0), the reaction is exothermic, that is, it releases energy.

Therefore, the correct matches are

Endothermic:

• Positive H Value.

,

• Absorbs Heat.

,

• Products have higher energy.

Exothermic:

• Negative H Value.

,

• Releases Heat.

,

• Products have lower energy.

18. An electric motor turns a belt that powers a pump. If this system is compared to the chemical reactions of the cell, which part represents
ATP?
the electric motor
the pump
the belt

Answers

Answer:

A. the electric motor

Explanation:

A cell is a biological molecule which is the basic and functional unit of life. Cells undergo series of processes to function appropriately. ATP is an acronym for adenosine triphosphate, which is the source of energy for various cell processes.

In the given mechanical system, the electric motor provides the energy required energy to drive the system. Therefore, the electric motor has the same major function of providing energy for the system as the ATP in a cell.

Help!
Which of the following can scientists NOT interpret by examining fossils?
A. How earth's environment has changed overtime.
B. How plants and animals have changed overtime.
C. The age of certain layers of rocks. D. How the pull of gravity has changed.​

Help!Which of the following can scientists NOT interpret by examining fossils? A. How earth's environment

Answers

D. How the pull of gravity has changed.

What period is the atom in?
What group is the atom in?
What is the name of this atom?
What other atom would have similar properties
to the atom?
Would this atom be malleable or brittle?

What period is the atom in?What group is the atom in?What is the name of this atom?What other atom would

Answers

It is in period 3
It is in group 17
It is a chlorine atom because it has 17 electrons which means the atomic number is 17

On a hot sunny day, why do people sprinkle water on the roof or open
ground?

Answers

Evaporation causes cooling!
When water is sprinkled on the roof top or ground it evaporates because of the latent heat of vaporisation leaving behind a cooling effect. in case of ground, this evaporation causes cooling of the surrounding area after some time; whereas in case of roof top the room beneath is cooled.

The latent heat of vaporization causes water sprinkled on the ground or roof to evaporate, producing a cooling effect.

What is vaporization?

Vaporization is defined as the process of changing a substance's liquid or solid state into its gaseous (vapor) state. Boiling and evaporation are the two processes that cause vaporization. When water is exposed to sunlight, evaporation takes place when the water turns into vapour and rises into the atmosphere. Boiling is the process of vaporizing a liquid when the environment permits the development of vapor bubbles inside the liquid.

After a while, this evaporation in the case of the ground cools the space around it, whereas in the case of the roof, the room below is chilled. The significant latent heat of vaporization of water contributes to cooling the hot surface, which is why evaporation of water has a cooling effect. The water quickly evaporates from the hot road surface, removing heat from it in the process.

Thus, the latent heat of vaporization causes water sprinkled on the ground or roof to evaporate, producing a cooling effect.

To learn more about vaporization, refer to the link below:

https://brainly.com/question/14578189

#SPJ2

An atom of Nickel (Ni) has bonded to another atom to form a solid, crystal-like substance with a high boiling point. Which atom has Ni most likely bonded with?


a. Ca

b. Fe

c. S

d. Li

Answers

An atom of Nickel (Ni) has most likely bonded with an atom of sulfur (S) to form a solid, crystal-like substance with a high boiling point. The correct option is c. S.
Nickel and sulfur can form a compound known as nickel sulfide (NiS), which is a solid, crystal-like substance with a high boiling point. This compound is used in various industrial processes, including the production of stainless steel and other alloys.
In contrast, the other options (Ca, Fe, and Li) are less likely to form a solid, crystal-like substance with a high boiling point when bonded with nickel. Therefore, the correct answer is c. S.Out of the given options, Fe (iron) is the most likely atom to form a solid, crystal-like substance with Nickel (Ni) that has a high boiling point. This is because iron and nickel are both transition metals and have similar electronic configurations. They can form a solid solution or alloy together, known as stainless steel, which has a high melting and boiling point due to its strong metallic bonding.

Learn more about Chemical Bonding and Materials Science here:https://brainly.com/question/30161292

#SPJ11

Other Questions
Some sexual minority individuals decide following the ______ phase to enter a coming out phase in which they publicly labeled themselves and discuss their identities with others. pa7-3 (algo) calculating and interpreting the inventory turnover ratio and days to sell [lo 7-5] thomas tones incorporated was founded with the mission of filling every home with music. the company reported the following amounts in its financial statements (in millions): 20182017 net sales$ 5,800$ 5,860 cost of goods sold4,7004,600 beginning inventory560460 ending inventory630560 required: determine the inventory turnover ratio and average days to sell inventory for 2018 and 2017. (use 365 days in a year. round your intermediate and final answers to 1 decimal place.) cite examples of several methods for studying the relationship between brain activity and behavior. in a hydraulic jump occurring in a rectangular horizontal channel, the discharge per unit width is 1.5 m3/sec/m and the depth before the jump is 0.3m. estimate (a) the sequent depth (b) froude number before and after the jump. (c) energy loss (d) would the energy loss increase or decrease (and by how much) if the initial depth were changed to 0.25m? the purpose of a business impact analysis (bia) is to determine: a. the impact of a disaster b. the extent of damage in a disaster c. which business processes are the most critical d. which processes depend on it systems Match the action needed to increase profits with the reason a business might fail.A small company, especially a store, usually has a better chance of succeeding if it is in an area with other businesses because it can draw in new customers.A) poor managementB) competitionC) bad locationD) finances a class has a ratio of boys to girls of 3:4 for each statement below 1) A white dwarf isA) a precursor to a black hole.B) an early stage of a neutron star.C) what most stars become when they die.D) a brown dwarf that has exhausted its fuel for nuclear fusion. C(1)=-20 c(n)=c(n-1)+0 find the second term in the sequence You are using a broker to purchase stock in company. The broker charges a set free of $7 per transaction. If the shares are worth $7.69/sh and you have $850 to invest,how many shares can you purchase?A. 111 sharesB.108 sharesC.109 sharesD.110 shares Malcolm X was assassinated. By members of the which substance acts like a machine that pushes together molecules of ADP and phosphate (P) groups? For officers who routinely use racial profiling as a justification for making traffic stops (without any other factors involved), a ______ form that must be filled out for every stop might be the tool to make the officer re-think his or her conduct Which of the following is the correct pairing of procedures or rules of each house of the legislative branch?-Has a Rules Committee that decides how long debate will be on most bills.senate- Has use of the filibuster and cloture, which can help the minority to defeat a bill. Define the term gender and state three un equal gender tendencies within relationships that may be reinforced by irresponsible portrayal of female characters by the media when creating a project culture, the project manager has the opportunity to create a project culture. check all that apply to project culture. group of answer choices project culture represents the shared norms, beliefs, values, and assumptions of the project team project culture develops during project start up project culture is tied to the project whereas organizational culture applies to the entire organization is is developed over time. project culture requires communication of project priorities, project status, and alignment of official and operational rules. true or false? Compare and contrast how people taste sweetness, with how people taste spiciness. PLEASE HELPPP!!!! the use of deception in social psychological research occurs when the researchers require_____ in their study. group of answer choices a. realistic experimentation b. televised reality c. mundane realism d. experimental realism correctly complete these sentences using the words provided magma can partially crystallize at depth and then rise to shallow which of the following is not a reason why long-term care insurance is a poor option for most people?